From 4ee7643f826f893251255ff951a972ef54ba8cba Mon Sep 17 00:00:00 2001 From: Tony Meyer Date: Sat, 29 Mar 2025 19:50:25 +1300 Subject: [PATCH 01/79] Initial implementation. --- .gitignore | 1 + ops/__init__.py | 4 + ops/_config.py | 284 +++++++++++++++++ ops/_private/harness.py | 26 +- ops/charm.py | 138 ++++++++- ops/model.py | 2 +- test/test_config.py | 414 +++++++++++++++++++++++++ test/test_main.py | 14 +- test/test_model.py | 6 +- test/test_testing.py | 2 +- testing/src/scenario/_ops_main_mock.py | 8 +- tox.ini | 1 + 12 files changed, 875 insertions(+), 25 deletions(-) create mode 100644 ops/_config.py create mode 100644 test/test_config.py diff --git a/.gitignore b/.gitignore index d3d5267b9..b5c2e46e3 100644 --- a/.gitignore +++ b/.gitignore @@ -11,6 +11,7 @@ coverage.xml .coverage.data /.tox .*.swp +/src # Tokens and settings for `act` to run GHA locally .env diff --git a/ops/__init__.py b/ops/__init__.py index 4cda2bca5..a4daec21b 100644 --- a/ops/__init__.py +++ b/ops/__init__.py @@ -180,6 +180,8 @@ 'Unit', 'UnknownStatus', 'WaitingStatus', + # From _config.py + 'ConfigBase', ] # The isort command wants to rearrange the nicely-formatted imports below; @@ -330,6 +332,8 @@ WaitingStatus, ) +from ._config import ConfigBase + # NOTE: don't import testing or Harness here, as that's a test-time concern # rather than a runtime concern. diff --git a/ops/_config.py b/ops/_config.py new file mode 100644 index 000000000..dee242871 --- /dev/null +++ b/ops/_config.py @@ -0,0 +1,284 @@ +# Copyright 2025 Canonical Ltd. +# +# Licensed under the Apache License, Version 2.0 (the "License"); +# you may not use this file except in compliance with the License. +# You may obtain a copy of the License at +# +# http://www.apache.org/licenses/LICENSE-2.0 +# +# Unless required by applicable law or agreed to in writing, software +# distributed under the License is distributed on an "AS IS" BASIS, +# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +# See the License for the specific language governing permissions and +# limitations under the License. + +"""Support for strongly typed charm config.""" + +from __future__ import annotations + +import ast +import importlib +import inspect +import logging +import pathlib +from typing import Any, ClassVar, cast + +from ._private import yaml +from .model import Secret + +logger = logging.getLogger(__name__) + + +# TODO: If we end up with this file, _action_params, and _relation_data, then we +# should factor out this class into a common helper module. +class _AttributeDocstringExtractor(ast.NodeVisitor): + def __init__(self): + self.attribute_docs: dict[str, str] = {} + self._last_attr = None + + def visit_ClassDef(self, node: ast.ClassDef): # noqa: N802 + # We iterate over the class definition, looking for attribute assignments. + # We also track any standalone strings, and when we find one we use it + # for the docstring of the most recent attribute assignments. + # This isn't perfect - but it should cover the majority of cases. + for child in node.body: + if isinstance(child, (ast.Assign, ast.AnnAssign)): + target = None # Make the type checker happy. + if isinstance(child, ast.Assign): + target = child.targets[0] + elif isinstance(child, ast.AnnAssign): + target = child.target + assert isinstance(target, ast.Name) + self._last_attr = target.id + elif ( + isinstance(child, ast.Expr) + and isinstance(child.value, ast.Constant) + and self._last_attr + ): + self.attribute_docs[self._last_attr] = child.value.value + self._last_attr = None + self.generic_visit(node) + + +class ConfigBase: + """Base class for strongly typed charm config. + + Use :class:`ConfigBase` as a base class for your config class, and define + the attributes as you would in ``charmcraft.yaml``. For example:: + + @dataclasses.dataclass(frozen=True) + class MyConfig(ops.ConfigBase): + my_bool: bool | None = None + '''A boolean value.''' + my_float: float = 3.14 + '''A floating point value.''' + my_int: int = 42 + '''An integer value.''' + my_str: str = "foo" + '''A string value.''' + my_secret: ops.Secret | None = None + '''A user secret.''' + + ```{note} + This is a dataclass, but can be any object that inherits from + ``ops.ConfigBase``, and can be initialised with the raw Juju config passed + as keyword arguments. Any errors should be indicated by raising + ``ValueError`` (or a ``ValueError`` subclass) in initialisation. + + Inheriting from ``ops.ConfigBase`` is not strictly necessary, but it + provides utility methods for translating the class to a YAML schema suitable + for use with Juju. + ``` + + Use this in your charm class like so:: + + class MyCharm(ops.CharmBase): + def __init__(self, framework): + super().__init__(framework) + self.typed_config = self.load_config(MyConfig) + + If the config provided by Juju is not valid, the charm will exit after + setting a blocked status with an error message based on the ``str()`` of the + exception raised. + """ + + JUJU_TYPES: ClassVar[dict[str, str]] = { + 'bool': 'boolean', + 'int': 'int', + 'float': 'float', + 'str': 'string', + 'ops.Secret': 'secret', + 'ops.model.Secret': 'secret', + } + + @classmethod + def _get_attr_docstrings(cls) -> dict[str, str]: + docs: dict[str, str] = {} + # pydantic stores descriptions in the field object. + if hasattr(cls, '__dataclass_fields__'): + fields = cast(dict[str, Any], cls.__dataclass_fields__) # type: ignore + for attr, field in fields.items(): + if ( + hasattr(field, 'default') + and hasattr(field.default, 'description') + and field.default.description + ): + docs[attr] = field.default.description + + try: + source_code = inspect.getsource(cls) + except OSError: + logger.debug('No source code found for %s', cls.__name__) + else: + try: + tree = ast.parse(source_code) + except (SyntaxError, IndentationError): + logger.debug('Failed to parse source code for %s', cls.__name__) + else: + extractor = _AttributeDocstringExtractor() + extractor.visit(tree) + docs.update(extractor.attribute_docs) + + return docs + + @staticmethod + def _extract_optional_type(attr: str, hint: str): + if 'Optional[' in hint: + hint = hint.split('[')[1].split(']')[0] + if '|' in hint: + parts = [p.strip() for p in hint.split('|')] + if 'None' in parts: + parts.remove('None') + if len(parts) != 1: + raise ValueError(f'{attr!r} has multiple types.') + hint = parts[0] + return hint + + @classmethod + def attr_to_yaml_type(cls, attr: str, default: Any = None) -> str: + """Provide the appropriate type for the config YAML for the given attribute. + + Raises: + ValueError: if an appropriate type cannot be found. + """ + types = cls.__annotations__ + try: + hint = cls._extract_optional_type(attr, str(types[attr])) + except (KeyError, ValueError): + # If there's a default value, use that object's type. + if default is not None and type(default).__name__ in cls.JUJU_TYPES: + return cls.JUJU_TYPES[type(default).__name__] + raise ValueError(f'{attr!r} type is unknown.') from None + if hint not in cls.JUJU_TYPES: + raise ValueError(f'{attr!r} type is unknown.') from None + return cls.JUJU_TYPES[hint] + + @staticmethod + def attr_name_to_yaml_name(name: str): + """Convert from the class attribute name to the name used in the schema. + + Python names are snake_case, but Juju config option names should be + kebab-case. Override if your config names do not match this pattern, for + backwards compatibility, for example. + """ + return name.replace('_', '-') + + @classmethod + def _yaml_schema_from_basemodel(cls) -> dict[str, Any]: + options = {} + for name, field in cls.model_fields.items(): # type: ignore + option = {} + if field.default is not None: # type: ignore + option['default'] = field.default # type: ignore + if field.annotation in (bool, int, float, str, Secret): # type: ignore + hint = field.annotation.__name__ # type: ignore + else: + hint = str(field.annotation) # type: ignore + hint = cls._extract_optional_type(name, hint) # type: ignore + option['type'] = cls.JUJU_TYPES[hint] + if field.description: # type: ignore + option['description'] = field.description # type: ignore + options[cls.attr_name_to_yaml_name(name)] = option # type: ignore + return {'options': options} + + @classmethod + def to_yaml_schema(cls) -> dict[str, Any]: + """Translate the class to YAML suitable for config.yaml. + + Using :attr:`MyConfig.to_yaml_schema` will generate a YAML schema + suitable for use in ``config.yaml``. For example, with the class from + the example above:: + + print(yaml.safe_dump(MyConfig.to_yaml_schema())) + + Will output:: + + options: + my-bool: + type: boolean + description: A boolean value. + my-float: + type: float + default: 3.14 + description: A floating point value. + my-int: + type: int + default: 42 + description: An integer value. + my-str: + type: string + default: foo + description: A string value. + my-secret: + type: secret + description: A user secret. + """ + # Special-case pydantic BaseModel. + if hasattr(cls, 'model_fields'): + return cls._yaml_schema_from_basemodel() + + # Dataclasses, regular classes, etc. + options: dict[str, dict[str, bool | int | float | str]] = {} + for attr in dir(cls): + if attr.startswith('_') or callable(getattr(cls, attr)): + continue + # Perhaps we should ignore anything that's typing.ClassVar? + if attr == 'JUJU_TYPES': + continue + option = {} + default = getattr(cls, attr, None) + if type(default).__name__ in cls.JUJU_TYPES: + option['default'] = default + option['type'] = cls.attr_to_yaml_type(attr, default) + doc = cls._get_attr_docstrings().get(attr) + if doc: + option['description'] = doc + options[cls.attr_name_to_yaml_name(attr)] = option + return {'options': options} + + @classmethod + def to_starlark_validator(cls) -> str: + """Validation code, as a Starlark script.""" + raise NotImplementedError('To be added at a later point.') + + +def generate_yaml_schema(): + """Look for all ConfigBase subclasses and generate their YAML schema. + + ```{caution} + This imports modules, so is not safe to run on untrusted code. + ``` + """ + config: dict[str, Any] = {} + for name in pathlib.Path('src').glob('*.py'): + module_name = name.stem + module = importlib.import_module(f'src.{module_name}') + for attr_name in dir(module): + obj = getattr(module, attr_name) + if hasattr(obj, 'to_yaml_schema'): + config.update(obj.to_yaml_schema()) + print(yaml.safe_dump(config)) + + +if __name__ == '__main__': + generate_yaml_schema() diff --git a/ops/_private/harness.py b/ops/_private/harness.py index bcf7a5fc9..7b413ef6f 100644 --- a/ops/_private/harness.py +++ b/ops/_private/harness.py @@ -296,7 +296,7 @@ def __init__( self._charm_cls = charm_cls self._charm: Optional[CharmType] = None self._charm_dir = 'no-disk-path' # this may be updated by _create_meta - self._meta = self._create_meta(meta, actions) + self._meta = self._create_meta(meta, actions, config) self._unit_name: str = f'{self._meta.name}/0' self._hooks_enabled: bool = True self._relation_id_counter: int = 0 @@ -558,13 +558,15 @@ def _create_meta( self, charm_metadata_yaml: Optional[YAMLStringOrFile], action_metadata_yaml: Optional[YAMLStringOrFile], + config_metadata_yaml: Optional[YAMLStringOrFile], ) -> CharmMeta: """Create a CharmMeta object. Handle the cases where a user doesn't supply explicit metadata snippets. This will try to load metadata from ``/charmcraft.yaml`` first, then ``/metadata.yaml`` if charmcraft.yaml does not include metadata, - and ``/actions.yaml`` if charmcraft.yaml does not include actions. + and ``/actions.yaml`` and ``/config.yaml`` if + charmcraft.yaml does not include actions or config. """ try: filename = inspect.getfile(self._charm_cls) @@ -624,7 +626,25 @@ def _create_meta( action_metadata = yaml.safe_load(actions_path.read_text()) self._charm_dir = charm_dir - return CharmMeta(charm_metadata, action_metadata) + config_metadata: Optional[Dict[str, Any]] = None + # Load config from parameters if provided + if config_metadata_yaml is not None: + if isinstance(config_metadata_yaml, str): + config_metadata_yaml = dedent(config_metadata_yaml) + config_metadata = yaml.safe_load(config_metadata_yaml) + else: + # Check charmcraft.yaml for config if no config is provided + if charmcraft_metadata is not None and 'config' in charmcraft_metadata: + config_metadata = charmcraft_metadata['config'] + + # Still no config, check config.yaml + if charm_dir and config_metadata is None: + config_path = charm_dir / 'config.yaml' + if config_path.is_file(): + config_metadata = yaml.safe_load(config_path.read_text()) + self._charm_dir = charm_dir + + return CharmMeta(charm_metadata, action_metadata, config_metadata) def _get_config(self, charm_config_yaml: Optional['YAMLStringOrFile']): """If the user passed a config to Harness, use it. diff --git a/ops/charm.py b/ops/charm.py index 8117d6201..303574124 100644 --- a/ops/charm.py +++ b/ops/charm.py @@ -22,6 +22,7 @@ from typing import ( TYPE_CHECKING, Any, + Callable, ClassVar, Dict, List, @@ -31,7 +32,9 @@ Optional, TextIO, Tuple, + Type, TypedDict, + TypeVar, Union, cast, ) @@ -1289,6 +1292,9 @@ class CharmEvents(ObjectEvents): """ +_ConfigType = TypeVar('_ConfigType') + + class CharmBase(Object): """Base class that represents the charm overall. @@ -1384,6 +1390,72 @@ def config(self) -> model.ConfigData: """A mapping containing the charm's config and current values.""" return self.model.config + def load_config( + self, + cls: Type[_ConfigType], + *args: Any, + convert_name: Optional[Callable[[str], str]] = None, + **kwargs: Any, + ) -> _ConfigType: + """Load the config into an instance of a config class. + + The object will be instantiated with keyword arguments of all the raw + Juju config, but with: + + * `secret` type options having a :class:`model.Secret` value rather than + the secret ID. + * dashes in names converted to underscores, unless a custom conversion + function is provided. + + Any additional positional or keyword arguments will be passed through to + the config class. + + Args: + cls: A class that inherits from :class:`ops.ConfigBase`. + convert_name: An optional function that takes a string option name + as found in the YAML config, and returns the name of the + attribute, which must be a valid Python identifier. + args: positional arguments to pass through to the config class. + kwargs: keyword arguments to pass through to the config class. + + Returns: + An instance of the config class with the current config values. + """ + from ._main import _Abort # Avoid circular import. + # We exit with a 'success' code because we don't want Juju to retry + # the hook - we need the Juju user to fix the config first, at + # which point the error will no longer be raised. + + # Convert secret IDs to secret objects. + config: Dict[str, Union[bool, int, float, str, model.Secret]] = kwargs.copy() + for key, value in self.config.items(): + if convert_name: + attr = convert_name(key) + if not attr.isidentifier(): + logger.error('Invalid attribute name %r from %s', attr, key) + self.unit.status = model.BlockedStatus(f'Invalid attribute name {attr}') + raise _Abort(0) + else: + attr = key.replace('-', '_') + option_type = self.meta.config.get(key) + if option_type and option_type.type == 'secret' and isinstance(value, str): + try: + config[attr] = self.model.get_secret(id=value) + except model.SecretNotFoundError: + logger.error('secret referenced in option {key} not found') + self.unit.status = model.BlockedStatus( + f"{key} option refers to a secret that doesn't exist or is not accessible" + ) + raise _Abort(0) from None + else: + config[attr] = value + try: + return cls(*args, **config) + except ValueError as e: + logger.error('Invalid configuration for %s: %r (%s)', cls.__name__, config, e) + self.unit.status = model.BlockedStatus(f'Error in config: {e}') + raise _Abort(0) from None + def _evaluate_status(charm: CharmBase): # pyright: ignore[reportUnusedFunction] """Trigger collect-status events and evaluate and set the highest-priority status. @@ -1405,13 +1477,15 @@ def _evaluate_status(charm: CharmBase): # pyright: ignore[reportUnusedFunction] class CharmMeta: """Object containing the metadata for the charm. - This is read from ``metadata.yaml`` and ``actions.yaml``. Generally - charms will define this information, rather than reading it at runtime. This - class is mostly for the framework to understand what the charm has defined. + This is read from ``metadata.yaml``, ``config.yaml``, and ``actions.yaml``. + Generally charms will define this information, rather than reading it at + runtime. This class is mostly for the framework to understand what the charm + has defined. Args: raw: a mapping containing the contents of metadata.yaml actions_raw: a mapping containing the contents of actions.yaml + config_raw: a mapping containing the contents of config.yaml """ name: str @@ -1497,11 +1571,18 @@ class is mostly for the framework to understand what the charm has defined. actions: Dict[str, 'ActionMeta'] """Actions the charm has defined.""" + config: Dict[str, 'ConfigMeta'] + """Config options the charm has defined.""" + def __init__( - self, raw: Optional[Dict[str, Any]] = None, actions_raw: Optional[Dict[str, Any]] = None + self, + raw: Optional[Dict[str, Any]] = None, + actions_raw: Optional[Dict[str, Any]] = None, + config_raw: Optional[Dict[str, Any]] = None, ): raw_: Dict[str, Any] = raw or {} actions_raw_: Dict[str, Any] = actions_raw or {} + config_raw_: Dict[str, Any] = config_raw or {} # When running in production, this data is generally loaded from # metadata.yaml. However, when running tests, this data is @@ -1563,6 +1644,10 @@ def __init__( } self.extra_bindings = raw_.get('extra-bindings', {}) self.actions = {name: ActionMeta(name, action) for name, action in actions_raw_.items()} + self.config = { + name: ConfigMeta(name, config) + for name, config in config_raw_.get('options', {}).items() + } self.containers = { name: ContainerMeta(name, container) for name, container in raw_.get('containers', {}).items() @@ -1578,13 +1663,18 @@ def from_charm_root(charm_root: Union[pathlib.Path, str]): meta = yaml.safe_load(f.read()) actions = None - actions_path = _charm_root / 'actions.yaml' if actions_path.exists(): with actions_path.open() as f: actions = yaml.safe_load(f.read()) - return CharmMeta(meta, actions) + options = None + config_path = _charm_root / 'config.yaml' + if config_path.exists(): + with config_path.open() as f: + options = yaml.safe_load(f.read()) + + return CharmMeta(meta, actions, options) def _load_links(self, raw: Dict[str, Any]): websites = raw.get('website', []) @@ -1617,7 +1707,10 @@ def _load_links(self, raw: Dict[str, Any]): @classmethod def from_yaml( - cls, metadata: Union[str, TextIO], actions: Optional[Union[str, TextIO]] = None + cls, + metadata: Union[str, TextIO], + actions: Optional[Union[str, TextIO]] = None, + config: Optional[Union[str, TextIO]] = None, ) -> 'CharmMeta': """Instantiate a :class:`CharmMeta` from a YAML description of ``metadata.yaml``. @@ -1625,6 +1718,7 @@ def from_yaml( metadata: A YAML description of charm metadata (name, relations, etc.) This can be a simple string, or a file-like object (passed to ``yaml.safe_load``). actions: YAML description of Actions for this charm (e.g., actions.yaml) + config: YAML description of Config for this charm (e.g., config.yaml) """ meta = yaml.safe_load(metadata) raw_actions = {} @@ -1632,7 +1726,12 @@ def from_yaml( raw_actions = cast(Optional[Dict[str, Any]], yaml.safe_load(actions)) if raw_actions is None: raw_actions = {} - return cls(meta, raw_actions) + raw_config = {} + if config is not None: + raw_config = cast(Optional[Dict[str, Any]], yaml.safe_load(config)) + if raw_config is None: + raw_config = {} + return cls(meta, raw_actions, raw_config) class RelationRole(enum.Enum): @@ -1879,6 +1978,29 @@ def __init__(self, name: str, raw: Optional[Dict[str, Any]] = None): self.additional_properties = raw.get('additionalProperties', True) +class ConfigMeta: + """Object containing metadata about a config option.""" + + name: str + """Name of the config option.""" + + type: Literal['string', 'int', 'float', 'boolean', 'secret'] + """Type of the config option.""" + + default: Any + """Default value of the config option.""" + + description: str + """Description of the config option.""" + + def __init__(self, name: str, raw: Optional[Dict[str, Any]] = None): + raw = raw or {} + self.name = name + self.type = raw['type'] + self.default = raw.get('default') + self.description = raw.get('description', '') + + @dataclasses.dataclass(frozen=True) class ContainerBase: """Metadata to resolve a container image.""" diff --git a/ops/model.py b/ops/model.py index b6437ebb9..3600f96e6 100644 --- a/ops/model.py +++ b/ops/model.py @@ -3929,7 +3929,7 @@ def validate_label_value(cls, label: str, value: str): if not value: raise ModelError(f'metric label {label} has an empty value, which is not allowed') v = str(value) - if re.search('[,=]', v) is not None: + if re.search(r'[,=]', v) is not None: raise ModelError(f'metric label values must not contain "," or "=": {label}={value!r}') diff --git a/test/test_config.py b/test/test_config.py new file mode 100644 index 000000000..5e6cc529b --- /dev/null +++ b/test/test_config.py @@ -0,0 +1,414 @@ +# Copyright 2025 Canonical Ltd. +# +# Licensed under the Apache License, Version 2.0 (the "License"); +# you may not use this file except in compliance with the License. +# You may obtain a copy of the License at +# +# http://www.apache.org/licenses/LICENSE-2.0 +# +# Unless required by applicable law or agreed to in writing, software +# distributed under the License is distributed on an "AS IS" BASIS, +# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +# See the License for the specific language governing permissions and +# limitations under the License. + +from __future__ import annotations + +import dataclasses +import logging +from typing import Optional, Union + +import pytest + +try: + import pydantic + import pydantic.dataclasses +except ImportError: + pydantic = None + +import ops +import ops._main +import ops._private.yaml +from ops import testing + +logger = logging.getLogger(__name__) + +JUJU_TYPES = Union[bool, int, float, str] + + +class MyConfig(ops.ConfigBase): + my_bool: bool | None = None + """A Boolean value.""" + + my_int: int = 42 + """A positive integer value.""" + + my_float: float = 3.14 + """A floating point value.""" + + my_str: str = 'foo' + """A string value.""" + + my_secret: Optional[ops.Secret] = None # 'Optional' and not '| None' to exercise that path. + """A user secret.""" + + def __init__( + self, + *, + my_bool: JUJU_TYPES | None = None, + my_int: JUJU_TYPES = 42, + my_float: JUJU_TYPES = 3.14, + my_str: JUJU_TYPES = 'foo', + my_secret: ops.Secret | None = None, + ): + super().__init__() + if my_bool is not None and not isinstance(my_bool, bool): + raise ValueError('my_bool must be a Boolean') + self.my_bool = my_bool + if not isinstance(my_float, float): + raise ValueError('my_float must be a float') + self.my_float = my_float + if not isinstance(my_int, int): + raise ValueError('my_int must be an integer') + if my_int < 0: + raise ValueError('my_int must be zero or positive') + self.my_int = my_int + if not isinstance(my_str, str): + raise ValueError('my_str must be a string') + self.my_str = my_str + if my_secret is not None: + if not isinstance(my_secret, ops.Secret): + raise ValueError('my_secret must be a secret') + self.my_secret = my_secret + + +class MyCharm(ops.CharmBase): + def __init__(self, framework: ops.Framework): + super().__init__(framework) + self.typed_config = self.load_config(MyConfig) + # These should not have any type errors. + new_float = self.typed_config.my_float + 2006.8 + new_int = self.typed_config.my_int + 1979 + new_str = self.typed_config.my_str + 'bar' + if self.typed_config.my_secret is not None: + label = self.typed_config.my_secret.label + else: + label = 'no secret' + logger.info(f'{new_float=}, {new_int=}, {new_str=}, {label=}') + + +# Note that we would really like to have kw_only=True here as well, but that's +# not available in Python 3.8. +@dataclasses.dataclass(frozen=True) +class MyDataclassConfig(ops.ConfigBase): + my_bool: bool | None = None + """A Boolean value.""" + + my_int: int = 42 + """A positive integer value.""" + + my_float: float = 3.14 + """A floating point value.""" + + my_str: str = 'foo' + """A string value.""" + + my_secret: Optional[ops.Secret] = None # 'Optional' and not '| None' to exercise that path. + """A user secret.""" + + def __post_init__(self): + if self.my_int < 0: + raise ValueError('my_int must be zero or positive') + + +class MyDataclassCharm(ops.CharmBase): + def __init__(self, framework: ops.Framework): + super().__init__(framework) + self.typed_config = self.load_config(MyDataclassConfig) + # These should not have any type errors. + new_float = self.typed_config.my_float + 2006.8 + new_int = self.typed_config.my_int + 1979 + new_str = self.typed_config.my_str + 'bar' + if self.typed_config.my_secret is not None: + label = self.typed_config.my_secret.label + else: + label = 'no secret' + logger.info(f'{new_float=}, {new_int=}, {new_str=}, {label=}') + + +_test_classes: list[type[ops.CharmBase]] = [MyCharm, MyDataclassCharm] +_test_class_types = Union[type[MyCharm], type[MyDataclassCharm]] +_test_config_classes: list[type[ops.ConfigBase]] = [MyConfig, MyDataclassConfig] +_test_config_classes_types = Union[type[MyConfig], type[MyDataclassConfig]] + +if pydantic: + + @pydantic.dataclasses.dataclass(frozen=True, config={'arbitrary_types_allowed': True}) + class MyPydanticDataclassConfig(ops.ConfigBase): + my_bool: bool | None = pydantic.Field(None, description='A Boolean value.') + my_int: int = pydantic.Field(42, description='A positive integer value.') + my_float: float = pydantic.Field(3.14, description='A floating point value.') + my_str: str = pydantic.Field('foo', description='A string value.') + my_secret: Optional[ops.Secret] = pydantic.Field(None, description='A user secret.') + + @pydantic.field_validator('my_int') + @classmethod + def validate_my_int(cls, my_int: int) -> int: + if my_int < 0: + raise ValueError('my_int must be zero or positive') + return my_int + + class MyPydanticDataclassCharm(ops.CharmBase): + def __init__(self, framework: ops.Framework): + super().__init__(framework) + self.typed_config = self.load_config(MyPydanticDataclassConfig) + # These should not have any type errors. + new_float = self.typed_config.my_float + 2006.8 + new_int = self.typed_config.my_int + 1979 + new_str = self.typed_config.my_str + 'bar' + if self.typed_config.my_secret is not None: + label = self.typed_config.my_secret.label + else: + label = 'no secret' + logger.info(f'{new_float=}, {new_int=}, {new_str=}, {label=}') + + class MyPydanticBaseModelConfig(pydantic.BaseModel, ops.ConfigBase): + my_bool: Optional[bool] = pydantic.Field(None, description='A Boolean value.') + my_int: int = pydantic.Field(42, description='A positive integer value.') + my_float: float = pydantic.Field(3.14, description='A floating point value.') + my_str: str = pydantic.Field('foo', description='A string value.') + my_secret: Optional[ops.Secret] = pydantic.Field(None, description='A user secret.') + + @pydantic.field_validator('my_int') + @classmethod + def validate_my_int(cls, my_int: int) -> int: + if my_int < 0: + raise ValueError('my_int must be zero or positive') + return my_int + + class Config: + arbitrary_types_allowed = True + frozen = True + + class MyPydanticBaseModelCharm(ops.CharmBase): + def __init__(self, framework: ops.Framework): + super().__init__(framework) + self.typed_config = self.load_config(MyPydanticBaseModelConfig) + # These should not have any type errors. + new_float = self.typed_config.my_float + 2006.8 + new_int = self.typed_config.my_int + 1979 + new_str = self.typed_config.my_str + 'bar' + if self.typed_config.my_secret is not None: + label = self.typed_config.my_secret.label + else: + label = 'no secret' + logger.info(f'{new_float=}, {new_int=}, {new_str=}, {label=}') + + _test_classes.extend((MyPydanticDataclassCharm, MyPydanticBaseModelCharm)) + _test_class_types = Union[ + _test_class_types, type[MyPydanticDataclassCharm], type[MyPydanticBaseModelCharm] + ] + _test_config_classes.extend((MyPydanticDataclassConfig, MyPydanticBaseModelConfig)) + _test_config_classes_types = Union[ + _test_config_classes_types, + type[MyPydanticDataclassConfig], + type[MyPydanticBaseModelConfig], + ] + + +@pytest.mark.parametrize('charm_class', _test_classes) +def test_config_init(charm_class: _test_class_types, request: pytest.FixtureRequest): + # We use the generated schema from the simple class for all variants, + # because we expect it to be the same. + config = MyConfig.to_yaml_schema() + harness = testing.Harness(charm_class, config=ops._private.yaml.safe_dump(config)) + request.addfinalizer(harness.cleanup) + harness.begin() + typed_config = harness.charm.typed_config + assert typed_config.my_bool is None + assert typed_config.my_float == 3.14 + assert isinstance(typed_config.my_float, float) + assert typed_config.my_int == 42 + assert isinstance(typed_config.my_int, int) + assert typed_config.my_str == 'foo' + assert isinstance(typed_config.my_str, str) + assert typed_config.my_secret is None + + +@pytest.mark.parametrize('charm_class', _test_classes) +def test_config_init_non_default(charm_class: _test_class_types, request: pytest.FixtureRequest): + config = MyConfig.to_yaml_schema() + harness = testing.Harness(charm_class, config=ops._private.yaml.safe_dump(config)) + request.addfinalizer(harness.cleanup) + harness.update_config({ + 'my-bool': True, + 'my-float': 2.71, + 'my-int': 24, + 'my-str': 'bar', + }) + harness.begin() + typed_config = harness.charm.typed_config + assert typed_config.my_bool is True + assert typed_config.my_float == 2.71 + assert typed_config.my_int == 24 + assert typed_config.my_str == 'bar' + assert typed_config.my_secret is None + + +@pytest.mark.parametrize('charm_class', _test_classes) +def test_config_with_error(charm_class: _test_class_types, request: pytest.FixtureRequest): + config = MyConfig.to_yaml_schema() + harness = testing.Harness(charm_class, config=ops._private.yaml.safe_dump(config)) + request.addfinalizer(harness.cleanup) + harness.update_config({ + 'my-int': -1, + }) + with pytest.raises(ops._main._Abort) as cm: + harness.begin() + assert cm.value.exit_code == 0 + # TODO: add a test_main check that makes sure that the status is set correctly. + + +@pytest.mark.parametrize('charm_class', _test_classes) +def test_config_with_secret(charm_class: _test_class_types, request: pytest.FixtureRequest): + config = MyConfig.to_yaml_schema() + harness = testing.Harness(charm_class, config=ops._private.yaml.safe_dump(config)) + request.addfinalizer(harness.cleanup) + content = {'password': 'admin'} + secret_id = harness.add_user_secret(content) + harness.grant_secret(secret_id, harness.model.app.name) + harness.update_config({ + 'my-secret': secret_id, + }) + harness.begin() + secret = harness.charm.typed_config.my_secret + assert secret is not None + assert secret.id == secret_id + assert secret.get_content() == content + + +@pytest.mark.parametrize('charm_class', _test_classes) +def test_config_invalid_secret_id(charm_class: _test_class_types, request: pytest.FixtureRequest): + config = MyConfig.to_yaml_schema() + harness = testing.Harness(charm_class, config=ops._private.yaml.safe_dump(config)) + request.addfinalizer(harness.cleanup) + content = {'password': 'admin'} + secret_id = harness.add_user_secret(content) + harness.grant_secret(secret_id, harness.model.app.name) + harness.update_config({ + 'my-secret': 'not a secret id', + }) + with pytest.raises(ops._main._Abort) as cm: + harness.begin() + assert cm.value.exit_code == 0 + # TODO: add a test_main check that makes sure that the status is set correctly. + + +@pytest.mark.parametrize('charm_class', _test_classes) +def test_config_missing_secret(charm_class: _test_class_types, request: pytest.FixtureRequest): + config = MyConfig.to_yaml_schema() + harness = testing.Harness(charm_class, config=ops._private.yaml.safe_dump(config)) + request.addfinalizer(harness.cleanup) + content = {'password': 'admin'} + secret_id = harness.add_user_secret(content) + harness.update_config({ + 'my-secret': secret_id, + }) + with pytest.raises(ops._main._Abort) as cm: + harness.begin() + assert cm.value.exit_code == 0 + # TODO: add a test_main check that makes sure that the status is set correctly. + + +def test_config_custom_naming_pattern(request: pytest.FixtureRequest): + @dataclasses.dataclass(frozen=True) + class Config(ops.ConfigBase): + foo_bar: int = 42 + other: str = 'baz' + + @staticmethod + def attr_name_to_yaml_name(name: str): + if name == 'foo_bar': + return 'fooBar' + return name.replace('_', '-') + + class Charm(ops.CharmBase): + def __init__(self, framework: ops.Framework): + super().__init__(framework) + self.typed_config = self.load_config(Config, convert_name=self.yaml_name_to_attr_name) + + @staticmethod + def yaml_name_to_attr_name(name: str): + if name == 'fooBar': + return 'foo_bar' + return name.replace('-', '_') + + config = Config.to_yaml_schema() + assert 'fooBar' in config['options'] + harness = testing.Harness(Charm, config=ops._private.yaml.safe_dump(config)) + request.addfinalizer(harness.cleanup) + harness.begin() + typed_config = harness.charm.typed_config + assert typed_config.foo_bar == 42 + assert typed_config.other == 'baz' + + +def test_config_bad_attr_naming_pattern(request: pytest.FixtureRequest): + @dataclasses.dataclass(frozen=True) + class BadConfig(ops.ConfigBase): + foo_bar: int = 42 + + class BadCharm(ops.CharmBase): + def __init__(self, framework: ops.Framework): + super().__init__(framework) + self.typed_config = self.load_config( + BadConfig, convert_name=lambda x: x.replace('_', '-') + ) + + config = BadConfig.to_yaml_schema() + assert 'foo-bar' in config['options'] + harness = testing.Harness(BadCharm, config=ops._private.yaml.safe_dump(config)) + request.addfinalizer(harness.cleanup) + with pytest.raises(ops._main._Abort) as cm: + harness.begin() + assert cm.value.exit_code == 0 + # TODO: add a test_main check that makes sure that the status is set correctly. + + +@pytest.mark.parametrize('config_class', _test_config_classes) +def test_config_yaml_schema(config_class: _test_config_classes_types): + generated_yaml = config_class.to_yaml_schema() + expected_yaml = { + 'options': { + 'my-bool': { + 'type': 'boolean', + 'description': 'A Boolean value.', + }, + 'my-float': { + 'type': 'float', + 'default': 3.14, + 'description': 'A floating point value.', + }, + 'my-int': { + 'type': 'int', + 'default': 42, + 'description': 'A positive integer value.', + }, + 'my-str': { + 'type': 'string', + 'default': 'foo', + 'description': 'A string value.', + }, + 'my-secret': { + 'type': 'secret', + 'description': 'A user secret.', + }, + }, + } + assert generated_yaml == expected_yaml + + +# TODO: +# Tests for passing in additional args/kwargs. +# Tests for custom types. +# Scenario change to generate the YAML if appropriate. diff --git a/test/test_main.py b/test/test_main.py index 62c9ead64..e3e8ec4f0 100644 --- a/test/test_main.py +++ b/test/test_main.py @@ -930,14 +930,14 @@ def test_excepthook(self, fake_script: FakeScript): calls = [' '.join(i) for i in fake_script.calls()] assert calls.pop(0) == ' '.join(VERSION_LOGLINE) - assert re.search('Using local storage: not a Kubernetes podspec charm', calls.pop(0)) - assert re.search('Initializing SQLite local storage: ', calls.pop(0)) + assert 'Using local storage: not a Kubernetes podspec charm' in calls.pop(0) + assert 'Initializing SQLite local storage: ' in calls.pop(0) assert re.search( '(?ms)juju-log --log-level ERROR -- Uncaught exception while in charm code:\n' 'Traceback .most recent call last.:\n' - ' .*' + r' .*' " raise RuntimeError.'failing as requested'.\n" - 'RuntimeError: failing as requested', + r'RuntimeError: failing as requested', calls[0], ) assert len(calls) == 1, f'expected 1 call, but got extra: {calls[1:]}' @@ -1209,7 +1209,7 @@ def test_hook_and_dispatch( ['is-leader', '--format=json'], ] calls = fake_script.calls() - assert re.search('Initializing SQLite local storage: ', ' '.join(calls.pop(-3))) + assert 'Initializing SQLite local storage: ' in ' '.join(calls.pop(-3)) assert calls == expected @pytest.mark.usefixtures('setup_charm') @@ -1240,7 +1240,7 @@ def test_non_executable_hook_and_dispatch(self, fake_script: FakeScript): ['is-leader', '--format=json'], ] calls = fake_script.calls() - assert re.search('Initializing SQLite local storage: ', ' '.join(calls.pop(-3))) + assert 'Initializing SQLite local storage: ' in ' '.join(calls.pop(-3)) assert calls == expected @pytest.mark.usefixtures('setup_charm') @@ -1331,7 +1331,7 @@ def test_hook_and_dispatch_but_hook_is_dispatch_copy(self, fake_script: FakeScri ['is-leader', '--format=json'], ] calls = fake_script.calls() - assert re.search('Initializing SQLite local storage: ', ' '.join(calls.pop(-3))) + assert 'Initializing SQLite local storage: ' in ' '.join(calls.pop(-3)) assert calls == expected diff --git a/test/test_model.py b/test/test_model.py index 42f3282f5..b29d38bc7 100644 --- a/test/test_model.py +++ b/test/test_model.py @@ -2072,7 +2072,7 @@ def raise_error(): with caplog.at_level(level='DEBUG', logger='ops'): assert not container.can_connect() assert len(caplog.records) == 1 - assert re.search(r'connection error!', caplog.text) + assert r'connection error!' in caplog.text def test_can_connect_file_not_found_error( self, @@ -2086,7 +2086,7 @@ def raise_error(): with caplog.at_level(level='DEBUG', logger='ops'): assert not container.can_connect() assert len(caplog.records) == 1 - assert re.search(r'file not found!', caplog.text) + assert r'file not found!' in caplog.text def test_can_connect_api_error( self, @@ -2100,7 +2100,7 @@ def raise_error(): with caplog.at_level(level='WARNING', logger='ops'): assert not container.can_connect() assert len(caplog.records) == 1 - assert re.search(r'api error!', caplog.text) + assert r'api error!' in caplog.text def test_exec(self, container: ops.Container, monkeypatch: pytest.MonkeyPatch): monkeypatch.setattr(container, '_juju_version', JujuVersion('3.1.6')) diff --git a/test/test_testing.py b/test/test_testing.py index 9f370a2c1..31f561d25 100644 --- a/test/test_testing.py +++ b/test/test_testing.py @@ -1222,7 +1222,7 @@ def test_config_secret_option(self, request: pytest.FixtureRequest): assert harness.charm.changes == [{'name': 'config-changed', 'data': {'a': secret_id}}] def test_no_config_option_type(self): - with pytest.raises(RuntimeError): + with pytest.raises(KeyError): ops.testing.Harness( RecordingCharm, config=""" diff --git a/testing/src/scenario/_ops_main_mock.py b/testing/src/scenario/_ops_main_mock.py index 7f8d99750..f3c236adb 100644 --- a/testing/src/scenario/_ops_main_mock.py +++ b/testing/src/scenario/_ops_main_mock.py @@ -1,4 +1,3 @@ -#!/usr/bin/env python3 # Copyright 2023 Canonical Ltd. # See LICENSE file for licensing details. @@ -134,8 +133,13 @@ def _load_charm_meta(self): actions_metadata = actions_meta.read_text() else: actions_metadata = None + config_meta = self._charm_root / "config.yaml" + if config_meta.exists(): + config_metadata = config_meta.read_text() + else: + config_metadata = None - return ops.CharmMeta.from_yaml(metadata, actions_metadata) + return ops.CharmMeta.from_yaml(metadata, actions_metadata, config_metadata) def _setup_root_logging(self): # The warnings module captures this in _showwarning_orig, but we diff --git a/tox.ini b/tox.ini index b550a6d66..c82a24c8f 100644 --- a/tox.ini +++ b/tox.ini @@ -103,6 +103,7 @@ deps = pytest-xdist~=3.6 typing_extensions~=4.2 jsonpatch~=1.33 + pydantic~=2.10 -e . -e testing commands = From 7f143cd35e5aec6a58ed739da1418ef46b9a9cb0 Mon Sep 17 00:00:00 2001 From: Tony Meyer Date: Sun, 30 Mar 2025 18:30:05 +1300 Subject: [PATCH 02/79] Tox is green, including docs. --- docs/custom_conf.py | 1 + ops/_config.py | 55 +++++++++++++++++++++++++++----------------- ops/charm.py | 27 ++-------------------- test/test_config.py | 47 ++++++++++++++++++++----------------- test/test_testing.py | 2 +- 5 files changed, 64 insertions(+), 68 deletions(-) diff --git a/docs/custom_conf.py b/docs/custom_conf.py index e141059e6..f80889caa 100644 --- a/docs/custom_conf.py +++ b/docs/custom_conf.py @@ -338,6 +338,7 @@ ('py:class', 'CharmType'), ('py:obj', 'ops._private.harness.CharmType'), ('py:class', 'ops._private.harness.CharmType'), + ('py:class', 'ops.charm._ConfigType'), ('py:class', 'ops.charm._ContainerBaseDict'), ('py:class', 'ops.model._AddressDict'), ('py:class', 'ops.model._GenericLazyMapping'), diff --git a/ops/_config.py b/ops/_config.py index dee242871..03be634b4 100644 --- a/ops/_config.py +++ b/ops/_config.py @@ -21,7 +21,7 @@ import inspect import logging import pathlib -from typing import Any, ClassVar, cast +from typing import Any, ClassVar, Generator, cast from ._private import yaml from .model import Secret @@ -79,16 +79,16 @@ class MyConfig(ops.ConfigBase): my_secret: ops.Secret | None = None '''A user secret.''' - ```{note} - This is a dataclass, but can be any object that inherits from - ``ops.ConfigBase``, and can be initialised with the raw Juju config passed - as keyword arguments. Any errors should be indicated by raising - ``ValueError`` (or a ``ValueError`` subclass) in initialisation. + .. note:: - Inheriting from ``ops.ConfigBase`` is not strictly necessary, but it - provides utility methods for translating the class to a YAML schema suitable - for use with Juju. - ``` + This is a dataclass, but can be any object that inherits from + ``ops.ConfigBase``, and can be initialised with the raw Juju config + pass as keyword arguments. Any errors should be indicated by raising + ``ValueError`` (or a ``ValueError`` subclass) in initialisation. + + Inheriting from ``ops.ConfigBase`` is not strictly necessary, but it + provides utility methods for translating the class to a YAML schema suitable + for use with Juju. Use this in your charm class like so:: @@ -111,6 +111,7 @@ def __init__(self, framework): 'ops.model.Secret': 'secret', } + # TODO: This could also be factored out into a common helper. @classmethod def _get_attr_docstrings(cls) -> dict[str, str]: docs: dict[str, str] = {} @@ -179,10 +180,25 @@ def attr_name_to_yaml_name(name: str): Python names are snake_case, but Juju config option names should be kebab-case. Override if your config names do not match this pattern, for - backwards compatibility, for example. + example for backwards compatibility. """ return name.replace('_', '-') + @classmethod + def option_names(cls) -> Generator[str, None, None]: + """Iterates over all the option names to include in the config YAML. + + By default, this is ``dir(cls)``, excluding any callables and any names + that start with an underscore, and the ``JUJU_TYPES`` name. + """ + for attr in dir(cls): + if attr.startswith('_') or callable(getattr(cls, attr)): + continue + # Perhaps we should ignore anything that's typing.ClassVar? + if attr == 'JUJU_TYPES': + continue + yield attr + @classmethod def _yaml_schema_from_basemodel(cls) -> dict[str, Any]: options = {} @@ -205,7 +221,7 @@ def _yaml_schema_from_basemodel(cls) -> dict[str, Any]: def to_yaml_schema(cls) -> dict[str, Any]: """Translate the class to YAML suitable for config.yaml. - Using :attr:`MyConfig.to_yaml_schema` will generate a YAML schema + Using :attr:`ConfigBase.to_yaml_schema` will generate a YAML schema suitable for use in ``config.yaml``. For example, with the class from the example above:: @@ -239,12 +255,7 @@ def to_yaml_schema(cls) -> dict[str, Any]: # Dataclasses, regular classes, etc. options: dict[str, dict[str, bool | int | float | str]] = {} - for attr in dir(cls): - if attr.startswith('_') or callable(getattr(cls, attr)): - continue - # Perhaps we should ignore anything that's typing.ClassVar? - if attr == 'JUJU_TYPES': - continue + for attr in cls.option_names(): option = {} default = getattr(cls, attr, None) if type(default).__name__ in cls.JUJU_TYPES: @@ -265,9 +276,9 @@ def to_starlark_validator(cls) -> str: def generate_yaml_schema(): """Look for all ConfigBase subclasses and generate their YAML schema. - ```{caution} - This imports modules, so is not safe to run on untrusted code. - ``` + .. caution:: + + This imports modules, so is not safe to run on untrusted code. """ config: dict[str, Any] = {} for name in pathlib.Path('src').glob('*.py'): @@ -282,3 +293,5 @@ def generate_yaml_schema(): if __name__ == '__main__': generate_yaml_schema() + +# TODO: if __future__ annotations is not used. diff --git a/ops/charm.py b/ops/charm.py index d46ff1ad5..848f17d4d 100644 --- a/ops/charm.py +++ b/ops/charm.py @@ -1419,8 +1419,8 @@ def load_config( The object will be instantiated with keyword arguments of all the raw Juju config, but with: - * `secret` type options having a :class:`model.Secret` value rather than - the secret ID. + * ``secret`` type options having a :class:`model.Secret` value rather + than the secret ID. * dashes in names converted to underscores, unless a custom conversion function is provided. @@ -2009,29 +2009,6 @@ def __init__(self, name: str, raw: Optional[Dict[str, Any]] = None): self.additional_properties = raw.get('additionalProperties', True) -class ConfigMeta: - """Object containing metadata about a config option.""" - - name: str - """Name of the config option.""" - - type: Literal['string', 'int', 'float', 'boolean', 'secret'] - """Type of the config option.""" - - default: Any - """Default value of the config option.""" - - description: str - """Description of the config option.""" - - def __init__(self, name: str, raw: Optional[Dict[str, Any]] = None): - raw = raw or {} - self.name = name - self.type = raw['type'] - self.default = raw.get('default') - self.description = raw.get('description', '') - - @dataclasses.dataclass(frozen=True) class ConfigMeta: """Object containing metadata about a config option.""" diff --git a/test/test_config.py b/test/test_config.py index 5e6cc529b..44635370b 100644 --- a/test/test_config.py +++ b/test/test_config.py @@ -16,7 +16,7 @@ import dataclasses import logging -from typing import Optional, Union +from typing import Optional, Protocol, Union, cast import pytest @@ -36,6 +36,14 @@ JUJU_TYPES = Union[bool, int, float, str] +class _ConfigProtocol(Protocol): + my_bool: bool | None + my_int: int + my_float: float + my_str: str + my_secret: Optional[ops.Secret] + + class MyConfig(ops.ConfigBase): my_bool: bool | None = None """A Boolean value.""" @@ -137,9 +145,7 @@ def __init__(self, framework: ops.Framework): _test_classes: list[type[ops.CharmBase]] = [MyCharm, MyDataclassCharm] -_test_class_types = Union[type[MyCharm], type[MyDataclassCharm]] _test_config_classes: list[type[ops.ConfigBase]] = [MyConfig, MyDataclassConfig] -_test_config_classes_types = Union[type[MyConfig], type[MyDataclassConfig]] if pydantic: @@ -205,26 +211,19 @@ def __init__(self, framework: ops.Framework): logger.info(f'{new_float=}, {new_int=}, {new_str=}, {label=}') _test_classes.extend((MyPydanticDataclassCharm, MyPydanticBaseModelCharm)) - _test_class_types = Union[ - _test_class_types, type[MyPydanticDataclassCharm], type[MyPydanticBaseModelCharm] - ] _test_config_classes.extend((MyPydanticDataclassConfig, MyPydanticBaseModelConfig)) - _test_config_classes_types = Union[ - _test_config_classes_types, - type[MyPydanticDataclassConfig], - type[MyPydanticBaseModelConfig], - ] @pytest.mark.parametrize('charm_class', _test_classes) -def test_config_init(charm_class: _test_class_types, request: pytest.FixtureRequest): +def test_config_init(charm_class: type[ops.CharmBase], request: pytest.FixtureRequest): # We use the generated schema from the simple class for all variants, # because we expect it to be the same. config = MyConfig.to_yaml_schema() harness = testing.Harness(charm_class, config=ops._private.yaml.safe_dump(config)) request.addfinalizer(harness.cleanup) harness.begin() - typed_config = harness.charm.typed_config + typed_config = harness.charm.typed_config # type: ignore + typed_config = cast(_ConfigProtocol, typed_config) assert typed_config.my_bool is None assert typed_config.my_float == 3.14 assert isinstance(typed_config.my_float, float) @@ -236,7 +235,7 @@ def test_config_init(charm_class: _test_class_types, request: pytest.FixtureRequ @pytest.mark.parametrize('charm_class', _test_classes) -def test_config_init_non_default(charm_class: _test_class_types, request: pytest.FixtureRequest): +def test_config_init_non_default(charm_class: type[ops.CharmBase], request: pytest.FixtureRequest): config = MyConfig.to_yaml_schema() harness = testing.Harness(charm_class, config=ops._private.yaml.safe_dump(config)) request.addfinalizer(harness.cleanup) @@ -247,7 +246,8 @@ def test_config_init_non_default(charm_class: _test_class_types, request: pytest 'my-str': 'bar', }) harness.begin() - typed_config = harness.charm.typed_config + typed_config = harness.charm.typed_config # type: ignore + typed_config = cast(_ConfigProtocol, typed_config) assert typed_config.my_bool is True assert typed_config.my_float == 2.71 assert typed_config.my_int == 24 @@ -256,7 +256,7 @@ def test_config_init_non_default(charm_class: _test_class_types, request: pytest @pytest.mark.parametrize('charm_class', _test_classes) -def test_config_with_error(charm_class: _test_class_types, request: pytest.FixtureRequest): +def test_config_with_error(charm_class: type[ops.CharmBase], request: pytest.FixtureRequest): config = MyConfig.to_yaml_schema() harness = testing.Harness(charm_class, config=ops._private.yaml.safe_dump(config)) request.addfinalizer(harness.cleanup) @@ -270,7 +270,7 @@ def test_config_with_error(charm_class: _test_class_types, request: pytest.Fixtu @pytest.mark.parametrize('charm_class', _test_classes) -def test_config_with_secret(charm_class: _test_class_types, request: pytest.FixtureRequest): +def test_config_with_secret(charm_class: type[ops.CharmBase], request: pytest.FixtureRequest): config = MyConfig.to_yaml_schema() harness = testing.Harness(charm_class, config=ops._private.yaml.safe_dump(config)) request.addfinalizer(harness.cleanup) @@ -281,14 +281,18 @@ def test_config_with_secret(charm_class: _test_class_types, request: pytest.Fixt 'my-secret': secret_id, }) harness.begin() - secret = harness.charm.typed_config.my_secret + typed_config = harness.charm.typed_config # type: ignore + typed_config = cast(_ConfigProtocol, typed_config) + secret = typed_config.my_secret assert secret is not None assert secret.id == secret_id assert secret.get_content() == content @pytest.mark.parametrize('charm_class', _test_classes) -def test_config_invalid_secret_id(charm_class: _test_class_types, request: pytest.FixtureRequest): +def test_config_invalid_secret_id( + charm_class: type[ops.CharmBase], request: pytest.FixtureRequest +): config = MyConfig.to_yaml_schema() harness = testing.Harness(charm_class, config=ops._private.yaml.safe_dump(config)) request.addfinalizer(harness.cleanup) @@ -305,7 +309,7 @@ def test_config_invalid_secret_id(charm_class: _test_class_types, request: pytes @pytest.mark.parametrize('charm_class', _test_classes) -def test_config_missing_secret(charm_class: _test_class_types, request: pytest.FixtureRequest): +def test_config_missing_secret(charm_class: type[ops.CharmBase], request: pytest.FixtureRequest): config = MyConfig.to_yaml_schema() harness = testing.Harness(charm_class, config=ops._private.yaml.safe_dump(config)) request.addfinalizer(harness.cleanup) @@ -376,7 +380,7 @@ def __init__(self, framework: ops.Framework): @pytest.mark.parametrize('config_class', _test_config_classes) -def test_config_yaml_schema(config_class: _test_config_classes_types): +def test_config_yaml_schema(config_class: type[ops.ConfigBase]): generated_yaml = config_class.to_yaml_schema() expected_yaml = { 'options': { @@ -411,4 +415,5 @@ def test_config_yaml_schema(config_class: _test_config_classes_types): # TODO: # Tests for passing in additional args/kwargs. # Tests for custom types. +# Tests for custom names. # Scenario change to generate the YAML if appropriate. diff --git a/test/test_testing.py b/test/test_testing.py index f20969246..207e07855 100644 --- a/test/test_testing.py +++ b/test/test_testing.py @@ -1241,7 +1241,7 @@ def test_config_secret_option(self, request: pytest.FixtureRequest): assert harness.charm.changes == [{'name': 'config-changed', 'data': {'a': secret_id}}] def test_no_config_option_type(self): - with pytest.raises(KeyError): + with pytest.raises(RuntimeError): ops.testing.Harness( RecordingCharm, config=""" From 739c20c275e10f479e293809f995bb37c582d344 Mon Sep 17 00:00:00 2001 From: Tony Meyer Date: Sun, 30 Mar 2025 19:15:58 +1300 Subject: [PATCH 03/79] Add extra tests. --- ops/_config.py | 18 +++++-- test/test_config.py | 68 ++++++++++++++++++++++++--- testing/tests/test_e2e/test_config.py | 50 ++++++++++++++++---- 3 files changed, 116 insertions(+), 20 deletions(-) diff --git a/ops/_config.py b/ops/_config.py index 03be634b4..f3ff0ae2e 100644 --- a/ops/_config.py +++ b/ops/_config.py @@ -107,6 +107,10 @@ def __init__(self, framework): 'int': 'int', 'float': 'float', 'str': 'string', + "": 'boolean', + "": 'int', + "": 'float', + "": 'string', 'ops.Secret': 'secret', 'ops.model.Secret': 'secret', } @@ -188,11 +192,17 @@ def attr_name_to_yaml_name(name: str): def option_names(cls) -> Generator[str, None, None]: """Iterates over all the option names to include in the config YAML. - By default, this is ``dir(cls)``, excluding any callables and any names - that start with an underscore, and the ``JUJU_TYPES`` name. + By default, this is ``dir(cls)``, any keys from ``cls.__annotations``, + and any keys from ``cls.__dataclass_fields__``, excluding any callables + and any names that start with an underscore, and the ``JUJU_TYPES`` + name. """ - for attr in dir(cls): - if attr.startswith('_') or callable(getattr(cls, attr)): + attrs = dir(cls) + attrs.extend(cls.__annotations__) + if hasattr(cls, '__dataclass_fields__'): + attrs.extend(cls.__dataclass_fields__) # type: ignore + for attr in set(attrs): + if attr.startswith('_') or (hasattr(cls, attr) and callable(getattr(cls, attr))): continue # Perhaps we should ignore anything that's typing.ClassVar? if attr == 'JUJU_TYPES': diff --git a/test/test_config.py b/test/test_config.py index 44635370b..0da00d2d1 100644 --- a/test/test_config.py +++ b/test/test_config.py @@ -15,8 +15,9 @@ from __future__ import annotations import dataclasses +import datetime import logging -from typing import Optional, Protocol, Union, cast +from typing import Any, Optional, Protocol, Union, cast import pytest @@ -412,8 +413,63 @@ def test_config_yaml_schema(config_class: type[ops.ConfigBase]): assert generated_yaml == expected_yaml -# TODO: -# Tests for passing in additional args/kwargs. -# Tests for custom types. -# Tests for custom names. -# Scenario change to generate the YAML if appropriate. +def test_config_extra_args(request: pytest.FixtureRequest): + @dataclasses.dataclass + class Config(ops.ConfigBase): + a: int + b: float + c: str + + @classmethod + def option_names(cls): + yield 'b' + + class Charm(ops.CharmBase): + def __init__(self, framework: ops.Framework): + super().__init__(framework) + self.typed_config = self.load_config(Config, 10, c='foo') + + schema = Config.to_yaml_schema() + options = ops._private.yaml.safe_dump(schema) + harness = testing.Harness(Charm, config=options) + request.addfinalizer(harness.cleanup) + harness.update_config({'b': 3.14}) + harness.begin() + typed_config = harness.charm.typed_config # type: ignore + typed_config = cast(Config, typed_config) + assert typed_config.a == 10 + assert typed_config.b == 3.14 + assert typed_config.c == 'foo' + + +def test_config_custom_type(request: pytest.FixtureRequest): + class Config(ops.ConfigBase): + x: int + y: datetime.date + + def __init__(self, x: int, y: str): + self.x = x + year, month, day = y.split('-') + self.y = datetime.date(int(year), int(month), int(day)) + + @classmethod + def attr_to_yaml_type(cls, attr: str, default: Any = None) -> str: + if attr == 'y': + return 'string' + return super().attr_to_yaml_type(attr, default) + + class Charm(ops.CharmBase): + def __init__(self, framework: ops.Framework): + super().__init__(framework) + self.typed_config = self.load_config(Config) + + schema = Config.to_yaml_schema() + options = ops._private.yaml.safe_dump(schema) + harness = testing.Harness(Charm, config=options) + request.addfinalizer(harness.cleanup) + harness.update_config({'x': 42, 'y': '2008-08-28'}) + harness.begin() + typed_config = harness.charm.typed_config # type: ignore + typed_config = cast(Config, typed_config) + assert typed_config.x == 42 + assert typed_config.y == datetime.date(2008, 8, 28) diff --git a/testing/tests/test_e2e/test_config.py b/testing/tests/test_e2e/test_config.py index 073410977..ea937217e 100644 --- a/testing/tests/test_e2e/test_config.py +++ b/testing/tests/test_e2e/test_config.py @@ -1,18 +1,20 @@ +import dataclasses + import pytest -from ops.charm import CharmBase -from ops.framework import Framework +import ops +from scenario.context import Context from scenario.state import State from ..helpers import trigger @pytest.fixture(scope="function") def mycharm(): - class MyCharm(CharmBase): - def __init__(self, framework: Framework): + class MyCharm(ops.CharmBase): + def __init__(self, framework: ops.Framework): super().__init__(framework) for evt in self.on.events().values(): - self.framework.observe(evt, self._on_event) + framework.observe(evt, self._on_event) def _on_event(self, event): pass @@ -21,7 +23,7 @@ def _on_event(self, event): def test_config_get(mycharm): - def check_cfg(charm: CharmBase): + def check_cfg(charm: ops.CharmBase): assert charm.config["foo"] == "bar" assert charm.config["baz"] == 1 @@ -38,7 +40,7 @@ def check_cfg(charm: CharmBase): def test_config_get_default_from_meta(mycharm): - def check_cfg(charm: CharmBase): + def check_cfg(charm: ops.CharmBase): assert charm.config["foo"] == "bar" assert charm.config["baz"] == 2 assert charm.config["qux"] is False @@ -70,11 +72,11 @@ def check_cfg(charm: CharmBase): ), ) def test_config_in_not_mutated(mycharm, cfg_in): - class MyCharm(CharmBase): - def __init__(self, framework: Framework): + class MyCharm(ops.CharmBase): + def __init__(self, framework: ops.Framework): super().__init__(framework) for evt in self.on.events().values(): - self.framework.observe(evt, self._on_event) + framework.observe(evt, self._on_event) def _on_event(self, event): # access the config to trigger a config-get @@ -99,3 +101,31 @@ def _on_event(self, event): ) # check config was not mutated by scenario assert state_out.config == cfg_in + + +def test_config_using_configbase_class(): + @dataclasses.dataclass + class Config(ops.ConfigBase): + a: int + b: float + c: str + + @classmethod + def option_names(cls): + yield "b" + + class Charm(ops.CharmBase): + def __init__(self, framework: ops.Framework): + super().__init__(framework) + framework.observe(self.on.config_changed, self._on_config_changed) + + def _on_config_changed(self, event: ops.ConfigChangedEvent): + self.typed_config = self.load_config(Config, 10, c="foo") + + schema = Config.to_yaml_schema() + ctx = Context(Charm, meta={"name": "foo"}, config=schema) + with ctx(ctx.on.config_changed(), State(config={"b": 3.14})) as mgr: + mgr.run() + assert mgr.charm.typed_config.a == 10 + assert mgr.charm.typed_config.b == 3.14 + assert mgr.charm.typed_config.c == "foo" From 2c9bb9f2fdd1fda0fc3afd17019c4ae6dad060e7 Mon Sep 17 00:00:00 2001 From: Tony Meyer Date: Sun, 30 Mar 2025 19:19:13 +1300 Subject: [PATCH 04/79] Tox is green again. --- ops/charm.py | 8 ++++---- test/test_config.py | 6 ++---- 2 files changed, 6 insertions(+), 8 deletions(-) diff --git a/ops/charm.py b/ops/charm.py index 848f17d4d..5727862e5 100644 --- a/ops/charm.py +++ b/ops/charm.py @@ -1687,20 +1687,20 @@ def __init__( @staticmethod def from_charm_root(charm_root: Union[pathlib.Path, str]): """Initialise CharmMeta from the path to a charm repository root folder.""" - _charm_root = pathlib.Path(charm_root) - metadata_path = _charm_root / 'metadata.yaml' + charm_root = pathlib.Path(charm_root) + metadata_path = charm_root / 'metadata.yaml' with metadata_path.open() as f: meta = yaml.safe_load(f.read()) actions = None - actions_path = _charm_root / 'actions.yaml' + actions_path = charm_root / 'actions.yaml' if actions_path.exists(): with actions_path.open() as f: actions = yaml.safe_load(f.read()) options = None - config_path = _charm_root / 'config.yaml' + config_path = charm_root / 'config.yaml' if config_path.exists(): with config_path.open() as f: options = yaml.safe_load(f.read()) diff --git a/test/test_config.py b/test/test_config.py index 0da00d2d1..1a75ed24d 100644 --- a/test/test_config.py +++ b/test/test_config.py @@ -435,8 +435,7 @@ def __init__(self, framework: ops.Framework): request.addfinalizer(harness.cleanup) harness.update_config({'b': 3.14}) harness.begin() - typed_config = harness.charm.typed_config # type: ignore - typed_config = cast(Config, typed_config) + typed_config = harness.charm.typed_config assert typed_config.a == 10 assert typed_config.b == 3.14 assert typed_config.c == 'foo' @@ -469,7 +468,6 @@ def __init__(self, framework: ops.Framework): request.addfinalizer(harness.cleanup) harness.update_config({'x': 42, 'y': '2008-08-28'}) harness.begin() - typed_config = harness.charm.typed_config # type: ignore - typed_config = cast(Config, typed_config) + typed_config = harness.charm.typed_config assert typed_config.x == 42 assert typed_config.y == datetime.date(2008, 8, 28) From a1d4f74e14687d18458e1f39b847a9015a26c46c Mon Sep 17 00:00:00 2001 From: Tony Meyer Date: Mon, 31 Mar 2025 12:49:11 +1300 Subject: [PATCH 05/79] Add a Raises section. --- ops/charm.py | 4 ++++ 1 file changed, 4 insertions(+) diff --git a/ops/charm.py b/ops/charm.py index 5727862e5..a707ad96d 100644 --- a/ops/charm.py +++ b/ops/charm.py @@ -1437,6 +1437,10 @@ def load_config( Returns: An instance of the config class with the current config values. + + Raises: + _Abort if the configuration is invalid, after setting an appropriate + blocked status. """ from ._main import _Abort # Avoid circular import. # We exit with a 'success' code because we don't want Juju to retry From fac6c7ca68b93842da3fb74922a81258f484755c Mon Sep 17 00:00:00 2001 From: Tony Meyer Date: Mon, 31 Mar 2025 16:24:49 +1300 Subject: [PATCH 06/79] Expand to-do list. --- ops/_config.py | 6 +++++- 1 file changed, 5 insertions(+), 1 deletion(-) diff --git a/ops/_config.py b/ops/_config.py index f3ff0ae2e..796f9de96 100644 --- a/ops/_config.py +++ b/ops/_config.py @@ -304,4 +304,8 @@ def generate_yaml_schema(): if __name__ == '__main__': generate_yaml_schema() -# TODO: if __future__ annotations is not used. +# TODO: if __future__ annotations is not used, does everything continue to work? Maybe it's a +# requirement? +# TODO: if no config is found, have Scenario try to generate it. +# TODO: test_main check to verify that the _Abort works correctly, maybe also using a charm that +# generates the config? From f155bf5f58eeda043f9219b0de1a8526bf23c98a Mon Sep 17 00:00:00 2001 From: Tony Meyer Date: Thu, 24 Apr 2025 19:46:55 +1200 Subject: [PATCH 07/79] Adjustments after initial review. --- ops/__init__.py | 2 + ops/_config.py | 165 +++++++++----------------- ops/_main.py | 6 + ops/_private/attrdocs.py | 93 +++++++++++++++ ops/charm.py | 42 ++----- ops/model.py | 4 + test/test_config.py | 63 +++++----- test/test_model.py | 12 +- test/test_testing.py | 12 +- testing/tests/test_e2e/test_config.py | 4 +- 10 files changed, 220 insertions(+), 183 deletions(-) create mode 100644 ops/_private/attrdocs.py diff --git a/ops/__init__.py b/ops/__init__.py index 73317e5c6..95a50f9e0 100644 --- a/ops/__init__.py +++ b/ops/__init__.py @@ -147,6 +147,7 @@ 'Container', 'ContainerMapping', 'ErrorStatus', + 'InvalidSchemaError', 'InvalidStatusError', 'LazyCheckInfo', 'LazyMapping', @@ -298,6 +299,7 @@ Container, ContainerMapping, ErrorStatus, + InvalidSchemaError, InvalidStatusError, LazyCheckInfo, LazyMapping, diff --git a/ops/_config.py b/ops/_config.py index 796f9de96..ffdf9c2c6 100644 --- a/ops/_config.py +++ b/ops/_config.py @@ -16,50 +16,17 @@ from __future__ import annotations -import ast import importlib -import inspect import logging import pathlib -from typing import Any, ClassVar, Generator, cast +from typing import Any, ClassVar, Generator -from ._private import yaml +from ._private import attrdocs, yaml from .model import Secret logger = logging.getLogger(__name__) -# TODO: If we end up with this file, _action_params, and _relation_data, then we -# should factor out this class into a common helper module. -class _AttributeDocstringExtractor(ast.NodeVisitor): - def __init__(self): - self.attribute_docs: dict[str, str] = {} - self._last_attr = None - - def visit_ClassDef(self, node: ast.ClassDef): # noqa: N802 - # We iterate over the class definition, looking for attribute assignments. - # We also track any standalone strings, and when we find one we use it - # for the docstring of the most recent attribute assignments. - # This isn't perfect - but it should cover the majority of cases. - for child in node.body: - if isinstance(child, (ast.Assign, ast.AnnAssign)): - target = None # Make the type checker happy. - if isinstance(child, ast.Assign): - target = child.targets[0] - elif isinstance(child, ast.AnnAssign): - target = child.target - assert isinstance(target, ast.Name) - self._last_attr = target.id - elif ( - isinstance(child, ast.Expr) - and isinstance(child.value, ast.Constant) - and self._last_attr - ): - self.attribute_docs[self._last_attr] = child.value.value - self._last_attr = None - self.generic_visit(node) - - class ConfigBase: """Base class for strongly typed charm config. @@ -83,7 +50,7 @@ class MyConfig(ops.ConfigBase): This is a dataclass, but can be any object that inherits from ``ops.ConfigBase``, and can be initialised with the raw Juju config - pass as keyword arguments. Any errors should be indicated by raising + passed as keyword arguments. Any errors should be indicated by raising ``ValueError`` (or a ``ValueError`` subclass) in initialisation. Inheriting from ``ops.ConfigBase`` is not strictly necessary, but it @@ -93,7 +60,7 @@ class MyConfig(ops.ConfigBase): Use this in your charm class like so:: class MyCharm(ops.CharmBase): - def __init__(self, framework): + def __init__(self, framework: ops.Framework): super().__init__(framework) self.typed_config = self.load_config(MyConfig) @@ -102,7 +69,7 @@ def __init__(self, framework): exception raised. """ - JUJU_TYPES: ClassVar[dict[str, str]] = { + _JUJU_TYPES: ClassVar[dict[str, str]] = { 'bool': 'boolean', 'int': 'int', 'float': 'float', @@ -115,39 +82,8 @@ def __init__(self, framework): 'ops.model.Secret': 'secret', } - # TODO: This could also be factored out into a common helper. - @classmethod - def _get_attr_docstrings(cls) -> dict[str, str]: - docs: dict[str, str] = {} - # pydantic stores descriptions in the field object. - if hasattr(cls, '__dataclass_fields__'): - fields = cast(dict[str, Any], cls.__dataclass_fields__) # type: ignore - for attr, field in fields.items(): - if ( - hasattr(field, 'default') - and hasattr(field.default, 'description') - and field.default.description - ): - docs[attr] = field.default.description - - try: - source_code = inspect.getsource(cls) - except OSError: - logger.debug('No source code found for %s', cls.__name__) - else: - try: - tree = ast.parse(source_code) - except (SyntaxError, IndentationError): - logger.debug('Failed to parse source code for %s', cls.__name__) - else: - extractor = _AttributeDocstringExtractor() - extractor.visit(tree) - docs.update(extractor.attribute_docs) - - return docs - @staticmethod - def _extract_optional_type(attr: str, hint: str): + def __extract_optional_type(attr: str, hint: str): if 'Optional[' in hint: hint = hint.split('[')[1].split(']')[0] if '|' in hint: @@ -160,36 +96,45 @@ def _extract_optional_type(attr: str, hint: str): return hint @classmethod - def attr_to_yaml_type(cls, attr: str, default: Any = None) -> str: + def _attr_to_juju_type(cls, name: str, default: Any = None) -> str: """Provide the appropriate type for the config YAML for the given attribute. Raises: ValueError: if an appropriate type cannot be found. """ + # TODO: This can probably use dataclasses.fields(). types = cls.__annotations__ try: - hint = cls._extract_optional_type(attr, str(types[attr])) + hint = cls.__extract_optional_type(name, str(types[name])) except (KeyError, ValueError): # If there's a default value, use that object's type. - if default is not None and type(default).__name__ in cls.JUJU_TYPES: - return cls.JUJU_TYPES[type(default).__name__] - raise ValueError(f'{attr!r} type is unknown.') from None - if hint not in cls.JUJU_TYPES: - raise ValueError(f'{attr!r} type is unknown.') from None - return cls.JUJU_TYPES[hint] + if default is not None and type(default).__name__ in cls._JUJU_TYPES: + return cls._JUJU_TYPES[type(default).__name__] + raise ValueError(f'{name!r} type is unknown.') from None + if hint not in cls._JUJU_TYPES: + raise ValueError(f'{name!r} type is unknown.') from None + return cls._JUJU_TYPES[hint] @staticmethod - def attr_name_to_yaml_name(name: str): + def _attr_to_juju_name(attr: str): """Convert from the class attribute name to the name used in the schema. Python names are snake_case, but Juju config option names should be - kebab-case. Override if your config names do not match this pattern, for - example for backwards compatibility. + kebab-case. + """ + return attr.replace('_', '-') + + @staticmethod + def _juju_name_to_attr(attr: str): + """Convert from the schema name to the class attribute name. + + Python names are snake_case, but Juju config option names should be + kebab-case. """ - return name.replace('_', '-') + return attr.replace('-', '_') @classmethod - def option_names(cls) -> Generator[str, None, None]: + def _juju_names(cls) -> Generator[str, None, None]: """Iterates over all the option names to include in the config YAML. By default, this is ``dir(cls)``, any keys from ``cls.__annotations``, @@ -210,7 +155,7 @@ def option_names(cls) -> Generator[str, None, None]: yield attr @classmethod - def _yaml_schema_from_basemodel(cls) -> dict[str, Any]: + def __juju_schema_from_basemodel(cls) -> dict[str, Any]: options = {} for name, field in cls.model_fields.items(): # type: ignore option = {} @@ -220,22 +165,22 @@ def _yaml_schema_from_basemodel(cls) -> dict[str, Any]: hint = field.annotation.__name__ # type: ignore else: hint = str(field.annotation) # type: ignore - hint = cls._extract_optional_type(name, hint) # type: ignore - option['type'] = cls.JUJU_TYPES[hint] + hint = cls.__extract_optional_type(name, hint) # type: ignore + option['type'] = cls._JUJU_TYPES[hint] if field.description: # type: ignore option['description'] = field.description # type: ignore - options[cls.attr_name_to_yaml_name(name)] = option # type: ignore + options[cls._attr_to_juju_name(name)] = option # type: ignore return {'options': options} @classmethod - def to_yaml_schema(cls) -> dict[str, Any]: + def to_juju_schema(cls) -> dict[str, Any]: """Translate the class to YAML suitable for config.yaml. - Using :attr:`ConfigBase.to_yaml_schema` will generate a YAML schema + Using :attr:`ConfigBase.to_juju_schema` will generate a YAML schema suitable for use in ``config.yaml``. For example, with the class from the example above:: - print(yaml.safe_dump(MyConfig.to_yaml_schema())) + print(yaml.safe_dump(MyConfig.to_juju_schema())) Will output:: @@ -258,32 +203,37 @@ def to_yaml_schema(cls) -> dict[str, Any]: my-secret: type: secret description: A user secret. + + To customise, override this method in your subclass. For example:: + + @classmethod + def to_juju_schema(cls) -> dict[str, Any]: + schema = super().to_juju_schema() + # Change the key names to upper-case. + schema = {key.upper(): value for key, value in schema.items()} + return schema """ # Special-case pydantic BaseModel. if hasattr(cls, 'model_fields'): - return cls._yaml_schema_from_basemodel() + return cls.__juju_schema_from_basemodel() # Dataclasses, regular classes, etc. + attr_docstrings = attrdocs.get_attr_docstrings(cls) options: dict[str, dict[str, bool | int | float | str]] = {} - for attr in cls.option_names(): + for attr in cls._juju_names(): option = {} default = getattr(cls, attr, None) - if type(default).__name__ in cls.JUJU_TYPES: + if type(default).__name__ in cls._JUJU_TYPES: option['default'] = default - option['type'] = cls.attr_to_yaml_type(attr, default) - doc = cls._get_attr_docstrings().get(attr) + option['type'] = cls._attr_to_juju_type(attr, default) + doc = attr_docstrings.get(attr) if doc: option['description'] = doc - options[cls.attr_name_to_yaml_name(attr)] = option + options[cls._attr_to_juju_name(attr)] = option return {'options': options} - @classmethod - def to_starlark_validator(cls) -> str: - """Validation code, as a Starlark script.""" - raise NotImplementedError('To be added at a later point.') - -def generate_yaml_schema(): +def generate_juju_schema(): """Look for all ConfigBase subclasses and generate their YAML schema. .. caution:: @@ -302,10 +252,11 @@ def generate_yaml_schema(): if __name__ == '__main__': - generate_yaml_schema() + generate_juju_schema() + +# TODO: Verify that if future annotations is not used, everything still works +# as expected (or make this an explicit requirement). -# TODO: if __future__ annotations is not used, does everything continue to work? Maybe it's a -# requirement? # TODO: if no config is found, have Scenario try to generate it. -# TODO: test_main check to verify that the _Abort works correctly, maybe also using a charm that -# generates the config? + +# TODO: test_main check to verify that the clean exit works correctly. diff --git a/ops/_main.py b/ops/_main.py index e66af0938..6f572801f 100644 --- a/ops/_main.py +++ b/ops/_main.py @@ -563,5 +563,11 @@ def main(charm_class: Type[_charm.CharmBase], use_juju_for_storage: Optional[boo manager = _Manager(charm_class, use_juju_for_storage=use_juju_for_storage) manager.run() + except _model.InvalidSchemaError: + # We exit with a zero exit code because we don't want Juju to go into + # error status (for config and databags, we have set a status ourselves) + # and we don't want to automatically retry (the Juju user or another + # unit must correct the data to match the schema). + sys.exit() except _Abort as e: sys.exit(e.exit_code) diff --git a/ops/_private/attrdocs.py b/ops/_private/attrdocs.py new file mode 100644 index 000000000..c765342e7 --- /dev/null +++ b/ops/_private/attrdocs.py @@ -0,0 +1,93 @@ +# Copyright 2025 Canonical Ltd. +# +# Licensed under the Apache License, Version 2.0 (the "License"); +# you may not use this file except in compliance with the License. +# You may obtain a copy of the License at +# +# http://www.apache.org/licenses/LICENSE-2.0 +# +# Unless required by applicable law or agreed to in writing, software +# distributed under the License is distributed on an "AS IS" BASIS, +# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +# See the License for the specific language governing permissions and +# limitations under the License. + +"""Extract attribute docstrings from classes. + +This essentially provides __doc__ type support for class attributes. For example:: + + class Foo: + bar: str = "bar" + '''This is the docstring for bar.''' + +Would provide a docstring of "This is the docstring for bar." for the ``Foo.bar`` +attribute. +""" + +from __future__ import annotations + +import ast +import inspect +import logging +from typing import Any, cast + +logger = logging.getLogger(__name__) + + +class AttributeDocstringExtractor(ast.NodeVisitor): + def __init__(self): + self.attribute_docs: dict[str, str] = {} + self._last_attr = None + + def visit_ClassDef(self, node: ast.ClassDef): # noqa: N802 + # We iterate over the class definition, looking for attribute assignments. + # We also track any standalone strings, and when we find one we use it + # for the docstring of the most recent attribute assignments. + # This isn't perfect - but it should cover the majority of cases. + for child in node.body: + if isinstance(child, (ast.Assign, ast.AnnAssign)): + target = None # Make the type checker happy. + if isinstance(child, ast.Assign): + target = child.targets[0] + elif isinstance(child, ast.AnnAssign): + target = child.target + assert isinstance(target, ast.Name) + self._last_attr = target.id + elif ( + isinstance(child, ast.Expr) + and isinstance(child.value, ast.Constant) + and self._last_attr + ): + self.attribute_docs[self._last_attr] = child.value.value + self._last_attr = None + self.generic_visit(node) + + +def get_attr_docstrings(cls: type[object]) -> dict[str, str]: + docs: dict[str, str] = {} + # pydantic stores descriptions in the field object. + if hasattr(cls, '__dataclass_fields__'): + fields = cast(dict[str, Any], cls.__dataclass_fields__) # type: ignore + for attr, field in fields.items(): + if ( + hasattr(field, 'default') + and hasattr(field.default, 'description') + and field.default.description + ): + docs[attr] = field.default.description + + try: + source_code = inspect.getsource(cls) + except OSError: + logger.debug('No source code found for %s', cls.__name__) + else: + try: + tree = ast.parse(source_code) + except (SyntaxError, IndentationError): + logger.debug('Failed to parse source code for %s', cls.__name__) + else: + extractor = AttributeDocstringExtractor() + extractor.visit(tree) + docs.update(extractor.attribute_docs) + + return docs diff --git a/ops/charm.py b/ops/charm.py index a707ad96d..510f10838 100644 --- a/ops/charm.py +++ b/ops/charm.py @@ -22,7 +22,6 @@ from typing import ( TYPE_CHECKING, Any, - Callable, ClassVar, Dict, List, @@ -1411,7 +1410,6 @@ def load_config( self, cls: Type[_ConfigType], *args: Any, - convert_name: Optional[Callable[[str], str]] = None, **kwargs: Any, ) -> _ConfigType: """Load the config into an instance of a config class. @@ -1421,17 +1419,13 @@ def load_config( * ``secret`` type options having a :class:`model.Secret` value rather than the secret ID. - * dashes in names converted to underscores, unless a custom conversion - function is provided. + * dashes in names converted to underscores. Any additional positional or keyword arguments will be passed through to the config class. Args: cls: A class that inherits from :class:`ops.ConfigBase`. - convert_name: An optional function that takes a string option name - as found in the YAML config, and returns the name of the - attribute, which must be a valid Python identifier. args: positional arguments to pass through to the config class. kwargs: keyword arguments to pass through to the config class. @@ -1439,43 +1433,33 @@ def load_config( An instance of the config class with the current config values. Raises: - _Abort if the configuration is invalid, after setting an appropriate - blocked status. + :class`InvalidSchemaError` if the configuration is invalid, after + setting an appropriate blocked status. """ - from ._main import _Abort # Avoid circular import. - # We exit with a 'success' code because we don't want Juju to retry - # the hook - we need the Juju user to fix the config first, at - # which point the error will no longer be raised. - # Convert secret IDs to secret objects. config: Dict[str, Union[bool, int, float, str, model.Secret]] = kwargs.copy() for key, value in self.config.items(): - if convert_name: - attr = convert_name(key) - if not attr.isidentifier(): - logger.error('Invalid attribute name %r from %s', attr, key) - self.unit.status = model.BlockedStatus(f'Invalid attribute name {attr}') - raise _Abort(0) - else: - attr = key.replace('-', '_') + attr = cls._juju_name_to_attr(key) # type: ignore + assert isinstance(attr, str) + if not attr.isidentifier(): + self.unit.status = model.BlockedStatus(f'Invalid attribute name {attr}') + raise model.InvalidSchemaError() from None option_type = self.meta.config.get(key) if option_type and option_type.type == 'secret' and isinstance(value, str): try: config[attr] = self.model.get_secret(id=value) except model.SecretNotFoundError: - logger.error('secret referenced in option {key} not found') self.unit.status = model.BlockedStatus( f"{key} option refers to a secret that doesn't exist or is not accessible" ) - raise _Abort(0) from None + raise model.InvalidSchemaError() from None else: config[attr] = value try: return cls(*args, **config) except ValueError as e: - logger.error('Invalid configuration for %s: %r (%s)', cls.__name__, config, e) self.unit.status = model.BlockedStatus(f'Error in config: {e}') - raise _Abort(0) from None + raise model.InvalidSchemaError() from None def _evaluate_status(charm: CharmBase): # pyright: ignore[reportUnusedFunction] @@ -1828,9 +1812,9 @@ class RelationMeta: VALID_SCOPES: ClassVar[List[str]] = ['global', 'container'] def __init__(self, role: RelationRole, relation_name: str, raw: '_RelationMetaDict'): - assert isinstance(role, RelationRole), ( - f'role should be one of {list(RelationRole)!r}, not {role!r}' - ) + assert isinstance( + role, RelationRole + ), f'role should be one of {list(RelationRole)!r}, not {role!r}' self._default_scope = self.VALID_SCOPES[0] self.role = role self.relation_name = relation_name diff --git a/ops/model.py b/ops/model.py index 70ff96a23..d734a9dea 100644 --- a/ops/model.py +++ b/ops/model.py @@ -115,6 +115,10 @@ MAX_LOG_LINE_LEN = 131071 # Max length of strings to pass to subshell. +class InvalidSchemaError(Exception): + """Raised when a config, action parameter, or databag schema does not match the data.""" + + class Model: """Represents the Juju Model as seen from this unit. diff --git a/test/test_config.py b/test/test_config.py index 1a75ed24d..5aeb670b1 100644 --- a/test/test_config.py +++ b/test/test_config.py @@ -219,7 +219,7 @@ def __init__(self, framework: ops.Framework): def test_config_init(charm_class: type[ops.CharmBase], request: pytest.FixtureRequest): # We use the generated schema from the simple class for all variants, # because we expect it to be the same. - config = MyConfig.to_yaml_schema() + config = MyConfig.to_juju_schema() harness = testing.Harness(charm_class, config=ops._private.yaml.safe_dump(config)) request.addfinalizer(harness.cleanup) harness.begin() @@ -237,7 +237,7 @@ def test_config_init(charm_class: type[ops.CharmBase], request: pytest.FixtureRe @pytest.mark.parametrize('charm_class', _test_classes) def test_config_init_non_default(charm_class: type[ops.CharmBase], request: pytest.FixtureRequest): - config = MyConfig.to_yaml_schema() + config = MyConfig.to_juju_schema() harness = testing.Harness(charm_class, config=ops._private.yaml.safe_dump(config)) request.addfinalizer(harness.cleanup) harness.update_config({ @@ -258,21 +258,20 @@ def test_config_init_non_default(charm_class: type[ops.CharmBase], request: pyte @pytest.mark.parametrize('charm_class', _test_classes) def test_config_with_error(charm_class: type[ops.CharmBase], request: pytest.FixtureRequest): - config = MyConfig.to_yaml_schema() + config = MyConfig.to_juju_schema() harness = testing.Harness(charm_class, config=ops._private.yaml.safe_dump(config)) request.addfinalizer(harness.cleanup) harness.update_config({ 'my-int': -1, }) - with pytest.raises(ops._main._Abort) as cm: + with pytest.raises(ops.InvalidSchemaError): harness.begin() - assert cm.value.exit_code == 0 # TODO: add a test_main check that makes sure that the status is set correctly. @pytest.mark.parametrize('charm_class', _test_classes) def test_config_with_secret(charm_class: type[ops.CharmBase], request: pytest.FixtureRequest): - config = MyConfig.to_yaml_schema() + config = MyConfig.to_juju_schema() harness = testing.Harness(charm_class, config=ops._private.yaml.safe_dump(config)) request.addfinalizer(harness.cleanup) content = {'password': 'admin'} @@ -294,7 +293,7 @@ def test_config_with_secret(charm_class: type[ops.CharmBase], request: pytest.Fi def test_config_invalid_secret_id( charm_class: type[ops.CharmBase], request: pytest.FixtureRequest ): - config = MyConfig.to_yaml_schema() + config = MyConfig.to_juju_schema() harness = testing.Harness(charm_class, config=ops._private.yaml.safe_dump(config)) request.addfinalizer(harness.cleanup) content = {'password': 'admin'} @@ -303,15 +302,14 @@ def test_config_invalid_secret_id( harness.update_config({ 'my-secret': 'not a secret id', }) - with pytest.raises(ops._main._Abort) as cm: + with pytest.raises(ops.InvalidSchemaError): harness.begin() - assert cm.value.exit_code == 0 # TODO: add a test_main check that makes sure that the status is set correctly. @pytest.mark.parametrize('charm_class', _test_classes) def test_config_missing_secret(charm_class: type[ops.CharmBase], request: pytest.FixtureRequest): - config = MyConfig.to_yaml_schema() + config = MyConfig.to_juju_schema() harness = testing.Harness(charm_class, config=ops._private.yaml.safe_dump(config)) request.addfinalizer(harness.cleanup) content = {'password': 'admin'} @@ -319,9 +317,8 @@ def test_config_missing_secret(charm_class: type[ops.CharmBase], request: pytest harness.update_config({ 'my-secret': secret_id, }) - with pytest.raises(ops._main._Abort) as cm: + with pytest.raises(ops.InvalidSchemaError): harness.begin() - assert cm.value.exit_code == 0 # TODO: add a test_main check that makes sure that the status is set correctly. @@ -332,23 +329,23 @@ class Config(ops.ConfigBase): other: str = 'baz' @staticmethod - def attr_name_to_yaml_name(name: str): + def _attr_to_juju_name(name: str): if name == 'foo_bar': return 'fooBar' return name.replace('_', '-') - class Charm(ops.CharmBase): - def __init__(self, framework: ops.Framework): - super().__init__(framework) - self.typed_config = self.load_config(Config, convert_name=self.yaml_name_to_attr_name) - @staticmethod - def yaml_name_to_attr_name(name: str): + def _juju_name_to_attr(name: str): if name == 'fooBar': return 'foo_bar' return name.replace('-', '_') - config = Config.to_yaml_schema() + class Charm(ops.CharmBase): + def __init__(self, framework: ops.Framework): + super().__init__(framework) + self.typed_config = self.load_config(Config) + + config = Config.to_juju_schema() assert 'fooBar' in config['options'] harness = testing.Harness(Charm, config=ops._private.yaml.safe_dump(config)) request.addfinalizer(harness.cleanup) @@ -363,26 +360,26 @@ def test_config_bad_attr_naming_pattern(request: pytest.FixtureRequest): class BadConfig(ops.ConfigBase): foo_bar: int = 42 + @staticmethod + def _juju_name_to_attr(attr: str): + return attr.replace('_', '-') + class BadCharm(ops.CharmBase): def __init__(self, framework: ops.Framework): super().__init__(framework) - self.typed_config = self.load_config( - BadConfig, convert_name=lambda x: x.replace('_', '-') - ) + self.typed_config = self.load_config(BadConfig) - config = BadConfig.to_yaml_schema() + config = BadConfig.to_juju_schema() assert 'foo-bar' in config['options'] harness = testing.Harness(BadCharm, config=ops._private.yaml.safe_dump(config)) request.addfinalizer(harness.cleanup) - with pytest.raises(ops._main._Abort) as cm: + with pytest.raises(ops.InvalidSchemaError): harness.begin() - assert cm.value.exit_code == 0 - # TODO: add a test_main check that makes sure that the status is set correctly. @pytest.mark.parametrize('config_class', _test_config_classes) def test_config_yaml_schema(config_class: type[ops.ConfigBase]): - generated_yaml = config_class.to_yaml_schema() + generated_yaml = config_class.to_juju_schema() expected_yaml = { 'options': { 'my-bool': { @@ -421,7 +418,7 @@ class Config(ops.ConfigBase): c: str @classmethod - def option_names(cls): + def _juju_names(cls): yield 'b' class Charm(ops.CharmBase): @@ -429,7 +426,7 @@ def __init__(self, framework: ops.Framework): super().__init__(framework) self.typed_config = self.load_config(Config, 10, c='foo') - schema = Config.to_yaml_schema() + schema = Config.to_juju_schema() options = ops._private.yaml.safe_dump(schema) harness = testing.Harness(Charm, config=options) request.addfinalizer(harness.cleanup) @@ -452,17 +449,17 @@ def __init__(self, x: int, y: str): self.y = datetime.date(int(year), int(month), int(day)) @classmethod - def attr_to_yaml_type(cls, attr: str, default: Any = None) -> str: + def _attr_to_juju_type(cls, attr: str, default: Any = None) -> str: if attr == 'y': return 'string' - return super().attr_to_yaml_type(attr, default) + return super()._attr_to_juju_type(attr, default) class Charm(ops.CharmBase): def __init__(self, framework: ops.Framework): super().__init__(framework) self.typed_config = self.load_config(Config) - schema = Config.to_yaml_schema() + schema = Config.to_juju_schema() options = ops._private.yaml.safe_dump(schema) harness = testing.Harness(Charm, config=options) request.addfinalizer(harness.cleanup) diff --git a/test/test_model.py b/test/test_model.py index 222f452e0..ac2a979b1 100644 --- a/test/test_model.py +++ b/test/test_model.py @@ -1450,9 +1450,9 @@ def test_recursive_push_and_pull(case: PushPullCase): raise errors = {src[len(push_src.name) :] for src, _ in err.errors} - assert case.errors == errors, ( - f'push_path gave wrong expected errors: want {case.errors}, got {errors}' - ) + assert ( + case.errors == errors + ), f'push_path gave wrong expected errors: want {case.errors}, got {errors}' for fpath in case.want: assert c.exists(fpath), f'push_path failed: file {fpath} missing at destination' content = c.pull(fpath, encoding=None).read() @@ -1477,9 +1477,9 @@ def test_recursive_push_and_pull(case: PushPullCase): raise errors = {src for src, _ in err.errors} - assert case.errors == errors, ( - f'pull_path gave wrong expected errors: want {case.errors}, got {errors}' - ) + assert ( + case.errors == errors + ), f'pull_path gave wrong expected errors: want {case.errors}, got {errors}' for fpath in case.want: assert c.exists(fpath), f'pull_path failed: file {fpath} missing at destination' for fdir in case.want_dirs: diff --git a/test/test_testing.py b/test/test_testing.py index 207e07855..c97571894 100644 --- a/test/test_testing.py +++ b/test/test_testing.py @@ -1726,9 +1726,9 @@ def test_add_storage_not_attached_default(self, request: pytest.FixtureRequest): harness.add_storage('test') harness.begin() - assert len(harness.model.storages['test']) == 0, ( - 'storage should start in detached state and be excluded from storage listing' - ) + assert ( + len(harness.model.storages['test']) == 0 + ), 'storage should start in detached state and be excluded from storage listing' def test_add_storage_without_metadata_key_fails(self, request: pytest.FixtureRequest): harness = ops.testing.Harness( @@ -3809,9 +3809,9 @@ def test_lazy_resource_directory(self, request: pytest.FixtureRequest): assert backend._resource_dir is None path = backend.resource_get('image') assert backend._resource_dir is not None - assert str(path).startswith(str(backend._resource_dir.name)), ( - f'expected {path} to be a subdirectory of {backend._resource_dir.name}' - ) + assert str(path).startswith( + str(backend._resource_dir.name) + ), f'expected {path} to be a subdirectory of {backend._resource_dir.name}' def test_resource_get_no_resource(self, request: pytest.FixtureRequest): harness = ops.testing.Harness( diff --git a/testing/tests/test_e2e/test_config.py b/testing/tests/test_e2e/test_config.py index ea937217e..6535bcc08 100644 --- a/testing/tests/test_e2e/test_config.py +++ b/testing/tests/test_e2e/test_config.py @@ -111,7 +111,7 @@ class Config(ops.ConfigBase): c: str @classmethod - def option_names(cls): + def _option_names(cls): yield "b" class Charm(ops.CharmBase): @@ -122,7 +122,7 @@ def __init__(self, framework: ops.Framework): def _on_config_changed(self, event: ops.ConfigChangedEvent): self.typed_config = self.load_config(Config, 10, c="foo") - schema = Config.to_yaml_schema() + schema = Config.to_juju_schema() ctx = Context(Charm, meta={"name": "foo"}, config=schema) with ctx(ctx.on.config_changed(), State(config={"b": 3.14})) as mgr: mgr.run() From ea10a4dd25b354be7be033cada8d90d423ee94c2 Mon Sep 17 00:00:00 2001 From: Tony Meyer Date: Thu, 24 Apr 2025 19:47:36 +1200 Subject: [PATCH 08/79] Provide pydantic for static checks. --- tox.ini | 1 + 1 file changed, 1 insertion(+) diff --git a/tox.ini b/tox.ini index c82a24c8f..cca549a31 100644 --- a/tox.ini +++ b/tox.ini @@ -86,6 +86,7 @@ deps = pyright==1.1.385 pytest~=7.2 typing_extensions~=4.2 + pydantic~=2.10 -e . -e testing commands = From bd2a2df489150cfac50084aa1369a3bbd31e391c Mon Sep 17 00:00:00 2001 From: Tony Meyer Date: Thu, 24 Apr 2025 19:47:59 +1200 Subject: [PATCH 09/79] Changes from initial review. --- ops/charm.py | 6 +++--- test/test_model.py | 12 ++++++------ test/test_testing.py | 12 ++++++------ 3 files changed, 15 insertions(+), 15 deletions(-) diff --git a/ops/charm.py b/ops/charm.py index 510f10838..c5e7c5f57 100644 --- a/ops/charm.py +++ b/ops/charm.py @@ -1812,9 +1812,9 @@ class RelationMeta: VALID_SCOPES: ClassVar[List[str]] = ['global', 'container'] def __init__(self, role: RelationRole, relation_name: str, raw: '_RelationMetaDict'): - assert isinstance( - role, RelationRole - ), f'role should be one of {list(RelationRole)!r}, not {role!r}' + assert isinstance(role, RelationRole), ( + f'role should be one of {list(RelationRole)!r}, not {role!r}' + ) self._default_scope = self.VALID_SCOPES[0] self.role = role self.relation_name = relation_name diff --git a/test/test_model.py b/test/test_model.py index ac2a979b1..222f452e0 100644 --- a/test/test_model.py +++ b/test/test_model.py @@ -1450,9 +1450,9 @@ def test_recursive_push_and_pull(case: PushPullCase): raise errors = {src[len(push_src.name) :] for src, _ in err.errors} - assert ( - case.errors == errors - ), f'push_path gave wrong expected errors: want {case.errors}, got {errors}' + assert case.errors == errors, ( + f'push_path gave wrong expected errors: want {case.errors}, got {errors}' + ) for fpath in case.want: assert c.exists(fpath), f'push_path failed: file {fpath} missing at destination' content = c.pull(fpath, encoding=None).read() @@ -1477,9 +1477,9 @@ def test_recursive_push_and_pull(case: PushPullCase): raise errors = {src for src, _ in err.errors} - assert ( - case.errors == errors - ), f'pull_path gave wrong expected errors: want {case.errors}, got {errors}' + assert case.errors == errors, ( + f'pull_path gave wrong expected errors: want {case.errors}, got {errors}' + ) for fpath in case.want: assert c.exists(fpath), f'pull_path failed: file {fpath} missing at destination' for fdir in case.want_dirs: diff --git a/test/test_testing.py b/test/test_testing.py index c97571894..207e07855 100644 --- a/test/test_testing.py +++ b/test/test_testing.py @@ -1726,9 +1726,9 @@ def test_add_storage_not_attached_default(self, request: pytest.FixtureRequest): harness.add_storage('test') harness.begin() - assert ( - len(harness.model.storages['test']) == 0 - ), 'storage should start in detached state and be excluded from storage listing' + assert len(harness.model.storages['test']) == 0, ( + 'storage should start in detached state and be excluded from storage listing' + ) def test_add_storage_without_metadata_key_fails(self, request: pytest.FixtureRequest): harness = ops.testing.Harness( @@ -3809,9 +3809,9 @@ def test_lazy_resource_directory(self, request: pytest.FixtureRequest): assert backend._resource_dir is None path = backend.resource_get('image') assert backend._resource_dir is not None - assert str(path).startswith( - str(backend._resource_dir.name) - ), f'expected {path} to be a subdirectory of {backend._resource_dir.name}' + assert str(path).startswith(str(backend._resource_dir.name)), ( + f'expected {path} to be a subdirectory of {backend._resource_dir.name}' + ) def test_resource_get_no_resource(self, request: pytest.FixtureRequest): harness = ops.testing.Harness( From 35b643a20e89f4215818ec09395e912cb8f4f078 Mon Sep 17 00:00:00 2001 From: Tony Meyer Date: Thu, 24 Apr 2025 19:55:32 +1200 Subject: [PATCH 10/79] Tweaks after merge. --- testing/src/scenario/mocking.py | 10 +++++----- 1 file changed, 5 insertions(+), 5 deletions(-) diff --git a/testing/src/scenario/mocking.py b/testing/src/scenario/mocking.py index b8639c7ef..8328a81a6 100644 --- a/testing/src/scenario/mocking.py +++ b/testing/src/scenario/mocking.py @@ -125,7 +125,7 @@ def wait_output(self): ) return stdout, stderr - def send_signal(self, sig: Union[int, str]) -> NoReturn: # noqa: U100 + def send_signal(self, sig: Union[int, str]) -> NoReturn: """Send the given signal to the (mock) process.""" raise NotImplementedError() @@ -699,8 +699,8 @@ def planned_units(self) -> int: # legacy ops API that we don't intend to mock: def pod_spec_set( self, - spec: Mapping[str, Any], # noqa: U100 - k8s_resources: Optional[Mapping[str, Any]] = None, # noqa: U100 + spec: Mapping[str, Any], + k8s_resources: Optional[Mapping[str, Any]] = None, ) -> NoReturn: raise NotImplementedError( 'pod-spec-set is not implemented in Scenario (and probably never will be: ' @@ -709,8 +709,8 @@ def pod_spec_set( def add_metrics( self, - metrics: Mapping[str, Union[int, float]], # noqa: U100 - labels: Optional[Mapping[str, str]] = None, # noqa: U100 + metrics: Mapping[str, Union[int, float]], + labels: Optional[Mapping[str, str]] = None, ) -> NoReturn: raise NotImplementedError( 'add-metrics is not implemented in Scenario (and probably never will be: ' From 441c68ac27213f5dd10473e1ff27d10aa4d4267e Mon Sep 17 00:00:00 2001 From: Tony Meyer Date: Thu, 24 Apr 2025 19:56:00 +1200 Subject: [PATCH 11/79] Add TODO. --- ops/_config.py | 1 + 1 file changed, 1 insertion(+) diff --git a/ops/_config.py b/ops/_config.py index ffdf9c2c6..94f0b9c57 100644 --- a/ops/_config.py +++ b/ops/_config.py @@ -144,6 +144,7 @@ def _juju_names(cls) -> Generator[str, None, None]: """ attrs = dir(cls) attrs.extend(cls.__annotations__) + # TODO: this can probably use dataclasses.fields(). if hasattr(cls, '__dataclass_fields__'): attrs.extend(cls.__dataclass_fields__) # type: ignore for attr in set(attrs): From 09660280eeb269701c3e43c33856f9b568489aff Mon Sep 17 00:00:00 2001 From: Tony Meyer Date: Mon, 28 Apr 2025 14:26:18 +1200 Subject: [PATCH 12/79] Remove ignore used during dev. --- .gitignore | 1 - 1 file changed, 1 deletion(-) diff --git a/.gitignore b/.gitignore index b5c2e46e3..d3d5267b9 100644 --- a/.gitignore +++ b/.gitignore @@ -11,7 +11,6 @@ coverage.xml .coverage.data /.tox .*.swp -/src # Tokens and settings for `act` to run GHA locally .env From 29875b128ea0114f4d953d0e4f61d2d7ac995fcd Mon Sep 17 00:00:00 2001 From: Tony Meyer Date: Tue, 29 Apr 2025 13:25:25 +1200 Subject: [PATCH 13/79] Add TODO note. --- ops/_config.py | 4 ++++ 1 file changed, 4 insertions(+) diff --git a/ops/_config.py b/ops/_config.py index 94f0b9c57..79578eb00 100644 --- a/ops/_config.py +++ b/ops/_config.py @@ -95,6 +95,10 @@ def __extract_optional_type(attr: str, hint: str): hint = parts[0] return hint + # TODO: now that we're not really exposing these methods, maybe they should + # not raise? We could fall back to string maybe? We want someone to be able + # to subclass and use to_juju_schema with super and then change things. + @classmethod def _attr_to_juju_type(cls, name: str, default: Any = None) -> str: """Provide the appropriate type for the config YAML for the given attribute. From f13ed9dd5d6214cb6d5f52758fc578050292a3f7 Mon Sep 17 00:00:00 2001 From: Tony Meyer Date: Wed, 30 Apr 2025 12:47:55 +1200 Subject: [PATCH 14/79] Do the status set right at the end, so that it only happens if charms don't catch the error themselves. --- ops/_main.py | 16 +++++++++------- ops/charm.py | 21 +++++++++++---------- ops/model.py | 12 ++++++++---- 3 files changed, 28 insertions(+), 21 deletions(-) diff --git a/ops/_main.py b/ops/_main.py index f637be829..166926463 100644 --- a/ops/_main.py +++ b/ops/_main.py @@ -456,6 +456,15 @@ def run(self): self._emit() self._commit() self._close() + except _model.InvalidSchemaError as e: + # Optionally set a status message on the unit. + if e.status: + self._model_backend.status_set('blocked', e.status) + # We exit with a zero exit code because we don't want Juju to go into + # error status (for config and databags, we have set a status ourselves) + # and we don't want to automatically retry (the Juju user or another + # unit must correct the data to match the schema). + raise _Abort(0) from e finally: self.framework.close() @@ -468,14 +477,7 @@ def main(charm_class: Type[_charm.CharmBase], use_juju_for_storage: Optional[boo manager = None try: manager = _Manager(charm_class, use_juju_for_storage=use_juju_for_storage) - manager.run() - except _model.InvalidSchemaError: - # We exit with a zero exit code because we don't want Juju to go into - # error status (for config and databags, we have set a status ourselves) - # and we don't want to automatically retry (the Juju user or another - # unit must correct the data to match the schema). - sys.exit() except _Abort as e: sys.exit(e.exit_code) finally: diff --git a/ops/charm.py b/ops/charm.py index 34abe342f..089df1869 100644 --- a/ops/charm.py +++ b/ops/charm.py @@ -1449,8 +1449,9 @@ def load_config( An instance of the config class with the current config values. Raises: - :class`InvalidSchemaError` if the configuration is invalid, after - setting an appropriate blocked status. + :class`InvalidSchemaError` if the configuration is invalid. If the + exception is not caught by the charm code, the hook will exit with a + zero exit code, after setting an appropriate blocked status. """ # Convert secret IDs to secret objects. config: Dict[str, Union[bool, int, float, str, model.Secret]] = kwargs.copy() @@ -1458,24 +1459,24 @@ def load_config( attr = cls._juju_name_to_attr(key) # type: ignore assert isinstance(attr, str) if not attr.isidentifier(): - self.unit.status = model.BlockedStatus(f'Invalid attribute name {attr}') - raise model.InvalidSchemaError() from None + raise model.InvalidSchemaError(status=f'Invalid attribute name {attr}') from None option_type = self.meta.config.get(key) if option_type and option_type.type == 'secret' and isinstance(value, str): try: config[attr] = self.model.get_secret(id=value) except model.SecretNotFoundError: - self.unit.status = model.BlockedStatus( - f"{key} option refers to a secret that doesn't exist or is not accessible" - ) - raise model.InvalidSchemaError() from None + raise model.InvalidSchemaError( + status=( + f"{key} option refers to a secret that doesn't exist " + f'or is not accessible' + ) + ) from None else: config[attr] = value try: return cls(*args, **config) except ValueError as e: - self.unit.status = model.BlockedStatus(f'Error in config: {e}') - raise model.InvalidSchemaError() from None + raise model.InvalidSchemaError(status=f'Error in config: {e}') from None def _evaluate_status(charm: CharmBase): # pyright: ignore[reportUnusedFunction] diff --git a/ops/model.py b/ops/model.py index 93348c2f3..fc1062be2 100644 --- a/ops/model.py +++ b/ops/model.py @@ -117,10 +117,6 @@ MAX_LOG_LINE_LEN = 131071 # Max length of strings to pass to subshell. -class InvalidSchemaError(Exception): - """Raised when a config, action parameter, or databag schema does not match the data.""" - - class Model: """Represents the Juju Model as seen from this unit. @@ -3277,6 +3273,14 @@ class SecretNotFoundError(ModelError): """Raised when the specified secret does not exist.""" +class InvalidSchemaError(Exception): + """Raised when a config, action parameter, or databag schema does not match the data.""" + + def __init__(self, message: str, status: str | None = None): + super().__init__(message) + self.status = status + + _ACTION_RESULT_KEY_REGEX = re.compile(r'^[a-z0-9](([a-z0-9-.]+)?[a-z0-9])?$') From 4320d97dcab4e53ff12efeee65701c11a7c78dae Mon Sep 17 00:00:00 2001 From: Tony Meyer Date: Wed, 30 Apr 2025 12:49:24 +1200 Subject: [PATCH 15/79] Tweak comment. --- ops/_main.py | 6 +++--- 1 file changed, 3 insertions(+), 3 deletions(-) diff --git a/ops/_main.py b/ops/_main.py index 166926463..c0d8bd72c 100644 --- a/ops/_main.py +++ b/ops/_main.py @@ -461,9 +461,9 @@ def run(self): if e.status: self._model_backend.status_set('blocked', e.status) # We exit with a zero exit code because we don't want Juju to go into - # error status (for config and databags, we have set a status ourselves) - # and we don't want to automatically retry (the Juju user or another - # unit must correct the data to match the schema). + # error status (for config we have set a status ourselves) and we + # don't want to automatically retry (the Juju user must correct the + # data to match the schema). raise _Abort(0) from e finally: self.framework.close() From 84ba89983e5dce6589a3673186198f3fca46523d Mon Sep 17 00:00:00 2001 From: Tony Meyer Date: Wed, 30 Apr 2025 13:11:50 +1200 Subject: [PATCH 16/79] Use cleaner methods to get the set of fields. --- ops/_config.py | 31 +++++++++++++++---------------- ops/model.py | 2 +- 2 files changed, 16 insertions(+), 17 deletions(-) diff --git a/ops/_config.py b/ops/_config.py index 79578eb00..9ac3908a2 100644 --- a/ops/_config.py +++ b/ops/_config.py @@ -16,10 +16,11 @@ from __future__ import annotations +import dataclasses import importlib import logging import pathlib -from typing import Any, ClassVar, Generator +from typing import Any, ClassVar, Generator, get_origin from ._private import attrdocs, yaml from .model import Secret @@ -138,25 +139,23 @@ def _juju_name_to_attr(attr: str): return attr.replace('-', '_') @classmethod - def _juju_names(cls) -> Generator[str, None, None]: - """Iterates over all the option names to include in the config YAML. - - By default, this is ``dir(cls)``, any keys from ``cls.__annotations``, - and any keys from ``cls.__dataclass_fields__``, excluding any callables - and any names that start with an underscore, and the ``JUJU_TYPES`` - name. - """ + def _juju_names(cls) -> Generator[str]: + """Iterates over all the option names to include in the config YAML.""" + try: + yield from (field.name for field in dataclasses.fields(cls)) # type: ignore + except TypeError: + pass + else: + return + if hasattr(cls, 'model_fields'): + yield from iter(cls.model_fields) # type: ignore + return + # Fall back to using dir() and __annotations__. attrs = dir(cls) - attrs.extend(cls.__annotations__) - # TODO: this can probably use dataclasses.fields(). - if hasattr(cls, '__dataclass_fields__'): - attrs.extend(cls.__dataclass_fields__) # type: ignore + attrs.extend((a for a, t in cls.__annotations__.items() if get_origin(t) is not ClassVar)) for attr in set(attrs): if attr.startswith('_') or (hasattr(cls, attr) and callable(getattr(cls, attr))): continue - # Perhaps we should ignore anything that's typing.ClassVar? - if attr == 'JUJU_TYPES': - continue yield attr @classmethod diff --git a/ops/model.py b/ops/model.py index fc1062be2..5854724f2 100644 --- a/ops/model.py +++ b/ops/model.py @@ -3276,7 +3276,7 @@ class SecretNotFoundError(ModelError): class InvalidSchemaError(Exception): """Raised when a config, action parameter, or databag schema does not match the data.""" - def __init__(self, message: str, status: str | None = None): + def __init__(self, message: str = '', status: str | None = None): super().__init__(message) self.status = status From b13c742c52ae161835c47dfaca26a0194fe6eb40 Mon Sep 17 00:00:00 2001 From: Tony Meyer Date: Wed, 30 Apr 2025 13:13:58 +1200 Subject: [PATCH 17/79] Only pass the config that the class defines. This makes it easier to break the config into multiple classes. --- ops/charm.py | 9 ++++++--- 1 file changed, 6 insertions(+), 3 deletions(-) diff --git a/ops/charm.py b/ops/charm.py index 089df1869..6c9c5e0aa 100644 --- a/ops/charm.py +++ b/ops/charm.py @@ -1430,8 +1430,8 @@ def load_config( ) -> _ConfigType: """Load the config into an instance of a config class. - The object will be instantiated with keyword arguments of all the raw - Juju config, but with: + The object will be instantiated with keyword arguments of the raw Juju + config for all the options that are found in the class, but with: * ``secret`` type options having a :class:`model.Secret` value rather than the secret ID. @@ -1453,14 +1453,17 @@ def load_config( exception is not caught by the charm code, the hook will exit with a zero exit code, after setting an appropriate blocked status. """ - # Convert secret IDs to secret objects. config: Dict[str, Union[bool, int, float, str, model.Secret]] = kwargs.copy() + fields = set(cls._juju_names) # type: ignore for key, value in self.config.items(): + if key not in fields: + continue attr = cls._juju_name_to_attr(key) # type: ignore assert isinstance(attr, str) if not attr.isidentifier(): raise model.InvalidSchemaError(status=f'Invalid attribute name {attr}') from None option_type = self.meta.config.get(key) + # Convert secret IDs to secret objects. if option_type and option_type.type == 'secret' and isinstance(value, str): try: config[attr] = self.model.get_secret(id=value) From 30573f9bf9b2ee7f00630b29c18bf9feb80112ca Mon Sep 17 00:00:00 2001 From: Tony Meyer Date: Wed, 30 Apr 2025 14:05:29 +1200 Subject: [PATCH 18/79] Provide lazy Secrets in the config - this means you get errors later if the secret isn't available, but avoids Juju calls when loading config. --- ops/charm.py | 26 ++++++++++++++------------ 1 file changed, 14 insertions(+), 12 deletions(-) diff --git a/ops/charm.py b/ops/charm.py index 6c9c5e0aa..7ac2d1b12 100644 --- a/ops/charm.py +++ b/ops/charm.py @@ -1434,7 +1434,10 @@ def load_config( config for all the options that are found in the class, but with: * ``secret`` type options having a :class:`model.Secret` value rather - than the secret ID. + than the secret ID. Note that the secret object is not validated by + Juju at this time, so may raise :class:`SecretNotFoundError` when it + is later used if the secret does not exist or the unit does not have + permission to access it. * dashes in names converted to underscores. Any additional positional or keyword arguments will be passed through to @@ -1454,7 +1457,7 @@ def load_config( zero exit code, after setting an appropriate blocked status. """ config: Dict[str, Union[bool, int, float, str, model.Secret]] = kwargs.copy() - fields = set(cls._juju_names) # type: ignore + fields = set(cls._juju_names()) # type: ignore for key, value in self.config.items(): if key not in fields: continue @@ -1463,17 +1466,16 @@ def load_config( if not attr.isidentifier(): raise model.InvalidSchemaError(status=f'Invalid attribute name {attr}') from None option_type = self.meta.config.get(key) - # Convert secret IDs to secret objects. + # Convert secret IDs to secret objects. We create the object rather + # that using model.get_secret so that it's entirely lazy, in the + # same way that SecretEvent.secret is. if option_type and option_type.type == 'secret' and isinstance(value, str): - try: - config[attr] = self.model.get_secret(id=value) - except model.SecretNotFoundError: - raise model.InvalidSchemaError( - status=( - f"{key} option refers to a secret that doesn't exist " - f'or is not accessible' - ) - ) from None + secret = model.Secret( + backend=self.model._backend, + id=value, + _secret_set_cache=self.model._cache._secret_set_cache, + ) + config[attr] = secret else: config[attr] = value try: From 172c692923957f110a72d5ac4c6c8fe3fa5c2911 Mon Sep 17 00:00:00 2001 From: Tony Meyer Date: Wed, 30 Apr 2025 16:28:38 +1200 Subject: [PATCH 19/79] With lazy Secrets, we no longer get errors with missing secrets/invalid secret IDs. --- test/test_config.py | 33 --------------------------------- 1 file changed, 33 deletions(-) diff --git a/test/test_config.py b/test/test_config.py index 5aeb670b1..b0e00ac21 100644 --- a/test/test_config.py +++ b/test/test_config.py @@ -289,39 +289,6 @@ def test_config_with_secret(charm_class: type[ops.CharmBase], request: pytest.Fi assert secret.get_content() == content -@pytest.mark.parametrize('charm_class', _test_classes) -def test_config_invalid_secret_id( - charm_class: type[ops.CharmBase], request: pytest.FixtureRequest -): - config = MyConfig.to_juju_schema() - harness = testing.Harness(charm_class, config=ops._private.yaml.safe_dump(config)) - request.addfinalizer(harness.cleanup) - content = {'password': 'admin'} - secret_id = harness.add_user_secret(content) - harness.grant_secret(secret_id, harness.model.app.name) - harness.update_config({ - 'my-secret': 'not a secret id', - }) - with pytest.raises(ops.InvalidSchemaError): - harness.begin() - # TODO: add a test_main check that makes sure that the status is set correctly. - - -@pytest.mark.parametrize('charm_class', _test_classes) -def test_config_missing_secret(charm_class: type[ops.CharmBase], request: pytest.FixtureRequest): - config = MyConfig.to_juju_schema() - harness = testing.Harness(charm_class, config=ops._private.yaml.safe_dump(config)) - request.addfinalizer(harness.cleanup) - content = {'password': 'admin'} - secret_id = harness.add_user_secret(content) - harness.update_config({ - 'my-secret': secret_id, - }) - with pytest.raises(ops.InvalidSchemaError): - harness.begin() - # TODO: add a test_main check that makes sure that the status is set correctly. - - def test_config_custom_naming_pattern(request: pytest.FixtureRequest): @dataclasses.dataclass(frozen=True) class Config(ops.ConfigBase): From 3ee1807a59b24b1bcc17aa4fc7d92deeb6a6d4a9 Mon Sep 17 00:00:00 2001 From: Tony Meyer Date: Wed, 30 Apr 2025 17:07:28 +1200 Subject: [PATCH 20/79] Clean up the attr-to-type code. --- ops/_config.py | 93 ++++++++++++++++++++++++++------------------------ 1 file changed, 49 insertions(+), 44 deletions(-) diff --git a/ops/_config.py b/ops/_config.py index 9ac3908a2..6f64a5dc4 100644 --- a/ops/_config.py +++ b/ops/_config.py @@ -20,7 +20,7 @@ import importlib import logging import pathlib -from typing import Any, ClassVar, Generator, get_origin +from typing import Any, ClassVar, Generator, get_args, get_origin, get_type_hints from ._private import attrdocs, yaml from .model import Secret @@ -81,44 +81,41 @@ def __init__(self, framework: ops.Framework): "": 'string', 'ops.Secret': 'secret', 'ops.model.Secret': 'secret', + "": 'secret', + "": 'secret', } - @staticmethod - def __extract_optional_type(attr: str, hint: str): - if 'Optional[' in hint: - hint = hint.split('[')[1].split(']')[0] - if '|' in hint: - parts = [p.strip() for p in hint.split('|')] - if 'None' in parts: - parts.remove('None') - if len(parts) != 1: - raise ValueError(f'{attr!r} has multiple types.') - hint = parts[0] - return hint - - # TODO: now that we're not really exposing these methods, maybe they should - # not raise? We could fall back to string maybe? We want someone to be able - # to subclass and use to_juju_schema with super and then change things. - @classmethod def _attr_to_juju_type(cls, name: str, default: Any = None) -> str: """Provide the appropriate type for the config YAML for the given attribute. - Raises: - ValueError: if an appropriate type cannot be found. + If an appropriate type cannot be determined, fall back to "string". """ - # TODO: This can probably use dataclasses.fields(). - types = cls.__annotations__ try: - hint = cls.__extract_optional_type(name, str(types[name])) - except (KeyError, ValueError): - # If there's a default value, use that object's type. - if default is not None and type(default).__name__ in cls._JUJU_TYPES: - return cls._JUJU_TYPES[type(default).__name__] - raise ValueError(f'{name!r} type is unknown.') from None - if hint not in cls._JUJU_TYPES: - raise ValueError(f'{name!r} type is unknown.') from None - return cls._JUJU_TYPES[hint] + raw_hint = get_type_hints(cls)[name] + except KeyError: + pass + else: + # Collapse Optional[] and Union[] and so on to the simpler form. + if get_origin(raw_hint): + hints = {arg for arg in get_args(raw_hint) if str(arg) in cls._JUJU_TYPES} + else: + hints = {raw_hint} + # If there are multiple types -- for example, the type annotation is + # `int | str` -- then we can't determine the type, and we fall back + # to "string", even if `str` is not in the type hint, because our + # "we can't determine the type" choice is always "string". + if len(hints) > 1: + return 'string' + elif hints: + return cls._JUJU_TYPES[str(hints.pop())] + # If there's a default value, use that object's type. + if default is not None: + return cls._JUJU_TYPES.get(type(default).__name__, 'string') + # If we can't figure it out, then use "string", which should be the most + # compatible, and most likely to be used for arbitrary types. Charms can + # override `to_juju_schema` to adjust this if required. + return 'string' @staticmethod def _attr_to_juju_name(attr: str): @@ -159,18 +156,24 @@ def _juju_names(cls) -> Generator[str]: yield attr @classmethod - def __juju_schema_from_basemodel(cls) -> dict[str, Any]: + def __juju_schema_from_model_fields(cls) -> dict[str, Any]: options = {} for name, field in cls.model_fields.items(): # type: ignore option = {} if field.default is not None: # type: ignore option['default'] = field.default # type: ignore if field.annotation in (bool, int, float, str, Secret): # type: ignore - hint = field.annotation.__name__ # type: ignore + hint = cls._JUJU_TYPES[field.annotation.__name__] # type: ignore else: - hint = str(field.annotation) # type: ignore - hint = cls.__extract_optional_type(name, hint) # type: ignore - option['type'] = cls._JUJU_TYPES[hint] + hint = field.annotation # type: ignore + if get_origin(hint): + hints = {arg for arg in get_args(hint) if str(arg) in cls._JUJU_TYPES} + if len(hints) > 1: + hint = type(str) + elif hints: + hint = hints.pop() + hint = cls._JUJU_TYPES.get(str(hint), 'string') # type: ignore + option['type'] = hint if field.description: # type: ignore option['description'] = field.description # type: ignore options[cls._attr_to_juju_name(name)] = option # type: ignore @@ -208,6 +211,10 @@ def to_juju_schema(cls) -> dict[str, Any]: type: secret description: A user secret. + Options with a default value of ``None`` will not have a ``default`` key + in the output. If the type of the option cannot be determined, it will + be set to ``string``. + To customise, override this method in your subclass. For example:: @classmethod @@ -217,9 +224,10 @@ def to_juju_schema(cls) -> dict[str, Any]: schema = {key.upper(): value for key, value in schema.items()} return schema """ - # Special-case pydantic BaseModel. + # Special-case pydantic BaseModel or anything else with a compatible + # `model_fields`` attribute. if hasattr(cls, 'model_fields'): - return cls.__juju_schema_from_basemodel() + return cls.__juju_schema_from_model_fields() # Dataclasses, regular classes, etc. attr_docstrings = attrdocs.get_attr_docstrings(cls) @@ -227,7 +235,7 @@ def to_juju_schema(cls) -> dict[str, Any]: for attr in cls._juju_names(): option = {} default = getattr(cls, attr, None) - if type(default).__name__ in cls._JUJU_TYPES: + if default is not None and type(default).__name__ in cls._JUJU_TYPES: option['default'] = default option['type'] = cls._attr_to_juju_type(attr, default) doc = attr_docstrings.get(attr) @@ -250,17 +258,14 @@ def generate_juju_schema(): module = importlib.import_module(f'src.{module_name}') for attr_name in dir(module): obj = getattr(module, attr_name) - if hasattr(obj, 'to_yaml_schema'): - config.update(obj.to_yaml_schema()) + if isinstance(obj, ConfigBase): + config.update(obj.to_juju_schema()) print(yaml.safe_dump(config)) if __name__ == '__main__': generate_juju_schema() -# TODO: Verify that if future annotations is not used, everything still works -# as expected (or make this an explicit requirement). - # TODO: if no config is found, have Scenario try to generate it. # TODO: test_main check to verify that the clean exit works correctly. From 5f8db5045db98d78b322bae2dd4bee211d05b448 Mon Sep 17 00:00:00 2001 From: Tony Meyer Date: Wed, 30 Apr 2025 17:07:42 +1200 Subject: [PATCH 21/79] Add a test for the 'only load some config' case. --- ops/charm.py | 4 ++-- test/test_config.py | 28 +++++++++++++++++++++++++++- 2 files changed, 29 insertions(+), 3 deletions(-) diff --git a/ops/charm.py b/ops/charm.py index 7ac2d1b12..8dfed099d 100644 --- a/ops/charm.py +++ b/ops/charm.py @@ -1459,12 +1459,12 @@ def load_config( config: Dict[str, Union[bool, int, float, str, model.Secret]] = kwargs.copy() fields = set(cls._juju_names()) # type: ignore for key, value in self.config.items(): - if key not in fields: - continue attr = cls._juju_name_to_attr(key) # type: ignore assert isinstance(attr, str) if not attr.isidentifier(): raise model.InvalidSchemaError(status=f'Invalid attribute name {attr}') from None + if attr not in fields: + continue option_type = self.meta.config.get(key) # Convert secret IDs to secret objects. We create the object rather # that using model.get_secret so that it's entirely lazy, in the diff --git a/test/test_config.py b/test/test_config.py index b0e00ac21..269b8e8b5 100644 --- a/test/test_config.py +++ b/test/test_config.py @@ -28,7 +28,6 @@ pydantic = None import ops -import ops._main import ops._private.yaml from ops import testing @@ -435,3 +434,30 @@ def __init__(self, framework: ops.Framework): typed_config = harness.charm.typed_config assert typed_config.x == 42 assert typed_config.y == datetime.date(2008, 8, 28) + + +def test_config_partial_init(request: pytest.FixtureRequest): + @dataclasses.dataclass(frozen=True) + class Config(ops.ConfigBase): + x: int + + class Charm(ops.CharmBase): + def __init__(self, framework: ops.Framework): + super().__init__(framework) + self.typed_config = self.load_config(Config) + + schema = Config.to_juju_schema() + # Harness needs to know about *all* the options, even though the charm does + # not. + schema['options']['y'] = { + 'type': 'string', + 'description': 'An int not used in the class', + } + options = ops._private.yaml.safe_dump(schema) + harness = testing.Harness(Charm, config=options) + request.addfinalizer(harness.cleanup) + # The raw config contains more fields than the class requires. + harness.update_config({'x': 42, 'y': 'foo'}) + harness.begin() + typed_config = harness.charm.typed_config + assert typed_config.x == 42 From d932a97c5e151ce9ab2b935cb1c3288751cc0f83 Mon Sep 17 00:00:00 2001 From: Tony Meyer Date: Wed, 30 Apr 2025 17:12:00 +1200 Subject: [PATCH 22/79] Move TODO to a better location. --- ops/_config.py | 2 -- testing/src/scenario/state.py | 4 ++++ 2 files changed, 4 insertions(+), 2 deletions(-) diff --git a/ops/_config.py b/ops/_config.py index 6f64a5dc4..e6508ae15 100644 --- a/ops/_config.py +++ b/ops/_config.py @@ -266,6 +266,4 @@ def generate_juju_schema(): if __name__ == '__main__': generate_juju_schema() -# TODO: if no config is found, have Scenario try to generate it. - # TODO: test_main check to verify that the clean exit works correctly. diff --git a/testing/src/scenario/state.py b/testing/src/scenario/state.py index d236705ba..2dbe06d8c 100644 --- a/testing/src/scenario/state.py +++ b/testing/src/scenario/state.py @@ -1761,6 +1761,10 @@ def autoload(charm_type: type[CharmBase]) -> _CharmSpec[CharmType]: # try to load using legacy metadata.yaml/actions.yaml/config.yaml files meta, config, actions = _CharmSpec._load_metadata_legacy(charm_root) + # TODO: ideally, we would look for ConfigBase classes in the charm + # module and autoload from there at this point. Leaving this until the + # conversation about if & how the generation is done is resolved. + if not meta: # still no metadata? bug out raise MetadataNotFoundError( From 197431aeb6d84bbc09df70a70042916b125a3983 Mon Sep 17 00:00:00 2001 From: Tony Meyer Date: Wed, 30 Apr 2025 18:00:43 +1200 Subject: [PATCH 23/79] Add tests for uncaught InvalidSchemaError. --- ops/_config.py | 2 -- test/charms/test_main/config.yaml | 5 +++- test/charms/test_main/src/charm.py | 4 +++ test/test_main.py | 45 ++++++++++++++++++++++++++++++ 4 files changed, 53 insertions(+), 3 deletions(-) diff --git a/ops/_config.py b/ops/_config.py index e6508ae15..4d792c2cb 100644 --- a/ops/_config.py +++ b/ops/_config.py @@ -265,5 +265,3 @@ def generate_juju_schema(): if __name__ == '__main__': generate_juju_schema() - -# TODO: test_main check to verify that the clean exit works correctly. diff --git a/test/charms/test_main/config.yaml b/test/charms/test_main/config.yaml index 26e3ec3c3..d18461d26 100644 --- a/test/charms/test_main/config.yaml +++ b/test/charms/test_main/config.yaml @@ -12,4 +12,7 @@ # See the License for the specific language governing permissions and # limitations under the License. -"options": {} +options: + invalid: + type: string + description: Raise InvalidSchemaError if set. diff --git a/test/charms/test_main/src/charm.py b/test/charms/test_main/src/charm.py index 75978fd58..1abfa3c6f 100755 --- a/test/charms/test_main/src/charm.py +++ b/test/charms/test_main/src/charm.py @@ -32,6 +32,7 @@ # during unit tests, and test_main failures that subprocess out are often # difficult to debug. Uncomment this line to get more informative errors when # running the tests. +# When uncommented the test_hook_and_dispatch_with_failing_hook test will fail. # logger.addHandler(logging.StreamHandler(sys.stderr)) @@ -152,6 +153,9 @@ def _on_start(self, event: ops.StartEvent): self._stored.observed_event_types.append(type(event).__name__) def _on_config_changed(self, event: ops.ConfigChangedEvent): + if 'invalid' in self.config: + status = str(self.config['invalid']) if self.config['invalid'] != 'invalid' else None + raise ops.InvalidSchemaError(status=status) self._stored.on_config_changed.append(type(event).__name__) self._stored.observed_event_types.append(type(event).__name__) event.defer() diff --git a/test/test_main.py b/test/test_main.py index 0bbf5d2f9..db13bab90 100644 --- a/test/test_main.py +++ b/test/test_main.py @@ -426,6 +426,7 @@ def test_event_reemitted(self, fake_script: FakeScript): assert list(state.observed_event_types) == ['InstallEvent'] # The config-changed handler always defers. + fake_script.write('config-get', "echo '{}'") state = self._simulate_event( fake_script, EventSpec(ops.ConfigChangedEvent, 'config-changed') ) @@ -442,6 +443,7 @@ def test_event_reemitted(self, fake_script: FakeScript): @pytest.mark.usefixtures('setup_charm') def test_no_reemission_on_collect_metrics(self, fake_script: FakeScript): fake_script.write('add-metric', 'exit 0') + fake_script.write('config-get', "echo '{}'") # First run "install" to make sure all hooks are set up. state = self._simulate_event(fake_script, EventSpec(ops.InstallEvent, 'install')) @@ -1116,6 +1118,49 @@ def test_hook_and_dispatch_but_hook_is_dispatch_copy(self, fake_script: FakeScri assert calls == expected + @pytest.mark.usefixtures('setup_charm') + def test_invalid_schema_clean_exit(self, fake_script: FakeScript): + # First run "install" to make sure all hooks are set up. + state = self._simulate_event(fake_script, EventSpec(ops.InstallEvent, 'install')) + assert isinstance(state, ops.BoundStoredState) + assert list(state.observed_event_types) == ['InstallEvent'] + + fake_script.write('config-get', 'echo \'{"invalid": "invalid"}\'') + state = self._simulate_event( + fake_script, + EventSpec( + ops.ConfigChangedEvent, + 'config-changed', + ), + ) + assert isinstance(state, ops.BoundStoredState) + expected = [['is-leader', '--format=json'], ['config-get', '--format=json']] + assert [call for call in fake_script.calls() if call[0] != 'juju-log'] == expected + + @pytest.mark.usefixtures('setup_charm') + def test_invalid_schema_set_status(self, fake_script: FakeScript): + # First run "install" to make sure all hooks are set up. + state = self._simulate_event(fake_script, EventSpec(ops.InstallEvent, 'install')) + assert isinstance(state, ops.BoundStoredState) + assert list(state.observed_event_types) == ['InstallEvent'] + + fake_script.write('config-get', 'echo \'{"invalid": "status message"}\'') + fake_script.write('status-set', 'exit 0') + state = self._simulate_event( + fake_script, + EventSpec( + ops.ConfigChangedEvent, + 'config-changed', + ), + ) + assert isinstance(state, ops.BoundStoredState) + expected = [ + ['is-leader', '--format=json'], + ['config-get', '--format=json'], + ['status-set', '--application=False', 'blocked', 'status message'], + ] + assert [call for call in fake_script.calls() if call[0] != 'juju-log'] == expected + class TestMainWithDispatchAsSymlink(_TestMain): def _setup_entry_point(self): From d0b7e2e6d3917754be34e8b722a9de8943ef4c82 Mon Sep 17 00:00:00 2001 From: Tony Meyer Date: Wed, 30 Apr 2025 18:07:16 +1200 Subject: [PATCH 24/79] Fix docs. --- ops/_config.py | 5 +++-- ops/charm.py | 7 ++++--- 2 files changed, 7 insertions(+), 5 deletions(-) diff --git a/ops/_config.py b/ops/_config.py index 4d792c2cb..088ec6741 100644 --- a/ops/_config.py +++ b/ops/_config.py @@ -65,8 +65,9 @@ def __init__(self, framework: ops.Framework): super().__init__(framework) self.typed_config = self.load_config(MyConfig) - If the config provided by Juju is not valid, the charm will exit after - setting a blocked status with an error message based on the ``str()`` of the + If the config provided by Juju is not valid, a :class:`ops.InvalidSchemaError` + will be raised, and if not caught the charm will exit after setting a + blocked status with an error message based on the ``str()`` of the original exception raised. """ diff --git a/ops/charm.py b/ops/charm.py index 3313a8684..cb00b913a 100644 --- a/ops/charm.py +++ b/ops/charm.py @@ -1463,9 +1463,10 @@ def load_config( An instance of the config class with the current config values. Raises: - :class`InvalidSchemaError` if the configuration is invalid. If the - exception is not caught by the charm code, the hook will exit with a - zero exit code, after setting an appropriate blocked status. + InvalidSchemaError: if the configuration is invalid. If the + exception is not caught by the charm code, the hook will exit + with a zero exit code, after setting an appropriate blocked + status. """ config: dict[str, bool | int | float | str | model.Secret] = kwargs.copy() fields = set(cls._juju_names()) # type: ignore From 1c09153b1e2cbb48f2314eec584a6435e59bf8ed Mon Sep 17 00:00:00 2001 From: Tony Meyer Date: Thu, 8 May 2025 07:53:08 +0200 Subject: [PATCH 25/79] Adjustments from spec review. --- ops/__init__.py | 2 - ops/_config.py | 45 ++++--------------- ops/_main.py | 2 +- ops/charm.py | 21 ++++++--- ops/model.py | 4 +- test/charms/test_main/config.yaml | 2 +- test/charms/test_main/src/charm.py | 13 +++++- test/test_config.py | 71 ++++++++++++++++++++++++------ test/test_main.py | 2 +- 9 files changed, 97 insertions(+), 65 deletions(-) diff --git a/ops/__init__.py b/ops/__init__.py index d6266bb9f..28c8bc184 100644 --- a/ops/__init__.py +++ b/ops/__init__.py @@ -150,7 +150,6 @@ 'Container', 'ContainerMapping', 'ErrorStatus', - 'InvalidSchemaError', 'InvalidStatusError', 'LazyCheckInfo', 'LazyMapping', @@ -301,7 +300,6 @@ Container, ContainerMapping, ErrorStatus, - InvalidSchemaError, InvalidStatusError, LazyCheckInfo, LazyMapping, diff --git a/ops/_config.py b/ops/_config.py index 088ec6741..4270e9738 100644 --- a/ops/_config.py +++ b/ops/_config.py @@ -17,12 +17,10 @@ from __future__ import annotations import dataclasses -import importlib import logging -import pathlib from typing import Any, ClassVar, Generator, get_args, get_origin, get_type_hints -from ._private import attrdocs, yaml +from ._private import attrdocs from .model import Secret logger = logging.getLogger(__name__) @@ -31,8 +29,8 @@ class ConfigBase: """Base class for strongly typed charm config. - Use :class:`ConfigBase` as a base class for your config class, and define - the attributes as you would in ``charmcraft.yaml``. For example:: + Use ``ConfigBase`` as a base class for your config class, and define the + attributes as you would in ``charmcraft.yaml``. For example:: @dataclasses.dataclass(frozen=True) class MyConfig(ops.ConfigBase): @@ -49,14 +47,14 @@ class MyConfig(ops.ConfigBase): .. note:: - This is a dataclass, but can be any object that inherits from - ``ops.ConfigBase``, and can be initialised with the raw Juju config + That is a dataclass, but the class can be any that inherits from + ``ops.ConfigBase``, and that can be initialised with the raw Juju config passed as keyword arguments. Any errors should be indicated by raising ``ValueError`` (or a ``ValueError`` subclass) in initialisation. Inheriting from ``ops.ConfigBase`` is not strictly necessary, but it - provides utility methods for translating the class to a YAML schema suitable - for use with Juju. + provides a utility method for translating the class to a YAML schema + suitable for use with Juju. Use this in your charm class like so:: @@ -64,11 +62,6 @@ class MyCharm(ops.CharmBase): def __init__(self, framework: ops.Framework): super().__init__(framework) self.typed_config = self.load_config(MyConfig) - - If the config provided by Juju is not valid, a :class:`ops.InvalidSchemaError` - will be raised, and if not caught the charm will exit after setting a - blocked status with an error message based on the ``str()`` of the original - exception raised. """ _JUJU_TYPES: ClassVar[dict[str, str]] = { @@ -188,7 +181,7 @@ def to_juju_schema(cls) -> dict[str, Any]: suitable for use in ``config.yaml``. For example, with the class from the example above:: - print(yaml.safe_dump(MyConfig.to_juju_schema())) + print(yaml.dump(MyConfig.to_juju_schema())) Will output:: @@ -244,25 +237,3 @@ def to_juju_schema(cls) -> dict[str, Any]: option['description'] = doc options[cls._attr_to_juju_name(attr)] = option return {'options': options} - - -def generate_juju_schema(): - """Look for all ConfigBase subclasses and generate their YAML schema. - - .. caution:: - - This imports modules, so is not safe to run on untrusted code. - """ - config: dict[str, Any] = {} - for name in pathlib.Path('src').glob('*.py'): - module_name = name.stem - module = importlib.import_module(f'src.{module_name}') - for attr_name in dir(module): - obj = getattr(module, attr_name) - if isinstance(obj, ConfigBase): - config.update(obj.to_juju_schema()) - print(yaml.safe_dump(config)) - - -if __name__ == '__main__': - generate_juju_schema() diff --git a/ops/_main.py b/ops/_main.py index f74aca2cb..df0fdf494 100644 --- a/ops/_main.py +++ b/ops/_main.py @@ -513,7 +513,7 @@ def run(self): self._emit(self.charm, self._dispatcher.event_name) self._commit(self.charm.framework) self._close() - except _model.InvalidSchemaError as e: + except _model._InvalidSchemaError as e: # Optionally set a status message on the unit. if e.status: backend = self._make_model_backend() diff --git a/ops/charm.py b/ops/charm.py index cb00b913a..5473bf980 100644 --- a/ops/charm.py +++ b/ops/charm.py @@ -1437,6 +1437,7 @@ def load_config( self, cls: type[_ConfigType], *args: Any, + errors: Literal['raise', 'blocked'] = 'raise', **kwargs: Any, ) -> _ConfigType: """Load the config into an instance of a config class. @@ -1456,6 +1457,12 @@ def load_config( Args: cls: A class that inherits from :class:`ops.ConfigBase`. + errors: what to do if the config is invalid. If ``blocked``, the + charm will exit successfully (note that this informs Juju that + the event was handled and it will not be retried) after setting + an appropriate blocked status. If ``raise``, ``load_config`` + will not catch any exceptions, leaving the charm to handle + errors. args: positional arguments to pass through to the config class. kwargs: keyword arguments to pass through to the config class. @@ -1463,10 +1470,8 @@ def load_config( An instance of the config class with the current config values. Raises: - InvalidSchemaError: if the configuration is invalid. If the - exception is not caught by the charm code, the hook will exit - with a zero exit code, after setting an appropriate blocked - status. + ValueError: if the configuration is invalid and ``errors`` is set to + ``raise``. """ config: dict[str, bool | int | float | str | model.Secret] = kwargs.copy() fields = set(cls._juju_names()) # type: ignore @@ -1474,7 +1479,9 @@ def load_config( attr = cls._juju_name_to_attr(key) # type: ignore assert isinstance(attr, str) if not attr.isidentifier(): - raise model.InvalidSchemaError(status=f'Invalid attribute name {attr}') from None + if errors == 'raise': + raise ValueError(f'Invalid attribute name {attr}') + raise model._InvalidSchemaError(status=f'Invalid attribute name {attr}') if attr not in fields: continue option_type = self.meta.config.get(key) @@ -1493,7 +1500,9 @@ def load_config( try: return cls(*args, **config) except ValueError as e: - raise model.InvalidSchemaError(status=f'Error in config: {e}') from None + if errors == 'raise': + raise + raise model._InvalidSchemaError(status=f'Error in config: {e}') from e def _evaluate_status(charm: CharmBase): # pyright: ignore[reportUnusedFunction] diff --git a/ops/model.py b/ops/model.py index ea2af1318..5019b8bf8 100644 --- a/ops/model.py +++ b/ops/model.py @@ -3269,8 +3269,8 @@ class SecretNotFoundError(ModelError): """Raised when the specified secret does not exist.""" -class InvalidSchemaError(Exception): - """Raised when a config, action parameter, or databag schema does not match the data.""" +class _InvalidSchemaError(Exception): # pyright: ignore[reportUnusedClass] + """Raised when a config option or action parameter schema does not match the data.""" def __init__(self, message: str = '', status: str | None = None): super().__init__(message) diff --git a/test/charms/test_main/config.yaml b/test/charms/test_main/config.yaml index d18461d26..3fd291200 100644 --- a/test/charms/test_main/config.yaml +++ b/test/charms/test_main/config.yaml @@ -15,4 +15,4 @@ options: invalid: type: string - description: Raise InvalidSchemaError if set. + description: Fail if set, using the value as the status message. diff --git a/test/charms/test_main/src/charm.py b/test/charms/test_main/src/charm.py index 1abfa3c6f..b5983b273 100755 --- a/test/charms/test_main/src/charm.py +++ b/test/charms/test_main/src/charm.py @@ -22,6 +22,7 @@ import warnings import ops +import ops.model sys.path.append('lib') @@ -154,8 +155,16 @@ def _on_start(self, event: ops.StartEvent): def _on_config_changed(self, event: ops.ConfigChangedEvent): if 'invalid' in self.config: - status = str(self.config['invalid']) if self.config['invalid'] != 'invalid' else None - raise ops.InvalidSchemaError(status=status) + if self.config['invalid'] == 'invalid': + raise ops.model._InvalidSchemaError() + + status = str(self.config['invalid']) + + class Config(ops.ConfigBase): + def __init__(self, **_): + raise ValueError(status) + + self.load_config(Config, errors='blocked') self._stored.on_config_changed.append(type(event).__name__) self._stored.observed_event_types.append(type(event).__name__) event.defer() diff --git a/test/test_config.py b/test/test_config.py index 5c0d838bf..746c81300 100644 --- a/test/test_config.py +++ b/test/test_config.py @@ -17,7 +17,7 @@ import dataclasses import datetime import logging -from typing import Any, Optional, Protocol, Union, cast +from typing import Any, Literal, Optional, Protocol, Union, cast import pytest @@ -29,6 +29,7 @@ import ops import ops._private.yaml +import ops.model as _model from ops import testing logger = logging.getLogger(__name__) @@ -91,9 +92,14 @@ def __init__( class MyCharm(ops.CharmBase): + _config_errors: Literal['blocked', 'raise'] | None = None + def __init__(self, framework: ops.Framework): super().__init__(framework) - self.typed_config = self.load_config(MyConfig) + if self._config_errors: + self.typed_config = self.load_config(MyConfig, errors=self._config_errors) + else: + self.typed_config = self.load_config(MyConfig) # These should not have any type errors. new_float = self.typed_config.my_float + 2006.8 new_int = self.typed_config.my_int + 1979 @@ -130,9 +136,14 @@ def __post_init__(self): class MyDataclassCharm(ops.CharmBase): + _config_errors: Literal['blocked', 'raise'] | None = None + def __init__(self, framework: ops.Framework): super().__init__(framework) - self.typed_config = self.load_config(MyDataclassConfig) + if self._config_errors: + self.typed_config = self.load_config(MyDataclassConfig, errors=self._config_errors) + else: + self.typed_config = self.load_config(MyDataclassConfig) # These should not have any type errors. new_float = self.typed_config.my_float + 2006.8 new_int = self.typed_config.my_int + 1979 @@ -168,9 +179,16 @@ def validate_my_int(cls, my_int: int) -> int: return my_int class MyPydanticDataclassCharm(ops.CharmBase): + _config_errors: Literal['blocked', 'raise'] | None = None + def __init__(self, framework: ops.Framework): super().__init__(framework) - self.typed_config = self.load_config(MyPydanticDataclassConfig) + if self._config_errors: + self.typed_config = self.load_config( + MyPydanticDataclassConfig, errors=self._config_errors + ) + else: + self.typed_config = self.load_config(MyPydanticDataclassConfig) # These should not have any type errors. new_float = self.typed_config.my_float + 2006.8 new_int = self.typed_config.my_int + 1979 @@ -206,9 +224,16 @@ class Config: frozen = True class MyPydanticBaseModelCharm(ops.CharmBase): + _config_errors: Literal['blocked', 'raise'] | None = None + def __init__(self, framework: ops.Framework): super().__init__(framework) - self.typed_config = self.load_config(MyPydanticBaseModelConfig) + if self._config_errors: + self.typed_config = self.load_config( + MyPydanticBaseModelConfig, errors=self._config_errors + ) + else: + self.typed_config = self.load_config(MyPydanticBaseModelConfig) # These should not have any type errors. new_float = self.typed_config.my_float + 2006.8 new_int = self.typed_config.my_int + 1979 @@ -264,17 +289,27 @@ def test_config_init_non_default(charm_class: type[ops.CharmBase], request: pyte assert typed_config.my_secret is None +@pytest.mark.parametrize( + 'errors,exc', + (('raise', ValueError), ('blocked', _model._InvalidSchemaError), (None, ValueError)), +) @pytest.mark.parametrize('charm_class', _test_classes) -def test_config_with_error(charm_class: type[ops.CharmBase], request: pytest.FixtureRequest): +def test_config_with_error_blocked( + charm_class: type[ops.CharmBase], + errors: Literal['blocked', 'raise'] | None, + exc: type[Exception], + request: pytest.FixtureRequest, +): config = MyConfig.to_juju_schema() harness = testing.Harness(charm_class, config=ops._private.yaml.safe_dump(config)) request.addfinalizer(harness.cleanup) + charm_class._config_errors = errors # type: ignore + request.addfinalizer(lambda: setattr(charm_class, '_config_errors', None)) harness.update_config({ 'my-int': -1, }) - with pytest.raises(ops.InvalidSchemaError): + with pytest.raises(exc): harness.begin() - # TODO: add a test_main check that makes sure that the status is set correctly. @pytest.mark.parametrize('charm_class', _test_classes) @@ -330,7 +365,15 @@ def __init__(self, framework: ops.Framework): assert typed_config.other == 'baz' -def test_config_bad_attr_naming_pattern(request: pytest.FixtureRequest): +@pytest.mark.parametrize( + 'errors,exc', + (('raise', ValueError), ('blocked', _model._InvalidSchemaError), (None, ValueError)), +) +def test_config_bad_attr_naming_pattern( + errors: Literal['blocked', 'raise'] | None, + exc: type[Exception], + request: pytest.FixtureRequest, +): @dataclasses.dataclass(frozen=True) class BadConfig(ops.ConfigBase): foo_bar: int = 42 @@ -342,13 +385,16 @@ def _juju_name_to_attr(attr: str): class BadCharm(ops.CharmBase): def __init__(self, framework: ops.Framework): super().__init__(framework) - self.typed_config = self.load_config(BadConfig) + if errors: + self.typed_config = self.load_config(BadConfig, errors=errors) + else: + self.typed_config = self.load_config(BadConfig) config = BadConfig.to_juju_schema() assert 'foo-bar' in config['options'] harness = testing.Harness(BadCharm, config=ops._private.yaml.safe_dump(config)) request.addfinalizer(harness.cleanup) - with pytest.raises(ops.InvalidSchemaError): + with pytest.raises(exc): harness.begin() @@ -456,8 +502,7 @@ def __init__(self, framework: ops.Framework): self.typed_config = self.load_config(Config) schema = Config.to_juju_schema() - # Harness needs to know about *all* the options, even though the charm does - # not. + # Harness needs to know about *all* the options, even though the charm does not. schema['options']['y'] = { 'type': 'string', 'description': 'An int not used in the class', diff --git a/test/test_main.py b/test/test_main.py index db13bab90..45cd2fd7a 100644 --- a/test/test_main.py +++ b/test/test_main.py @@ -1157,7 +1157,7 @@ def test_invalid_schema_set_status(self, fake_script: FakeScript): expected = [ ['is-leader', '--format=json'], ['config-get', '--format=json'], - ['status-set', '--application=False', 'blocked', 'status message'], + ['status-set', '--application=False', 'blocked', 'Error in config: status message'], ] assert [call for call in fake_script.calls() if call[0] != 'juju-log'] == expected From 97cd70adb2bb53422c29a40c7f3528913ac8f489 Mon Sep 17 00:00:00 2001 From: Tony Meyer Date: Thu, 8 May 2025 12:58:05 +0200 Subject: [PATCH 26/79] Provide Python 3.8 support. --- ops/_config.py | 17 +++++++++++++++++ tox.ini | 2 ++ 2 files changed, 19 insertions(+) diff --git a/ops/_config.py b/ops/_config.py index 4270e9738..12c2518d5 100644 --- a/ops/_config.py +++ b/ops/_config.py @@ -89,6 +89,23 @@ def _attr_to_juju_type(cls, name: str, default: Any = None) -> str: raw_hint = get_type_hints(cls)[name] except KeyError: pass + except TypeError: + # In Python 3.8, this fails even though __future__ annotations is + # used. Provide a reasonable effort fallback. + hint = cls.__annotations__.get(name) + if hint and '|' in hint: + hints = {h.strip() for h in hint.split('|')} + try: + hints.remove('None') + except ValueError: + pass + if len(hints) > 1: + return 'string' + hint = hints.pop() + if hint and hint.startswith('Optional['): + hint = hint[9:-1] + if hint: + return cls._JUJU_TYPES[str(hint)] else: # Collapse Optional[] and Union[] and so on to the simpler form. if get_origin(raw_hint): diff --git a/tox.ini b/tox.ini index a2384bfb7..34cd74617 100644 --- a/tox.ini +++ b/tox.ini @@ -111,6 +111,7 @@ deps = pytest-xdist~=3.6 typing_extensions~=4.2 jsonpatch~=1.33 + eval-type-backport~=0.2 pydantic~=2.10 -e . -e testing @@ -138,6 +139,7 @@ deps = pytest~=7.2 typing_extensions~=4.2 jsonpatch~=1.33 + eval-type-backport~=0.2 -e . -e testing -e tracing From b3c494195909de24adf34f81913ab0c7669b7089 Mon Sep 17 00:00:00 2001 From: Tony Meyer Date: Wed, 21 May 2025 10:15:57 +1200 Subject: [PATCH 27/79] Apply suggestions from code review Co-authored-by: James Garner --- ops/_config.py | 2 +- ops/charm.py | 6 ++---- 2 files changed, 3 insertions(+), 5 deletions(-) diff --git a/ops/_config.py b/ops/_config.py index 12c2518d5..00e859425 100644 --- a/ops/_config.py +++ b/ops/_config.py @@ -47,7 +47,7 @@ class MyConfig(ops.ConfigBase): .. note:: - That is a dataclass, but the class can be any that inherits from + This example is a dataclass, but the class can be any that inherits from ``ops.ConfigBase``, and that can be initialised with the raw Juju config passed as keyword arguments. Any errors should be indicated by raising ``ValueError`` (or a ``ValueError`` subclass) in initialisation. diff --git a/ops/charm.py b/ops/charm.py index 45600c5e4..776d3b53b 100644 --- a/ops/charm.py +++ b/ops/charm.py @@ -1477,14 +1477,12 @@ def load_config( # that using model.get_secret so that it's entirely lazy, in the # same way that SecretEvent.secret is. if option_type and option_type.type == 'secret' and isinstance(value, str): - secret = model.Secret( + value = model.Secret( backend=self.model._backend, id=value, _secret_set_cache=self.model._cache._secret_set_cache, ) - config[attr] = secret - else: - config[attr] = value + config[attr] = value try: return cls(*args, **config) except ValueError as e: From 3949ca7189caedef2bb5432c82e71dc477500a95 Mon Sep 17 00:00:00 2001 From: Tony Meyer Date: Wed, 21 May 2025 10:29:41 +1200 Subject: [PATCH 28/79] Remove methods for customising attribute names, per review. --- ops/_config.py | 22 ++--------------- ops/charm.py | 3 +-- test/test_config.py | 60 ++++++++++++--------------------------------- 3 files changed, 19 insertions(+), 66 deletions(-) diff --git a/ops/_config.py b/ops/_config.py index 00e859425..d45737d23 100644 --- a/ops/_config.py +++ b/ops/_config.py @@ -128,24 +128,6 @@ def _attr_to_juju_type(cls, name: str, default: Any = None) -> str: # override `to_juju_schema` to adjust this if required. return 'string' - @staticmethod - def _attr_to_juju_name(attr: str): - """Convert from the class attribute name to the name used in the schema. - - Python names are snake_case, but Juju config option names should be - kebab-case. - """ - return attr.replace('_', '-') - - @staticmethod - def _juju_name_to_attr(attr: str): - """Convert from the schema name to the class attribute name. - - Python names are snake_case, but Juju config option names should be - kebab-case. - """ - return attr.replace('-', '_') - @classmethod def _juju_names(cls) -> Generator[str]: """Iterates over all the option names to include in the config YAML.""" @@ -187,7 +169,7 @@ def __juju_schema_from_model_fields(cls) -> dict[str, Any]: option['type'] = hint if field.description: # type: ignore option['description'] = field.description # type: ignore - options[cls._attr_to_juju_name(name)] = option # type: ignore + options[name.replace('_', '-')] = option # type: ignore return {'options': options} @classmethod @@ -252,5 +234,5 @@ def to_juju_schema(cls) -> dict[str, Any]: doc = attr_docstrings.get(attr) if doc: option['description'] = doc - options[cls._attr_to_juju_name(attr)] = option + options[attr.replace('_', '-')] = option return {'options': options} diff --git a/ops/charm.py b/ops/charm.py index 776d3b53b..faf4950e8 100644 --- a/ops/charm.py +++ b/ops/charm.py @@ -1464,8 +1464,7 @@ def load_config( config: dict[str, bool | int | float | str | model.Secret] = kwargs.copy() fields = set(cls._juju_names()) # type: ignore for key, value in self.config.items(): - attr = cls._juju_name_to_attr(key) # type: ignore - assert isinstance(attr, str) + attr = key.replace('-', '_') if not attr.isidentifier(): if errors == 'raise': raise ValueError(f'Invalid attribute name {attr}') diff --git a/test/test_config.py b/test/test_config.py index 746c81300..c773072b6 100644 --- a/test/test_config.py +++ b/test/test_config.py @@ -338,17 +338,22 @@ class Config(ops.ConfigBase): foo_bar: int = 42 other: str = 'baz' - @staticmethod - def _attr_to_juju_name(name: str): - if name == 'foo_bar': - return 'fooBar' - return name.replace('_', '-') - - @staticmethod - def _juju_name_to_attr(name: str): - if name == 'fooBar': - return 'foo_bar' - return name.replace('-', '_') + def __init__(self, fooBar: int = 42, other: str = 'baz'): # noqa: N803 + super().__init__() + if not isinstance(fooBar, int): + raise ValueError('fooBar must be an integer') + if not isinstance(other, str): + raise ValueError('other must be a string') + object.__setattr__(self, 'foo_bar', fooBar) + object.__setattr__(self, 'other', other) + + @classmethod + def to_juju_schema(cls): + schema = super().to_juju_schema() + # We need to override the options to use the custom names. + options = schema['options'] + options['fooBar'] = options.pop('foo-bar') + return schema class Charm(ops.CharmBase): def __init__(self, framework: ops.Framework): @@ -365,39 +370,6 @@ def __init__(self, framework: ops.Framework): assert typed_config.other == 'baz' -@pytest.mark.parametrize( - 'errors,exc', - (('raise', ValueError), ('blocked', _model._InvalidSchemaError), (None, ValueError)), -) -def test_config_bad_attr_naming_pattern( - errors: Literal['blocked', 'raise'] | None, - exc: type[Exception], - request: pytest.FixtureRequest, -): - @dataclasses.dataclass(frozen=True) - class BadConfig(ops.ConfigBase): - foo_bar: int = 42 - - @staticmethod - def _juju_name_to_attr(attr: str): - return attr.replace('_', '-') - - class BadCharm(ops.CharmBase): - def __init__(self, framework: ops.Framework): - super().__init__(framework) - if errors: - self.typed_config = self.load_config(BadConfig, errors=errors) - else: - self.typed_config = self.load_config(BadConfig) - - config = BadConfig.to_juju_schema() - assert 'foo-bar' in config['options'] - harness = testing.Harness(BadCharm, config=ops._private.yaml.safe_dump(config)) - request.addfinalizer(harness.cleanup) - with pytest.raises(exc): - harness.begin() - - @pytest.mark.parametrize('config_class', _test_config_classes) def test_config_yaml_schema(config_class: type[ops.ConfigBase]): generated_yaml = config_class.to_juju_schema() From 0b4a84d51fcaff83306df1523bf5ef83152ed42d Mon Sep 17 00:00:00 2001 From: Tony Meyer Date: Wed, 21 May 2025 10:33:33 +1200 Subject: [PATCH 29/79] Sort the field names for consistent output. --- ops/_config.py | 6 +++--- 1 file changed, 3 insertions(+), 3 deletions(-) diff --git a/ops/_config.py b/ops/_config.py index d45737d23..c56531c18 100644 --- a/ops/_config.py +++ b/ops/_config.py @@ -132,18 +132,18 @@ def _attr_to_juju_type(cls, name: str, default: Any = None) -> str: def _juju_names(cls) -> Generator[str]: """Iterates over all the option names to include in the config YAML.""" try: - yield from (field.name for field in dataclasses.fields(cls)) # type: ignore + yield from (field.name for field in sorted(dataclasses.fields(cls))) # type: ignore except TypeError: pass else: return if hasattr(cls, 'model_fields'): - yield from iter(cls.model_fields) # type: ignore + yield from sorted(cls.model_fields) # type: ignore return # Fall back to using dir() and __annotations__. attrs = dir(cls) attrs.extend((a for a, t in cls.__annotations__.items() if get_origin(t) is not ClassVar)) - for attr in set(attrs): + for attr in sorted(set(attrs)): if attr.startswith('_') or (hasattr(cls, attr) and callable(getattr(cls, attr))): continue yield attr From 7f203a10caeb39d645acff1b2c9ecfe94669b0ad Mon Sep 17 00:00:00 2001 From: Tony Meyer Date: Wed, 21 May 2025 11:01:23 +1200 Subject: [PATCH 30/79] Move private methods from the class to the module, per review. --- ops/_config.py | 233 +++++++++++++++++++++++--------------------- ops/charm.py | 4 +- test/test_config.py | 11 ++- 3 files changed, 128 insertions(+), 120 deletions(-) diff --git a/ops/_config.py b/ops/_config.py index c56531c18..e9b628bd2 100644 --- a/ops/_config.py +++ b/ops/_config.py @@ -18,7 +18,7 @@ import dataclasses import logging -from typing import Any, ClassVar, Generator, get_args, get_origin, get_type_hints +from typing import Any, ClassVar, Final, Generator, Mapping, get_args, get_origin, get_type_hints from ._private import attrdocs from .model import Secret @@ -26,6 +26,121 @@ logger = logging.getLogger(__name__) +_JUJU_TYPES: Final[Mapping[str, str]] = { + 'bool': 'boolean', + 'int': 'int', + 'float': 'float', + 'str': 'string', + "": 'boolean', + "": 'int', + "": 'float', + "": 'string', + 'ops.Secret': 'secret', + 'ops.model.Secret': 'secret', + "": 'secret', + "": 'secret', +} + + +def _attr_to_juju_type(cls: type[object], name: str, default: Any = None) -> str: + """Provide the appropriate type for the config YAML for the given class attribute. + + If possible, use the type hint from the class attribute, ignoring + optionality. Fall back to the type of the default value if it is not None. + + If an appropriate type cannot be determined, fall back to "string". + """ + try: + raw_hint = get_type_hints(cls)[name] + except KeyError: + pass + except TypeError: + # In Python 3.8, this fails even though __future__ annotations is + # used. Provide a reasonable effort fallback. + hint = cls.__annotations__.get(name) + if hint and '|' in hint: + hints = {h.strip() for h in hint.split('|')} + try: + hints.remove('None') + except ValueError: + pass + if len(hints) > 1: + return 'string' + hint = hints.pop() + if hint and hint.startswith('Optional['): + hint = hint[9:-1] + if hint: + return _JUJU_TYPES[str(hint)] + else: + # Collapse Optional[] and Union[] and so on to the simpler form. + if get_origin(raw_hint): + hints = {arg for arg in get_args(raw_hint) if str(arg) in _JUJU_TYPES} + else: + hints = {raw_hint} + # If there are multiple types -- for example, the type annotation is + # `int | str` -- then we can't determine the type, and we fall back + # to "string", even if `str` is not in the type hint, because our + # "we can't determine the type" choice is always "string". + if len(hints) > 1: + return 'string' + elif hints: + try: + return _JUJU_TYPES[str(hints.pop())] + except KeyError: + pass + # If there's a default value, use that object's type. + if default is not None: + return _JUJU_TYPES.get(type(default).__name__, 'string') + # If we can't figure it out, then use "string", which should be the most + # compatible, and most likely to be used for arbitrary types. Charms can + # override `to_juju_schema` to adjust this if required. + return 'string' + + +def _juju_schema_from_model_fields(cls: type[object]) -> dict[str, Any]: + options = {} + for name, field in cls.model_fields.items(): # type: ignore + option = {} + if field.default is not None: # type: ignore + option['default'] = field.default # type: ignore + if field.annotation in (bool, int, float, str, Secret): # type: ignore + hint = _JUJU_TYPES[field.annotation.__name__] # type: ignore + else: + hint = field.annotation # type: ignore + if get_origin(hint): + hints = {arg for arg in get_args(hint) if str(arg) in _JUJU_TYPES} + if len(hints) > 1: + hint = type(str) + elif hints: + hint = hints.pop() + hint = _JUJU_TYPES.get(str(hint), 'string') # type: ignore + option['type'] = hint + if field.description: # type: ignore + option['description'] = field.description # type: ignore + options[name.replace('_', '-')] = option # type: ignore + return {'options': options} + + +def _juju_names(cls: type[object]) -> Generator[str]: + """Iterates over all the option names to include in the config YAML.""" + try: + yield from (field.name for field in sorted(dataclasses.fields(cls))) # type: ignore + except TypeError: + pass + else: + return + if hasattr(cls, 'model_fields'): + yield from sorted(cls.model_fields) # type: ignore + return + # Fall back to using dir() and __annotations__. + attrs = dir(cls) + attrs.extend((a for a, t in cls.__annotations__.items() if get_origin(t) is not ClassVar)) + for attr in sorted(set(attrs)): + if attr.startswith('_') or (hasattr(cls, attr) and callable(getattr(cls, attr))): + continue + yield attr + + class ConfigBase: """Base class for strongly typed charm config. @@ -64,114 +179,6 @@ def __init__(self, framework: ops.Framework): self.typed_config = self.load_config(MyConfig) """ - _JUJU_TYPES: ClassVar[dict[str, str]] = { - 'bool': 'boolean', - 'int': 'int', - 'float': 'float', - 'str': 'string', - "": 'boolean', - "": 'int', - "": 'float', - "": 'string', - 'ops.Secret': 'secret', - 'ops.model.Secret': 'secret', - "": 'secret', - "": 'secret', - } - - @classmethod - def _attr_to_juju_type(cls, name: str, default: Any = None) -> str: - """Provide the appropriate type for the config YAML for the given attribute. - - If an appropriate type cannot be determined, fall back to "string". - """ - try: - raw_hint = get_type_hints(cls)[name] - except KeyError: - pass - except TypeError: - # In Python 3.8, this fails even though __future__ annotations is - # used. Provide a reasonable effort fallback. - hint = cls.__annotations__.get(name) - if hint and '|' in hint: - hints = {h.strip() for h in hint.split('|')} - try: - hints.remove('None') - except ValueError: - pass - if len(hints) > 1: - return 'string' - hint = hints.pop() - if hint and hint.startswith('Optional['): - hint = hint[9:-1] - if hint: - return cls._JUJU_TYPES[str(hint)] - else: - # Collapse Optional[] and Union[] and so on to the simpler form. - if get_origin(raw_hint): - hints = {arg for arg in get_args(raw_hint) if str(arg) in cls._JUJU_TYPES} - else: - hints = {raw_hint} - # If there are multiple types -- for example, the type annotation is - # `int | str` -- then we can't determine the type, and we fall back - # to "string", even if `str` is not in the type hint, because our - # "we can't determine the type" choice is always "string". - if len(hints) > 1: - return 'string' - elif hints: - return cls._JUJU_TYPES[str(hints.pop())] - # If there's a default value, use that object's type. - if default is not None: - return cls._JUJU_TYPES.get(type(default).__name__, 'string') - # If we can't figure it out, then use "string", which should be the most - # compatible, and most likely to be used for arbitrary types. Charms can - # override `to_juju_schema` to adjust this if required. - return 'string' - - @classmethod - def _juju_names(cls) -> Generator[str]: - """Iterates over all the option names to include in the config YAML.""" - try: - yield from (field.name for field in sorted(dataclasses.fields(cls))) # type: ignore - except TypeError: - pass - else: - return - if hasattr(cls, 'model_fields'): - yield from sorted(cls.model_fields) # type: ignore - return - # Fall back to using dir() and __annotations__. - attrs = dir(cls) - attrs.extend((a for a, t in cls.__annotations__.items() if get_origin(t) is not ClassVar)) - for attr in sorted(set(attrs)): - if attr.startswith('_') or (hasattr(cls, attr) and callable(getattr(cls, attr))): - continue - yield attr - - @classmethod - def __juju_schema_from_model_fields(cls) -> dict[str, Any]: - options = {} - for name, field in cls.model_fields.items(): # type: ignore - option = {} - if field.default is not None: # type: ignore - option['default'] = field.default # type: ignore - if field.annotation in (bool, int, float, str, Secret): # type: ignore - hint = cls._JUJU_TYPES[field.annotation.__name__] # type: ignore - else: - hint = field.annotation # type: ignore - if get_origin(hint): - hints = {arg for arg in get_args(hint) if str(arg) in cls._JUJU_TYPES} - if len(hints) > 1: - hint = type(str) - elif hints: - hint = hints.pop() - hint = cls._JUJU_TYPES.get(str(hint), 'string') # type: ignore - option['type'] = hint - if field.description: # type: ignore - option['description'] = field.description # type: ignore - options[name.replace('_', '-')] = option # type: ignore - return {'options': options} - @classmethod def to_juju_schema(cls) -> dict[str, Any]: """Translate the class to YAML suitable for config.yaml. @@ -220,17 +227,17 @@ def to_juju_schema(cls) -> dict[str, Any]: # Special-case pydantic BaseModel or anything else with a compatible # `model_fields`` attribute. if hasattr(cls, 'model_fields'): - return cls.__juju_schema_from_model_fields() + return _juju_schema_from_model_fields(cls) # Dataclasses, regular classes, etc. attr_docstrings = attrdocs.get_attr_docstrings(cls) options: dict[str, dict[str, bool | int | float | str]] = {} - for attr in cls._juju_names(): + for attr in _juju_names(cls): option = {} default = getattr(cls, attr, None) - if default is not None and type(default).__name__ in cls._JUJU_TYPES: + if default is not None and type(default).__name__ in _JUJU_TYPES: option['default'] = default - option['type'] = cls._attr_to_juju_type(attr, default) + option['type'] = _attr_to_juju_type(cls, attr, default) doc = attr_docstrings.get(attr) if doc: option['description'] = doc diff --git a/ops/charm.py b/ops/charm.py index faf4950e8..dcd8990bb 100644 --- a/ops/charm.py +++ b/ops/charm.py @@ -37,7 +37,7 @@ cast, ) -from . import model +from . import _config, model from ._private import yaml from .framework import ( EventBase, @@ -1462,7 +1462,7 @@ def load_config( ``raise``. """ config: dict[str, bool | int | float | str | model.Secret] = kwargs.copy() - fields = set(cls._juju_names()) # type: ignore + fields = set(_config._juju_names(cls)) for key, value in self.config.items(): attr = key.replace('-', '_') if not attr.isidentifier(): diff --git a/test/test_config.py b/test/test_config.py index c773072b6..9e0a4f134 100644 --- a/test/test_config.py +++ b/test/test_config.py @@ -17,7 +17,7 @@ import dataclasses import datetime import logging -from typing import Any, Literal, Optional, Protocol, Union, cast +from typing import Literal, Optional, Protocol, Union, cast import pytest @@ -442,10 +442,11 @@ def __init__(self, x: int, y: str): self.y = datetime.date(int(year), int(month), int(day)) @classmethod - def _attr_to_juju_type(cls, attr: str, default: Any = None) -> str: - if attr == 'y': - return 'string' - return super()._attr_to_juju_type(attr, default) + def to_juju_schema(cls): + schema = super().to_juju_schema() + # Override the custom type. + schema['options']['y']['type'] = 'string' + return schema class Charm(ops.CharmBase): def __init__(self, framework: ops.Framework): From 734b292f2e977c4cdcf95e87c1c79ed1d6c1f656 Mon Sep 17 00:00:00 2001 From: Tony Meyer Date: Wed, 21 May 2025 11:14:50 +1200 Subject: [PATCH 31/79] Provide a more explicit type, per review. --- ops/_config.py | 30 +++++++++++++++++++++++++----- 1 file changed, 25 insertions(+), 5 deletions(-) diff --git a/ops/_config.py b/ops/_config.py index e9b628bd2..7a86c75b1 100644 --- a/ops/_config.py +++ b/ops/_config.py @@ -18,7 +18,18 @@ import dataclasses import logging -from typing import Any, ClassVar, Final, Generator, Mapping, get_args, get_origin, get_type_hints +from typing import ( + TYPE_CHECKING, + Any, + ClassVar, + Final, + Generator, + Mapping, + TypedDict, + get_args, + get_origin, + get_type_hints, +) from ._private import attrdocs from .model import Secret @@ -26,6 +37,16 @@ logger = logging.getLogger(__name__) +if TYPE_CHECKING: + from typing_extensions import NotRequired + + class OptionDict(TypedDict): + type: str + """The Juju option type.""" + description: NotRequired[str] + default: NotRequired[bool | int | float | str] + + _JUJU_TYPES: Final[Mapping[str, str]] = { 'bool': 'boolean', 'int': 'int', @@ -180,7 +201,7 @@ def __init__(self, framework: ops.Framework): """ @classmethod - def to_juju_schema(cls) -> dict[str, Any]: + def to_juju_schema(cls) -> dict[str, dict[str, OptionDict]]: """Translate the class to YAML suitable for config.yaml. Using :attr:`ConfigBase.to_juju_schema` will generate a YAML schema @@ -231,13 +252,12 @@ def to_juju_schema(cls) -> dict[str, Any]: # Dataclasses, regular classes, etc. attr_docstrings = attrdocs.get_attr_docstrings(cls) - options: dict[str, dict[str, bool | int | float | str]] = {} + options: dict[str, OptionDict] = {} for attr in _juju_names(cls): - option = {} default = getattr(cls, attr, None) + option: OptionDict = {'type': _attr_to_juju_type(cls, attr, default)} if default is not None and type(default).__name__ in _JUJU_TYPES: option['default'] = default - option['type'] = _attr_to_juju_type(cls, attr, default) doc = attr_docstrings.get(attr) if doc: option['description'] = doc From 5b865f2f8f568d2446743ab6d361045e519950b0 Mon Sep 17 00:00:00 2001 From: Tony Meyer Date: Wed, 21 May 2025 12:02:38 +1200 Subject: [PATCH 32/79] Get the default value via pydantic and dataclasses if needed. --- ops/_config.py | 45 ++++++++++++++++++++++++++++++++++++++------- ops/charm.py | 2 +- 2 files changed, 39 insertions(+), 8 deletions(-) diff --git a/ops/_config.py b/ops/_config.py index 7a86c75b1..dc9ace58f 100644 --- a/ops/_config.py +++ b/ops/_config.py @@ -63,7 +63,38 @@ class OptionDict(TypedDict): } -def _attr_to_juju_type(cls: type[object], name: str, default: Any = None) -> str: +def get_default_value(cls: type[object], name: str) -> Any: + """Get the default value for a class attribute.""" + # Dataclasses: + if hasattr(cls, '__dataclass_fields__'): + field = {f.name: f for f in dataclasses.fields(cls)}[name] # type: ignore + # This might be a Pydantic dataclass using a Pydantic.Field object. + field_default = ( # type: ignore + field.default.default # type: ignore + if hasattr(field.default, 'default') + else field.default + ) + if field_default is not dataclasses.MISSING: + return field_default # type: ignore + if field.default_factory is not dataclasses.MISSING: + return field.default_factory() + return None + + # Pydantic models: + if hasattr(cls, 'model_fields'): + field = cls.model_fields[name] # type: ignore + # This is a hack to avoid importing pydantic. + if 'PydanticUndefinedType' not in str(type(field.default)): # type: ignore + return field.default # type: ignore + if field.default_factory is not None: # type: ignore + return field.default_factory() # type: ignore + return None + + # Everything else: + return getattr(cls, name, None) + + +def attr_to_juju_type(cls: type[object], name: str, default: Any = None) -> str: """Provide the appropriate type for the config YAML for the given class attribute. If possible, use the type hint from the class attribute, ignoring @@ -118,7 +149,7 @@ def _attr_to_juju_type(cls: type[object], name: str, default: Any = None) -> str return 'string' -def _juju_schema_from_model_fields(cls: type[object]) -> dict[str, Any]: +def juju_schema_from_model_fields(cls: type[object]) -> dict[str, Any]: options = {} for name, field in cls.model_fields.items(): # type: ignore option = {} @@ -142,7 +173,7 @@ def _juju_schema_from_model_fields(cls: type[object]) -> dict[str, Any]: return {'options': options} -def _juju_names(cls: type[object]) -> Generator[str]: +def juju_names(cls: type[object]) -> Generator[str]: """Iterates over all the option names to include in the config YAML.""" try: yield from (field.name for field in sorted(dataclasses.fields(cls))) # type: ignore @@ -248,14 +279,14 @@ def to_juju_schema(cls) -> dict[str, Any]: # Special-case pydantic BaseModel or anything else with a compatible # `model_fields`` attribute. if hasattr(cls, 'model_fields'): - return _juju_schema_from_model_fields(cls) + return juju_schema_from_model_fields(cls) # Dataclasses, regular classes, etc. attr_docstrings = attrdocs.get_attr_docstrings(cls) options: dict[str, OptionDict] = {} - for attr in _juju_names(cls): - default = getattr(cls, attr, None) - option: OptionDict = {'type': _attr_to_juju_type(cls, attr, default)} + for attr in juju_names(cls): + default = get_default_value(cls, attr) + option: OptionDict = {'type': attr_to_juju_type(cls, attr, default)} if default is not None and type(default).__name__ in _JUJU_TYPES: option['default'] = default doc = attr_docstrings.get(attr) diff --git a/ops/charm.py b/ops/charm.py index dcd8990bb..bb9fab504 100644 --- a/ops/charm.py +++ b/ops/charm.py @@ -1462,7 +1462,7 @@ def load_config( ``raise``. """ config: dict[str, bool | int | float | str | model.Secret] = kwargs.copy() - fields = set(_config._juju_names(cls)) + fields = set(_config.juju_names(cls)) for key, value in self.config.items(): attr = key.replace('-', '_') if not attr.isidentifier(): From ea24f944fc567255f2a109bb75e2577c63c65142 Mon Sep 17 00:00:00 2001 From: Tony Meyer Date: Wed, 21 May 2025 12:07:05 +1200 Subject: [PATCH 33/79] Improve comment. --- ops/_main.py | 10 ++++++---- 1 file changed, 6 insertions(+), 4 deletions(-) diff --git a/ops/_main.py b/ops/_main.py index 0bfc11179..23575d610 100644 --- a/ops/_main.py +++ b/ops/_main.py @@ -462,10 +462,12 @@ def run(self): # Optionally set a status message on the unit. if e.status: self._model_backend.status_set('blocked', e.status) - # We exit with a zero exit code because we don't want Juju to go into - # error status (for config we have set a status ourselves) and we - # don't want to automatically retry (the Juju user must correct the - # data to match the schema). + # We exit with a zero exit code. If this has been raised when + # loading config, we don't want to go into error status, which would + # overwrite any status we set above and would automatically retry, + # even though the Juju user must manually fix the config. If this + # has been raised when loading action parameters, we don't want the + # action to *crash*, we want it to gracefully fail. raise _Abort(0) from e finally: self.framework.close() From dc61cc9aafa2a58fc977777754fe5e0bc35489fe Mon Sep 17 00:00:00 2001 From: Tony Meyer Date: Wed, 21 May 2025 12:16:33 +1200 Subject: [PATCH 34/79] Simplify the BaseModel case. --- ops/_private/attrdocs.py | 11 +++++++++-- 1 file changed, 9 insertions(+), 2 deletions(-) diff --git a/ops/_private/attrdocs.py b/ops/_private/attrdocs.py index 870812e03..cf9f6ecd4 100644 --- a/ops/_private/attrdocs.py +++ b/ops/_private/attrdocs.py @@ -65,8 +65,15 @@ def visit_ClassDef(self, node: ast.ClassDef): # noqa: N802 def get_attr_docstrings(cls: type[object]) -> dict[str, str]: docs: dict[str, str] = {} - # pydantic stores descriptions in the field object. - if hasattr(cls, '__dataclass_fields__'): + # For Pydantic models, we expect to have the docstrings in field objects. + if hasattr(cls, 'model_fields'): + for attr, field in cls.model_fields.items(): # type: ignore + if hasattr(field, 'description') and field.description: # type: ignore + docs[attr] = field.description # type: ignore + + # For Pydantic dataclasses, we expect to have the docstrings in field + # objects, but there's no "model_fields" attribute. + elif hasattr(cls, '__dataclass_fields__'): fields = cast('dict[str, Any]', cls.__dataclass_fields__) # type: ignore for attr, field in fields.items(): if ( From bf3b0bd6f72ecf5697d35f2f118fe695e8282442 Mon Sep 17 00:00:00 2001 From: Tony Meyer Date: Wed, 21 May 2025 12:22:26 +1200 Subject: [PATCH 35/79] Use fields() per review. --- ops/_private/attrdocs.py | 9 ++++----- 1 file changed, 4 insertions(+), 5 deletions(-) diff --git a/ops/_private/attrdocs.py b/ops/_private/attrdocs.py index cf9f6ecd4..728bd911a 100644 --- a/ops/_private/attrdocs.py +++ b/ops/_private/attrdocs.py @@ -27,9 +27,9 @@ class Foo: from __future__ import annotations import ast +import dataclasses import inspect import logging -from typing import Any, cast logger = logging.getLogger(__name__) @@ -74,14 +74,13 @@ def get_attr_docstrings(cls: type[object]) -> dict[str, str]: # For Pydantic dataclasses, we expect to have the docstrings in field # objects, but there's no "model_fields" attribute. elif hasattr(cls, '__dataclass_fields__'): - fields = cast('dict[str, Any]', cls.__dataclass_fields__) # type: ignore - for attr, field in fields.items(): + for field in dataclasses.fields(cls): # type: ignore if ( hasattr(field, 'default') and hasattr(field.default, 'description') - and field.default.description + and field.default.description # type: ignore ): - docs[attr] = field.default.description + docs[field.name] = field.default.description # type: ignore try: source_code = inspect.getsource(cls) From 703938c2bce36e29a6d94d4b845028286537cf85 Mon Sep 17 00:00:00 2001 From: Tony Meyer Date: Wed, 21 May 2025 12:23:56 +1200 Subject: [PATCH 36/79] Update ops/_private/attrdocs.py Co-authored-by: James Garner --- ops/_private/attrdocs.py | 19 +++++++++---------- 1 file changed, 9 insertions(+), 10 deletions(-) diff --git a/ops/_private/attrdocs.py b/ops/_private/attrdocs.py index 728bd911a..3421201fb 100644 --- a/ops/_private/attrdocs.py +++ b/ops/_private/attrdocs.py @@ -86,14 +86,13 @@ def get_attr_docstrings(cls: type[object]) -> dict[str, str]: source_code = inspect.getsource(cls) except OSError: logger.debug('No source code found for %s', cls.__name__) - else: - try: - tree = ast.parse(source_code) - except (SyntaxError, IndentationError): - logger.debug('Failed to parse source code for %s', cls.__name__) - else: - extractor = AttributeDocstringExtractor() - extractor.visit(tree) - docs.update(extractor.attribute_docs) - + return docs + try: + tree = ast.parse(source_code) + except (SyntaxError, IndentationError): + logger.debug('Failed to parse source code for %s', cls.__name__) + return docs + extractor = AttributeDocstringExtractor() + extractor.visit(tree) + docs.update(extractor.attribute_docs) return docs From 9d614ea7c54e653834bd2f40917c7a069a6a6c3a Mon Sep 17 00:00:00 2001 From: Tony Meyer Date: Wed, 21 May 2025 13:25:03 +1200 Subject: [PATCH 37/79] Update ops/charm.py Co-authored-by: Ben Hoyt --- ops/charm.py | 2 +- 1 file changed, 1 insertion(+), 1 deletion(-) diff --git a/ops/charm.py b/ops/charm.py index bb9fab504..5f02d9a59 100644 --- a/ops/charm.py +++ b/ops/charm.py @@ -1446,7 +1446,7 @@ def load_config( Args: cls: A class that inherits from :class:`ops.ConfigBase`. errors: what to do if the config is invalid. If ``blocked``, the - charm will exit successfully (note that this informs Juju that + charm will exit successfully (this informs Juju that the event was handled and it will not be retried) after setting an appropriate blocked status. If ``raise``, ``load_config`` will not catch any exceptions, leaving the charm to handle From b929496fc2e278ef7d49f5d3bc3e1e166203de3d Mon Sep 17 00:00:00 2001 From: Tony Meyer Date: Wed, 21 May 2025 12:26:31 +1200 Subject: [PATCH 38/79] Add comment so that when 3.8 support is dropped this is found. --- tox.ini | 2 ++ 1 file changed, 2 insertions(+) diff --git a/tox.ini b/tox.ini index 34cd74617..0521951b3 100644 --- a/tox.ini +++ b/tox.ini @@ -111,6 +111,7 @@ deps = pytest-xdist~=3.6 typing_extensions~=4.2 jsonpatch~=1.33 + # Note that this should not be required when we drop Python 3.8 support. eval-type-backport~=0.2 pydantic~=2.10 -e . @@ -139,6 +140,7 @@ deps = pytest~=7.2 typing_extensions~=4.2 jsonpatch~=1.33 + # Note that this should not be required when we drop Python 3.8 support. eval-type-backport~=0.2 -e . -e testing From 832a6d1c5c9a41b0c73aeedffad702b8289c0ef9 Mon Sep 17 00:00:00 2001 From: Tony Meyer Date: Wed, 21 May 2025 12:28:24 +1200 Subject: [PATCH 39/79] Minor tweak per review. --- ops/charm.py | 3 ++- 1 file changed, 2 insertions(+), 1 deletion(-) diff --git a/ops/charm.py b/ops/charm.py index 5f02d9a59..f42c42909 100644 --- a/ops/charm.py +++ b/ops/charm.py @@ -1475,7 +1475,8 @@ def load_config( # Convert secret IDs to secret objects. We create the object rather # that using model.get_secret so that it's entirely lazy, in the # same way that SecretEvent.secret is. - if option_type and option_type.type == 'secret' and isinstance(value, str): + if option_type and option_type.type == 'secret': + assert isinstance(value, str) # Juju will have made sure of this. value = model.Secret( backend=self.model._backend, id=value, From 4294b296d6bc336e16b8813796bbb3e234d82a79 Mon Sep 17 00:00:00 2001 From: Tony Meyer Date: Wed, 21 May 2025 14:29:11 +1200 Subject: [PATCH 40/79] Remove the custom exception. --- ops/_main.py | 11 -------- ops/charm.py | 12 ++++++-- ops/model.py | 8 ------ test/charms/test_main/config.yaml | 5 +--- test/charms/test_main/src/charm.py | 12 -------- test/test_config.py | 8 ++++-- test/test_main.py | 45 ------------------------------ 7 files changed, 17 insertions(+), 84 deletions(-) diff --git a/ops/_main.py b/ops/_main.py index 23575d610..8925bd25a 100644 --- a/ops/_main.py +++ b/ops/_main.py @@ -458,17 +458,6 @@ def run(self): self._emit() self._commit() self._close() - except _model._InvalidSchemaError as e: - # Optionally set a status message on the unit. - if e.status: - self._model_backend.status_set('blocked', e.status) - # We exit with a zero exit code. If this has been raised when - # loading config, we don't want to go into error status, which would - # overwrite any status we set above and would automatically retry, - # even though the Juju user must manually fix the config. If this - # has been raised when loading action parameters, we don't want the - # action to *crash*, we want it to gracefully fail. - raise _Abort(0) from e finally: self.framework.close() diff --git a/ops/charm.py b/ops/charm.py index f42c42909..56192785c 100644 --- a/ops/charm.py +++ b/ops/charm.py @@ -1461,6 +1461,8 @@ def load_config( ValueError: if the configuration is invalid and ``errors`` is set to ``raise``. """ + from ._main import _Abort + config: dict[str, bool | int | float | str | model.Secret] = kwargs.copy() fields = set(_config.juju_names(cls)) for key, value in self.config.items(): @@ -1468,7 +1470,8 @@ def load_config( if not attr.isidentifier(): if errors == 'raise': raise ValueError(f'Invalid attribute name {attr}') - raise model._InvalidSchemaError(status=f'Invalid attribute name {attr}') + self.unit.status = model.BlockedStatus(f'Invalid attribute name {attr}') + raise _Abort(0) if attr not in fields: continue option_type = self.meta.config.get(key) @@ -1488,7 +1491,12 @@ def load_config( except ValueError as e: if errors == 'raise': raise - raise model._InvalidSchemaError(status=f'Error in config: {e}') from e + # We exit with a zero code because we don't want Juju to retry + # (the config needs to be fixed by the Juju user), and we don't + # want the status we just set to be overridden by an error + # status. + self.unit.status = model.BlockedStatus(f'Invalid config: {e}') + raise _Abort(0) from e def _evaluate_status(charm: CharmBase): # pyright: ignore[reportUnusedFunction] diff --git a/ops/model.py b/ops/model.py index 382d3a49d..e525f1f99 100644 --- a/ops/model.py +++ b/ops/model.py @@ -3269,14 +3269,6 @@ class SecretNotFoundError(ModelError): """Raised when the specified secret does not exist.""" -class _InvalidSchemaError(Exception): # pyright: ignore[reportUnusedClass] - """Raised when a config option or action parameter schema does not match the data.""" - - def __init__(self, message: str = '', status: str | None = None): - super().__init__(message) - self.status = status - - _ACTION_RESULT_KEY_REGEX = re.compile(r'^[a-z0-9](([a-z0-9-.]+)?[a-z0-9])?$') diff --git a/test/charms/test_main/config.yaml b/test/charms/test_main/config.yaml index 3fd291200..75824ae81 100644 --- a/test/charms/test_main/config.yaml +++ b/test/charms/test_main/config.yaml @@ -12,7 +12,4 @@ # See the License for the specific language governing permissions and # limitations under the License. -options: - invalid: - type: string - description: Fail if set, using the value as the status message. +options: {} diff --git a/test/charms/test_main/src/charm.py b/test/charms/test_main/src/charm.py index 8d4182e30..ab73b93f9 100755 --- a/test/charms/test_main/src/charm.py +++ b/test/charms/test_main/src/charm.py @@ -22,7 +22,6 @@ import warnings import ops -import ops.model sys.path.append('lib') @@ -142,17 +141,6 @@ def _on_start(self, event: ops.StartEvent): self._stored.observed_event_types.append(type(event).__name__) def _on_config_changed(self, event: ops.ConfigChangedEvent): - if 'invalid' in self.config: - if self.config['invalid'] == 'invalid': - raise ops.model._InvalidSchemaError() - - status = str(self.config['invalid']) - - class Config(ops.ConfigBase): - def __init__(self, **_): - raise ValueError(status) - - self.load_config(Config, errors='blocked') self._stored.on_config_changed.append(type(event).__name__) self._stored.observed_event_types.append(type(event).__name__) event.defer() diff --git a/test/test_config.py b/test/test_config.py index 9e0a4f134..97b8e2af0 100644 --- a/test/test_config.py +++ b/test/test_config.py @@ -28,8 +28,8 @@ pydantic = None import ops +import ops._main import ops._private.yaml -import ops.model as _model from ops import testing logger = logging.getLogger(__name__) @@ -291,7 +291,7 @@ def test_config_init_non_default(charm_class: type[ops.CharmBase], request: pyte @pytest.mark.parametrize( 'errors,exc', - (('raise', ValueError), ('blocked', _model._InvalidSchemaError), (None, ValueError)), + (('raise', ValueError), ('blocked', ops._main._Abort), (None, ValueError)), ) @pytest.mark.parametrize('charm_class', _test_classes) def test_config_with_error_blocked( @@ -310,6 +310,10 @@ def test_config_with_error_blocked( }) with pytest.raises(exc): harness.begin() + if errors == 'blocked': + status_dict = harness._backend.status_get() + assert status_dict['status'] == 'blocked' + assert 'my_int must be zero or positive' in status_dict['message'] @pytest.mark.parametrize('charm_class', _test_classes) diff --git a/test/test_main.py b/test/test_main.py index 2329966fa..cb6928872 100644 --- a/test/test_main.py +++ b/test/test_main.py @@ -425,7 +425,6 @@ def test_event_reemitted(self, fake_script: FakeScript): assert isinstance(state, ops.BoundStoredState) assert list(state.observed_event_types) == ['InstallEvent'] - fake_script.write('config-get', "echo '{}'") state = self._simulate_event( fake_script, EventSpec(ops.ConfigChangedEvent, 'config-changed') ) @@ -442,7 +441,6 @@ def test_event_reemitted(self, fake_script: FakeScript): @pytest.mark.usefixtures('setup_charm') def test_no_reemission_on_collect_metrics(self, fake_script: FakeScript): fake_script.write('add-metric', 'exit 0') - fake_script.write('config-get', "echo '{}'") # First run "install" to make sure all hooks are set up. state = self._simulate_event(fake_script, EventSpec(ops.InstallEvent, 'install')) @@ -1110,49 +1108,6 @@ def test_hook_and_dispatch_but_hook_is_dispatch_copy(self, fake_script: FakeScri assert calls == expected - @pytest.mark.usefixtures('setup_charm') - def test_invalid_schema_clean_exit(self, fake_script: FakeScript): - # First run "install" to make sure all hooks are set up. - state = self._simulate_event(fake_script, EventSpec(ops.InstallEvent, 'install')) - assert isinstance(state, ops.BoundStoredState) - assert list(state.observed_event_types) == ['InstallEvent'] - - fake_script.write('config-get', 'echo \'{"invalid": "invalid"}\'') - state = self._simulate_event( - fake_script, - EventSpec( - ops.ConfigChangedEvent, - 'config-changed', - ), - ) - assert isinstance(state, ops.BoundStoredState) - expected = [['is-leader', '--format=json'], ['config-get', '--format=json']] - assert [call for call in fake_script.calls() if call[0] != 'juju-log'] == expected - - @pytest.mark.usefixtures('setup_charm') - def test_invalid_schema_set_status(self, fake_script: FakeScript): - # First run "install" to make sure all hooks are set up. - state = self._simulate_event(fake_script, EventSpec(ops.InstallEvent, 'install')) - assert isinstance(state, ops.BoundStoredState) - assert list(state.observed_event_types) == ['InstallEvent'] - - fake_script.write('config-get', 'echo \'{"invalid": "status message"}\'') - fake_script.write('status-set', 'exit 0') - state = self._simulate_event( - fake_script, - EventSpec( - ops.ConfigChangedEvent, - 'config-changed', - ), - ) - assert isinstance(state, ops.BoundStoredState) - expected = [ - ['is-leader', '--format=json'], - ['config-get', '--format=json'], - ['status-set', '--application=False', 'blocked', 'Error in config: status message'], - ] - assert [call for call in fake_script.calls() if call[0] != 'juju-log'] == expected - class TestMainWithDispatchAsSymlink(_TestMain): def _setup_entry_point(self): From f4ebc542b19224e73796fa1bab0c98a6a61ef17f Mon Sep 17 00:00:00 2001 From: Tony Meyer Date: Wed, 21 May 2025 14:32:46 +1200 Subject: [PATCH 41/79] Reword docstring. --- ops/charm.py | 10 +++++----- 1 file changed, 5 insertions(+), 5 deletions(-) diff --git a/ops/charm.py b/ops/charm.py index 56192785c..c4ad4506e 100644 --- a/ops/charm.py +++ b/ops/charm.py @@ -1430,18 +1430,18 @@ def load_config( ) -> _ConfigType: """Load the config into an instance of a config class. - The object will be instantiated with keyword arguments of the raw Juju - config for all the options that are found in the class, but with: + The raw Juju config is passed to the config class's ``__init__``, as + keyword arguments, with the following changes: - * ``secret`` type options having a :class:`model.Secret` value rather + * ``secret`` type options have a :class:`model.Secret` value rather than the secret ID. Note that the secret object is not validated by Juju at this time, so may raise :class:`SecretNotFoundError` when it is later used if the secret does not exist or the unit does not have permission to access it. * dashes in names converted to underscores. - Any additional positional or keyword arguments will be passed through to - the config class. + Any additional positional or keyword arguments to this method will be + passed through to the config class ``__init__``. Args: cls: A class that inherits from :class:`ops.ConfigBase`. From 86a85d982c81499f821d22e3f15d0430edf7091b Mon Sep 17 00:00:00 2001 From: Tony Meyer Date: Mon, 7 Jul 2025 14:20:55 +1200 Subject: [PATCH 42/79] Tidy up after merge. --- docs/custom_conf.py | 1 - ops/__init__.py | 4 ---- 2 files changed, 5 deletions(-) diff --git a/docs/custom_conf.py b/docs/custom_conf.py index 568d1920b..a142c82f5 100644 --- a/docs/custom_conf.py +++ b/docs/custom_conf.py @@ -345,7 +345,6 @@ ('py:class', 'ReadableSpan'), ('py:obj', 'ops._private.harness.CharmType'), ('py:class', 'ops._private.harness.CharmType'), - ('py:class', 'ops.charm._ConfigType'), ('py:class', 'ops.charm._ContainerBaseDict'), ('py:class', 'ops.charm._T'), ('py:class', 'ops.model._AddressDict'), diff --git a/ops/__init__.py b/ops/__init__.py index 28c8bc184..1e186df0e 100644 --- a/ops/__init__.py +++ b/ops/__init__.py @@ -185,8 +185,6 @@ 'Unit', 'UnknownStatus', 'WaitingStatus', - # From _config.py - 'ConfigBase', ] # The isort command wants to rearrange the nicely-formatted imports below; @@ -338,8 +336,6 @@ WaitingStatus, ) -from ._config import ConfigBase - # NOTE: don't import testing or Harness here, as that's a test-time concern # rather than a runtime concern. From d1f1113ee30542526894d51cd64588557951f895 Mon Sep 17 00:00:00 2001 From: Tony Meyer Date: Mon, 7 Jul 2025 14:26:31 +1200 Subject: [PATCH 43/79] Small cleanup. --- ops/_config.py | 30 +++--------------------------- 1 file changed, 3 insertions(+), 27 deletions(-) diff --git a/ops/_config.py b/ops/_config.py index dc9ace58f..d5f539da8 100644 --- a/ops/_config.py +++ b/ops/_config.py @@ -52,22 +52,15 @@ class OptionDict(TypedDict): 'int': 'int', 'float': 'float', 'str': 'string', - "": 'boolean', - "": 'int', - "": 'float', - "": 'string', 'ops.Secret': 'secret', 'ops.model.Secret': 'secret', - "": 'secret', - "": 'secret', } def get_default_value(cls: type[object], name: str) -> Any: """Get the default value for a class attribute.""" - # Dataclasses: - if hasattr(cls, '__dataclass_fields__'): - field = {f.name: f for f in dataclasses.fields(cls)}[name] # type: ignore + if dataclasses.is_dataclass(cls): + field = {f.name: f for f in dataclasses.fields(cls)}[name] # This might be a Pydantic dataclass using a Pydantic.Field object. field_default = ( # type: ignore field.default.default # type: ignore @@ -106,23 +99,6 @@ def attr_to_juju_type(cls: type[object], name: str, default: Any = None) -> str: raw_hint = get_type_hints(cls)[name] except KeyError: pass - except TypeError: - # In Python 3.8, this fails even though __future__ annotations is - # used. Provide a reasonable effort fallback. - hint = cls.__annotations__.get(name) - if hint and '|' in hint: - hints = {h.strip() for h in hint.split('|')} - try: - hints.remove('None') - except ValueError: - pass - if len(hints) > 1: - return 'string' - hint = hints.pop() - if hint and hint.startswith('Optional['): - hint = hint[9:-1] - if hint: - return _JUJU_TYPES[str(hint)] else: # Collapse Optional[] and Union[] and so on to the simpler form. if get_origin(raw_hint): @@ -156,7 +132,7 @@ def juju_schema_from_model_fields(cls: type[object]) -> dict[str, Any]: if field.default is not None: # type: ignore option['default'] = field.default # type: ignore if field.annotation in (bool, int, float, str, Secret): # type: ignore - hint = _JUJU_TYPES[field.annotation.__name__] # type: ignore + hint = _JUJU_TYPES[field.annotation.__name__] else: hint = field.annotation # type: ignore if get_origin(hint): From dac0582208f7e7e7ab7cb8408556c8a6669f1bad Mon Sep 17 00:00:00 2001 From: Tony Meyer Date: Fri, 8 Aug 2025 12:57:14 +1200 Subject: [PATCH 44/79] Shuffle things around. --- .gitignore | 1 + ops/_config.py | 272 --- pyproject.toml | 15 +- test/test_config.py | 352 --- testing/tests/test_e2e/test_config.py | 9 +- tools/README.md | 112 + tools/pyproject.toml | 54 + tools/src/ops_tools.egg-info/PKG-INFO | 145 ++ tools/src/ops_tools.egg-info/SOURCES.txt | 12 + .../ops_tools.egg-info/dependency_links.txt | 1 + tools/src/ops_tools.egg-info/requires.txt | 3 + tools/src/ops_tools.egg-info/top_level.txt | 1 + tools/src/ops_tools/__init__.py | 27 + .../src/ops_tools/_attrdocs.py | 29 +- tools/src/ops_tools/_generate_yaml.py | 411 ++++ tools/src/ops_tools/py.typed | 0 tools/tests-ugh/__init__.py | 13 + tools/tests-ugh/test_generate_yaml_action.py | 304 +++ tools/tests-ugh/test_generate_yaml_config.py | 238 ++ tox.ini | 2 + uv.lock | 2002 +++++++++-------- 21 files changed, 2369 insertions(+), 1634 deletions(-) delete mode 100644 ops/_config.py delete mode 100644 test/test_config.py create mode 100644 tools/README.md create mode 100644 tools/pyproject.toml create mode 100644 tools/src/ops_tools.egg-info/PKG-INFO create mode 100644 tools/src/ops_tools.egg-info/SOURCES.txt create mode 100644 tools/src/ops_tools.egg-info/dependency_links.txt create mode 100644 tools/src/ops_tools.egg-info/requires.txt create mode 100644 tools/src/ops_tools.egg-info/top_level.txt create mode 100644 tools/src/ops_tools/__init__.py rename ops/_private/attrdocs.py => tools/src/ops_tools/_attrdocs.py (84%) create mode 100644 tools/src/ops_tools/_generate_yaml.py create mode 100644 tools/src/ops_tools/py.typed create mode 100644 tools/tests-ugh/__init__.py create mode 100644 tools/tests-ugh/test_generate_yaml_action.py create mode 100644 tools/tests-ugh/test_generate_yaml_config.py diff --git a/.gitignore b/.gitignore index 76dda7259..ce518973e 100644 --- a/.gitignore +++ b/.gitignore @@ -13,6 +13,7 @@ coverage.xml .coverage.data /.tox .*.swp +.ruff_cache # Tokens and settings for `act` to run GHA locally .env diff --git a/ops/_config.py b/ops/_config.py deleted file mode 100644 index d5f539da8..000000000 --- a/ops/_config.py +++ /dev/null @@ -1,272 +0,0 @@ -# Copyright 2025 Canonical Ltd. -# -# Licensed under the Apache License, Version 2.0 (the "License"); -# you may not use this file except in compliance with the License. -# You may obtain a copy of the License at -# -# http://www.apache.org/licenses/LICENSE-2.0 -# -# Unless required by applicable law or agreed to in writing, software -# distributed under the License is distributed on an "AS IS" BASIS, -# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. -# See the License for the specific language governing permissions and -# limitations under the License. - -"""Support for strongly typed charm config.""" - -from __future__ import annotations - -import dataclasses -import logging -from typing import ( - TYPE_CHECKING, - Any, - ClassVar, - Final, - Generator, - Mapping, - TypedDict, - get_args, - get_origin, - get_type_hints, -) - -from ._private import attrdocs -from .model import Secret - -logger = logging.getLogger(__name__) - - -if TYPE_CHECKING: - from typing_extensions import NotRequired - - class OptionDict(TypedDict): - type: str - """The Juju option type.""" - description: NotRequired[str] - default: NotRequired[bool | int | float | str] - - -_JUJU_TYPES: Final[Mapping[str, str]] = { - 'bool': 'boolean', - 'int': 'int', - 'float': 'float', - 'str': 'string', - 'ops.Secret': 'secret', - 'ops.model.Secret': 'secret', -} - - -def get_default_value(cls: type[object], name: str) -> Any: - """Get the default value for a class attribute.""" - if dataclasses.is_dataclass(cls): - field = {f.name: f for f in dataclasses.fields(cls)}[name] - # This might be a Pydantic dataclass using a Pydantic.Field object. - field_default = ( # type: ignore - field.default.default # type: ignore - if hasattr(field.default, 'default') - else field.default - ) - if field_default is not dataclasses.MISSING: - return field_default # type: ignore - if field.default_factory is not dataclasses.MISSING: - return field.default_factory() - return None - - # Pydantic models: - if hasattr(cls, 'model_fields'): - field = cls.model_fields[name] # type: ignore - # This is a hack to avoid importing pydantic. - if 'PydanticUndefinedType' not in str(type(field.default)): # type: ignore - return field.default # type: ignore - if field.default_factory is not None: # type: ignore - return field.default_factory() # type: ignore - return None - - # Everything else: - return getattr(cls, name, None) - - -def attr_to_juju_type(cls: type[object], name: str, default: Any = None) -> str: - """Provide the appropriate type for the config YAML for the given class attribute. - - If possible, use the type hint from the class attribute, ignoring - optionality. Fall back to the type of the default value if it is not None. - - If an appropriate type cannot be determined, fall back to "string". - """ - try: - raw_hint = get_type_hints(cls)[name] - except KeyError: - pass - else: - # Collapse Optional[] and Union[] and so on to the simpler form. - if get_origin(raw_hint): - hints = {arg for arg in get_args(raw_hint) if str(arg) in _JUJU_TYPES} - else: - hints = {raw_hint} - # If there are multiple types -- for example, the type annotation is - # `int | str` -- then we can't determine the type, and we fall back - # to "string", even if `str` is not in the type hint, because our - # "we can't determine the type" choice is always "string". - if len(hints) > 1: - return 'string' - elif hints: - try: - return _JUJU_TYPES[str(hints.pop())] - except KeyError: - pass - # If there's a default value, use that object's type. - if default is not None: - return _JUJU_TYPES.get(type(default).__name__, 'string') - # If we can't figure it out, then use "string", which should be the most - # compatible, and most likely to be used for arbitrary types. Charms can - # override `to_juju_schema` to adjust this if required. - return 'string' - - -def juju_schema_from_model_fields(cls: type[object]) -> dict[str, Any]: - options = {} - for name, field in cls.model_fields.items(): # type: ignore - option = {} - if field.default is not None: # type: ignore - option['default'] = field.default # type: ignore - if field.annotation in (bool, int, float, str, Secret): # type: ignore - hint = _JUJU_TYPES[field.annotation.__name__] - else: - hint = field.annotation # type: ignore - if get_origin(hint): - hints = {arg for arg in get_args(hint) if str(arg) in _JUJU_TYPES} - if len(hints) > 1: - hint = type(str) - elif hints: - hint = hints.pop() - hint = _JUJU_TYPES.get(str(hint), 'string') # type: ignore - option['type'] = hint - if field.description: # type: ignore - option['description'] = field.description # type: ignore - options[name.replace('_', '-')] = option # type: ignore - return {'options': options} - - -def juju_names(cls: type[object]) -> Generator[str]: - """Iterates over all the option names to include in the config YAML.""" - try: - yield from (field.name for field in sorted(dataclasses.fields(cls))) # type: ignore - except TypeError: - pass - else: - return - if hasattr(cls, 'model_fields'): - yield from sorted(cls.model_fields) # type: ignore - return - # Fall back to using dir() and __annotations__. - attrs = dir(cls) - attrs.extend((a for a, t in cls.__annotations__.items() if get_origin(t) is not ClassVar)) - for attr in sorted(set(attrs)): - if attr.startswith('_') or (hasattr(cls, attr) and callable(getattr(cls, attr))): - continue - yield attr - - -class ConfigBase: - """Base class for strongly typed charm config. - - Use ``ConfigBase`` as a base class for your config class, and define the - attributes as you would in ``charmcraft.yaml``. For example:: - - @dataclasses.dataclass(frozen=True) - class MyConfig(ops.ConfigBase): - my_bool: bool | None = None - '''A boolean value.''' - my_float: float = 3.14 - '''A floating point value.''' - my_int: int = 42 - '''An integer value.''' - my_str: str = "foo" - '''A string value.''' - my_secret: ops.Secret | None = None - '''A user secret.''' - - .. note:: - - This example is a dataclass, but the class can be any that inherits from - ``ops.ConfigBase``, and that can be initialised with the raw Juju config - passed as keyword arguments. Any errors should be indicated by raising - ``ValueError`` (or a ``ValueError`` subclass) in initialisation. - - Inheriting from ``ops.ConfigBase`` is not strictly necessary, but it - provides a utility method for translating the class to a YAML schema - suitable for use with Juju. - - Use this in your charm class like so:: - - class MyCharm(ops.CharmBase): - def __init__(self, framework: ops.Framework): - super().__init__(framework) - self.typed_config = self.load_config(MyConfig) - """ - - @classmethod - def to_juju_schema(cls) -> dict[str, dict[str, OptionDict]]: - """Translate the class to YAML suitable for config.yaml. - - Using :attr:`ConfigBase.to_juju_schema` will generate a YAML schema - suitable for use in ``config.yaml``. For example, with the class from - the example above:: - - print(yaml.dump(MyConfig.to_juju_schema())) - - Will output:: - - options: - my-bool: - type: boolean - description: A boolean value. - my-float: - type: float - default: 3.14 - description: A floating point value. - my-int: - type: int - default: 42 - description: An integer value. - my-str: - type: string - default: foo - description: A string value. - my-secret: - type: secret - description: A user secret. - - Options with a default value of ``None`` will not have a ``default`` key - in the output. If the type of the option cannot be determined, it will - be set to ``string``. - - To customise, override this method in your subclass. For example:: - - @classmethod - def to_juju_schema(cls) -> dict[str, Any]: - schema = super().to_juju_schema() - # Change the key names to upper-case. - schema = {key.upper(): value for key, value in schema.items()} - return schema - """ - # Special-case pydantic BaseModel or anything else with a compatible - # `model_fields`` attribute. - if hasattr(cls, 'model_fields'): - return juju_schema_from_model_fields(cls) - - # Dataclasses, regular classes, etc. - attr_docstrings = attrdocs.get_attr_docstrings(cls) - options: dict[str, OptionDict] = {} - for attr in juju_names(cls): - default = get_default_value(cls, attr) - option: OptionDict = {'type': attr_to_juju_type(cls, attr, default)} - if default is not None and type(default).__name__ in _JUJU_TYPES: - option['default'] = default - doc = attr_docstrings.get(attr) - if doc: - option['description'] = doc - options[attr.replace('_', '-')] = option - return {'options': options} diff --git a/pyproject.toml b/pyproject.toml index 9a03a9c40..bd867dd5e 100644 --- a/pyproject.toml +++ b/pyproject.toml @@ -42,6 +42,7 @@ lint = [ ] docs = [ "ops[testing,tracing]", + "ops-tools", "canonical-sphinx-extensions", "furo", "linkify-it-py", @@ -58,11 +59,13 @@ docs = [ ] static = [ "ops[testing,tracing]", + "ops-tools", "pyright==1.1.385", "typing_extensions~=4.2", ] unit = [ "ops[testing,tracing]", + "ops-tools", "pytest~=8.4", "jsonpatch~=1.33", "pydantic~=2.10", @@ -79,6 +82,7 @@ benchmark = [ ] integration = [ "ops[testing,tracing]", + "ops-tools", "pytest~=8.4", "pytest-operator~=0.23", "jubilant~=1.2", @@ -102,12 +106,13 @@ requires = [ build-backend = "setuptools.build_meta" [tool.uv.workspace] -members = ["tracing", "testing"] +members = ["tracing", "testing", "tools"] [tool.uv.sources] ops = { workspace = true } ops-scenario = { workspace = true } ops-tracing = { workspace = true } +ops-tools = { workspace = true } [tool.setuptools.packages.find] include = ["ops"] @@ -288,6 +293,10 @@ exclude = [ "RUF015", # Prefer `next` over single element slice "SIM115", # Use a context manager for opening files ] +"tools/tests/*" = [ + # All documentation linting. + "D", +] "ops/_private/timeconv.py" = [ "RUF001", # String contains ambiguous `µ` (MICRO SIGN). Did you mean `μ` (GREEK SMALL LETTER MU)? "RUF002", # Docstring contains ambiguous `µ` (MICRO SIGN). Did you mean `μ` (GREEK SMALL LETTER MU)? @@ -319,9 +328,9 @@ convention = "google" builtins-ignorelist = ["id", "min", "map", "range", "type", "TimeoutError", "ConnectionError", "Warning", "input", "format"] [tool.pyright] -include = ["ops/*.py", "ops/_private/*.py", "test/*.py", "test/charms/*/src/*.py", "testing/src/*.py"] +include = ["ops/*.py", "ops/_private/*.py", "test/*.py", "test/charms/*/src/*.py", "testing/src/*.py", "tools/src/*.py", "tools/tests/*.py"] exclude = ["tracing/*"] -extraPaths = ["testing", "tracing"] +extraPaths = ["testing", "tracing", "tools"] pythonVersion = "3.10" # check no python > 3.10 features are used pythonPlatform = "All" typeCheckingMode = "strict" diff --git a/test/test_config.py b/test/test_config.py deleted file mode 100644 index 7e01cba20..000000000 --- a/test/test_config.py +++ /dev/null @@ -1,352 +0,0 @@ -# Copyright 2025 Canonical Ltd. -# -# Licensed under the Apache License, Version 2.0 (the "License"); -# you may not use this file except in compliance with the License. -# You may obtain a copy of the License at -# -# http://www.apache.org/licenses/LICENSE-2.0 -# -# Unless required by applicable law or agreed to in writing, software -# distributed under the License is distributed on an "AS IS" BASIS, -# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. -# See the License for the specific language governing permissions and -# limitations under the License. - -from __future__ import annotations - -import dataclasses -import datetime -import logging -from typing import Literal, Optional, Protocol, Union - -import pytest - -try: - import pydantic - import pydantic.dataclasses -except ImportError: - pydantic = None - -import ops -import ops._main -import ops._private.yaml -from ops import testing - -logger = logging.getLogger(__name__) - -JUJU_TYPES = Union[bool, int, float, str] - - -class _ConfigProtocol(Protocol): - my_bool: bool | None - my_int: int - my_float: float - my_str: str - my_secret: Optional[ops.Secret] # noqa: UP045 - - -class MyConfig(ops.ConfigBase): - my_bool: bool | None = None - """A Boolean value.""" - - my_int: int = 42 - """A positive integer value.""" - - my_float: float = 3.14 - """A floating point value.""" - - my_str: str = 'foo' - """A string value.""" - - my_secret: Optional[ops.Secret] = None # noqa: UP045 'Optional' and not '| None' to exercise that path. - """A user secret.""" - - def __init__( - self, - *, - my_bool: JUJU_TYPES | None = None, - my_int: JUJU_TYPES = 42, - my_float: JUJU_TYPES = 3.14, - my_str: JUJU_TYPES = 'foo', - my_secret: ops.Secret | None = None, - ): - super().__init__() - if my_bool is not None and not isinstance(my_bool, bool): - raise ValueError('my_bool must be a Boolean') - self.my_bool = my_bool - if not isinstance(my_float, float): - raise ValueError('my_float must be a float') - self.my_float = my_float - if not isinstance(my_int, int): - raise ValueError('my_int must be an integer') - if my_int < 0: - raise ValueError('my_int must be zero or positive') - self.my_int = my_int - if not isinstance(my_str, str): - raise ValueError('my_str must be a string') - self.my_str = my_str - if my_secret is not None: - if not isinstance(my_secret, ops.Secret): - raise ValueError('my_secret must be a secret') - self.my_secret = my_secret - - -class MyCharm(ops.CharmBase): - _config_errors: Literal['blocked', 'raise'] | None = None - - def __init__(self, framework: ops.Framework): - super().__init__(framework) - if self._config_errors: - self.typed_config = self.load_config(MyConfig, errors=self._config_errors) - else: - self.typed_config = self.load_config(MyConfig) - # These should not have any type errors. - new_float = self.typed_config.my_float + 2006.8 - new_int = self.typed_config.my_int + 1979 - new_str = self.typed_config.my_str + 'bar' - if self.typed_config.my_secret is not None: - label = self.typed_config.my_secret.label - else: - label = 'no secret' - logger.info(f'{new_float=}, {new_int=}, {new_str=}, {label=}') - - -# Note that we would really like to have kw_only=True here as well, but that's -# not available in Python 3.8. -@dataclasses.dataclass(frozen=True) -class MyDataclassConfig(ops.ConfigBase): - my_bool: bool | None = None - """A Boolean value.""" - - my_int: int = 42 - """A positive integer value.""" - - my_float: float = 3.14 - """A floating point value.""" - - my_str: str = 'foo' - """A string value.""" - - my_secret: Optional[ops.Secret] = None # noqa: UP045 'Optional' and not '| None' to exercise that path. - """A user secret.""" - - def __post_init__(self): - if self.my_int < 0: - raise ValueError('my_int must be zero or positive') - - -class MyDataclassCharm(ops.CharmBase): - _config_errors: Literal['blocked', 'raise'] | None = None - - def __init__(self, framework: ops.Framework): - super().__init__(framework) - if self._config_errors: - self.typed_config = self.load_config(MyDataclassConfig, errors=self._config_errors) - else: - self.typed_config = self.load_config(MyDataclassConfig) - # These should not have any type errors. - new_float = self.typed_config.my_float + 2006.8 - new_int = self.typed_config.my_int + 1979 - new_str = self.typed_config.my_str + 'bar' - if self.typed_config.my_secret is not None: - label = self.typed_config.my_secret.label - else: - label = 'no secret' - logger.info(f'{new_float=}, {new_int=}, {new_str=}, {label=}') - - -_test_classes: list[type[ops.CharmBase]] = [MyCharm, MyDataclassCharm] -_test_config_classes: list[type[ops.ConfigBase]] = [MyConfig, MyDataclassConfig] - -if pydantic: - - @pydantic.dataclasses.dataclass(frozen=True, config={'arbitrary_types_allowed': True}) - class MyPydanticDataclassConfig(ops.ConfigBase): - my_bool: bool | None = pydantic.Field(None, description='A Boolean value.') - my_int: int = pydantic.Field(42, description='A positive integer value.') - my_float: float = pydantic.Field(3.14, description='A floating point value.') - my_str: str = pydantic.Field('foo', description='A string value.') - my_secret: Optional[ops.Secret] = pydantic.Field( # noqa: UP045 - None, - description='A user secret.', - ) - - @pydantic.field_validator('my_int') - @classmethod - def validate_my_int(cls, my_int: int) -> int: - if my_int < 0: - raise ValueError('my_int must be zero or positive') - return my_int - - class MyPydanticDataclassCharm(ops.CharmBase): - _config_errors: Literal['blocked', 'raise'] | None = None - - def __init__(self, framework: ops.Framework): - super().__init__(framework) - if self._config_errors: - self.typed_config = self.load_config( - MyPydanticDataclassConfig, errors=self._config_errors - ) - else: - self.typed_config = self.load_config(MyPydanticDataclassConfig) - # These should not have any type errors. - new_float = self.typed_config.my_float + 2006.8 - new_int = self.typed_config.my_int + 1979 - new_str = self.typed_config.my_str + 'bar' - if self.typed_config.my_secret is not None: - label = self.typed_config.my_secret.label - else: - label = 'no secret' - logger.info(f'{new_float=}, {new_int=}, {new_str=}, {label=}') - - class MyPydanticBaseModelConfig(pydantic.BaseModel, ops.ConfigBase): - my_bool: Optional[bool] = pydantic.Field( # noqa: UP045 - None, - description='A Boolean value.', - ) - my_int: int = pydantic.Field(42, description='A positive integer value.') - my_float: float = pydantic.Field(3.14, description='A floating point value.') - my_str: str = pydantic.Field('foo', description='A string value.') - my_secret: Optional[ops.Secret] = pydantic.Field( # noqa: UP045 - None, - description='A user secret.', - ) - - @pydantic.field_validator('my_int') - @classmethod - def validate_my_int(cls, my_int: int) -> int: - if my_int < 0: - raise ValueError('my_int must be zero or positive') - return my_int - - class Config: - arbitrary_types_allowed = True - frozen = True - - class MyPydanticBaseModelCharm(ops.CharmBase): - _config_errors: Literal['blocked', 'raise'] | None = None - - def __init__(self, framework: ops.Framework): - super().__init__(framework) - if self._config_errors: - self.typed_config = self.load_config( - MyPydanticBaseModelConfig, errors=self._config_errors - ) - else: - self.typed_config = self.load_config(MyPydanticBaseModelConfig) - # These should not have any type errors. - new_float = self.typed_config.my_float + 2006.8 - new_int = self.typed_config.my_int + 1979 - new_str = self.typed_config.my_str + 'bar' - if self.typed_config.my_secret is not None: - label = self.typed_config.my_secret.label - else: - label = 'no secret' - logger.info(f'{new_float=}, {new_int=}, {new_str=}, {label=}') - - _test_classes.extend((MyPydanticDataclassCharm, MyPydanticBaseModelCharm)) - _test_config_classes.extend((MyPydanticDataclassConfig, MyPydanticBaseModelConfig)) - - -def test_config_custom_naming_pattern(request: pytest.FixtureRequest): - @dataclasses.dataclass(frozen=True) - class Config(ops.ConfigBase): - foo_bar: int = 42 - other: str = 'baz' - - def __init__(self, fooBar: int = 42, other: str = 'baz'): # noqa: N803 - super().__init__() - if not isinstance(fooBar, int): - raise ValueError('fooBar must be an integer') - if not isinstance(other, str): - raise ValueError('other must be a string') - object.__setattr__(self, 'foo_bar', fooBar) - object.__setattr__(self, 'other', other) - - @classmethod - def to_juju_schema(cls): - schema = super().to_juju_schema() - # We need to override the options to use the custom names. - options = schema['options'] - options['fooBar'] = options.pop('foo-bar') - return schema - - class Charm(ops.CharmBase): - def __init__(self, framework: ops.Framework): - super().__init__(framework) - self.typed_config = self.load_config(Config) - - config = Config.to_juju_schema() - assert 'fooBar' in config['options'] - harness = testing.Harness(Charm, config=ops._private.yaml.safe_dump(config)) - request.addfinalizer(harness.cleanup) - harness.begin() - typed_config = harness.charm.typed_config - assert typed_config.foo_bar == 42 - assert typed_config.other == 'baz' - - -@pytest.mark.parametrize('config_class', _test_config_classes) -def test_config_yaml_schema(config_class: type[ops.ConfigBase]): - generated_yaml = config_class.to_juju_schema() - expected_yaml = { - 'options': { - 'my-bool': { - 'type': 'boolean', - 'description': 'A Boolean value.', - }, - 'my-float': { - 'type': 'float', - 'default': 3.14, - 'description': 'A floating point value.', - }, - 'my-int': { - 'type': 'int', - 'default': 42, - 'description': 'A positive integer value.', - }, - 'my-str': { - 'type': 'string', - 'default': 'foo', - 'description': 'A string value.', - }, - 'my-secret': { - 'type': 'secret', - 'description': 'A user secret.', - }, - }, - } - assert generated_yaml == expected_yaml - - -def test_config_custom_type(request: pytest.FixtureRequest): - class Config(ops.ConfigBase): - x: int - y: datetime.date - - def __init__(self, x: int, y: str): - self.x = x - year, month, day = y.split('-') - self.y = datetime.date(int(year), int(month), int(day)) - - @classmethod - def to_juju_schema(cls): - schema = super().to_juju_schema() - # Override the custom type. - schema['options']['y']['type'] = 'string' - return schema - - class Charm(ops.CharmBase): - def __init__(self, framework: ops.Framework): - super().__init__(framework) - self.typed_config = self.load_config(Config) - - schema = Config.to_juju_schema() - options = ops._private.yaml.safe_dump(schema) - harness = testing.Harness(Charm, config=options) - request.addfinalizer(harness.cleanup) - harness.update_config({'x': 42, 'y': '2008-08-28'}) - harness.begin() - typed_config = harness.charm.typed_config - assert typed_config.x == 42 - assert typed_config.y == datetime.date(2008, 8, 28) diff --git a/testing/tests/test_e2e/test_config.py b/testing/tests/test_e2e/test_config.py index 78f921e82..5fd4e2e35 100644 --- a/testing/tests/test_e2e/test_config.py +++ b/testing/tests/test_e2e/test_config.py @@ -5,6 +5,7 @@ import pytest import ops +import ops_tools from scenario.context import Context from scenario.state import State @@ -108,15 +109,11 @@ def _on_event(self, event): def test_config_using_configbase_class(): @dataclasses.dataclass - class Config(ops.ConfigBase): + class Config: a: int b: float c: str - @classmethod - def _option_names(cls): - yield 'b' - class Charm(ops.CharmBase): def __init__(self, framework: ops.Framework): super().__init__(framework) @@ -125,7 +122,7 @@ def __init__(self, framework: ops.Framework): def _on_config_changed(self, event: ops.ConfigChangedEvent): self.typed_config = self.load_config(Config, 10, c='foo') - schema = Config.to_juju_schema() + schema = ops_tools.config_to_juju_schema(Config) ctx = Context(Charm, meta={'name': 'foo'}, config=schema) with ctx(ctx.on.config_changed(), State(config={'b': 3.14})) as mgr: mgr.run() diff --git a/tools/README.md b/tools/README.md new file mode 100644 index 000000000..aeac7cabf --- /dev/null +++ b/tools/README.md @@ -0,0 +1,112 @@ +# Ops charmcraft.yaml generation tooling + +The definition of charm configuration options and actions should have a single +source of truth. Our preference is that truth is in the charm code: this is in +an expressive language (Python), that allows more complex type definitions and +validation than possible in the Juju config schema language or action parameter +JSONSchema. However, Juju and Charmcraft need to find these schema in the +`charmcraft.yaml` file. + +This package provides tooling to generate the appropriate `charmcraft.yaml` +sections for `config` and `actions` from config and action classes in the charm +Python code. + +For example, the config class: + +```python +@dataclasses.dataclass(frozen=True, kw_only=True) +class MyConfig: + my_bool: bool | None = None + '''A boolean value.''' + my_float: float = 3.14 + '''A floating point value.''' + my_int: int = 42 + '''An integer value.''' + my_str: str = "foo" + '''A string value.''' + my_secret: ops.Secret | None = None + '''A user secret.''' +``` + +would generate this YAML: + +```yaml +options: + my-bool: + type: boolean + description: A boolean value. + my-float: + type: float + default: 3.14 + description: A floating point value. + my-int: + type: int + default: 42 + description: An integer value. + my-str: + type: string + default: foo + description: A string value. + my-secret: + type: secret + description: A user secret. +``` + +And the action classes: + +```python +class Compression(enum.Enum): + GZ = 'gzip' + BZ = 'bzip2' + +@dataclasses.dataclass(frozen=True, kw_only=True) +class RunBackup: + '''Backup the database.''' + + filename: str + '''The name of the backup file.''' + compression: Compression = Compression.GZ + '''The type of compression to use.''' + +@dataclasses.dataclass(frozen=True, kw_only=True) +class AddAdminUser: + '''Add a new admin user and return their credentials.''' + + username: str +``` + +would generate this YAML: + +```yaml +run-backup: + description: Backup the database. + params: + filename: + type: string + description: The name of the backup file. + compression: + type: string + description: The type of compression to use. + default: gzip + enum: [gzip, bzip2] + required: [filename] + additionalProperties: false + +add-admin-user: + description: Add a new admin user and return their credentials. + params: + username: + type: string + required: [username] + additionalProperties: false +``` + +The Python classes may be: + +* Standard library `dataclasses.dataclass` classes. +* Pydantic dataclasses. +* Pydantic `BaseModel` subclasses. +* Other Python classes, as long as TODO + +Type annotations for all classes should use the modern `a | b` and `a | None` +form, rather than `Union[a, b]` or `Optional[a]`. diff --git a/tools/pyproject.toml b/tools/pyproject.toml new file mode 100644 index 000000000..a2635de6c --- /dev/null +++ b/tools/pyproject.toml @@ -0,0 +1,54 @@ +[build-system] +requires = [ + "setuptools >= 35.0.2", + "setuptools_scm >= 2.0.0, <3" +] +build-backend = "setuptools.build_meta" + +[project] +name = "ops-tools" + +version = "1.2.0.dev0" + +authors = [ + { name = "The Charm Tech team at Canonical Ltd." } +] +description = "Tools to extend Ops charm code" +license.text = "Apache-2.0" +keywords = ["juju", "ops", "charms"] + +dependencies = [ + "ops==3.1.0.dev0", + "PyYAML>=6.0.1", + "typing_extensions~=4.2", +] +readme = "README.md" +requires-python = ">=3.10" + +classifiers = [ + "Development Status :: 5 - Production/Stable", + "License :: OSI Approved :: Apache Software License", + "Intended Audience :: Developers", + "Intended Audience :: System Administrators", + "Topic :: Utilities", + "Natural Language :: English", + "Operating System :: MacOS :: MacOS X", + "Operating System :: POSIX :: Linux", + "Programming Language :: Python", + "Programming Language :: Python :: 3", + "Programming Language :: Python :: 3.10", + "Programming Language :: Python :: 3.11", + "Programming Language :: Python :: 3.12", + "Programming Language :: Python :: 3.13", + "Programming Language :: Python :: 3.14", + "Programming Language :: Python :: 3 :: Only", + "Programming Language :: Python :: Implementation :: CPython", + "Topic :: Software Development :: Libraries", +] + +[project.urls] +"Homepage" = "https://github.com/canonical/operator" +"Bug Tracker" = "https://github.com/canonical/operator/issues" + +[bdist_wheel] +universal = 1 diff --git a/tools/src/ops_tools.egg-info/PKG-INFO b/tools/src/ops_tools.egg-info/PKG-INFO new file mode 100644 index 000000000..2da387cc9 --- /dev/null +++ b/tools/src/ops_tools.egg-info/PKG-INFO @@ -0,0 +1,145 @@ +Metadata-Version: 2.4 +Name: ops-tools +Version: 1.2.0.dev0 +Summary: Tools to extend Ops charm code +Author: The Charm Tech team at Canonical Ltd. +License: Apache-2.0 +Project-URL: Homepage, https://github.com/canonical/operator +Project-URL: Bug Tracker, https://github.com/canonical/operator/issues +Keywords: juju,ops,charms +Classifier: Development Status :: 5 - Production/Stable +Classifier: License :: OSI Approved :: Apache Software License +Classifier: Intended Audience :: Developers +Classifier: Intended Audience :: System Administrators +Classifier: Topic :: Utilities +Classifier: Natural Language :: English +Classifier: Operating System :: MacOS :: MacOS X +Classifier: Operating System :: POSIX :: Linux +Classifier: Programming Language :: Python +Classifier: Programming Language :: Python :: 3 +Classifier: Programming Language :: Python :: 3.10 +Classifier: Programming Language :: Python :: 3.11 +Classifier: Programming Language :: Python :: 3.12 +Classifier: Programming Language :: Python :: 3.13 +Classifier: Programming Language :: Python :: 3.14 +Classifier: Programming Language :: Python :: 3 :: Only +Classifier: Programming Language :: Python :: Implementation :: CPython +Classifier: Topic :: Software Development :: Libraries +Requires-Python: >=3.10 +Description-Content-Type: text/markdown +Requires-Dist: ops==3.1.0.dev0 +Requires-Dist: PyYAML>=6.0.1 +Requires-Dist: typing_extensions~=4.2 + +# Ops charmcraft.yaml generation tooling + +The definition of charm configuration options and actions should have a single +source of truth. Our preference is that truth is in the charm code: this is in +an expressive language (Python), that allows more complex type definitions and +validation than possible in the Juju config schema language or action parameter +JSONSchema. However, Juju and Charmcraft need to find these schema in the +`charmcraft.yaml` file. + +This package provides tooling to generate the appropriate `charmcraft.yaml` +sections for `config` and `actions` from config and action classes in the charm +Python code. + +For example, the config class: + +```python +@dataclasses.dataclass(frozen=True, kw_only=True) +class MyConfig: + my_bool: bool | None = None + '''A boolean value.''' + my_float: float = 3.14 + '''A floating point value.''' + my_int: int = 42 + '''An integer value.''' + my_str: str = "foo" + '''A string value.''' + my_secret: ops.Secret | None = None + '''A user secret.''' +``` + +would generate this YAML: + +```yaml +options: + my-bool: + type: boolean + description: A boolean value. + my-float: + type: float + default: 3.14 + description: A floating point value. + my-int: + type: int + default: 42 + description: An integer value. + my-str: + type: string + default: foo + description: A string value. + my-secret: + type: secret + description: A user secret. +``` + +And the action classes: + +```python +class Compression(enum.Enum): + GZ = 'gzip' + BZ = 'bzip2' + +@dataclasses.dataclass(frozen=True, kw_only=True) +class RunBackup: + '''Backup the database.''' + + filename: str + '''The name of the backup file.''' + compression: Compression = Compression.GZ + '''The type of compression to use.''' + +@dataclasses.dataclass(frozen=True, kw_only=True) +class AddAdminUser: + '''Add a new admin user and return their credentials.''' + + username: str +``` + +would generate this YAML: + +```yaml +run-backup: + description: Backup the database. + params: + filename: + type: string + description: The name of the backup file. + compression: + type: string + description: The type of compression to use. + default: gzip + enum: [gzip, bzip2] + required: [filename] + additionalProperties: false + +add-admin-user: + description: Add a new admin user and return their credentials. + params: + username: + type: string + required: [username] + additionalProperties: false +``` + +The Python classes may be: + +* Standard library `dataclasses.dataclass` classes. +* Pydantic dataclasses. +* Pydantic `BaseModel` subclasses. +* Other Python classes, as long as TODO + +Type annotations for all classes should use the modern `a | b` and `a | None` +form, rather than `Union[a, b]` or `Optional[a]`. diff --git a/tools/src/ops_tools.egg-info/SOURCES.txt b/tools/src/ops_tools.egg-info/SOURCES.txt new file mode 100644 index 000000000..12ab4c290 --- /dev/null +++ b/tools/src/ops_tools.egg-info/SOURCES.txt @@ -0,0 +1,12 @@ +README.md +pyproject.toml +src/ops_tools/__init__.py +src/ops_tools/_attrdocs.py +src/ops_tools/_generate_yaml.py +src/ops_tools.egg-info/PKG-INFO +src/ops_tools.egg-info/SOURCES.txt +src/ops_tools.egg-info/dependency_links.txt +src/ops_tools.egg-info/requires.txt +src/ops_tools.egg-info/top_level.txt +tests/test_generate_yaml_action.py +tests/test_generate_yaml_config.py \ No newline at end of file diff --git a/tools/src/ops_tools.egg-info/dependency_links.txt b/tools/src/ops_tools.egg-info/dependency_links.txt new file mode 100644 index 000000000..8b1378917 --- /dev/null +++ b/tools/src/ops_tools.egg-info/dependency_links.txt @@ -0,0 +1 @@ + diff --git a/tools/src/ops_tools.egg-info/requires.txt b/tools/src/ops_tools.egg-info/requires.txt new file mode 100644 index 000000000..8427549be --- /dev/null +++ b/tools/src/ops_tools.egg-info/requires.txt @@ -0,0 +1,3 @@ +ops==3.1.0.dev0 +PyYAML>=6.0.1 +typing_extensions~=4.2 diff --git a/tools/src/ops_tools.egg-info/top_level.txt b/tools/src/ops_tools.egg-info/top_level.txt new file mode 100644 index 000000000..29a82c813 --- /dev/null +++ b/tools/src/ops_tools.egg-info/top_level.txt @@ -0,0 +1 @@ +ops_tools diff --git a/tools/src/ops_tools/__init__.py b/tools/src/ops_tools/__init__.py new file mode 100644 index 000000000..14a440318 --- /dev/null +++ b/tools/src/ops_tools/__init__.py @@ -0,0 +1,27 @@ +# Copyright 2025 Canonical Ltd. +# +# Licensed under the Apache License, Version 2.0 (the "License"); +# you may not use this file except in compliance with the License. +# You may obtain a copy of the License at +# +# http://www.apache.org/licenses/LICENSE-2.0 +# +# Unless required by applicable law or agreed to in writing, software +# distributed under the License is distributed on an "AS IS" BASIS, +# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +# See the License for the specific language governing permissions and +# limitations under the License. + +"""Tools to extend Ops charms. + +Includes tools to: + * Generate charmcraft.yaml from Python config and action classes. +""" + +from ._generate_yaml import OptionDict, action_to_juju_schema, config_to_juju_schema + +__all__ = [ + 'OptionDict', + 'action_to_juju_schema', + 'config_to_juju_schema', +] diff --git a/ops/_private/attrdocs.py b/tools/src/ops_tools/_attrdocs.py similarity index 84% rename from ops/_private/attrdocs.py rename to tools/src/ops_tools/_attrdocs.py index 3421201fb..ceb3681f2 100644 --- a/ops/_private/attrdocs.py +++ b/tools/src/ops_tools/_attrdocs.py @@ -82,17 +82,20 @@ def get_attr_docstrings(cls: type[object]) -> dict[str, str]: ): docs[field.name] = field.default.description # type: ignore - try: - source_code = inspect.getsource(cls) - except OSError: - logger.debug('No source code found for %s', cls.__name__) - return docs - try: - tree = ast.parse(source_code) - except (SyntaxError, IndentationError): - logger.debug('Failed to parse source code for %s', cls.__name__) - return docs - extractor = AttributeDocstringExtractor() - extractor.visit(tree) - docs.update(extractor.attribute_docs) + for cls in cls.mro(): + if cls is object: + continue + try: + source_code = inspect.getsource(cls) + except OSError: + logger.debug('No source code found for %s', cls.__name__) + continue + try: + tree = ast.parse(source_code) + except (SyntaxError, IndentationError): + logger.debug('Failed to parse source code for %s', cls.__name__) + continue + extractor = AttributeDocstringExtractor() + extractor.visit(tree) + docs.update(extractor.attribute_docs) return docs diff --git a/tools/src/ops_tools/_generate_yaml.py b/tools/src/ops_tools/_generate_yaml.py new file mode 100644 index 000000000..5275f309b --- /dev/null +++ b/tools/src/ops_tools/_generate_yaml.py @@ -0,0 +1,411 @@ +# Copyright 2025 Canonical Ltd. +# +# Licensed under the Apache License, Version 2.0 (the "License"); +# you may not use this file except in compliance with the License. +# You may obtain a copy of the License at +# +# http://www.apache.org/licenses/LICENSE-2.0 +# +# Unless required by applicable law or agreed to in writing, software +# distributed under the License is distributed on an "AS IS" BASIS, +# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +# See the License for the specific language governing permissions and +# limitations under the License. + +"""Generate charmcraft.yaml config and actions from Python classes.""" + +from __future__ import annotations + +import dataclasses +import enum +import logging +import re +from typing import ( + Any, + Final, + Generator, + Mapping, + TypedDict, + get_args, + get_origin, + get_type_hints, +) +from typing_extensions import NotRequired + +import ops + +from . import _attrdocs + +logger = logging.getLogger(__name__) + + +class OptionDict(TypedDict): + type: str + """The Juju option type.""" + description: NotRequired[str] + default: NotRequired[bool | int | float | str] + + +JUJU_TYPES: Final[Mapping[type, str]] = { + bool: 'boolean', + int: 'int', + float: 'float', + str: 'string', + ops.Secret: 'secret', +} + +# We currently only handle the basic types that we expect to see in real charms. +JSON_TYPES: Final[Mapping[type, str]] = { + bool: 'boolean', + int: 'integer', + float: 'number', + str: 'string', + list[bool]: 'array', + list[int]: 'array', + list[float]: 'array', + list[str]: 'array', + tuple[bool]: 'array', + tuple[int]: 'array', + tuple[float]: 'array', + tuple[str]: 'array', +} + + +def attr_to_default(cls: type[object], name: str) -> Any: + """Get the default value for the attribute.""" + if not dataclasses.is_dataclass(cls): + return getattr(cls, name, None) + default = None + for field in dataclasses.fields(cls): + if field.name != name: + continue + break + else: + return default + + # This might be a Pydantic dataclass using a Pydantic.Field object. + field_default = ( # type: ignore + field.default.default # type: ignore + if hasattr(field.default, 'default') + else field.default + ) + if field_default is not dataclasses.MISSING: + return field_default # type: ignore + if field.default_factory is not dataclasses.MISSING: + return field.default_factory() + return default + + +def _attr_to_yaml_type(cls: type[object], name: str, yaml_types: dict[type, str]) -> str: + try: + raw_hint = get_type_hints(cls)[name] + except KeyError: + pass + else: + # Collapse Optional[] and Union[] and so on to the simpler form. + origin = get_origin(raw_hint) + if origin in (list, tuple): + return yaml_types[origin] + elif origin: + hints = {arg for arg in get_args(raw_hint) if arg in yaml_types} + else: + hints = {raw_hint} + # If there are multiple types -- for example, the type annotation is + # `int | str` -- then we can't determine the type, and we fall back to + # "string", even if `str` is not in the type hint, because our + # "we can't determine the type" choice is always "string". + if len(hints) > 1: + return 'string' + elif hints: + try: + return yaml_types[hints.pop()] + except KeyError: + pass + # If we can't figure it out, then use "string", which should be the most + # compatible, and most likely to be used for arbitrary types. Charms can + # override `to_juju_schema` to adjust this if required. + return 'string' + + +def attr_to_juju_type(cls: type[object], name: str) -> str: + """Provide the appropriate type for the config YAML for the given class attribute. + + If an appropriate type cannot be determined, fall back to "string". + """ + return _attr_to_yaml_type(cls, name, JUJU_TYPES) + + +def attr_to_json_type(cls: type[object], name: str) -> str: + """Provide the appropriate type for the action YAML for the given attribute. + + If an appropriate type cannot be determined, fall back to "string". + """ + return _attr_to_yaml_type(cls, name, JSON_TYPES) + + +def juju_schema_from_model_fields(cls: type[object]) -> dict[str, OptionDict]: + """Generate a Juju schema from the model fields of a Pydantic model.""" + # The many type: ignores are required because we don't want to import + # pydantic in this code. + options: dict[str, OptionDict] = {} + for name, field in cls.model_fields.items(): # type: ignore + option = {} + if 'PydanticUndefinedType' not in str(type(field.default)) and field.default is not None: # type: ignore + default = field.default # type: ignore + elif field.default_factory is not None: # type: ignore + default = field.default_factory() # type: ignore + else: + default = None + if default is not None: + if type(default) in JUJU_TYPES: # type: ignore + option['default'] = default + else: + option['default'] = str(default) # type: ignore + if field.annotation in (bool, int, float, str, ops.Secret): # type: ignore + hint = JUJU_TYPES[field.annotation] + else: + hint = field.annotation # type: ignore + if get_origin(hint): # type: ignore + hints = {arg for arg in get_args(hint) if arg in JUJU_TYPES} + if len(hints) > 1: + hint = type(str) + elif hints: + hint = hints.pop() + hint = JUJU_TYPES.get(hint, 'string') # type: ignore + option['type'] = hint + if field.description: # type: ignore + option['description'] = field.description # type: ignore + options[name.replace('_', '-')] = option # type: ignore + return options + + +def juju_names(cls: type[object]) -> Generator[str]: + """Iterates over all the names to include in the config or action YAML.""" + if dataclasses.is_dataclass(cls): + for field in dataclasses.fields(cls): + yield field.name + return + if hasattr(cls, 'model_fields'): + for field in cls.model_fields.values(): # type: ignore + yield field.name # type: ignore + return + # If this isn't a dataclass or a Pydantic model, then fall back to using + # any class attribute with a type annotation. + yield from get_type_hints(cls) + + +def to_json_schema(cls: type[object]) -> tuple[dict[str, Any], list[str]]: + """Translate the class to JSONSchema suitable for use in ``charmcraft.yaml``. + + This only handles simple types (strings, Booleans, integers, floats, tuples, + and lists). + + Returns a dictionary that can be dumped to YAML and a list of required + params. + """ + # As of March 2025, most charms use only simple parameter types, despite + # being able to use anything that JSONSchema offers. The 'type' breakdown + # among the charms analysed is: + # * 'string': 158 + # * 'boolean': 16 + # * 'array': 10 + # * 'integer': 7 + # * 'number': 2 + # * 'object': 1 + # Only one charm has a `properties' field that further defines the + # parameter. It seems reasonable to handle all of the simple cases and + # require anyone using anything more complicated to provide a custom + # to_juju_schema and provide their own details (or to use a Pydantic + # class). + + attr_docs = _attrdocs.get_attr_docstrings(cls) + params: dict[str, Any] = {} + required_params: list[str] = [] + for attr in sorted(juju_names(cls)): + param = {} + + hint_obj = get_type_hints(cls)[attr] + if isinstance(hint_obj, type) and issubclass(hint_obj, enum.Enum): + param['type'] = 'string' + param['enum'] = [m.value for m in hint_obj.__members__.values()] + elif isinstance(hint_obj, type) and issubclass(hint_obj, (list, tuple)): + param['type'] = 'array' + param['items'] = {'type': attr_to_json_type(cls, attr)} + else: + param['type'] = attr_to_json_type(cls, attr) + + default = attr_to_default(cls, attr) + if default is None: + required = True + else: + required = False + if type(default) in (tuple, list): + param['items'] = {'type': attr_to_json_type(cls, attr)} + else: + if type(default) not in (bool, int, float, str): + default = str(default) + param['default'] = default + + doc = attr_docs.get(attr) + if doc: + param['description'] = doc + json_name = attr.replace('_', '-') + params[json_name] = param + if required: + required_params.append(json_name) + + return params, required_params + + +def config_to_juju_schema(cls: type[object]) -> dict[str, dict[str, OptionDict]]: + """Translate the class to YAML suitable for charmcraft.yaml. + + For example, with the class:: + + @dataclasses.dataclass(frozen=True, kw_only=True) + class MyConfig: + my_bool: bool | None = None + '''A boolean value.''' + my_float: float = 3.14 + '''A floating point value.''' + my_int: int = 42 + '''An integer value.''' + my_str: str = "foo" + '''A string value.''' + my_secret: ops.Secret | None = None + '''A user secret.''' + + ``print(yaml.safe_dump(to_juju_schema(MyConfig)))`` will output:: + + options: + my-bool: + type: boolean + description: A boolean value. + my-float: + type: float + default: 3.14 + description: A floating point value. + my-int: + type: int + default: 42 + description: An integer value. + my-str: + type: string + default: foo + description: A string value. + my-secret: + type: secret + description: A user secret. + + Options with a default value of ``None`` will not have a ``default`` key + in the output. If the type of the option cannot be determined, it will + be set to ``string``. If there is a default value, but it is not one of the + Juju option types, the ``str()`` representation of the value will be used. + + To customise, define a ``to_juju_schema`` method in your class. For example:: + + @classmethod + def to_juju_schema(cls, schema: dict[str, OptionDict]) -> dict[str, OptionDict]: + # Change the key names to upper-case. + schema = {key.upper(): value for key, value in schema.items()} + return schema + """ + if hasattr(cls, 'model_fields'): + # Special-case pydantic BaseModel or anything else with a compatible + # `model_fields`` attribute. + options = juju_schema_from_model_fields(cls) + else: + # Dataclasses, regular classes, etc. + attr_docstrings = _attrdocs.get_attr_docstrings(cls) + options: dict[str, OptionDict] = {} + for attr in sorted(juju_names(cls)): + option: OptionDict = {'type': attr_to_juju_type(cls, attr)} + default = attr_to_default(cls, attr) + if default is not None: + if type(default) in JUJU_TYPES: + option['default'] = default + else: + option['default'] = str(default) + doc = attr_docstrings.get(attr) + if doc: + option['description'] = doc + options[attr.replace('_', '-')] = option + + if hasattr(cls, 'to_juju_schema'): + # If the class has a custom `to_juju_schema` method, call it. + # This allows the class to override the default schema generation. + return {'options': cls.to_juju_schema(options)} # type: ignore + return {'options': options} + + +def action_to_juju_schema(cls: type[object]) -> dict[str, Any]: + """Translate the class to a dictionary suitable for ``charmcraft.yaml``. + + For example, with the classes:: + + class Compression(enum.Enum): + GZ = 'gzip' + BZ = 'bzip2' + + @dataclasses.dataclass(frozen=True, kw_only=True) + class RunBackup: + '''Backup the database.''' + + filename: str + '''The name of the backup file.''' + compression: Compression = Compression.GZ + '''The type of compression to use.''' + + The output will be a dictionary that can be dumped to produce YAML like this:: + + run-backup: + description: Backup the database. + params: + filename: + type: string + description: The name of the backup file. + compression: + type: string + description: The type of compression to use. + default: gzip + enum: [gzip, bzip2] + required: [filename] + additionalProperties: false + + To adjust the YAML, provide a ``to_juju_schema`` method in the class. For + example, to allow additional properties:: + + TODO: the type isn't right here, because we allow changing the name too. + def to_juju_schema(cls, schema: dict[str, Any]) -> dict[str, Any]: + schema['additionalProperties'] = True + return schema + """ + # As of March 2025, there are no known charms that are using + # execution-group or parallel, so we don't support those here. If any + # charms do need them, they can change the output by defining a + # `to_juju_schema` method. + action = {} + if cls.__doc__: + action['description'] = cls.__doc__ + # Pydantic classes provide this, so we can just get it directly. + # The type: ignores are required because we don't want to import pydantic + # in this code. + if hasattr(cls, 'schema'): + schema = cls.schema() # type: ignore + params = schema['properties'] # type: ignore + required_params = schema['required'] # type: ignore + else: + params, required_params = to_json_schema(cls) + if params: + action['params'] = params + if required_params: + action['required'] = required_params + action['additionalProperties'] = False + # Add a ``-`` after each A-Z character of the class name, and then + # lower-case the resulting string. + action_name = re.sub(r'(? dict[str, Any]: + schema['action-true']['additionalProperties'] = True + return schema + + generated_yaml = ops_tools.action_to_juju_schema(ActionTrue) + expected_yaml = { + 'action-true': { + 'description': 'An action.', + 'params': {'x': {'type': 'integer', 'default': 42}}, + 'additionalProperties': True, + }, + } + assert generated_yaml == expected_yaml + + class ActionDefault: + """An action.""" + + x: int = 42 + + @classmethod + def to_juju_schema(cls: type[object], schema: dict[str, Any]) -> dict[str, Any]: + del schema['action-default']['additionalProperties'] + return schema + + generated_yaml = ops_tools.action_to_juju_schema(ActionDefault) + expected_yaml = { + 'action-default': { + 'description': 'An action.', + 'params': {'x': {'type': 'integer', 'default': 42}}, + }, + } + assert generated_yaml == expected_yaml + + +def test_action_class_modification(): + class ActionMinimum: + """An action.""" + + x: int = 42 + + @classmethod + def to_juju_schema(cls, schema: dict[str, Any]) -> dict[str, Any]: + schema['action-minimum']['params']['x']['minimum'] = 0 + return schema + + generated_yaml = ops_tools.action_to_juju_schema(ActionMinimum) + expected_yaml = { + 'action-minimum': { + 'description': 'An action.', + 'additionalProperties': False, + 'params': {'x': {'type': 'integer', 'default': 42, 'minimum': 0}}, + }, + } + assert generated_yaml == expected_yaml + + +class Mode(enum.Enum): + FULL = 'full' + ADD = 'add' + REMOVE = 'remove' + + +class Rebalance: + """Trigger a rebalance of cluster partitions based on configured goals""" + + mode: Mode + """The operation to issue to the balancer.""" + + +def test_action_enum(): + generated_yaml = ops_tools.action_to_juju_schema(Rebalance) + expected_yaml = { + 'rebalance': { + 'description': 'Trigger a rebalance of cluster partitions based on configured goals', + 'additionalProperties': False, + 'required': ['mode'], + 'params': { + 'mode': { + 'type': 'string', + 'description': 'The operation to issue to the balancer.', + 'enum': ['full', 'add', 'remove'], + }, + }, + }, + } + assert generated_yaml == expected_yaml + + +class action: ... # noqa: N801 + + +class Action: ... + + +class AcTioN: ... + + +class TheAction: ... + + +class MYAction: ... + + +class ABC: ... + + +class myAction: ... # noqa: N801 + + +class DoThisThing: ... + + +@pytest.mark.parametrize( + 'cls,action_name', + [ + (action, 'action'), + (Action, 'action'), + (AcTioN, 'ac-tio-n'), + (TheAction, 'the-action'), + (MYAction, 'm-y-action'), + (ABC, 'a-b-c'), + (myAction, 'my-action'), + (DoThisThing, 'do-this-thing'), + ], +) +def test_action_class_name_to_action_name(cls: type[object], action_name: str): + assert list(ops_tools.action_to_juju_schema(cls).keys()) == [action_name] diff --git a/tools/tests-ugh/test_generate_yaml_config.py b/tools/tests-ugh/test_generate_yaml_config.py new file mode 100644 index 000000000..b51192c90 --- /dev/null +++ b/tools/tests-ugh/test_generate_yaml_config.py @@ -0,0 +1,238 @@ +# Copyright 2025 Canonical Ltd. +# +# Licensed under the Apache License, Version 2.0 (the "License"); +# you may not use this file except in compliance with the License. +# You may obtain a copy of the License at +# +# http://www.apache.org/licenses/LICENSE-2.0 +# +# Unless required by applicable law or agreed to in writing, software +# distributed under the License is distributed on an "AS IS" BASIS, +# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +# See the License for the specific language governing permissions and +# limitations under the License. + +from __future__ import annotations + +import dataclasses +import datetime +import logging + +import pytest + +try: + import pydantic + import pydantic.dataclasses +except ImportError: + pydantic = None + +import ops + +import ops_tools + + +logger = logging.getLogger(__name__) + + +class MyConfig: + basic_bool: bool + basic_int: int + basic_float: float + basic_str: str + + my_bool: bool = False + """A Boolean value.""" + + my_int: int = 42 + """A positive integer value.""" + + my_float: float = 3.14 + """A floating point value.""" + + my_str: str = 'foo' + """A string value.""" + + my_secret: ops.Secret | None = None + """A user secret.""" + + my_date: datetime.date = datetime.date(2023, 9, 4) + """A date value.""" + + +@dataclasses.dataclass(frozen=True, kw_only=True) +class MyDataclassConfig: + basic_bool: bool + basic_int: int + basic_float: float + basic_str: str + + my_bool: bool = False + """A Boolean value.""" + + my_int: int = 42 + """A positive integer value.""" + + my_float: float = 3.14 + """A floating point value.""" + + my_str: str = 'foo' + """A string value.""" + + my_secret: ops.Secret | None = None + """A user secret.""" + + my_date: datetime.date = datetime.date(2023, 9, 4) + """A date value.""" + + +_test_config_classes: list[type[object]] = [MyConfig, MyDataclassConfig] + +if pydantic: + + @pydantic.dataclasses.dataclass(frozen=True, config={'arbitrary_types_allowed': True}) + class MyPydanticDataclassConfig: + basic_bool: bool + basic_int: int + basic_float: float + basic_str: str + my_bool: bool = pydantic.Field(False, description='A Boolean value.') + my_int: int = pydantic.Field(42, description='A positive integer value.') + my_float: float = pydantic.Field(3.14, description='A floating point value.') + my_str: str = pydantic.Field('foo', description='A string value.') + my_secret: ops.Secret | None = pydantic.Field(None, description='A user secret.') + my_date: datetime.date = pydantic.Field(datetime.date(2023, 9, 4), description='A date value.') + + class MyPydanticBaseModelConfig(pydantic.BaseModel): + basic_bool: bool + basic_int: int + basic_float: float + basic_str: str + my_bool: bool = pydantic.Field(False, description='A Boolean value.') + my_int: int = pydantic.Field(42, description='A positive integer value.') + my_float: float = pydantic.Field(3.14, description='A floating point value.') + my_str: str = pydantic.Field('foo', description='A string value.') + my_secret: ops.Secret | None = pydantic.Field(None, description='A user secret.') + my_date: datetime.date = pydantic.Field(datetime.date(2023, 9, 4), description='A date value.') + + class Config: + arbitrary_types_allowed = True + frozen = True + + _test_config_classes.extend((MyPydanticDataclassConfig, MyPydanticBaseModelConfig)) + + +@pytest.mark.parametrize('config_class', _test_config_classes) +def test_config_yaml_schema(config_class: type[object]): + generated_schema = ops_tools.config_to_juju_schema(config_class) + expected_schema = { + 'options': { + 'basic-bool': { + 'type': 'boolean', + }, + 'basic-int': { + 'type': 'int', + }, + 'basic-float': { + 'type': 'float', + }, + 'basic-str': { + 'type': 'string', + }, + 'my-bool': { + 'type': 'boolean', + 'default': False, + 'description': 'A Boolean value.', + }, + 'my-float': { + 'type': 'float', + 'default': 3.14, + 'description': 'A floating point value.', + }, + 'my-int': { + 'type': 'int', + 'default': 42, + 'description': 'A positive integer value.', + }, + 'my-str': { + 'type': 'string', + 'default': 'foo', + 'description': 'A string value.', + }, + 'my-secret': { + 'type': 'secret', + 'description': 'A user secret.', + }, + 'my-date': { + 'default': '2023-09-04', + 'description': 'A date value.', + 'type': 'string', + }, + }, + } + assert generated_schema == expected_schema + + +@pytest.mark.parametrize('config_class', _test_config_classes) +def test_config_custom_type(config_class: type[object]): + class Config(config_class): + @classmethod + def to_juju_schema( + cls, schema: dict[str, ops_tools.OptionDict] + ) -> dict[str, ops_tools.OptionDict]: + # Override the custom type. + assert schema['my-date'] == { + 'type': 'string', + 'default': '2023-09-04', + 'description': 'A date value.', + } + schema['my-date']['type'] = 'int' + schema['my-date']['default'] = 20230904 + return schema + + generated_schema = ops_tools.config_to_juju_schema(Config) + expected_schema = { + 'options': { + 'basic-bool': { + 'type': 'boolean', + }, + 'basic-int': { + 'type': 'int', + }, + 'basic-float': { + 'type': 'float', + }, + 'basic-str': { + 'type': 'string', + }, + 'my-bool': { + 'type': 'boolean', + 'default': False, + 'description': 'A Boolean value.', + }, + 'my-float': { + 'type': 'float', + 'default': 3.14, + 'description': 'A floating point value.', + }, + 'my-int': { + 'type': 'int', + 'default': 42, + 'description': 'A positive integer value.', + }, + 'my-str': { + 'type': 'string', + 'default': 'foo', + 'description': 'A string value.', + }, + 'my-secret': { + 'type': 'secret', + 'description': 'A user secret.', + }, + 'my-date': { + 'type': 'int', + 'default': 20230904, + 'description': 'A date value.', + }, + }, + } + assert generated_schema == expected_schema diff --git a/tox.ini b/tox.ini index 3c4132f77..1193ca2fa 100644 --- a/tox.ini +++ b/tox.ini @@ -26,6 +26,8 @@ all_path = {[vars]src_path} {[vars]tst_path} testing_src_path = testing/src/scenario/ testing_tst_path = testing/tests/ tracing_tst_path = tracing/test/ +tools_src_path = tools/src/ops_tools/ +tools_tst_path = tools/tests-ugh/ examples_path = examples/ [testenv] diff --git a/uv.lock b/uv.lock index 835054331..28755585c 100644 --- a/uv.lock +++ b/uv.lock @@ -1,5 +1,5 @@ version = 1 -revision = 1 +revision = 3 requires-python = ">=3.10" resolution-markers = [ "python_full_version >= '3.11'", @@ -10,6 +10,7 @@ resolution-markers = [ members = [ "ops", "ops-scenario", + "ops-tools", "ops-tracing", ] @@ -17,18 +18,18 @@ members = [ name = "alabaster" version = "1.0.0" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/a6/f8/d9c74d0daf3f742840fd818d69cfae176fa332022fd44e3469487d5a9420/alabaster-1.0.0.tar.gz", hash = "sha256:c00dca57bca26fa62a6d7d0a9fcce65f3e026e9bfe33e9c538fd3fbb2144fd9e", size = 24210 } +sdist = { url = "https://files.pythonhosted.org/packages/a6/f8/d9c74d0daf3f742840fd818d69cfae176fa332022fd44e3469487d5a9420/alabaster-1.0.0.tar.gz", hash = "sha256:c00dca57bca26fa62a6d7d0a9fcce65f3e026e9bfe33e9c538fd3fbb2144fd9e", size = 24210, upload-time = "2024-07-26T18:15:03.762Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/7e/b3/6b4067be973ae96ba0d615946e314c5ae35f9f993eca561b356540bb0c2b/alabaster-1.0.0-py3-none-any.whl", hash = "sha256:fc6786402dc3fcb2de3cabd5fe455a2db534b371124f1f21de8731783dec828b", size = 13929 }, + { url = "https://files.pythonhosted.org/packages/7e/b3/6b4067be973ae96ba0d615946e314c5ae35f9f993eca561b356540bb0c2b/alabaster-1.0.0-py3-none-any.whl", hash = "sha256:fc6786402dc3fcb2de3cabd5fe455a2db534b371124f1f21de8731783dec828b", size = 13929, upload-time = "2024-07-26T18:15:02.05Z" }, ] [[package]] name = "annotated-types" version = "0.7.0" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/ee/67/531ea369ba64dcff5ec9c3402f9f51bf748cec26dde048a2f973a4eea7f5/annotated_types-0.7.0.tar.gz", hash = "sha256:aff07c09a53a08bc8cfccb9c85b05f1aa9a2a6f23728d790723543408344ce89", size = 16081 } +sdist = { url = "https://files.pythonhosted.org/packages/ee/67/531ea369ba64dcff5ec9c3402f9f51bf748cec26dde048a2f973a4eea7f5/annotated_types-0.7.0.tar.gz", hash = "sha256:aff07c09a53a08bc8cfccb9c85b05f1aa9a2a6f23728d790723543408344ce89", size = 16081, upload-time = "2024-05-20T21:33:25.928Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/78/b6/6307fbef88d9b5ee7421e68d78a9f162e0da4900bc5f5793f6d3d0e34fb8/annotated_types-0.7.0-py3-none-any.whl", hash = "sha256:1f02e8b43a8fbbc3f3e0d4f0f4bfc8131bcb4eebe8849b8e5c773f3a1c582a53", size = 13643 }, + { url = "https://files.pythonhosted.org/packages/78/b6/6307fbef88d9b5ee7421e68d78a9f162e0da4900bc5f5793f6d3d0e34fb8/annotated_types-0.7.0-py3-none-any.whl", hash = "sha256:1f02e8b43a8fbbc3f3e0d4f0f4bfc8131bcb4eebe8849b8e5c773f3a1c582a53", size = 13643, upload-time = "2024-05-20T21:33:24.1Z" }, ] [[package]] @@ -41,9 +42,9 @@ dependencies = [ { name = "sniffio" }, { name = "typing-extensions", marker = "python_full_version < '3.13'" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/95/7d/4c1bd541d4dffa1b52bd83fb8527089e097a106fc90b467a7313b105f840/anyio-4.9.0.tar.gz", hash = "sha256:673c0c244e15788651a4ff38710fea9675823028a6f08a5eda409e0c9840a028", size = 190949 } +sdist = { url = "https://files.pythonhosted.org/packages/95/7d/4c1bd541d4dffa1b52bd83fb8527089e097a106fc90b467a7313b105f840/anyio-4.9.0.tar.gz", hash = "sha256:673c0c244e15788651a4ff38710fea9675823028a6f08a5eda409e0c9840a028", size = 190949, upload-time = "2025-03-17T00:02:54.77Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/a1/ee/48ca1a7c89ffec8b6a0c5d02b89c305671d5ffd8d3c94acf8b8c408575bb/anyio-4.9.0-py3-none-any.whl", hash = "sha256:9f76d541cad6e36af7beb62e978876f3b41e3e04f2c1fbf0884604c0a9c4d93c", size = 100916 }, + { url = "https://files.pythonhosted.org/packages/a1/ee/48ca1a7c89ffec8b6a0c5d02b89c305671d5ffd8d3c94acf8b8c408575bb/anyio-4.9.0-py3-none-any.whl", hash = "sha256:9f76d541cad6e36af7beb62e978876f3b41e3e04f2c1fbf0884604c0a9c4d93c", size = 100916, upload-time = "2025-03-17T00:02:52.713Z" }, ] [[package]] @@ -53,9 +54,9 @@ source = { registry = "https://pypi.org/simple" } dependencies = [ { name = "argon2-cffi-bindings" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/0e/89/ce5af8a7d472a67cc819d5d998aa8c82c5d860608c4db9f46f1162d7dab9/argon2_cffi-25.1.0.tar.gz", hash = "sha256:694ae5cc8a42f4c4e2bf2ca0e64e51e23a040c6a517a85074683d3959e1346c1", size = 45706 } +sdist = { url = "https://files.pythonhosted.org/packages/0e/89/ce5af8a7d472a67cc819d5d998aa8c82c5d860608c4db9f46f1162d7dab9/argon2_cffi-25.1.0.tar.gz", hash = "sha256:694ae5cc8a42f4c4e2bf2ca0e64e51e23a040c6a517a85074683d3959e1346c1", size = 45706, upload-time = "2025-06-03T06:55:32.073Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/4f/d3/a8b22fa575b297cd6e3e3b0155c7e25db170edf1c74783d6a31a2490b8d9/argon2_cffi-25.1.0-py3-none-any.whl", hash = "sha256:fdc8b074db390fccb6eb4a3604ae7231f219aa669a2652e0f20e16ba513d5741", size = 14657 }, + { url = "https://files.pythonhosted.org/packages/4f/d3/a8b22fa575b297cd6e3e3b0155c7e25db170edf1c74783d6a31a2490b8d9/argon2_cffi-25.1.0-py3-none-any.whl", hash = "sha256:fdc8b074db390fccb6eb4a3604ae7231f219aa669a2652e0f20e16ba513d5741", size = 14657, upload-time = "2025-06-03T06:55:30.804Z" }, ] [[package]] @@ -65,137 +66,137 @@ source = { registry = "https://pypi.org/simple" } dependencies = [ { name = "cffi" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/b9/e9/184b8ccce6683b0aa2fbb7ba5683ea4b9c5763f1356347f1312c32e3c66e/argon2-cffi-bindings-21.2.0.tar.gz", hash = "sha256:bb89ceffa6c791807d1305ceb77dbfacc5aa499891d2c55661c6459651fc39e3", size = 1779911 } +sdist = { url = "https://files.pythonhosted.org/packages/b9/e9/184b8ccce6683b0aa2fbb7ba5683ea4b9c5763f1356347f1312c32e3c66e/argon2-cffi-bindings-21.2.0.tar.gz", hash = "sha256:bb89ceffa6c791807d1305ceb77dbfacc5aa499891d2c55661c6459651fc39e3", size = 1779911, upload-time = "2021-12-01T08:52:55.68Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/d4/13/838ce2620025e9666aa8f686431f67a29052241692a3dd1ae9d3692a89d3/argon2_cffi_bindings-21.2.0-cp36-abi3-macosx_10_9_x86_64.whl", hash = "sha256:ccb949252cb2ab3a08c02024acb77cfb179492d5701c7cbdbfd776124d4d2367", size = 29658 }, - { url = "https://files.pythonhosted.org/packages/b3/02/f7f7bb6b6af6031edb11037639c697b912e1dea2db94d436e681aea2f495/argon2_cffi_bindings-21.2.0-cp36-abi3-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:9524464572e12979364b7d600abf96181d3541da11e23ddf565a32e70bd4dc0d", size = 80583 }, - { url = "https://files.pythonhosted.org/packages/ec/f7/378254e6dd7ae6f31fe40c8649eea7d4832a42243acaf0f1fff9083b2bed/argon2_cffi_bindings-21.2.0-cp36-abi3-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:b746dba803a79238e925d9046a63aa26bf86ab2a2fe74ce6b009a1c3f5c8f2ae", size = 86168 }, - { url = "https://files.pythonhosted.org/packages/74/f6/4a34a37a98311ed73bb80efe422fed95f2ac25a4cacc5ae1d7ae6a144505/argon2_cffi_bindings-21.2.0-cp36-abi3-manylinux_2_5_i686.manylinux1_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:58ed19212051f49a523abb1dbe954337dc82d947fb6e5a0da60f7c8471a8476c", size = 82709 }, - { url = "https://files.pythonhosted.org/packages/74/2b/73d767bfdaab25484f7e7901379d5f8793cccbb86c6e0cbc4c1b96f63896/argon2_cffi_bindings-21.2.0-cp36-abi3-musllinux_1_1_aarch64.whl", hash = "sha256:bd46088725ef7f58b5a1ef7ca06647ebaf0eb4baff7d1d0d177c6cc8744abd86", size = 83613 }, - { url = "https://files.pythonhosted.org/packages/4f/fd/37f86deef67ff57c76f137a67181949c2d408077e2e3dd70c6c42912c9bf/argon2_cffi_bindings-21.2.0-cp36-abi3-musllinux_1_1_i686.whl", hash = "sha256:8cd69c07dd875537a824deec19f978e0f2078fdda07fd5c42ac29668dda5f40f", size = 84583 }, - { url = "https://files.pythonhosted.org/packages/6f/52/5a60085a3dae8fded8327a4f564223029f5f54b0cb0455a31131b5363a01/argon2_cffi_bindings-21.2.0-cp36-abi3-musllinux_1_1_x86_64.whl", hash = "sha256:f1152ac548bd5b8bcecfb0b0371f082037e47128653df2e8ba6e914d384f3c3e", size = 88475 }, - { url = "https://files.pythonhosted.org/packages/8b/95/143cd64feb24a15fa4b189a3e1e7efbaeeb00f39a51e99b26fc62fbacabd/argon2_cffi_bindings-21.2.0-cp36-abi3-win32.whl", hash = "sha256:603ca0aba86b1349b147cab91ae970c63118a0f30444d4bc80355937c950c082", size = 27698 }, - { url = "https://files.pythonhosted.org/packages/37/2c/e34e47c7dee97ba6f01a6203e0383e15b60fb85d78ac9a15cd066f6fe28b/argon2_cffi_bindings-21.2.0-cp36-abi3-win_amd64.whl", hash = "sha256:b2ef1c30440dbbcba7a5dc3e319408b59676e2e039e2ae11a8775ecf482b192f", size = 30817 }, - { url = "https://files.pythonhosted.org/packages/5a/e4/bf8034d25edaa495da3c8a3405627d2e35758e44ff6eaa7948092646fdcc/argon2_cffi_bindings-21.2.0-cp38-abi3-macosx_10_9_universal2.whl", hash = "sha256:e415e3f62c8d124ee16018e491a009937f8cf7ebf5eb430ffc5de21b900dad93", size = 53104 }, + { url = "https://files.pythonhosted.org/packages/d4/13/838ce2620025e9666aa8f686431f67a29052241692a3dd1ae9d3692a89d3/argon2_cffi_bindings-21.2.0-cp36-abi3-macosx_10_9_x86_64.whl", hash = "sha256:ccb949252cb2ab3a08c02024acb77cfb179492d5701c7cbdbfd776124d4d2367", size = 29658, upload-time = "2021-12-01T09:09:17.016Z" }, + { url = "https://files.pythonhosted.org/packages/b3/02/f7f7bb6b6af6031edb11037639c697b912e1dea2db94d436e681aea2f495/argon2_cffi_bindings-21.2.0-cp36-abi3-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:9524464572e12979364b7d600abf96181d3541da11e23ddf565a32e70bd4dc0d", size = 80583, upload-time = "2021-12-01T09:09:19.546Z" }, + { url = "https://files.pythonhosted.org/packages/ec/f7/378254e6dd7ae6f31fe40c8649eea7d4832a42243acaf0f1fff9083b2bed/argon2_cffi_bindings-21.2.0-cp36-abi3-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:b746dba803a79238e925d9046a63aa26bf86ab2a2fe74ce6b009a1c3f5c8f2ae", size = 86168, upload-time = "2021-12-01T09:09:21.445Z" }, + { url = "https://files.pythonhosted.org/packages/74/f6/4a34a37a98311ed73bb80efe422fed95f2ac25a4cacc5ae1d7ae6a144505/argon2_cffi_bindings-21.2.0-cp36-abi3-manylinux_2_5_i686.manylinux1_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:58ed19212051f49a523abb1dbe954337dc82d947fb6e5a0da60f7c8471a8476c", size = 82709, upload-time = "2021-12-01T09:09:18.182Z" }, + { url = "https://files.pythonhosted.org/packages/74/2b/73d767bfdaab25484f7e7901379d5f8793cccbb86c6e0cbc4c1b96f63896/argon2_cffi_bindings-21.2.0-cp36-abi3-musllinux_1_1_aarch64.whl", hash = "sha256:bd46088725ef7f58b5a1ef7ca06647ebaf0eb4baff7d1d0d177c6cc8744abd86", size = 83613, upload-time = "2021-12-01T09:09:22.741Z" }, + { url = "https://files.pythonhosted.org/packages/4f/fd/37f86deef67ff57c76f137a67181949c2d408077e2e3dd70c6c42912c9bf/argon2_cffi_bindings-21.2.0-cp36-abi3-musllinux_1_1_i686.whl", hash = "sha256:8cd69c07dd875537a824deec19f978e0f2078fdda07fd5c42ac29668dda5f40f", size = 84583, upload-time = "2021-12-01T09:09:24.177Z" }, + { url = "https://files.pythonhosted.org/packages/6f/52/5a60085a3dae8fded8327a4f564223029f5f54b0cb0455a31131b5363a01/argon2_cffi_bindings-21.2.0-cp36-abi3-musllinux_1_1_x86_64.whl", hash = "sha256:f1152ac548bd5b8bcecfb0b0371f082037e47128653df2e8ba6e914d384f3c3e", size = 88475, upload-time = "2021-12-01T09:09:26.673Z" }, + { url = "https://files.pythonhosted.org/packages/8b/95/143cd64feb24a15fa4b189a3e1e7efbaeeb00f39a51e99b26fc62fbacabd/argon2_cffi_bindings-21.2.0-cp36-abi3-win32.whl", hash = "sha256:603ca0aba86b1349b147cab91ae970c63118a0f30444d4bc80355937c950c082", size = 27698, upload-time = "2021-12-01T09:09:27.87Z" }, + { url = "https://files.pythonhosted.org/packages/37/2c/e34e47c7dee97ba6f01a6203e0383e15b60fb85d78ac9a15cd066f6fe28b/argon2_cffi_bindings-21.2.0-cp36-abi3-win_amd64.whl", hash = "sha256:b2ef1c30440dbbcba7a5dc3e319408b59676e2e039e2ae11a8775ecf482b192f", size = 30817, upload-time = "2021-12-01T09:09:30.267Z" }, + { url = "https://files.pythonhosted.org/packages/5a/e4/bf8034d25edaa495da3c8a3405627d2e35758e44ff6eaa7948092646fdcc/argon2_cffi_bindings-21.2.0-cp38-abi3-macosx_10_9_universal2.whl", hash = "sha256:e415e3f62c8d124ee16018e491a009937f8cf7ebf5eb430ffc5de21b900dad93", size = 53104, upload-time = "2021-12-01T09:09:31.335Z" }, ] [[package]] name = "asttokens" version = "3.0.0" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/4a/e7/82da0a03e7ba5141f05cce0d302e6eed121ae055e0456ca228bf693984bc/asttokens-3.0.0.tar.gz", hash = "sha256:0dcd8baa8d62b0c1d118b399b2ddba3c4aff271d0d7a9e0d4c1681c79035bbc7", size = 61978 } +sdist = { url = "https://files.pythonhosted.org/packages/4a/e7/82da0a03e7ba5141f05cce0d302e6eed121ae055e0456ca228bf693984bc/asttokens-3.0.0.tar.gz", hash = "sha256:0dcd8baa8d62b0c1d118b399b2ddba3c4aff271d0d7a9e0d4c1681c79035bbc7", size = 61978, upload-time = "2024-11-30T04:30:14.439Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/25/8a/c46dcc25341b5bce5472c718902eb3d38600a903b14fa6aeecef3f21a46f/asttokens-3.0.0-py3-none-any.whl", hash = "sha256:e3078351a059199dd5138cb1c706e6430c05eff2ff136af5eb4790f9d28932e2", size = 26918 }, + { url = "https://files.pythonhosted.org/packages/25/8a/c46dcc25341b5bce5472c718902eb3d38600a903b14fa6aeecef3f21a46f/asttokens-3.0.0-py3-none-any.whl", hash = "sha256:e3078351a059199dd5138cb1c706e6430c05eff2ff136af5eb4790f9d28932e2", size = 26918, upload-time = "2024-11-30T04:30:10.946Z" }, ] [[package]] name = "babel" version = "2.17.0" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/7d/6b/d52e42361e1aa00709585ecc30b3f9684b3ab62530771402248b1b1d6240/babel-2.17.0.tar.gz", hash = "sha256:0c54cffb19f690cdcc52a3b50bcbf71e07a808d1c80d549f2459b9d2cf0afb9d", size = 9951852 } +sdist = { url = "https://files.pythonhosted.org/packages/7d/6b/d52e42361e1aa00709585ecc30b3f9684b3ab62530771402248b1b1d6240/babel-2.17.0.tar.gz", hash = "sha256:0c54cffb19f690cdcc52a3b50bcbf71e07a808d1c80d549f2459b9d2cf0afb9d", size = 9951852, upload-time = "2025-02-01T15:17:41.026Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/b7/b8/3fe70c75fe32afc4bb507f75563d39bc5642255d1d94f1f23604725780bf/babel-2.17.0-py3-none-any.whl", hash = "sha256:4d0b53093fdfb4b21c92b5213dba5a1b23885afa8383709427046b21c366e5f2", size = 10182537 }, + { url = "https://files.pythonhosted.org/packages/b7/b8/3fe70c75fe32afc4bb507f75563d39bc5642255d1d94f1f23604725780bf/babel-2.17.0-py3-none-any.whl", hash = "sha256:4d0b53093fdfb4b21c92b5213dba5a1b23885afa8383709427046b21c366e5f2", size = 10182537, upload-time = "2025-02-01T15:17:37.39Z" }, ] [[package]] name = "backports-datetime-fromisoformat" version = "2.0.3" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/71/81/eff3184acb1d9dc3ce95a98b6f3c81a49b4be296e664db8e1c2eeabef3d9/backports_datetime_fromisoformat-2.0.3.tar.gz", hash = "sha256:b58edc8f517b66b397abc250ecc737969486703a66eb97e01e6d51291b1a139d", size = 23588 } -wheels = [ - { url = "https://files.pythonhosted.org/packages/42/4b/d6b051ca4b3d76f23c2c436a9669f3be616b8cf6461a7e8061c7c4269642/backports_datetime_fromisoformat-2.0.3-cp310-cp310-macosx_11_0_arm64.whl", hash = "sha256:5f681f638f10588fa3c101ee9ae2b63d3734713202ddfcfb6ec6cea0778a29d4", size = 27561 }, - { url = "https://files.pythonhosted.org/packages/6d/40/e39b0d471e55eb1b5c7c81edab605c02f71c786d59fb875f0a6f23318747/backports_datetime_fromisoformat-2.0.3-cp310-cp310-macosx_11_0_universal2.whl", hash = "sha256:cd681460e9142f1249408e5aee6d178c6d89b49e06d44913c8fdfb6defda8d1c", size = 34448 }, - { url = "https://files.pythonhosted.org/packages/f2/28/7a5c87c5561d14f1c9af979231fdf85d8f9fad7a95ff94e56d2205e2520a/backports_datetime_fromisoformat-2.0.3-cp310-cp310-macosx_11_0_x86_64.whl", hash = "sha256:ee68bc8735ae5058695b76d3bb2aee1d137c052a11c8303f1e966aa23b72b65b", size = 27093 }, - { url = "https://files.pythonhosted.org/packages/80/ba/f00296c5c4536967c7d1136107fdb91c48404fe769a4a6fd5ab045629af8/backports_datetime_fromisoformat-2.0.3-cp310-cp310-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:8273fe7932db65d952a43e238318966eab9e49e8dd546550a41df12175cc2be4", size = 52836 }, - { url = "https://files.pythonhosted.org/packages/e3/92/bb1da57a069ddd601aee352a87262c7ae93467e66721d5762f59df5021a6/backports_datetime_fromisoformat-2.0.3-cp310-cp310-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:39d57ea50aa5a524bb239688adc1d1d824c31b6094ebd39aa164d6cadb85de22", size = 52798 }, - { url = "https://files.pythonhosted.org/packages/df/ef/b6cfd355982e817ccdb8d8d109f720cab6e06f900784b034b30efa8fa832/backports_datetime_fromisoformat-2.0.3-cp310-cp310-musllinux_1_2_aarch64.whl", hash = "sha256:ac6272f87693e78209dc72e84cf9ab58052027733cd0721c55356d3c881791cf", size = 52891 }, - { url = "https://files.pythonhosted.org/packages/37/39/b13e3ae8a7c5d88b68a6e9248ffe7066534b0cfe504bf521963e61b6282d/backports_datetime_fromisoformat-2.0.3-cp310-cp310-musllinux_1_2_x86_64.whl", hash = "sha256:44c497a71f80cd2bcfc26faae8857cf8e79388e3d5fbf79d2354b8c360547d58", size = 52955 }, - { url = "https://files.pythonhosted.org/packages/1e/e4/70cffa3ce1eb4f2ff0c0d6f5d56285aacead6bd3879b27a2ba57ab261172/backports_datetime_fromisoformat-2.0.3-cp310-cp310-win_amd64.whl", hash = "sha256:6335a4c9e8af329cb1ded5ab41a666e1448116161905a94e054f205aa6d263bc", size = 29323 }, - { url = "https://files.pythonhosted.org/packages/62/f5/5bc92030deadf34c365d908d4533709341fb05d0082db318774fdf1b2bcb/backports_datetime_fromisoformat-2.0.3-cp311-cp311-macosx_11_0_arm64.whl", hash = "sha256:e2e4b66e017253cdbe5a1de49e0eecff3f66cd72bcb1229d7db6e6b1832c0443", size = 27626 }, - { url = "https://files.pythonhosted.org/packages/28/45/5885737d51f81dfcd0911dd5c16b510b249d4c4cf6f4a991176e0358a42a/backports_datetime_fromisoformat-2.0.3-cp311-cp311-macosx_11_0_universal2.whl", hash = "sha256:43e2d648e150777e13bbc2549cc960373e37bf65bd8a5d2e0cef40e16e5d8dd0", size = 34588 }, - { url = "https://files.pythonhosted.org/packages/bc/6d/bd74de70953f5dd3e768c8fc774af942af0ce9f211e7c38dd478fa7ea910/backports_datetime_fromisoformat-2.0.3-cp311-cp311-macosx_11_0_x86_64.whl", hash = "sha256:4ce6326fd86d5bae37813c7bf1543bae9e4c215ec6f5afe4c518be2635e2e005", size = 27162 }, - { url = "https://files.pythonhosted.org/packages/47/ba/1d14b097f13cce45b2b35db9898957578b7fcc984e79af3b35189e0d332f/backports_datetime_fromisoformat-2.0.3-cp311-cp311-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:d7c8fac333bf860208fd522a5394369ee3c790d0aa4311f515fcc4b6c5ef8d75", size = 54482 }, - { url = "https://files.pythonhosted.org/packages/25/e9/a2a7927d053b6fa148b64b5e13ca741ca254c13edca99d8251e9a8a09cfe/backports_datetime_fromisoformat-2.0.3-cp311-cp311-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:24a4da5ab3aa0cc293dc0662a0c6d1da1a011dc1edcbc3122a288cfed13a0b45", size = 54362 }, - { url = "https://files.pythonhosted.org/packages/c1/99/394fb5e80131a7d58c49b89e78a61733a9994885804a0bb582416dd10c6f/backports_datetime_fromisoformat-2.0.3-cp311-cp311-musllinux_1_2_aarch64.whl", hash = "sha256:58ea11e3bf912bd0a36b0519eae2c5b560b3cb972ea756e66b73fb9be460af01", size = 54162 }, - { url = "https://files.pythonhosted.org/packages/88/25/1940369de573c752889646d70b3fe8645e77b9e17984e72a554b9b51ffc4/backports_datetime_fromisoformat-2.0.3-cp311-cp311-musllinux_1_2_x86_64.whl", hash = "sha256:8a375c7dbee4734318714a799b6c697223e4bbb57232af37fbfff88fb48a14c6", size = 54118 }, - { url = "https://files.pythonhosted.org/packages/b7/46/f275bf6c61683414acaf42b2df7286d68cfef03e98b45c168323d7707778/backports_datetime_fromisoformat-2.0.3-cp311-cp311-win_amd64.whl", hash = "sha256:ac677b1664c4585c2e014739f6678137c8336815406052349c85898206ec7061", size = 29329 }, - { url = "https://files.pythonhosted.org/packages/a2/0f/69bbdde2e1e57c09b5f01788804c50e68b29890aada999f2b1a40519def9/backports_datetime_fromisoformat-2.0.3-cp312-cp312-macosx_11_0_arm64.whl", hash = "sha256:66ce47ee1ba91e146149cf40565c3d750ea1be94faf660ca733d8601e0848147", size = 27630 }, - { url = "https://files.pythonhosted.org/packages/d5/1d/1c84a50c673c87518b1adfeafcfd149991ed1f7aedc45d6e5eac2f7d19d7/backports_datetime_fromisoformat-2.0.3-cp312-cp312-macosx_11_0_universal2.whl", hash = "sha256:8b7e069910a66b3bba61df35b5f879e5253ff0821a70375b9daf06444d046fa4", size = 34707 }, - { url = "https://files.pythonhosted.org/packages/71/44/27eae384e7e045cda83f70b551d04b4a0b294f9822d32dea1cbf1592de59/backports_datetime_fromisoformat-2.0.3-cp312-cp312-macosx_11_0_x86_64.whl", hash = "sha256:a3b5d1d04a9e0f7b15aa1e647c750631a873b298cdd1255687bb68779fe8eb35", size = 27280 }, - { url = "https://files.pythonhosted.org/packages/a7/7a/a4075187eb6bbb1ff6beb7229db5f66d1070e6968abeb61e056fa51afa5e/backports_datetime_fromisoformat-2.0.3-cp312-cp312-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:ec1b95986430e789c076610aea704db20874f0781b8624f648ca9fb6ef67c6e1", size = 55094 }, - { url = "https://files.pythonhosted.org/packages/71/03/3fced4230c10af14aacadc195fe58e2ced91d011217b450c2e16a09a98c8/backports_datetime_fromisoformat-2.0.3-cp312-cp312-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:ffe5f793db59e2f1d45ec35a1cf51404fdd69df9f6952a0c87c3060af4c00e32", size = 55605 }, - { url = "https://files.pythonhosted.org/packages/f6/0a/4b34a838c57bd16d3e5861ab963845e73a1041034651f7459e9935289cfd/backports_datetime_fromisoformat-2.0.3-cp312-cp312-musllinux_1_2_aarch64.whl", hash = "sha256:620e8e73bd2595dfff1b4d256a12b67fce90ece3de87b38e1dde46b910f46f4d", size = 55353 }, - { url = "https://files.pythonhosted.org/packages/d9/68/07d13c6e98e1cad85606a876367ede2de46af859833a1da12c413c201d78/backports_datetime_fromisoformat-2.0.3-cp312-cp312-musllinux_1_2_x86_64.whl", hash = "sha256:4cf9c0a985d68476c1cabd6385c691201dda2337d7453fb4da9679ce9f23f4e7", size = 55298 }, - { url = "https://files.pythonhosted.org/packages/60/33/45b4d5311f42360f9b900dea53ab2bb20a3d61d7f9b7c37ddfcb3962f86f/backports_datetime_fromisoformat-2.0.3-cp312-cp312-win_amd64.whl", hash = "sha256:d144868a73002e6e2e6fef72333e7b0129cecdd121aa8f1edba7107fd067255d", size = 29375 }, - { url = "https://files.pythonhosted.org/packages/be/03/7eaa9f9bf290395d57fd30d7f1f2f9dff60c06a31c237dc2beb477e8f899/backports_datetime_fromisoformat-2.0.3-pp310-pypy310_pp73-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:90e202e72a3d5aae673fcc8c9a4267d56b2f532beeb9173361293625fe4d2039", size = 28980 }, - { url = "https://files.pythonhosted.org/packages/47/80/a0ecf33446c7349e79f54cc532933780341d20cff0ee12b5bfdcaa47067e/backports_datetime_fromisoformat-2.0.3-pp310-pypy310_pp73-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:2df98ef1b76f5a58bb493dda552259ba60c3a37557d848e039524203951c9f06", size = 28449 }, +sdist = { url = "https://files.pythonhosted.org/packages/71/81/eff3184acb1d9dc3ce95a98b6f3c81a49b4be296e664db8e1c2eeabef3d9/backports_datetime_fromisoformat-2.0.3.tar.gz", hash = "sha256:b58edc8f517b66b397abc250ecc737969486703a66eb97e01e6d51291b1a139d", size = 23588, upload-time = "2024-12-28T20:18:15.017Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/42/4b/d6b051ca4b3d76f23c2c436a9669f3be616b8cf6461a7e8061c7c4269642/backports_datetime_fromisoformat-2.0.3-cp310-cp310-macosx_11_0_arm64.whl", hash = "sha256:5f681f638f10588fa3c101ee9ae2b63d3734713202ddfcfb6ec6cea0778a29d4", size = 27561, upload-time = "2024-12-28T20:16:47.974Z" }, + { url = "https://files.pythonhosted.org/packages/6d/40/e39b0d471e55eb1b5c7c81edab605c02f71c786d59fb875f0a6f23318747/backports_datetime_fromisoformat-2.0.3-cp310-cp310-macosx_11_0_universal2.whl", hash = "sha256:cd681460e9142f1249408e5aee6d178c6d89b49e06d44913c8fdfb6defda8d1c", size = 34448, upload-time = "2024-12-28T20:16:50.712Z" }, + { url = "https://files.pythonhosted.org/packages/f2/28/7a5c87c5561d14f1c9af979231fdf85d8f9fad7a95ff94e56d2205e2520a/backports_datetime_fromisoformat-2.0.3-cp310-cp310-macosx_11_0_x86_64.whl", hash = "sha256:ee68bc8735ae5058695b76d3bb2aee1d137c052a11c8303f1e966aa23b72b65b", size = 27093, upload-time = "2024-12-28T20:16:52.994Z" }, + { url = "https://files.pythonhosted.org/packages/80/ba/f00296c5c4536967c7d1136107fdb91c48404fe769a4a6fd5ab045629af8/backports_datetime_fromisoformat-2.0.3-cp310-cp310-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:8273fe7932db65d952a43e238318966eab9e49e8dd546550a41df12175cc2be4", size = 52836, upload-time = "2024-12-28T20:16:55.283Z" }, + { url = "https://files.pythonhosted.org/packages/e3/92/bb1da57a069ddd601aee352a87262c7ae93467e66721d5762f59df5021a6/backports_datetime_fromisoformat-2.0.3-cp310-cp310-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:39d57ea50aa5a524bb239688adc1d1d824c31b6094ebd39aa164d6cadb85de22", size = 52798, upload-time = "2024-12-28T20:16:56.64Z" }, + { url = "https://files.pythonhosted.org/packages/df/ef/b6cfd355982e817ccdb8d8d109f720cab6e06f900784b034b30efa8fa832/backports_datetime_fromisoformat-2.0.3-cp310-cp310-musllinux_1_2_aarch64.whl", hash = "sha256:ac6272f87693e78209dc72e84cf9ab58052027733cd0721c55356d3c881791cf", size = 52891, upload-time = "2024-12-28T20:16:58.887Z" }, + { url = "https://files.pythonhosted.org/packages/37/39/b13e3ae8a7c5d88b68a6e9248ffe7066534b0cfe504bf521963e61b6282d/backports_datetime_fromisoformat-2.0.3-cp310-cp310-musllinux_1_2_x86_64.whl", hash = "sha256:44c497a71f80cd2bcfc26faae8857cf8e79388e3d5fbf79d2354b8c360547d58", size = 52955, upload-time = "2024-12-28T20:17:00.028Z" }, + { url = "https://files.pythonhosted.org/packages/1e/e4/70cffa3ce1eb4f2ff0c0d6f5d56285aacead6bd3879b27a2ba57ab261172/backports_datetime_fromisoformat-2.0.3-cp310-cp310-win_amd64.whl", hash = "sha256:6335a4c9e8af329cb1ded5ab41a666e1448116161905a94e054f205aa6d263bc", size = 29323, upload-time = "2024-12-28T20:17:01.125Z" }, + { url = "https://files.pythonhosted.org/packages/62/f5/5bc92030deadf34c365d908d4533709341fb05d0082db318774fdf1b2bcb/backports_datetime_fromisoformat-2.0.3-cp311-cp311-macosx_11_0_arm64.whl", hash = "sha256:e2e4b66e017253cdbe5a1de49e0eecff3f66cd72bcb1229d7db6e6b1832c0443", size = 27626, upload-time = "2024-12-28T20:17:03.448Z" }, + { url = "https://files.pythonhosted.org/packages/28/45/5885737d51f81dfcd0911dd5c16b510b249d4c4cf6f4a991176e0358a42a/backports_datetime_fromisoformat-2.0.3-cp311-cp311-macosx_11_0_universal2.whl", hash = "sha256:43e2d648e150777e13bbc2549cc960373e37bf65bd8a5d2e0cef40e16e5d8dd0", size = 34588, upload-time = "2024-12-28T20:17:04.459Z" }, + { url = "https://files.pythonhosted.org/packages/bc/6d/bd74de70953f5dd3e768c8fc774af942af0ce9f211e7c38dd478fa7ea910/backports_datetime_fromisoformat-2.0.3-cp311-cp311-macosx_11_0_x86_64.whl", hash = "sha256:4ce6326fd86d5bae37813c7bf1543bae9e4c215ec6f5afe4c518be2635e2e005", size = 27162, upload-time = "2024-12-28T20:17:06.752Z" }, + { url = "https://files.pythonhosted.org/packages/47/ba/1d14b097f13cce45b2b35db9898957578b7fcc984e79af3b35189e0d332f/backports_datetime_fromisoformat-2.0.3-cp311-cp311-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:d7c8fac333bf860208fd522a5394369ee3c790d0aa4311f515fcc4b6c5ef8d75", size = 54482, upload-time = "2024-12-28T20:17:08.15Z" }, + { url = "https://files.pythonhosted.org/packages/25/e9/a2a7927d053b6fa148b64b5e13ca741ca254c13edca99d8251e9a8a09cfe/backports_datetime_fromisoformat-2.0.3-cp311-cp311-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:24a4da5ab3aa0cc293dc0662a0c6d1da1a011dc1edcbc3122a288cfed13a0b45", size = 54362, upload-time = "2024-12-28T20:17:10.605Z" }, + { url = "https://files.pythonhosted.org/packages/c1/99/394fb5e80131a7d58c49b89e78a61733a9994885804a0bb582416dd10c6f/backports_datetime_fromisoformat-2.0.3-cp311-cp311-musllinux_1_2_aarch64.whl", hash = "sha256:58ea11e3bf912bd0a36b0519eae2c5b560b3cb972ea756e66b73fb9be460af01", size = 54162, upload-time = "2024-12-28T20:17:12.301Z" }, + { url = "https://files.pythonhosted.org/packages/88/25/1940369de573c752889646d70b3fe8645e77b9e17984e72a554b9b51ffc4/backports_datetime_fromisoformat-2.0.3-cp311-cp311-musllinux_1_2_x86_64.whl", hash = "sha256:8a375c7dbee4734318714a799b6c697223e4bbb57232af37fbfff88fb48a14c6", size = 54118, upload-time = "2024-12-28T20:17:13.609Z" }, + { url = "https://files.pythonhosted.org/packages/b7/46/f275bf6c61683414acaf42b2df7286d68cfef03e98b45c168323d7707778/backports_datetime_fromisoformat-2.0.3-cp311-cp311-win_amd64.whl", hash = "sha256:ac677b1664c4585c2e014739f6678137c8336815406052349c85898206ec7061", size = 29329, upload-time = "2024-12-28T20:17:16.124Z" }, + { url = "https://files.pythonhosted.org/packages/a2/0f/69bbdde2e1e57c09b5f01788804c50e68b29890aada999f2b1a40519def9/backports_datetime_fromisoformat-2.0.3-cp312-cp312-macosx_11_0_arm64.whl", hash = "sha256:66ce47ee1ba91e146149cf40565c3d750ea1be94faf660ca733d8601e0848147", size = 27630, upload-time = "2024-12-28T20:17:19.442Z" }, + { url = "https://files.pythonhosted.org/packages/d5/1d/1c84a50c673c87518b1adfeafcfd149991ed1f7aedc45d6e5eac2f7d19d7/backports_datetime_fromisoformat-2.0.3-cp312-cp312-macosx_11_0_universal2.whl", hash = "sha256:8b7e069910a66b3bba61df35b5f879e5253ff0821a70375b9daf06444d046fa4", size = 34707, upload-time = "2024-12-28T20:17:21.79Z" }, + { url = "https://files.pythonhosted.org/packages/71/44/27eae384e7e045cda83f70b551d04b4a0b294f9822d32dea1cbf1592de59/backports_datetime_fromisoformat-2.0.3-cp312-cp312-macosx_11_0_x86_64.whl", hash = "sha256:a3b5d1d04a9e0f7b15aa1e647c750631a873b298cdd1255687bb68779fe8eb35", size = 27280, upload-time = "2024-12-28T20:17:24.503Z" }, + { url = "https://files.pythonhosted.org/packages/a7/7a/a4075187eb6bbb1ff6beb7229db5f66d1070e6968abeb61e056fa51afa5e/backports_datetime_fromisoformat-2.0.3-cp312-cp312-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:ec1b95986430e789c076610aea704db20874f0781b8624f648ca9fb6ef67c6e1", size = 55094, upload-time = "2024-12-28T20:17:25.546Z" }, + { url = "https://files.pythonhosted.org/packages/71/03/3fced4230c10af14aacadc195fe58e2ced91d011217b450c2e16a09a98c8/backports_datetime_fromisoformat-2.0.3-cp312-cp312-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:ffe5f793db59e2f1d45ec35a1cf51404fdd69df9f6952a0c87c3060af4c00e32", size = 55605, upload-time = "2024-12-28T20:17:29.208Z" }, + { url = "https://files.pythonhosted.org/packages/f6/0a/4b34a838c57bd16d3e5861ab963845e73a1041034651f7459e9935289cfd/backports_datetime_fromisoformat-2.0.3-cp312-cp312-musllinux_1_2_aarch64.whl", hash = "sha256:620e8e73bd2595dfff1b4d256a12b67fce90ece3de87b38e1dde46b910f46f4d", size = 55353, upload-time = "2024-12-28T20:17:32.433Z" }, + { url = "https://files.pythonhosted.org/packages/d9/68/07d13c6e98e1cad85606a876367ede2de46af859833a1da12c413c201d78/backports_datetime_fromisoformat-2.0.3-cp312-cp312-musllinux_1_2_x86_64.whl", hash = "sha256:4cf9c0a985d68476c1cabd6385c691201dda2337d7453fb4da9679ce9f23f4e7", size = 55298, upload-time = "2024-12-28T20:17:34.919Z" }, + { url = "https://files.pythonhosted.org/packages/60/33/45b4d5311f42360f9b900dea53ab2bb20a3d61d7f9b7c37ddfcb3962f86f/backports_datetime_fromisoformat-2.0.3-cp312-cp312-win_amd64.whl", hash = "sha256:d144868a73002e6e2e6fef72333e7b0129cecdd121aa8f1edba7107fd067255d", size = 29375, upload-time = "2024-12-28T20:17:36.018Z" }, + { url = "https://files.pythonhosted.org/packages/be/03/7eaa9f9bf290395d57fd30d7f1f2f9dff60c06a31c237dc2beb477e8f899/backports_datetime_fromisoformat-2.0.3-pp310-pypy310_pp73-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:90e202e72a3d5aae673fcc8c9a4267d56b2f532beeb9173361293625fe4d2039", size = 28980, upload-time = "2024-12-28T20:18:06.554Z" }, + { url = "https://files.pythonhosted.org/packages/47/80/a0ecf33446c7349e79f54cc532933780341d20cff0ee12b5bfdcaa47067e/backports_datetime_fromisoformat-2.0.3-pp310-pypy310_pp73-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:2df98ef1b76f5a58bb493dda552259ba60c3a37557d848e039524203951c9f06", size = 28449, upload-time = "2024-12-28T20:18:07.77Z" }, ] [[package]] name = "backports-strenum" version = "1.3.1" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/35/c7/2ed54c32fed313591ffb21edbd48db71e68827d43a61938e5a0bc2b6ec91/backports_strenum-1.3.1.tar.gz", hash = "sha256:77c52407342898497714f0596e86188bb7084f89063226f4ba66863482f42414", size = 7257 } +sdist = { url = "https://files.pythonhosted.org/packages/35/c7/2ed54c32fed313591ffb21edbd48db71e68827d43a61938e5a0bc2b6ec91/backports_strenum-1.3.1.tar.gz", hash = "sha256:77c52407342898497714f0596e86188bb7084f89063226f4ba66863482f42414", size = 7257, upload-time = "2023-12-09T14:36:40.937Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/d6/50/56cf20e2ee5127b603b81d5a69580a1a325083e2b921aa8f067da83927c0/backports_strenum-1.3.1-py3-none-any.whl", hash = "sha256:cdcfe36dc897e2615dc793b7d3097f54d359918fc448754a517e6f23044ccf83", size = 8304 }, + { url = "https://files.pythonhosted.org/packages/d6/50/56cf20e2ee5127b603b81d5a69580a1a325083e2b921aa8f067da83927c0/backports_strenum-1.3.1-py3-none-any.whl", hash = "sha256:cdcfe36dc897e2615dc793b7d3097f54d359918fc448754a517e6f23044ccf83", size = 8304, upload-time = "2023-12-09T14:36:39.905Z" }, ] [[package]] name = "bcrypt" version = "4.3.0" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/bb/5d/6d7433e0f3cd46ce0b43cd65e1db465ea024dbb8216fb2404e919c2ad77b/bcrypt-4.3.0.tar.gz", hash = "sha256:3a3fd2204178b6d2adcf09cb4f6426ffef54762577a7c9b54c159008cb288c18", size = 25697 } -wheels = [ - { url = "https://files.pythonhosted.org/packages/bf/2c/3d44e853d1fe969d229bd58d39ae6902b3d924af0e2b5a60d17d4b809ded/bcrypt-4.3.0-cp313-cp313t-macosx_10_12_universal2.whl", hash = "sha256:f01e060f14b6b57bbb72fc5b4a83ac21c443c9a2ee708e04a10e9192f90a6281", size = 483719 }, - { url = "https://files.pythonhosted.org/packages/a1/e2/58ff6e2a22eca2e2cff5370ae56dba29d70b1ea6fc08ee9115c3ae367795/bcrypt-4.3.0-cp313-cp313t-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:c5eeac541cefd0bb887a371ef73c62c3cd78535e4887b310626036a7c0a817bb", size = 272001 }, - { url = "https://files.pythonhosted.org/packages/37/1f/c55ed8dbe994b1d088309e366749633c9eb90d139af3c0a50c102ba68a1a/bcrypt-4.3.0-cp313-cp313t-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:59e1aa0e2cd871b08ca146ed08445038f42ff75968c7ae50d2fdd7860ade2180", size = 277451 }, - { url = "https://files.pythonhosted.org/packages/d7/1c/794feb2ecf22fe73dcfb697ea7057f632061faceb7dcf0f155f3443b4d79/bcrypt-4.3.0-cp313-cp313t-manylinux_2_28_aarch64.whl", hash = "sha256:0042b2e342e9ae3d2ed22727c1262f76cc4f345683b5c1715f0250cf4277294f", size = 272792 }, - { url = "https://files.pythonhosted.org/packages/13/b7/0b289506a3f3598c2ae2bdfa0ea66969812ed200264e3f61df77753eee6d/bcrypt-4.3.0-cp313-cp313t-manylinux_2_28_armv7l.manylinux_2_31_armv7l.whl", hash = "sha256:74a8d21a09f5e025a9a23e7c0fd2c7fe8e7503e4d356c0a2c1486ba010619f09", size = 289752 }, - { url = "https://files.pythonhosted.org/packages/dc/24/d0fb023788afe9e83cc118895a9f6c57e1044e7e1672f045e46733421fe6/bcrypt-4.3.0-cp313-cp313t-manylinux_2_28_x86_64.whl", hash = "sha256:0142b2cb84a009f8452c8c5a33ace5e3dfec4159e7735f5afe9a4d50a8ea722d", size = 277762 }, - { url = "https://files.pythonhosted.org/packages/e4/38/cde58089492e55ac4ef6c49fea7027600c84fd23f7520c62118c03b4625e/bcrypt-4.3.0-cp313-cp313t-manylinux_2_34_aarch64.whl", hash = "sha256:12fa6ce40cde3f0b899729dbd7d5e8811cb892d31b6f7d0334a1f37748b789fd", size = 272384 }, - { url = "https://files.pythonhosted.org/packages/de/6a/d5026520843490cfc8135d03012a413e4532a400e471e6188b01b2de853f/bcrypt-4.3.0-cp313-cp313t-manylinux_2_34_x86_64.whl", hash = "sha256:5bd3cca1f2aa5dbcf39e2aa13dd094ea181f48959e1071265de49cc2b82525af", size = 277329 }, - { url = "https://files.pythonhosted.org/packages/b3/a3/4fc5255e60486466c389e28c12579d2829b28a527360e9430b4041df4cf9/bcrypt-4.3.0-cp313-cp313t-musllinux_1_1_aarch64.whl", hash = "sha256:335a420cfd63fc5bc27308e929bee231c15c85cc4c496610ffb17923abf7f231", size = 305241 }, - { url = "https://files.pythonhosted.org/packages/c7/15/2b37bc07d6ce27cc94e5b10fd5058900eb8fb11642300e932c8c82e25c4a/bcrypt-4.3.0-cp313-cp313t-musllinux_1_1_x86_64.whl", hash = "sha256:0e30e5e67aed0187a1764911af023043b4542e70a7461ad20e837e94d23e1d6c", size = 309617 }, - { url = "https://files.pythonhosted.org/packages/5f/1f/99f65edb09e6c935232ba0430c8c13bb98cb3194b6d636e61d93fe60ac59/bcrypt-4.3.0-cp313-cp313t-musllinux_1_2_aarch64.whl", hash = "sha256:3b8d62290ebefd49ee0b3ce7500f5dbdcf13b81402c05f6dafab9a1e1b27212f", size = 335751 }, - { url = "https://files.pythonhosted.org/packages/00/1b/b324030c706711c99769988fcb694b3cb23f247ad39a7823a78e361bdbb8/bcrypt-4.3.0-cp313-cp313t-musllinux_1_2_x86_64.whl", hash = "sha256:2ef6630e0ec01376f59a006dc72918b1bf436c3b571b80fa1968d775fa02fe7d", size = 355965 }, - { url = "https://files.pythonhosted.org/packages/aa/dd/20372a0579dd915dfc3b1cd4943b3bca431866fcb1dfdfd7518c3caddea6/bcrypt-4.3.0-cp313-cp313t-win32.whl", hash = "sha256:7a4be4cbf241afee43f1c3969b9103a41b40bcb3a3f467ab19f891d9bc4642e4", size = 155316 }, - { url = "https://files.pythonhosted.org/packages/6d/52/45d969fcff6b5577c2bf17098dc36269b4c02197d551371c023130c0f890/bcrypt-4.3.0-cp313-cp313t-win_amd64.whl", hash = "sha256:5c1949bf259a388863ced887c7861da1df681cb2388645766c89fdfd9004c669", size = 147752 }, - { url = "https://files.pythonhosted.org/packages/11/22/5ada0b9af72b60cbc4c9a399fdde4af0feaa609d27eb0adc61607997a3fa/bcrypt-4.3.0-cp38-abi3-macosx_10_12_universal2.whl", hash = "sha256:f81b0ed2639568bf14749112298f9e4e2b28853dab50a8b357e31798686a036d", size = 498019 }, - { url = "https://files.pythonhosted.org/packages/b8/8c/252a1edc598dc1ce57905be173328eda073083826955ee3c97c7ff5ba584/bcrypt-4.3.0-cp38-abi3-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:864f8f19adbe13b7de11ba15d85d4a428c7e2f344bac110f667676a0ff84924b", size = 279174 }, - { url = "https://files.pythonhosted.org/packages/29/5b/4547d5c49b85f0337c13929f2ccbe08b7283069eea3550a457914fc078aa/bcrypt-4.3.0-cp38-abi3-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:3e36506d001e93bffe59754397572f21bb5dc7c83f54454c990c74a468cd589e", size = 283870 }, - { url = "https://files.pythonhosted.org/packages/be/21/7dbaf3fa1745cb63f776bb046e481fbababd7d344c5324eab47f5ca92dd2/bcrypt-4.3.0-cp38-abi3-manylinux_2_28_aarch64.whl", hash = "sha256:842d08d75d9fe9fb94b18b071090220697f9f184d4547179b60734846461ed59", size = 279601 }, - { url = "https://files.pythonhosted.org/packages/6d/64/e042fc8262e971347d9230d9abbe70d68b0a549acd8611c83cebd3eaec67/bcrypt-4.3.0-cp38-abi3-manylinux_2_28_armv7l.manylinux_2_31_armv7l.whl", hash = "sha256:7c03296b85cb87db865d91da79bf63d5609284fc0cab9472fdd8367bbd830753", size = 297660 }, - { url = "https://files.pythonhosted.org/packages/50/b8/6294eb84a3fef3b67c69b4470fcdd5326676806bf2519cda79331ab3c3a9/bcrypt-4.3.0-cp38-abi3-manylinux_2_28_x86_64.whl", hash = "sha256:62f26585e8b219cdc909b6a0069efc5e4267e25d4a3770a364ac58024f62a761", size = 284083 }, - { url = "https://files.pythonhosted.org/packages/62/e6/baff635a4f2c42e8788fe1b1633911c38551ecca9a749d1052d296329da6/bcrypt-4.3.0-cp38-abi3-manylinux_2_34_aarch64.whl", hash = "sha256:beeefe437218a65322fbd0069eb437e7c98137e08f22c4660ac2dc795c31f8bb", size = 279237 }, - { url = "https://files.pythonhosted.org/packages/39/48/46f623f1b0c7dc2e5de0b8af5e6f5ac4cc26408ac33f3d424e5ad8da4a90/bcrypt-4.3.0-cp38-abi3-manylinux_2_34_x86_64.whl", hash = "sha256:97eea7408db3a5bcce4a55d13245ab3fa566e23b4c67cd227062bb49e26c585d", size = 283737 }, - { url = "https://files.pythonhosted.org/packages/49/8b/70671c3ce9c0fca4a6cc3cc6ccbaa7e948875a2e62cbd146e04a4011899c/bcrypt-4.3.0-cp38-abi3-musllinux_1_1_aarch64.whl", hash = "sha256:191354ebfe305e84f344c5964c7cd5f924a3bfc5d405c75ad07f232b6dffb49f", size = 312741 }, - { url = "https://files.pythonhosted.org/packages/27/fb/910d3a1caa2d249b6040a5caf9f9866c52114d51523ac2fb47578a27faee/bcrypt-4.3.0-cp38-abi3-musllinux_1_1_x86_64.whl", hash = "sha256:41261d64150858eeb5ff43c753c4b216991e0ae16614a308a15d909503617732", size = 316472 }, - { url = "https://files.pythonhosted.org/packages/dc/cf/7cf3a05b66ce466cfb575dbbda39718d45a609daa78500f57fa9f36fa3c0/bcrypt-4.3.0-cp38-abi3-musllinux_1_2_aarch64.whl", hash = "sha256:33752b1ba962ee793fa2b6321404bf20011fe45b9afd2a842139de3011898fef", size = 343606 }, - { url = "https://files.pythonhosted.org/packages/e3/b8/e970ecc6d7e355c0d892b7f733480f4aa8509f99b33e71550242cf0b7e63/bcrypt-4.3.0-cp38-abi3-musllinux_1_2_x86_64.whl", hash = "sha256:50e6e80a4bfd23a25f5c05b90167c19030cf9f87930f7cb2eacb99f45d1c3304", size = 362867 }, - { url = "https://files.pythonhosted.org/packages/a9/97/8d3118efd8354c555a3422d544163f40d9f236be5b96c714086463f11699/bcrypt-4.3.0-cp38-abi3-win32.whl", hash = "sha256:67a561c4d9fb9465ec866177e7aebcad08fe23aaf6fbd692a6fab69088abfc51", size = 160589 }, - { url = "https://files.pythonhosted.org/packages/29/07/416f0b99f7f3997c69815365babbc2e8754181a4b1899d921b3c7d5b6f12/bcrypt-4.3.0-cp38-abi3-win_amd64.whl", hash = "sha256:584027857bc2843772114717a7490a37f68da563b3620f78a849bcb54dc11e62", size = 152794 }, - { url = "https://files.pythonhosted.org/packages/6e/c1/3fa0e9e4e0bfd3fd77eb8b52ec198fd6e1fd7e9402052e43f23483f956dd/bcrypt-4.3.0-cp39-abi3-macosx_10_12_universal2.whl", hash = "sha256:0d3efb1157edebfd9128e4e46e2ac1a64e0c1fe46fb023158a407c7892b0f8c3", size = 498969 }, - { url = "https://files.pythonhosted.org/packages/ce/d4/755ce19b6743394787fbd7dff6bf271b27ee9b5912a97242e3caf125885b/bcrypt-4.3.0-cp39-abi3-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:08bacc884fd302b611226c01014eca277d48f0a05187666bca23aac0dad6fe24", size = 279158 }, - { url = "https://files.pythonhosted.org/packages/9b/5d/805ef1a749c965c46b28285dfb5cd272a7ed9fa971f970435a5133250182/bcrypt-4.3.0-cp39-abi3-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:f6746e6fec103fcd509b96bacdfdaa2fbde9a553245dbada284435173a6f1aef", size = 284285 }, - { url = "https://files.pythonhosted.org/packages/ab/2b/698580547a4a4988e415721b71eb45e80c879f0fb04a62da131f45987b96/bcrypt-4.3.0-cp39-abi3-manylinux_2_28_aarch64.whl", hash = "sha256:afe327968aaf13fc143a56a3360cb27d4ad0345e34da12c7290f1b00b8fe9a8b", size = 279583 }, - { url = "https://files.pythonhosted.org/packages/f2/87/62e1e426418204db520f955ffd06f1efd389feca893dad7095bf35612eec/bcrypt-4.3.0-cp39-abi3-manylinux_2_28_armv7l.manylinux_2_31_armv7l.whl", hash = "sha256:d9af79d322e735b1fc33404b5765108ae0ff232d4b54666d46730f8ac1a43676", size = 297896 }, - { url = "https://files.pythonhosted.org/packages/cb/c6/8fedca4c2ada1b6e889c52d2943b2f968d3427e5d65f595620ec4c06fa2f/bcrypt-4.3.0-cp39-abi3-manylinux_2_28_x86_64.whl", hash = "sha256:f1e3ffa1365e8702dc48c8b360fef8d7afeca482809c5e45e653af82ccd088c1", size = 284492 }, - { url = "https://files.pythonhosted.org/packages/4d/4d/c43332dcaaddb7710a8ff5269fcccba97ed3c85987ddaa808db084267b9a/bcrypt-4.3.0-cp39-abi3-manylinux_2_34_aarch64.whl", hash = "sha256:3004df1b323d10021fda07a813fd33e0fd57bef0e9a480bb143877f6cba996fe", size = 279213 }, - { url = "https://files.pythonhosted.org/packages/dc/7f/1e36379e169a7df3a14a1c160a49b7b918600a6008de43ff20d479e6f4b5/bcrypt-4.3.0-cp39-abi3-manylinux_2_34_x86_64.whl", hash = "sha256:531457e5c839d8caea9b589a1bcfe3756b0547d7814e9ce3d437f17da75c32b0", size = 284162 }, - { url = "https://files.pythonhosted.org/packages/1c/0a/644b2731194b0d7646f3210dc4d80c7fee3ecb3a1f791a6e0ae6bb8684e3/bcrypt-4.3.0-cp39-abi3-musllinux_1_1_aarch64.whl", hash = "sha256:17a854d9a7a476a89dcef6c8bd119ad23e0f82557afbd2c442777a16408e614f", size = 312856 }, - { url = "https://files.pythonhosted.org/packages/dc/62/2a871837c0bb6ab0c9a88bf54de0fc021a6a08832d4ea313ed92a669d437/bcrypt-4.3.0-cp39-abi3-musllinux_1_1_x86_64.whl", hash = "sha256:6fb1fd3ab08c0cbc6826a2e0447610c6f09e983a281b919ed721ad32236b8b23", size = 316726 }, - { url = "https://files.pythonhosted.org/packages/0c/a1/9898ea3faac0b156d457fd73a3cb9c2855c6fd063e44b8522925cdd8ce46/bcrypt-4.3.0-cp39-abi3-musllinux_1_2_aarch64.whl", hash = "sha256:e965a9c1e9a393b8005031ff52583cedc15b7884fce7deb8b0346388837d6cfe", size = 343664 }, - { url = "https://files.pythonhosted.org/packages/40/f2/71b4ed65ce38982ecdda0ff20c3ad1b15e71949c78b2c053df53629ce940/bcrypt-4.3.0-cp39-abi3-musllinux_1_2_x86_64.whl", hash = "sha256:79e70b8342a33b52b55d93b3a59223a844962bef479f6a0ea318ebbcadf71505", size = 363128 }, - { url = "https://files.pythonhosted.org/packages/11/99/12f6a58eca6dea4be992d6c681b7ec9410a1d9f5cf368c61437e31daa879/bcrypt-4.3.0-cp39-abi3-win32.whl", hash = "sha256:b4d4e57f0a63fd0b358eb765063ff661328f69a04494427265950c71b992a39a", size = 160598 }, - { url = "https://files.pythonhosted.org/packages/a9/cf/45fb5261ece3e6b9817d3d82b2f343a505fd58674a92577923bc500bd1aa/bcrypt-4.3.0-cp39-abi3-win_amd64.whl", hash = "sha256:e53e074b120f2877a35cc6c736b8eb161377caae8925c17688bd46ba56daaa5b", size = 152799 }, - { url = "https://files.pythonhosted.org/packages/55/2d/0c7e5ab0524bf1a443e34cdd3926ec6f5879889b2f3c32b2f5074e99ed53/bcrypt-4.3.0-pp310-pypy310_pp73-manylinux_2_28_aarch64.whl", hash = "sha256:c950d682f0952bafcceaf709761da0a32a942272fad381081b51096ffa46cea1", size = 275367 }, - { url = "https://files.pythonhosted.org/packages/10/4f/f77509f08bdff8806ecc4dc472b6e187c946c730565a7470db772d25df70/bcrypt-4.3.0-pp310-pypy310_pp73-manylinux_2_28_x86_64.whl", hash = "sha256:107d53b5c67e0bbc3f03ebf5b030e0403d24dda980f8e244795335ba7b4a027d", size = 280644 }, - { url = "https://files.pythonhosted.org/packages/35/18/7d9dc16a3a4d530d0a9b845160e9e5d8eb4f00483e05d44bb4116a1861da/bcrypt-4.3.0-pp310-pypy310_pp73-manylinux_2_34_aarch64.whl", hash = "sha256:b693dbb82b3c27a1604a3dff5bfc5418a7e6a781bb795288141e5f80cf3a3492", size = 274881 }, - { url = "https://files.pythonhosted.org/packages/df/c4/ae6921088adf1e37f2a3a6a688e72e7d9e45fdd3ae5e0bc931870c1ebbda/bcrypt-4.3.0-pp310-pypy310_pp73-manylinux_2_34_x86_64.whl", hash = "sha256:b6354d3760fcd31994a14c89659dee887f1351a06e5dac3c1142307172a79f90", size = 280203 }, - { url = "https://files.pythonhosted.org/packages/4c/b1/1289e21d710496b88340369137cc4c5f6ee036401190ea116a7b4ae6d32a/bcrypt-4.3.0-pp311-pypy311_pp73-manylinux_2_28_aarch64.whl", hash = "sha256:a839320bf27d474e52ef8cb16449bb2ce0ba03ca9f44daba6d93fa1d8828e48a", size = 275103 }, - { url = "https://files.pythonhosted.org/packages/94/41/19be9fe17e4ffc5d10b7b67f10e459fc4eee6ffe9056a88de511920cfd8d/bcrypt-4.3.0-pp311-pypy311_pp73-manylinux_2_28_x86_64.whl", hash = "sha256:bdc6a24e754a555d7316fa4774e64c6c3997d27ed2d1964d55920c7c227bc4ce", size = 280513 }, - { url = "https://files.pythonhosted.org/packages/aa/73/05687a9ef89edebdd8ad7474c16d8af685eb4591c3c38300bb6aad4f0076/bcrypt-4.3.0-pp311-pypy311_pp73-manylinux_2_34_aarch64.whl", hash = "sha256:55a935b8e9a1d2def0626c4269db3fcd26728cbff1e84f0341465c31c4ee56d8", size = 274685 }, - { url = "https://files.pythonhosted.org/packages/63/13/47bba97924ebe86a62ef83dc75b7c8a881d53c535f83e2c54c4bd701e05c/bcrypt-4.3.0-pp311-pypy311_pp73-manylinux_2_34_x86_64.whl", hash = "sha256:57967b7a28d855313a963aaea51bf6df89f833db4320da458e5b3c5ab6d4c938", size = 280110 }, +sdist = { url = "https://files.pythonhosted.org/packages/bb/5d/6d7433e0f3cd46ce0b43cd65e1db465ea024dbb8216fb2404e919c2ad77b/bcrypt-4.3.0.tar.gz", hash = "sha256:3a3fd2204178b6d2adcf09cb4f6426ffef54762577a7c9b54c159008cb288c18", size = 25697, upload-time = "2025-02-28T01:24:09.174Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/bf/2c/3d44e853d1fe969d229bd58d39ae6902b3d924af0e2b5a60d17d4b809ded/bcrypt-4.3.0-cp313-cp313t-macosx_10_12_universal2.whl", hash = "sha256:f01e060f14b6b57bbb72fc5b4a83ac21c443c9a2ee708e04a10e9192f90a6281", size = 483719, upload-time = "2025-02-28T01:22:34.539Z" }, + { url = "https://files.pythonhosted.org/packages/a1/e2/58ff6e2a22eca2e2cff5370ae56dba29d70b1ea6fc08ee9115c3ae367795/bcrypt-4.3.0-cp313-cp313t-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:c5eeac541cefd0bb887a371ef73c62c3cd78535e4887b310626036a7c0a817bb", size = 272001, upload-time = "2025-02-28T01:22:38.078Z" }, + { url = "https://files.pythonhosted.org/packages/37/1f/c55ed8dbe994b1d088309e366749633c9eb90d139af3c0a50c102ba68a1a/bcrypt-4.3.0-cp313-cp313t-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:59e1aa0e2cd871b08ca146ed08445038f42ff75968c7ae50d2fdd7860ade2180", size = 277451, upload-time = "2025-02-28T01:22:40.787Z" }, + { url = "https://files.pythonhosted.org/packages/d7/1c/794feb2ecf22fe73dcfb697ea7057f632061faceb7dcf0f155f3443b4d79/bcrypt-4.3.0-cp313-cp313t-manylinux_2_28_aarch64.whl", hash = "sha256:0042b2e342e9ae3d2ed22727c1262f76cc4f345683b5c1715f0250cf4277294f", size = 272792, upload-time = "2025-02-28T01:22:43.144Z" }, + { url = "https://files.pythonhosted.org/packages/13/b7/0b289506a3f3598c2ae2bdfa0ea66969812ed200264e3f61df77753eee6d/bcrypt-4.3.0-cp313-cp313t-manylinux_2_28_armv7l.manylinux_2_31_armv7l.whl", hash = "sha256:74a8d21a09f5e025a9a23e7c0fd2c7fe8e7503e4d356c0a2c1486ba010619f09", size = 289752, upload-time = "2025-02-28T01:22:45.56Z" }, + { url = "https://files.pythonhosted.org/packages/dc/24/d0fb023788afe9e83cc118895a9f6c57e1044e7e1672f045e46733421fe6/bcrypt-4.3.0-cp313-cp313t-manylinux_2_28_x86_64.whl", hash = "sha256:0142b2cb84a009f8452c8c5a33ace5e3dfec4159e7735f5afe9a4d50a8ea722d", size = 277762, upload-time = "2025-02-28T01:22:47.023Z" }, + { url = "https://files.pythonhosted.org/packages/e4/38/cde58089492e55ac4ef6c49fea7027600c84fd23f7520c62118c03b4625e/bcrypt-4.3.0-cp313-cp313t-manylinux_2_34_aarch64.whl", hash = "sha256:12fa6ce40cde3f0b899729dbd7d5e8811cb892d31b6f7d0334a1f37748b789fd", size = 272384, upload-time = "2025-02-28T01:22:49.221Z" }, + { url = "https://files.pythonhosted.org/packages/de/6a/d5026520843490cfc8135d03012a413e4532a400e471e6188b01b2de853f/bcrypt-4.3.0-cp313-cp313t-manylinux_2_34_x86_64.whl", hash = "sha256:5bd3cca1f2aa5dbcf39e2aa13dd094ea181f48959e1071265de49cc2b82525af", size = 277329, upload-time = "2025-02-28T01:22:51.603Z" }, + { url = "https://files.pythonhosted.org/packages/b3/a3/4fc5255e60486466c389e28c12579d2829b28a527360e9430b4041df4cf9/bcrypt-4.3.0-cp313-cp313t-musllinux_1_1_aarch64.whl", hash = "sha256:335a420cfd63fc5bc27308e929bee231c15c85cc4c496610ffb17923abf7f231", size = 305241, upload-time = "2025-02-28T01:22:53.283Z" }, + { url = "https://files.pythonhosted.org/packages/c7/15/2b37bc07d6ce27cc94e5b10fd5058900eb8fb11642300e932c8c82e25c4a/bcrypt-4.3.0-cp313-cp313t-musllinux_1_1_x86_64.whl", hash = "sha256:0e30e5e67aed0187a1764911af023043b4542e70a7461ad20e837e94d23e1d6c", size = 309617, upload-time = "2025-02-28T01:22:55.461Z" }, + { url = "https://files.pythonhosted.org/packages/5f/1f/99f65edb09e6c935232ba0430c8c13bb98cb3194b6d636e61d93fe60ac59/bcrypt-4.3.0-cp313-cp313t-musllinux_1_2_aarch64.whl", hash = "sha256:3b8d62290ebefd49ee0b3ce7500f5dbdcf13b81402c05f6dafab9a1e1b27212f", size = 335751, upload-time = "2025-02-28T01:22:57.81Z" }, + { url = "https://files.pythonhosted.org/packages/00/1b/b324030c706711c99769988fcb694b3cb23f247ad39a7823a78e361bdbb8/bcrypt-4.3.0-cp313-cp313t-musllinux_1_2_x86_64.whl", hash = "sha256:2ef6630e0ec01376f59a006dc72918b1bf436c3b571b80fa1968d775fa02fe7d", size = 355965, upload-time = "2025-02-28T01:22:59.181Z" }, + { url = "https://files.pythonhosted.org/packages/aa/dd/20372a0579dd915dfc3b1cd4943b3bca431866fcb1dfdfd7518c3caddea6/bcrypt-4.3.0-cp313-cp313t-win32.whl", hash = "sha256:7a4be4cbf241afee43f1c3969b9103a41b40bcb3a3f467ab19f891d9bc4642e4", size = 155316, upload-time = "2025-02-28T01:23:00.763Z" }, + { url = "https://files.pythonhosted.org/packages/6d/52/45d969fcff6b5577c2bf17098dc36269b4c02197d551371c023130c0f890/bcrypt-4.3.0-cp313-cp313t-win_amd64.whl", hash = "sha256:5c1949bf259a388863ced887c7861da1df681cb2388645766c89fdfd9004c669", size = 147752, upload-time = "2025-02-28T01:23:02.908Z" }, + { url = "https://files.pythonhosted.org/packages/11/22/5ada0b9af72b60cbc4c9a399fdde4af0feaa609d27eb0adc61607997a3fa/bcrypt-4.3.0-cp38-abi3-macosx_10_12_universal2.whl", hash = "sha256:f81b0ed2639568bf14749112298f9e4e2b28853dab50a8b357e31798686a036d", size = 498019, upload-time = "2025-02-28T01:23:05.838Z" }, + { url = "https://files.pythonhosted.org/packages/b8/8c/252a1edc598dc1ce57905be173328eda073083826955ee3c97c7ff5ba584/bcrypt-4.3.0-cp38-abi3-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:864f8f19adbe13b7de11ba15d85d4a428c7e2f344bac110f667676a0ff84924b", size = 279174, upload-time = "2025-02-28T01:23:07.274Z" }, + { url = "https://files.pythonhosted.org/packages/29/5b/4547d5c49b85f0337c13929f2ccbe08b7283069eea3550a457914fc078aa/bcrypt-4.3.0-cp38-abi3-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:3e36506d001e93bffe59754397572f21bb5dc7c83f54454c990c74a468cd589e", size = 283870, upload-time = "2025-02-28T01:23:09.151Z" }, + { url = "https://files.pythonhosted.org/packages/be/21/7dbaf3fa1745cb63f776bb046e481fbababd7d344c5324eab47f5ca92dd2/bcrypt-4.3.0-cp38-abi3-manylinux_2_28_aarch64.whl", hash = "sha256:842d08d75d9fe9fb94b18b071090220697f9f184d4547179b60734846461ed59", size = 279601, upload-time = "2025-02-28T01:23:11.461Z" }, + { url = "https://files.pythonhosted.org/packages/6d/64/e042fc8262e971347d9230d9abbe70d68b0a549acd8611c83cebd3eaec67/bcrypt-4.3.0-cp38-abi3-manylinux_2_28_armv7l.manylinux_2_31_armv7l.whl", hash = "sha256:7c03296b85cb87db865d91da79bf63d5609284fc0cab9472fdd8367bbd830753", size = 297660, upload-time = "2025-02-28T01:23:12.989Z" }, + { url = "https://files.pythonhosted.org/packages/50/b8/6294eb84a3fef3b67c69b4470fcdd5326676806bf2519cda79331ab3c3a9/bcrypt-4.3.0-cp38-abi3-manylinux_2_28_x86_64.whl", hash = "sha256:62f26585e8b219cdc909b6a0069efc5e4267e25d4a3770a364ac58024f62a761", size = 284083, upload-time = "2025-02-28T01:23:14.5Z" }, + { url = "https://files.pythonhosted.org/packages/62/e6/baff635a4f2c42e8788fe1b1633911c38551ecca9a749d1052d296329da6/bcrypt-4.3.0-cp38-abi3-manylinux_2_34_aarch64.whl", hash = "sha256:beeefe437218a65322fbd0069eb437e7c98137e08f22c4660ac2dc795c31f8bb", size = 279237, upload-time = "2025-02-28T01:23:16.686Z" }, + { url = "https://files.pythonhosted.org/packages/39/48/46f623f1b0c7dc2e5de0b8af5e6f5ac4cc26408ac33f3d424e5ad8da4a90/bcrypt-4.3.0-cp38-abi3-manylinux_2_34_x86_64.whl", hash = "sha256:97eea7408db3a5bcce4a55d13245ab3fa566e23b4c67cd227062bb49e26c585d", size = 283737, upload-time = "2025-02-28T01:23:18.897Z" }, + { url = "https://files.pythonhosted.org/packages/49/8b/70671c3ce9c0fca4a6cc3cc6ccbaa7e948875a2e62cbd146e04a4011899c/bcrypt-4.3.0-cp38-abi3-musllinux_1_1_aarch64.whl", hash = "sha256:191354ebfe305e84f344c5964c7cd5f924a3bfc5d405c75ad07f232b6dffb49f", size = 312741, upload-time = "2025-02-28T01:23:21.041Z" }, + { url = "https://files.pythonhosted.org/packages/27/fb/910d3a1caa2d249b6040a5caf9f9866c52114d51523ac2fb47578a27faee/bcrypt-4.3.0-cp38-abi3-musllinux_1_1_x86_64.whl", hash = "sha256:41261d64150858eeb5ff43c753c4b216991e0ae16614a308a15d909503617732", size = 316472, upload-time = "2025-02-28T01:23:23.183Z" }, + { url = "https://files.pythonhosted.org/packages/dc/cf/7cf3a05b66ce466cfb575dbbda39718d45a609daa78500f57fa9f36fa3c0/bcrypt-4.3.0-cp38-abi3-musllinux_1_2_aarch64.whl", hash = "sha256:33752b1ba962ee793fa2b6321404bf20011fe45b9afd2a842139de3011898fef", size = 343606, upload-time = "2025-02-28T01:23:25.361Z" }, + { url = "https://files.pythonhosted.org/packages/e3/b8/e970ecc6d7e355c0d892b7f733480f4aa8509f99b33e71550242cf0b7e63/bcrypt-4.3.0-cp38-abi3-musllinux_1_2_x86_64.whl", hash = "sha256:50e6e80a4bfd23a25f5c05b90167c19030cf9f87930f7cb2eacb99f45d1c3304", size = 362867, upload-time = "2025-02-28T01:23:26.875Z" }, + { url = "https://files.pythonhosted.org/packages/a9/97/8d3118efd8354c555a3422d544163f40d9f236be5b96c714086463f11699/bcrypt-4.3.0-cp38-abi3-win32.whl", hash = "sha256:67a561c4d9fb9465ec866177e7aebcad08fe23aaf6fbd692a6fab69088abfc51", size = 160589, upload-time = "2025-02-28T01:23:28.381Z" }, + { url = "https://files.pythonhosted.org/packages/29/07/416f0b99f7f3997c69815365babbc2e8754181a4b1899d921b3c7d5b6f12/bcrypt-4.3.0-cp38-abi3-win_amd64.whl", hash = "sha256:584027857bc2843772114717a7490a37f68da563b3620f78a849bcb54dc11e62", size = 152794, upload-time = "2025-02-28T01:23:30.187Z" }, + { url = "https://files.pythonhosted.org/packages/6e/c1/3fa0e9e4e0bfd3fd77eb8b52ec198fd6e1fd7e9402052e43f23483f956dd/bcrypt-4.3.0-cp39-abi3-macosx_10_12_universal2.whl", hash = "sha256:0d3efb1157edebfd9128e4e46e2ac1a64e0c1fe46fb023158a407c7892b0f8c3", size = 498969, upload-time = "2025-02-28T01:23:31.945Z" }, + { url = "https://files.pythonhosted.org/packages/ce/d4/755ce19b6743394787fbd7dff6bf271b27ee9b5912a97242e3caf125885b/bcrypt-4.3.0-cp39-abi3-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:08bacc884fd302b611226c01014eca277d48f0a05187666bca23aac0dad6fe24", size = 279158, upload-time = "2025-02-28T01:23:34.161Z" }, + { url = "https://files.pythonhosted.org/packages/9b/5d/805ef1a749c965c46b28285dfb5cd272a7ed9fa971f970435a5133250182/bcrypt-4.3.0-cp39-abi3-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:f6746e6fec103fcd509b96bacdfdaa2fbde9a553245dbada284435173a6f1aef", size = 284285, upload-time = "2025-02-28T01:23:35.765Z" }, + { url = "https://files.pythonhosted.org/packages/ab/2b/698580547a4a4988e415721b71eb45e80c879f0fb04a62da131f45987b96/bcrypt-4.3.0-cp39-abi3-manylinux_2_28_aarch64.whl", hash = "sha256:afe327968aaf13fc143a56a3360cb27d4ad0345e34da12c7290f1b00b8fe9a8b", size = 279583, upload-time = "2025-02-28T01:23:38.021Z" }, + { url = "https://files.pythonhosted.org/packages/f2/87/62e1e426418204db520f955ffd06f1efd389feca893dad7095bf35612eec/bcrypt-4.3.0-cp39-abi3-manylinux_2_28_armv7l.manylinux_2_31_armv7l.whl", hash = "sha256:d9af79d322e735b1fc33404b5765108ae0ff232d4b54666d46730f8ac1a43676", size = 297896, upload-time = "2025-02-28T01:23:39.575Z" }, + { url = "https://files.pythonhosted.org/packages/cb/c6/8fedca4c2ada1b6e889c52d2943b2f968d3427e5d65f595620ec4c06fa2f/bcrypt-4.3.0-cp39-abi3-manylinux_2_28_x86_64.whl", hash = "sha256:f1e3ffa1365e8702dc48c8b360fef8d7afeca482809c5e45e653af82ccd088c1", size = 284492, upload-time = "2025-02-28T01:23:40.901Z" }, + { url = "https://files.pythonhosted.org/packages/4d/4d/c43332dcaaddb7710a8ff5269fcccba97ed3c85987ddaa808db084267b9a/bcrypt-4.3.0-cp39-abi3-manylinux_2_34_aarch64.whl", hash = "sha256:3004df1b323d10021fda07a813fd33e0fd57bef0e9a480bb143877f6cba996fe", size = 279213, upload-time = "2025-02-28T01:23:42.653Z" }, + { url = "https://files.pythonhosted.org/packages/dc/7f/1e36379e169a7df3a14a1c160a49b7b918600a6008de43ff20d479e6f4b5/bcrypt-4.3.0-cp39-abi3-manylinux_2_34_x86_64.whl", hash = "sha256:531457e5c839d8caea9b589a1bcfe3756b0547d7814e9ce3d437f17da75c32b0", size = 284162, upload-time = "2025-02-28T01:23:43.964Z" }, + { url = "https://files.pythonhosted.org/packages/1c/0a/644b2731194b0d7646f3210dc4d80c7fee3ecb3a1f791a6e0ae6bb8684e3/bcrypt-4.3.0-cp39-abi3-musllinux_1_1_aarch64.whl", hash = "sha256:17a854d9a7a476a89dcef6c8bd119ad23e0f82557afbd2c442777a16408e614f", size = 312856, upload-time = "2025-02-28T01:23:46.011Z" }, + { url = "https://files.pythonhosted.org/packages/dc/62/2a871837c0bb6ab0c9a88bf54de0fc021a6a08832d4ea313ed92a669d437/bcrypt-4.3.0-cp39-abi3-musllinux_1_1_x86_64.whl", hash = "sha256:6fb1fd3ab08c0cbc6826a2e0447610c6f09e983a281b919ed721ad32236b8b23", size = 316726, upload-time = "2025-02-28T01:23:47.575Z" }, + { url = "https://files.pythonhosted.org/packages/0c/a1/9898ea3faac0b156d457fd73a3cb9c2855c6fd063e44b8522925cdd8ce46/bcrypt-4.3.0-cp39-abi3-musllinux_1_2_aarch64.whl", hash = "sha256:e965a9c1e9a393b8005031ff52583cedc15b7884fce7deb8b0346388837d6cfe", size = 343664, upload-time = "2025-02-28T01:23:49.059Z" }, + { url = "https://files.pythonhosted.org/packages/40/f2/71b4ed65ce38982ecdda0ff20c3ad1b15e71949c78b2c053df53629ce940/bcrypt-4.3.0-cp39-abi3-musllinux_1_2_x86_64.whl", hash = "sha256:79e70b8342a33b52b55d93b3a59223a844962bef479f6a0ea318ebbcadf71505", size = 363128, upload-time = "2025-02-28T01:23:50.399Z" }, + { url = "https://files.pythonhosted.org/packages/11/99/12f6a58eca6dea4be992d6c681b7ec9410a1d9f5cf368c61437e31daa879/bcrypt-4.3.0-cp39-abi3-win32.whl", hash = "sha256:b4d4e57f0a63fd0b358eb765063ff661328f69a04494427265950c71b992a39a", size = 160598, upload-time = "2025-02-28T01:23:51.775Z" }, + { url = "https://files.pythonhosted.org/packages/a9/cf/45fb5261ece3e6b9817d3d82b2f343a505fd58674a92577923bc500bd1aa/bcrypt-4.3.0-cp39-abi3-win_amd64.whl", hash = "sha256:e53e074b120f2877a35cc6c736b8eb161377caae8925c17688bd46ba56daaa5b", size = 152799, upload-time = "2025-02-28T01:23:53.139Z" }, + { url = "https://files.pythonhosted.org/packages/55/2d/0c7e5ab0524bf1a443e34cdd3926ec6f5879889b2f3c32b2f5074e99ed53/bcrypt-4.3.0-pp310-pypy310_pp73-manylinux_2_28_aarch64.whl", hash = "sha256:c950d682f0952bafcceaf709761da0a32a942272fad381081b51096ffa46cea1", size = 275367, upload-time = "2025-02-28T01:23:54.578Z" }, + { url = "https://files.pythonhosted.org/packages/10/4f/f77509f08bdff8806ecc4dc472b6e187c946c730565a7470db772d25df70/bcrypt-4.3.0-pp310-pypy310_pp73-manylinux_2_28_x86_64.whl", hash = "sha256:107d53b5c67e0bbc3f03ebf5b030e0403d24dda980f8e244795335ba7b4a027d", size = 280644, upload-time = "2025-02-28T01:23:56.547Z" }, + { url = "https://files.pythonhosted.org/packages/35/18/7d9dc16a3a4d530d0a9b845160e9e5d8eb4f00483e05d44bb4116a1861da/bcrypt-4.3.0-pp310-pypy310_pp73-manylinux_2_34_aarch64.whl", hash = "sha256:b693dbb82b3c27a1604a3dff5bfc5418a7e6a781bb795288141e5f80cf3a3492", size = 274881, upload-time = "2025-02-28T01:23:57.935Z" }, + { url = "https://files.pythonhosted.org/packages/df/c4/ae6921088adf1e37f2a3a6a688e72e7d9e45fdd3ae5e0bc931870c1ebbda/bcrypt-4.3.0-pp310-pypy310_pp73-manylinux_2_34_x86_64.whl", hash = "sha256:b6354d3760fcd31994a14c89659dee887f1351a06e5dac3c1142307172a79f90", size = 280203, upload-time = "2025-02-28T01:23:59.331Z" }, + { url = "https://files.pythonhosted.org/packages/4c/b1/1289e21d710496b88340369137cc4c5f6ee036401190ea116a7b4ae6d32a/bcrypt-4.3.0-pp311-pypy311_pp73-manylinux_2_28_aarch64.whl", hash = "sha256:a839320bf27d474e52ef8cb16449bb2ce0ba03ca9f44daba6d93fa1d8828e48a", size = 275103, upload-time = "2025-02-28T01:24:00.764Z" }, + { url = "https://files.pythonhosted.org/packages/94/41/19be9fe17e4ffc5d10b7b67f10e459fc4eee6ffe9056a88de511920cfd8d/bcrypt-4.3.0-pp311-pypy311_pp73-manylinux_2_28_x86_64.whl", hash = "sha256:bdc6a24e754a555d7316fa4774e64c6c3997d27ed2d1964d55920c7c227bc4ce", size = 280513, upload-time = "2025-02-28T01:24:02.243Z" }, + { url = "https://files.pythonhosted.org/packages/aa/73/05687a9ef89edebdd8ad7474c16d8af685eb4591c3c38300bb6aad4f0076/bcrypt-4.3.0-pp311-pypy311_pp73-manylinux_2_34_aarch64.whl", hash = "sha256:55a935b8e9a1d2def0626c4269db3fcd26728cbff1e84f0341465c31c4ee56d8", size = 274685, upload-time = "2025-02-28T01:24:04.512Z" }, + { url = "https://files.pythonhosted.org/packages/63/13/47bba97924ebe86a62ef83dc75b7c8a881d53c535f83e2c54c4bd701e05c/bcrypt-4.3.0-pp311-pypy311_pp73-manylinux_2_34_x86_64.whl", hash = "sha256:57967b7a28d855313a963aaea51bf6df89f833db4320da458e5b3c5ab6d4c938", size = 280110, upload-time = "2025-02-28T01:24:05.896Z" }, ] [[package]] @@ -206,18 +207,18 @@ dependencies = [ { name = "soupsieve" }, { name = "typing-extensions" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/d8/e4/0c4c39e18fd76d6a628d4dd8da40543d136ce2d1752bd6eeeab0791f4d6b/beautifulsoup4-4.13.4.tar.gz", hash = "sha256:dbb3c4e1ceae6aefebdaf2423247260cd062430a410e38c66f2baa50a8437195", size = 621067 } +sdist = { url = "https://files.pythonhosted.org/packages/d8/e4/0c4c39e18fd76d6a628d4dd8da40543d136ce2d1752bd6eeeab0791f4d6b/beautifulsoup4-4.13.4.tar.gz", hash = "sha256:dbb3c4e1ceae6aefebdaf2423247260cd062430a410e38c66f2baa50a8437195", size = 621067, upload-time = "2025-04-15T17:05:13.836Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/50/cd/30110dc0ffcf3b131156077b90e9f60ed75711223f306da4db08eff8403b/beautifulsoup4-4.13.4-py3-none-any.whl", hash = "sha256:9bbbb14bfde9d79f38b8cd5f8c7c85f4b8f2523190ebed90e950a8dea4cb1c4b", size = 187285 }, + { url = "https://files.pythonhosted.org/packages/50/cd/30110dc0ffcf3b131156077b90e9f60ed75711223f306da4db08eff8403b/beautifulsoup4-4.13.4-py3-none-any.whl", hash = "sha256:9bbbb14bfde9d79f38b8cd5f8c7c85f4b8f2523190ebed90e950a8dea4cb1c4b", size = 187285, upload-time = "2025-04-15T17:05:12.221Z" }, ] [[package]] name = "bracex" version = "2.5.post1" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/d6/6c/57418c4404cd22fe6275b8301ca2b46a8cdaa8157938017a9ae0b3edf363/bracex-2.5.post1.tar.gz", hash = "sha256:12c50952415bfa773d2d9ccb8e79651b8cdb1f31a42f6091b804f6ba2b4a66b6", size = 26641 } +sdist = { url = "https://files.pythonhosted.org/packages/d6/6c/57418c4404cd22fe6275b8301ca2b46a8cdaa8157938017a9ae0b3edf363/bracex-2.5.post1.tar.gz", hash = "sha256:12c50952415bfa773d2d9ccb8e79651b8cdb1f31a42f6091b804f6ba2b4a66b6", size = 26641, upload-time = "2024-09-28T21:41:22.017Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/4b/02/8db98cdc1a58e0abd6716d5e63244658e6e63513c65f469f34b6f1053fd0/bracex-2.5.post1-py3-none-any.whl", hash = "sha256:13e5732fec27828d6af308628285ad358047cec36801598368cb28bc631dbaf6", size = 11558 }, + { url = "https://files.pythonhosted.org/packages/4b/02/8db98cdc1a58e0abd6716d5e63244658e6e63513c65f469f34b6f1053fd0/bracex-2.5.post1-py3-none-any.whl", hash = "sha256:13e5732fec27828d6af308628285ad358047cec36801598368cb28bc631dbaf6", size = 11558, upload-time = "2024-09-28T21:41:21.016Z" }, ] [[package]] @@ -231,18 +232,18 @@ dependencies = [ { name = "pyproject-hooks" }, { name = "tomli", marker = "python_full_version < '3.11'" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/7d/46/aeab111f8e06793e4f0e421fcad593d547fb8313b50990f31681ee2fb1ad/build-1.2.2.post1.tar.gz", hash = "sha256:b36993e92ca9375a219c99e606a122ff365a760a2d4bba0caa09bd5278b608b7", size = 46701 } +sdist = { url = "https://files.pythonhosted.org/packages/7d/46/aeab111f8e06793e4f0e421fcad593d547fb8313b50990f31681ee2fb1ad/build-1.2.2.post1.tar.gz", hash = "sha256:b36993e92ca9375a219c99e606a122ff365a760a2d4bba0caa09bd5278b608b7", size = 46701, upload-time = "2024-10-06T17:22:25.251Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/84/c2/80633736cd183ee4a62107413def345f7e6e3c01563dbca1417363cf957e/build-1.2.2.post1-py3-none-any.whl", hash = "sha256:1d61c0887fa860c01971625baae8bdd338e517b836a2f70dd1f7aa3a6b2fc5b5", size = 22950 }, + { url = "https://files.pythonhosted.org/packages/84/c2/80633736cd183ee4a62107413def345f7e6e3c01563dbca1417363cf957e/build-1.2.2.post1-py3-none-any.whl", hash = "sha256:1d61c0887fa860c01971625baae8bdd338e517b836a2f70dd1f7aa3a6b2fc5b5", size = 22950, upload-time = "2024-10-06T17:22:23.299Z" }, ] [[package]] name = "cachetools" version = "5.5.2" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/6c/81/3747dad6b14fa2cf53fcf10548cf5aea6913e96fab41a3c198676f8948a5/cachetools-5.5.2.tar.gz", hash = "sha256:1a661caa9175d26759571b2e19580f9d6393969e5dfca11fdb1f947a23e640d4", size = 28380 } +sdist = { url = "https://files.pythonhosted.org/packages/6c/81/3747dad6b14fa2cf53fcf10548cf5aea6913e96fab41a3c198676f8948a5/cachetools-5.5.2.tar.gz", hash = "sha256:1a661caa9175d26759571b2e19580f9d6393969e5dfca11fdb1f947a23e640d4", size = 28380, upload-time = "2025-02-20T21:01:19.524Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/72/76/20fa66124dbe6be5cafeb312ece67de6b61dd91a0247d1ea13db4ebb33c2/cachetools-5.5.2-py3-none-any.whl", hash = "sha256:d26a22bcc62eb95c3beabd9f1ee5e820d3d2704fe2967cbe350e20c8ffcd3f0a", size = 10080 }, + { url = "https://files.pythonhosted.org/packages/72/76/20fa66124dbe6be5cafeb312ece67de6b61dd91a0247d1ea13db4ebb33c2/cachetools-5.5.2-py3-none-any.whl", hash = "sha256:d26a22bcc62eb95c3beabd9f1ee5e820d3d2704fe2967cbe350e20c8ffcd3f0a", size = 10080, upload-time = "2025-02-20T21:01:16.647Z" }, ] [[package]] @@ -256,18 +257,18 @@ dependencies = [ { name = "requests" }, { name = "sphinx" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/5d/5c/332207eef59ae7a621b0f6327a9ee1e5096ced12c5f06ee3e26b7e0419ca/canonical_sphinx_extensions-0.0.27.tar.gz", hash = "sha256:668ad29a7f8f0154bcc4eed7df393abb75bba67dc907dc343e11405f3bfa97bf", size = 32159 } +sdist = { url = "https://files.pythonhosted.org/packages/5d/5c/332207eef59ae7a621b0f6327a9ee1e5096ced12c5f06ee3e26b7e0419ca/canonical_sphinx_extensions-0.0.27.tar.gz", hash = "sha256:668ad29a7f8f0154bcc4eed7df393abb75bba67dc907dc343e11405f3bfa97bf", size = 32159, upload-time = "2025-03-14T03:15:10.995Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/dc/42/910aa5e2143be98125cd4dd84f3576817d38bee60a77a934dc0b2c31f04b/canonical_sphinx_extensions-0.0.27-py3-none-any.whl", hash = "sha256:2b3294bf3024f5a59a91a082a9ac5cbc56dc3ff61d367e0c6322982c52fe57f8", size = 60906 }, + { url = "https://files.pythonhosted.org/packages/dc/42/910aa5e2143be98125cd4dd84f3576817d38bee60a77a934dc0b2c31f04b/canonical_sphinx_extensions-0.0.27-py3-none-any.whl", hash = "sha256:2b3294bf3024f5a59a91a082a9ac5cbc56dc3ff61d367e0c6322982c52fe57f8", size = 60906, upload-time = "2025-03-14T03:15:09.477Z" }, ] [[package]] name = "certifi" version = "2025.4.26" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/e8/9e/c05b3920a3b7d20d3d3310465f50348e5b3694f4f88c6daf736eef3024c4/certifi-2025.4.26.tar.gz", hash = "sha256:0a816057ea3cdefcef70270d2c515e4506bbc954f417fa5ade2021213bb8f0c6", size = 160705 } +sdist = { url = "https://files.pythonhosted.org/packages/e8/9e/c05b3920a3b7d20d3d3310465f50348e5b3694f4f88c6daf736eef3024c4/certifi-2025.4.26.tar.gz", hash = "sha256:0a816057ea3cdefcef70270d2c515e4506bbc954f417fa5ade2021213bb8f0c6", size = 160705, upload-time = "2025-04-26T02:12:29.51Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/4a/7e/3db2bd1b1f9e95f7cddca6d6e75e2f2bd9f51b1246e546d88addca0106bd/certifi-2025.4.26-py3-none-any.whl", hash = "sha256:30350364dfe371162649852c63336a15c70c6510c2ad5015b21c2345311805f3", size = 159618 }, + { url = "https://files.pythonhosted.org/packages/4a/7e/3db2bd1b1f9e95f7cddca6d6e75e2f2bd9f51b1246e546d88addca0106bd/certifi-2025.4.26-py3-none-any.whl", hash = "sha256:30350364dfe371162649852c63336a15c70c6510c2ad5015b21c2345311805f3", size = 159618, upload-time = "2025-04-26T02:12:27.662Z" }, ] [[package]] @@ -277,115 +278,115 @@ source = { registry = "https://pypi.org/simple" } dependencies = [ { name = "pycparser" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/fc/97/c783634659c2920c3fc70419e3af40972dbaf758daa229a7d6ea6135c90d/cffi-1.17.1.tar.gz", hash = "sha256:1c39c6016c32bc48dd54561950ebd6836e1670f2ae46128f67cf49e789c52824", size = 516621 } -wheels = [ - { url = "https://files.pythonhosted.org/packages/90/07/f44ca684db4e4f08a3fdc6eeb9a0d15dc6883efc7b8c90357fdbf74e186c/cffi-1.17.1-cp310-cp310-macosx_10_9_x86_64.whl", hash = "sha256:df8b1c11f177bc2313ec4b2d46baec87a5f3e71fc8b45dab2ee7cae86d9aba14", size = 182191 }, - { url = "https://files.pythonhosted.org/packages/08/fd/cc2fedbd887223f9f5d170c96e57cbf655df9831a6546c1727ae13fa977a/cffi-1.17.1-cp310-cp310-macosx_11_0_arm64.whl", hash = "sha256:8f2cdc858323644ab277e9bb925ad72ae0e67f69e804f4898c070998d50b1a67", size = 178592 }, - { url = "https://files.pythonhosted.org/packages/de/cc/4635c320081c78d6ffc2cab0a76025b691a91204f4aa317d568ff9280a2d/cffi-1.17.1-cp310-cp310-manylinux_2_12_i686.manylinux2010_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:edae79245293e15384b51f88b00613ba9f7198016a5948b5dddf4917d4d26382", size = 426024 }, - { url = "https://files.pythonhosted.org/packages/b6/7b/3b2b250f3aab91abe5f8a51ada1b717935fdaec53f790ad4100fe2ec64d1/cffi-1.17.1-cp310-cp310-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:45398b671ac6d70e67da8e4224a065cec6a93541bb7aebe1b198a61b58c7b702", size = 448188 }, - { url = "https://files.pythonhosted.org/packages/d3/48/1b9283ebbf0ec065148d8de05d647a986c5f22586b18120020452fff8f5d/cffi-1.17.1-cp310-cp310-manylinux_2_17_ppc64le.manylinux2014_ppc64le.whl", hash = "sha256:ad9413ccdeda48c5afdae7e4fa2192157e991ff761e7ab8fdd8926f40b160cc3", size = 455571 }, - { url = "https://files.pythonhosted.org/packages/40/87/3b8452525437b40f39ca7ff70276679772ee7e8b394934ff60e63b7b090c/cffi-1.17.1-cp310-cp310-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:5da5719280082ac6bd9aa7becb3938dc9f9cbd57fac7d2871717b1feb0902ab6", size = 436687 }, - { url = "https://files.pythonhosted.org/packages/8d/fb/4da72871d177d63649ac449aec2e8a29efe0274035880c7af59101ca2232/cffi-1.17.1-cp310-cp310-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:2bb1a08b8008b281856e5971307cc386a8e9c5b625ac297e853d36da6efe9c17", size = 446211 }, - { url = "https://files.pythonhosted.org/packages/ab/a0/62f00bcb411332106c02b663b26f3545a9ef136f80d5df746c05878f8c4b/cffi-1.17.1-cp310-cp310-musllinux_1_1_aarch64.whl", hash = "sha256:045d61c734659cc045141be4bae381a41d89b741f795af1dd018bfb532fd0df8", size = 461325 }, - { url = "https://files.pythonhosted.org/packages/36/83/76127035ed2e7e27b0787604d99da630ac3123bfb02d8e80c633f218a11d/cffi-1.17.1-cp310-cp310-musllinux_1_1_i686.whl", hash = "sha256:6883e737d7d9e4899a8a695e00ec36bd4e5e4f18fabe0aca0efe0a4b44cdb13e", size = 438784 }, - { url = "https://files.pythonhosted.org/packages/21/81/a6cd025db2f08ac88b901b745c163d884641909641f9b826e8cb87645942/cffi-1.17.1-cp310-cp310-musllinux_1_1_x86_64.whl", hash = "sha256:6b8b4a92e1c65048ff98cfe1f735ef8f1ceb72e3d5f0c25fdb12087a23da22be", size = 461564 }, - { url = "https://files.pythonhosted.org/packages/f8/fe/4d41c2f200c4a457933dbd98d3cf4e911870877bd94d9656cc0fcb390681/cffi-1.17.1-cp310-cp310-win32.whl", hash = "sha256:c9c3d058ebabb74db66e431095118094d06abf53284d9c81f27300d0e0d8bc7c", size = 171804 }, - { url = "https://files.pythonhosted.org/packages/d1/b6/0b0f5ab93b0df4acc49cae758c81fe4e5ef26c3ae2e10cc69249dfd8b3ab/cffi-1.17.1-cp310-cp310-win_amd64.whl", hash = "sha256:0f048dcf80db46f0098ccac01132761580d28e28bc0f78ae0d58048063317e15", size = 181299 }, - { url = "https://files.pythonhosted.org/packages/6b/f4/927e3a8899e52a27fa57a48607ff7dc91a9ebe97399b357b85a0c7892e00/cffi-1.17.1-cp311-cp311-macosx_10_9_x86_64.whl", hash = "sha256:a45e3c6913c5b87b3ff120dcdc03f6131fa0065027d0ed7ee6190736a74cd401", size = 182264 }, - { url = "https://files.pythonhosted.org/packages/6c/f5/6c3a8efe5f503175aaddcbea6ad0d2c96dad6f5abb205750d1b3df44ef29/cffi-1.17.1-cp311-cp311-macosx_11_0_arm64.whl", hash = "sha256:30c5e0cb5ae493c04c8b42916e52ca38079f1b235c2f8ae5f4527b963c401caf", size = 178651 }, - { url = "https://files.pythonhosted.org/packages/94/dd/a3f0118e688d1b1a57553da23b16bdade96d2f9bcda4d32e7d2838047ff7/cffi-1.17.1-cp311-cp311-manylinux_2_12_i686.manylinux2010_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:f75c7ab1f9e4aca5414ed4d8e5c0e303a34f4421f8a0d47a4d019ceff0ab6af4", size = 445259 }, - { url = "https://files.pythonhosted.org/packages/2e/ea/70ce63780f096e16ce8588efe039d3c4f91deb1dc01e9c73a287939c79a6/cffi-1.17.1-cp311-cp311-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:a1ed2dd2972641495a3ec98445e09766f077aee98a1c896dcb4ad0d303628e41", size = 469200 }, - { url = "https://files.pythonhosted.org/packages/1c/a0/a4fa9f4f781bda074c3ddd57a572b060fa0df7655d2a4247bbe277200146/cffi-1.17.1-cp311-cp311-manylinux_2_17_ppc64le.manylinux2014_ppc64le.whl", hash = "sha256:46bf43160c1a35f7ec506d254e5c890f3c03648a4dbac12d624e4490a7046cd1", size = 477235 }, - { url = "https://files.pythonhosted.org/packages/62/12/ce8710b5b8affbcdd5c6e367217c242524ad17a02fe5beec3ee339f69f85/cffi-1.17.1-cp311-cp311-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:a24ed04c8ffd54b0729c07cee15a81d964e6fee0e3d4d342a27b020d22959dc6", size = 459721 }, - { url = "https://files.pythonhosted.org/packages/ff/6b/d45873c5e0242196f042d555526f92aa9e0c32355a1be1ff8c27f077fd37/cffi-1.17.1-cp311-cp311-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:610faea79c43e44c71e1ec53a554553fa22321b65fae24889706c0a84d4ad86d", size = 467242 }, - { url = "https://files.pythonhosted.org/packages/1a/52/d9a0e523a572fbccf2955f5abe883cfa8bcc570d7faeee06336fbd50c9fc/cffi-1.17.1-cp311-cp311-musllinux_1_1_aarch64.whl", hash = "sha256:a9b15d491f3ad5d692e11f6b71f7857e7835eb677955c00cc0aefcd0669adaf6", size = 477999 }, - { url = "https://files.pythonhosted.org/packages/44/74/f2a2460684a1a2d00ca799ad880d54652841a780c4c97b87754f660c7603/cffi-1.17.1-cp311-cp311-musllinux_1_1_i686.whl", hash = "sha256:de2ea4b5833625383e464549fec1bc395c1bdeeb5f25c4a3a82b5a8c756ec22f", size = 454242 }, - { url = "https://files.pythonhosted.org/packages/f8/4a/34599cac7dfcd888ff54e801afe06a19c17787dfd94495ab0c8d35fe99fb/cffi-1.17.1-cp311-cp311-musllinux_1_1_x86_64.whl", hash = "sha256:fc48c783f9c87e60831201f2cce7f3b2e4846bf4d8728eabe54d60700b318a0b", size = 478604 }, - { url = "https://files.pythonhosted.org/packages/34/33/e1b8a1ba29025adbdcda5fb3a36f94c03d771c1b7b12f726ff7fef2ebe36/cffi-1.17.1-cp311-cp311-win32.whl", hash = "sha256:85a950a4ac9c359340d5963966e3e0a94a676bd6245a4b55bc43949eee26a655", size = 171727 }, - { url = "https://files.pythonhosted.org/packages/3d/97/50228be003bb2802627d28ec0627837ac0bf35c90cf769812056f235b2d1/cffi-1.17.1-cp311-cp311-win_amd64.whl", hash = "sha256:caaf0640ef5f5517f49bc275eca1406b0ffa6aa184892812030f04c2abf589a0", size = 181400 }, - { url = "https://files.pythonhosted.org/packages/5a/84/e94227139ee5fb4d600a7a4927f322e1d4aea6fdc50bd3fca8493caba23f/cffi-1.17.1-cp312-cp312-macosx_10_9_x86_64.whl", hash = "sha256:805b4371bf7197c329fcb3ead37e710d1bca9da5d583f5073b799d5c5bd1eee4", size = 183178 }, - { url = "https://files.pythonhosted.org/packages/da/ee/fb72c2b48656111c4ef27f0f91da355e130a923473bf5ee75c5643d00cca/cffi-1.17.1-cp312-cp312-macosx_11_0_arm64.whl", hash = "sha256:733e99bc2df47476e3848417c5a4540522f234dfd4ef3ab7fafdf555b082ec0c", size = 178840 }, - { url = "https://files.pythonhosted.org/packages/cc/b6/db007700f67d151abadf508cbfd6a1884f57eab90b1bb985c4c8c02b0f28/cffi-1.17.1-cp312-cp312-manylinux_2_12_i686.manylinux2010_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:1257bdabf294dceb59f5e70c64a3e2f462c30c7ad68092d01bbbfb1c16b1ba36", size = 454803 }, - { url = "https://files.pythonhosted.org/packages/1a/df/f8d151540d8c200eb1c6fba8cd0dfd40904f1b0682ea705c36e6c2e97ab3/cffi-1.17.1-cp312-cp312-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:da95af8214998d77a98cc14e3a3bd00aa191526343078b530ceb0bd710fb48a5", size = 478850 }, - { url = "https://files.pythonhosted.org/packages/28/c0/b31116332a547fd2677ae5b78a2ef662dfc8023d67f41b2a83f7c2aa78b1/cffi-1.17.1-cp312-cp312-manylinux_2_17_ppc64le.manylinux2014_ppc64le.whl", hash = "sha256:d63afe322132c194cf832bfec0dc69a99fb9bb6bbd550f161a49e9e855cc78ff", size = 485729 }, - { url = "https://files.pythonhosted.org/packages/91/2b/9a1ddfa5c7f13cab007a2c9cc295b70fbbda7cb10a286aa6810338e60ea1/cffi-1.17.1-cp312-cp312-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:f79fc4fc25f1c8698ff97788206bb3c2598949bfe0fef03d299eb1b5356ada99", size = 471256 }, - { url = "https://files.pythonhosted.org/packages/b2/d5/da47df7004cb17e4955df6a43d14b3b4ae77737dff8bf7f8f333196717bf/cffi-1.17.1-cp312-cp312-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:b62ce867176a75d03a665bad002af8e6d54644fad99a3c70905c543130e39d93", size = 479424 }, - { url = "https://files.pythonhosted.org/packages/0b/ac/2a28bcf513e93a219c8a4e8e125534f4f6db03e3179ba1c45e949b76212c/cffi-1.17.1-cp312-cp312-musllinux_1_1_aarch64.whl", hash = "sha256:386c8bf53c502fff58903061338ce4f4950cbdcb23e2902d86c0f722b786bbe3", size = 484568 }, - { url = "https://files.pythonhosted.org/packages/d4/38/ca8a4f639065f14ae0f1d9751e70447a261f1a30fa7547a828ae08142465/cffi-1.17.1-cp312-cp312-musllinux_1_1_x86_64.whl", hash = "sha256:4ceb10419a9adf4460ea14cfd6bc43d08701f0835e979bf821052f1805850fe8", size = 488736 }, - { url = "https://files.pythonhosted.org/packages/86/c5/28b2d6f799ec0bdecf44dced2ec5ed43e0eb63097b0f58c293583b406582/cffi-1.17.1-cp312-cp312-win32.whl", hash = "sha256:a08d7e755f8ed21095a310a693525137cfe756ce62d066e53f502a83dc550f65", size = 172448 }, - { url = "https://files.pythonhosted.org/packages/50/b9/db34c4755a7bd1cb2d1603ac3863f22bcecbd1ba29e5ee841a4bc510b294/cffi-1.17.1-cp312-cp312-win_amd64.whl", hash = "sha256:51392eae71afec0d0c8fb1a53b204dbb3bcabcb3c9b807eedf3e1e6ccf2de903", size = 181976 }, - { url = "https://files.pythonhosted.org/packages/8d/f8/dd6c246b148639254dad4d6803eb6a54e8c85c6e11ec9df2cffa87571dbe/cffi-1.17.1-cp313-cp313-macosx_10_13_x86_64.whl", hash = "sha256:f3a2b4222ce6b60e2e8b337bb9596923045681d71e5a082783484d845390938e", size = 182989 }, - { url = "https://files.pythonhosted.org/packages/8b/f1/672d303ddf17c24fc83afd712316fda78dc6fce1cd53011b839483e1ecc8/cffi-1.17.1-cp313-cp313-macosx_11_0_arm64.whl", hash = "sha256:0984a4925a435b1da406122d4d7968dd861c1385afe3b45ba82b750f229811e2", size = 178802 }, - { url = "https://files.pythonhosted.org/packages/0e/2d/eab2e858a91fdff70533cab61dcff4a1f55ec60425832ddfdc9cd36bc8af/cffi-1.17.1-cp313-cp313-manylinux_2_12_i686.manylinux2010_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:d01b12eeeb4427d3110de311e1774046ad344f5b1a7403101878976ecd7a10f3", size = 454792 }, - { url = "https://files.pythonhosted.org/packages/75/b2/fbaec7c4455c604e29388d55599b99ebcc250a60050610fadde58932b7ee/cffi-1.17.1-cp313-cp313-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:706510fe141c86a69c8ddc029c7910003a17353970cff3b904ff0686a5927683", size = 478893 }, - { url = "https://files.pythonhosted.org/packages/4f/b7/6e4a2162178bf1935c336d4da8a9352cccab4d3a5d7914065490f08c0690/cffi-1.17.1-cp313-cp313-manylinux_2_17_ppc64le.manylinux2014_ppc64le.whl", hash = "sha256:de55b766c7aa2e2a3092c51e0483d700341182f08e67c63630d5b6f200bb28e5", size = 485810 }, - { url = "https://files.pythonhosted.org/packages/c7/8a/1d0e4a9c26e54746dc08c2c6c037889124d4f59dffd853a659fa545f1b40/cffi-1.17.1-cp313-cp313-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:c59d6e989d07460165cc5ad3c61f9fd8f1b4796eacbd81cee78957842b834af4", size = 471200 }, - { url = "https://files.pythonhosted.org/packages/26/9f/1aab65a6c0db35f43c4d1b4f580e8df53914310afc10ae0397d29d697af4/cffi-1.17.1-cp313-cp313-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:dd398dbc6773384a17fe0d3e7eeb8d1a21c2200473ee6806bb5e6a8e62bb73dd", size = 479447 }, - { url = "https://files.pythonhosted.org/packages/5f/e4/fb8b3dd8dc0e98edf1135ff067ae070bb32ef9d509d6cb0f538cd6f7483f/cffi-1.17.1-cp313-cp313-musllinux_1_1_aarch64.whl", hash = "sha256:3edc8d958eb099c634dace3c7e16560ae474aa3803a5df240542b305d14e14ed", size = 484358 }, - { url = "https://files.pythonhosted.org/packages/f1/47/d7145bf2dc04684935d57d67dff9d6d795b2ba2796806bb109864be3a151/cffi-1.17.1-cp313-cp313-musllinux_1_1_x86_64.whl", hash = "sha256:72e72408cad3d5419375fc87d289076ee319835bdfa2caad331e377589aebba9", size = 488469 }, - { url = "https://files.pythonhosted.org/packages/bf/ee/f94057fa6426481d663b88637a9a10e859e492c73d0384514a17d78ee205/cffi-1.17.1-cp313-cp313-win32.whl", hash = "sha256:e03eab0a8677fa80d646b5ddece1cbeaf556c313dcfac435ba11f107ba117b5d", size = 172475 }, - { url = "https://files.pythonhosted.org/packages/7c/fc/6a8cb64e5f0324877d503c854da15d76c1e50eb722e320b15345c4d0c6de/cffi-1.17.1-cp313-cp313-win_amd64.whl", hash = "sha256:f6a16c31041f09ead72d69f583767292f750d24913dadacf5756b966aacb3f1a", size = 182009 }, +sdist = { url = "https://files.pythonhosted.org/packages/fc/97/c783634659c2920c3fc70419e3af40972dbaf758daa229a7d6ea6135c90d/cffi-1.17.1.tar.gz", hash = "sha256:1c39c6016c32bc48dd54561950ebd6836e1670f2ae46128f67cf49e789c52824", size = 516621, upload-time = "2024-09-04T20:45:21.852Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/90/07/f44ca684db4e4f08a3fdc6eeb9a0d15dc6883efc7b8c90357fdbf74e186c/cffi-1.17.1-cp310-cp310-macosx_10_9_x86_64.whl", hash = "sha256:df8b1c11f177bc2313ec4b2d46baec87a5f3e71fc8b45dab2ee7cae86d9aba14", size = 182191, upload-time = "2024-09-04T20:43:30.027Z" }, + { url = "https://files.pythonhosted.org/packages/08/fd/cc2fedbd887223f9f5d170c96e57cbf655df9831a6546c1727ae13fa977a/cffi-1.17.1-cp310-cp310-macosx_11_0_arm64.whl", hash = "sha256:8f2cdc858323644ab277e9bb925ad72ae0e67f69e804f4898c070998d50b1a67", size = 178592, upload-time = "2024-09-04T20:43:32.108Z" }, + { url = "https://files.pythonhosted.org/packages/de/cc/4635c320081c78d6ffc2cab0a76025b691a91204f4aa317d568ff9280a2d/cffi-1.17.1-cp310-cp310-manylinux_2_12_i686.manylinux2010_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:edae79245293e15384b51f88b00613ba9f7198016a5948b5dddf4917d4d26382", size = 426024, upload-time = "2024-09-04T20:43:34.186Z" }, + { url = "https://files.pythonhosted.org/packages/b6/7b/3b2b250f3aab91abe5f8a51ada1b717935fdaec53f790ad4100fe2ec64d1/cffi-1.17.1-cp310-cp310-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:45398b671ac6d70e67da8e4224a065cec6a93541bb7aebe1b198a61b58c7b702", size = 448188, upload-time = "2024-09-04T20:43:36.286Z" }, + { url = "https://files.pythonhosted.org/packages/d3/48/1b9283ebbf0ec065148d8de05d647a986c5f22586b18120020452fff8f5d/cffi-1.17.1-cp310-cp310-manylinux_2_17_ppc64le.manylinux2014_ppc64le.whl", hash = "sha256:ad9413ccdeda48c5afdae7e4fa2192157e991ff761e7ab8fdd8926f40b160cc3", size = 455571, upload-time = "2024-09-04T20:43:38.586Z" }, + { url = "https://files.pythonhosted.org/packages/40/87/3b8452525437b40f39ca7ff70276679772ee7e8b394934ff60e63b7b090c/cffi-1.17.1-cp310-cp310-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:5da5719280082ac6bd9aa7becb3938dc9f9cbd57fac7d2871717b1feb0902ab6", size = 436687, upload-time = "2024-09-04T20:43:40.084Z" }, + { url = "https://files.pythonhosted.org/packages/8d/fb/4da72871d177d63649ac449aec2e8a29efe0274035880c7af59101ca2232/cffi-1.17.1-cp310-cp310-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:2bb1a08b8008b281856e5971307cc386a8e9c5b625ac297e853d36da6efe9c17", size = 446211, upload-time = "2024-09-04T20:43:41.526Z" }, + { url = "https://files.pythonhosted.org/packages/ab/a0/62f00bcb411332106c02b663b26f3545a9ef136f80d5df746c05878f8c4b/cffi-1.17.1-cp310-cp310-musllinux_1_1_aarch64.whl", hash = "sha256:045d61c734659cc045141be4bae381a41d89b741f795af1dd018bfb532fd0df8", size = 461325, upload-time = "2024-09-04T20:43:43.117Z" }, + { url = "https://files.pythonhosted.org/packages/36/83/76127035ed2e7e27b0787604d99da630ac3123bfb02d8e80c633f218a11d/cffi-1.17.1-cp310-cp310-musllinux_1_1_i686.whl", hash = "sha256:6883e737d7d9e4899a8a695e00ec36bd4e5e4f18fabe0aca0efe0a4b44cdb13e", size = 438784, upload-time = "2024-09-04T20:43:45.256Z" }, + { url = "https://files.pythonhosted.org/packages/21/81/a6cd025db2f08ac88b901b745c163d884641909641f9b826e8cb87645942/cffi-1.17.1-cp310-cp310-musllinux_1_1_x86_64.whl", hash = "sha256:6b8b4a92e1c65048ff98cfe1f735ef8f1ceb72e3d5f0c25fdb12087a23da22be", size = 461564, upload-time = "2024-09-04T20:43:46.779Z" }, + { url = "https://files.pythonhosted.org/packages/f8/fe/4d41c2f200c4a457933dbd98d3cf4e911870877bd94d9656cc0fcb390681/cffi-1.17.1-cp310-cp310-win32.whl", hash = "sha256:c9c3d058ebabb74db66e431095118094d06abf53284d9c81f27300d0e0d8bc7c", size = 171804, upload-time = "2024-09-04T20:43:48.186Z" }, + { url = "https://files.pythonhosted.org/packages/d1/b6/0b0f5ab93b0df4acc49cae758c81fe4e5ef26c3ae2e10cc69249dfd8b3ab/cffi-1.17.1-cp310-cp310-win_amd64.whl", hash = "sha256:0f048dcf80db46f0098ccac01132761580d28e28bc0f78ae0d58048063317e15", size = 181299, upload-time = "2024-09-04T20:43:49.812Z" }, + { url = "https://files.pythonhosted.org/packages/6b/f4/927e3a8899e52a27fa57a48607ff7dc91a9ebe97399b357b85a0c7892e00/cffi-1.17.1-cp311-cp311-macosx_10_9_x86_64.whl", hash = "sha256:a45e3c6913c5b87b3ff120dcdc03f6131fa0065027d0ed7ee6190736a74cd401", size = 182264, upload-time = "2024-09-04T20:43:51.124Z" }, + { url = "https://files.pythonhosted.org/packages/6c/f5/6c3a8efe5f503175aaddcbea6ad0d2c96dad6f5abb205750d1b3df44ef29/cffi-1.17.1-cp311-cp311-macosx_11_0_arm64.whl", hash = "sha256:30c5e0cb5ae493c04c8b42916e52ca38079f1b235c2f8ae5f4527b963c401caf", size = 178651, upload-time = "2024-09-04T20:43:52.872Z" }, + { url = "https://files.pythonhosted.org/packages/94/dd/a3f0118e688d1b1a57553da23b16bdade96d2f9bcda4d32e7d2838047ff7/cffi-1.17.1-cp311-cp311-manylinux_2_12_i686.manylinux2010_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:f75c7ab1f9e4aca5414ed4d8e5c0e303a34f4421f8a0d47a4d019ceff0ab6af4", size = 445259, upload-time = "2024-09-04T20:43:56.123Z" }, + { url = "https://files.pythonhosted.org/packages/2e/ea/70ce63780f096e16ce8588efe039d3c4f91deb1dc01e9c73a287939c79a6/cffi-1.17.1-cp311-cp311-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:a1ed2dd2972641495a3ec98445e09766f077aee98a1c896dcb4ad0d303628e41", size = 469200, upload-time = "2024-09-04T20:43:57.891Z" }, + { url = "https://files.pythonhosted.org/packages/1c/a0/a4fa9f4f781bda074c3ddd57a572b060fa0df7655d2a4247bbe277200146/cffi-1.17.1-cp311-cp311-manylinux_2_17_ppc64le.manylinux2014_ppc64le.whl", hash = "sha256:46bf43160c1a35f7ec506d254e5c890f3c03648a4dbac12d624e4490a7046cd1", size = 477235, upload-time = "2024-09-04T20:44:00.18Z" }, + { url = "https://files.pythonhosted.org/packages/62/12/ce8710b5b8affbcdd5c6e367217c242524ad17a02fe5beec3ee339f69f85/cffi-1.17.1-cp311-cp311-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:a24ed04c8ffd54b0729c07cee15a81d964e6fee0e3d4d342a27b020d22959dc6", size = 459721, upload-time = "2024-09-04T20:44:01.585Z" }, + { url = "https://files.pythonhosted.org/packages/ff/6b/d45873c5e0242196f042d555526f92aa9e0c32355a1be1ff8c27f077fd37/cffi-1.17.1-cp311-cp311-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:610faea79c43e44c71e1ec53a554553fa22321b65fae24889706c0a84d4ad86d", size = 467242, upload-time = "2024-09-04T20:44:03.467Z" }, + { url = "https://files.pythonhosted.org/packages/1a/52/d9a0e523a572fbccf2955f5abe883cfa8bcc570d7faeee06336fbd50c9fc/cffi-1.17.1-cp311-cp311-musllinux_1_1_aarch64.whl", hash = "sha256:a9b15d491f3ad5d692e11f6b71f7857e7835eb677955c00cc0aefcd0669adaf6", size = 477999, upload-time = "2024-09-04T20:44:05.023Z" }, + { url = "https://files.pythonhosted.org/packages/44/74/f2a2460684a1a2d00ca799ad880d54652841a780c4c97b87754f660c7603/cffi-1.17.1-cp311-cp311-musllinux_1_1_i686.whl", hash = "sha256:de2ea4b5833625383e464549fec1bc395c1bdeeb5f25c4a3a82b5a8c756ec22f", size = 454242, upload-time = "2024-09-04T20:44:06.444Z" }, + { url = "https://files.pythonhosted.org/packages/f8/4a/34599cac7dfcd888ff54e801afe06a19c17787dfd94495ab0c8d35fe99fb/cffi-1.17.1-cp311-cp311-musllinux_1_1_x86_64.whl", hash = "sha256:fc48c783f9c87e60831201f2cce7f3b2e4846bf4d8728eabe54d60700b318a0b", size = 478604, upload-time = "2024-09-04T20:44:08.206Z" }, + { url = "https://files.pythonhosted.org/packages/34/33/e1b8a1ba29025adbdcda5fb3a36f94c03d771c1b7b12f726ff7fef2ebe36/cffi-1.17.1-cp311-cp311-win32.whl", hash = "sha256:85a950a4ac9c359340d5963966e3e0a94a676bd6245a4b55bc43949eee26a655", size = 171727, upload-time = "2024-09-04T20:44:09.481Z" }, + { url = "https://files.pythonhosted.org/packages/3d/97/50228be003bb2802627d28ec0627837ac0bf35c90cf769812056f235b2d1/cffi-1.17.1-cp311-cp311-win_amd64.whl", hash = "sha256:caaf0640ef5f5517f49bc275eca1406b0ffa6aa184892812030f04c2abf589a0", size = 181400, upload-time = "2024-09-04T20:44:10.873Z" }, + { url = "https://files.pythonhosted.org/packages/5a/84/e94227139ee5fb4d600a7a4927f322e1d4aea6fdc50bd3fca8493caba23f/cffi-1.17.1-cp312-cp312-macosx_10_9_x86_64.whl", hash = "sha256:805b4371bf7197c329fcb3ead37e710d1bca9da5d583f5073b799d5c5bd1eee4", size = 183178, upload-time = "2024-09-04T20:44:12.232Z" }, + { url = "https://files.pythonhosted.org/packages/da/ee/fb72c2b48656111c4ef27f0f91da355e130a923473bf5ee75c5643d00cca/cffi-1.17.1-cp312-cp312-macosx_11_0_arm64.whl", hash = "sha256:733e99bc2df47476e3848417c5a4540522f234dfd4ef3ab7fafdf555b082ec0c", size = 178840, upload-time = "2024-09-04T20:44:13.739Z" }, + { url = "https://files.pythonhosted.org/packages/cc/b6/db007700f67d151abadf508cbfd6a1884f57eab90b1bb985c4c8c02b0f28/cffi-1.17.1-cp312-cp312-manylinux_2_12_i686.manylinux2010_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:1257bdabf294dceb59f5e70c64a3e2f462c30c7ad68092d01bbbfb1c16b1ba36", size = 454803, upload-time = "2024-09-04T20:44:15.231Z" }, + { url = "https://files.pythonhosted.org/packages/1a/df/f8d151540d8c200eb1c6fba8cd0dfd40904f1b0682ea705c36e6c2e97ab3/cffi-1.17.1-cp312-cp312-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:da95af8214998d77a98cc14e3a3bd00aa191526343078b530ceb0bd710fb48a5", size = 478850, upload-time = "2024-09-04T20:44:17.188Z" }, + { url = "https://files.pythonhosted.org/packages/28/c0/b31116332a547fd2677ae5b78a2ef662dfc8023d67f41b2a83f7c2aa78b1/cffi-1.17.1-cp312-cp312-manylinux_2_17_ppc64le.manylinux2014_ppc64le.whl", hash = "sha256:d63afe322132c194cf832bfec0dc69a99fb9bb6bbd550f161a49e9e855cc78ff", size = 485729, upload-time = "2024-09-04T20:44:18.688Z" }, + { url = "https://files.pythonhosted.org/packages/91/2b/9a1ddfa5c7f13cab007a2c9cc295b70fbbda7cb10a286aa6810338e60ea1/cffi-1.17.1-cp312-cp312-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:f79fc4fc25f1c8698ff97788206bb3c2598949bfe0fef03d299eb1b5356ada99", size = 471256, upload-time = "2024-09-04T20:44:20.248Z" }, + { url = "https://files.pythonhosted.org/packages/b2/d5/da47df7004cb17e4955df6a43d14b3b4ae77737dff8bf7f8f333196717bf/cffi-1.17.1-cp312-cp312-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:b62ce867176a75d03a665bad002af8e6d54644fad99a3c70905c543130e39d93", size = 479424, upload-time = "2024-09-04T20:44:21.673Z" }, + { url = "https://files.pythonhosted.org/packages/0b/ac/2a28bcf513e93a219c8a4e8e125534f4f6db03e3179ba1c45e949b76212c/cffi-1.17.1-cp312-cp312-musllinux_1_1_aarch64.whl", hash = "sha256:386c8bf53c502fff58903061338ce4f4950cbdcb23e2902d86c0f722b786bbe3", size = 484568, upload-time = "2024-09-04T20:44:23.245Z" }, + { url = "https://files.pythonhosted.org/packages/d4/38/ca8a4f639065f14ae0f1d9751e70447a261f1a30fa7547a828ae08142465/cffi-1.17.1-cp312-cp312-musllinux_1_1_x86_64.whl", hash = "sha256:4ceb10419a9adf4460ea14cfd6bc43d08701f0835e979bf821052f1805850fe8", size = 488736, upload-time = "2024-09-04T20:44:24.757Z" }, + { url = "https://files.pythonhosted.org/packages/86/c5/28b2d6f799ec0bdecf44dced2ec5ed43e0eb63097b0f58c293583b406582/cffi-1.17.1-cp312-cp312-win32.whl", hash = "sha256:a08d7e755f8ed21095a310a693525137cfe756ce62d066e53f502a83dc550f65", size = 172448, upload-time = "2024-09-04T20:44:26.208Z" }, + { url = "https://files.pythonhosted.org/packages/50/b9/db34c4755a7bd1cb2d1603ac3863f22bcecbd1ba29e5ee841a4bc510b294/cffi-1.17.1-cp312-cp312-win_amd64.whl", hash = "sha256:51392eae71afec0d0c8fb1a53b204dbb3bcabcb3c9b807eedf3e1e6ccf2de903", size = 181976, upload-time = "2024-09-04T20:44:27.578Z" }, + { url = "https://files.pythonhosted.org/packages/8d/f8/dd6c246b148639254dad4d6803eb6a54e8c85c6e11ec9df2cffa87571dbe/cffi-1.17.1-cp313-cp313-macosx_10_13_x86_64.whl", hash = "sha256:f3a2b4222ce6b60e2e8b337bb9596923045681d71e5a082783484d845390938e", size = 182989, upload-time = "2024-09-04T20:44:28.956Z" }, + { url = "https://files.pythonhosted.org/packages/8b/f1/672d303ddf17c24fc83afd712316fda78dc6fce1cd53011b839483e1ecc8/cffi-1.17.1-cp313-cp313-macosx_11_0_arm64.whl", hash = "sha256:0984a4925a435b1da406122d4d7968dd861c1385afe3b45ba82b750f229811e2", size = 178802, upload-time = "2024-09-04T20:44:30.289Z" }, + { url = "https://files.pythonhosted.org/packages/0e/2d/eab2e858a91fdff70533cab61dcff4a1f55ec60425832ddfdc9cd36bc8af/cffi-1.17.1-cp313-cp313-manylinux_2_12_i686.manylinux2010_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:d01b12eeeb4427d3110de311e1774046ad344f5b1a7403101878976ecd7a10f3", size = 454792, upload-time = "2024-09-04T20:44:32.01Z" }, + { url = "https://files.pythonhosted.org/packages/75/b2/fbaec7c4455c604e29388d55599b99ebcc250a60050610fadde58932b7ee/cffi-1.17.1-cp313-cp313-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:706510fe141c86a69c8ddc029c7910003a17353970cff3b904ff0686a5927683", size = 478893, upload-time = "2024-09-04T20:44:33.606Z" }, + { url = "https://files.pythonhosted.org/packages/4f/b7/6e4a2162178bf1935c336d4da8a9352cccab4d3a5d7914065490f08c0690/cffi-1.17.1-cp313-cp313-manylinux_2_17_ppc64le.manylinux2014_ppc64le.whl", hash = "sha256:de55b766c7aa2e2a3092c51e0483d700341182f08e67c63630d5b6f200bb28e5", size = 485810, upload-time = "2024-09-04T20:44:35.191Z" }, + { url = "https://files.pythonhosted.org/packages/c7/8a/1d0e4a9c26e54746dc08c2c6c037889124d4f59dffd853a659fa545f1b40/cffi-1.17.1-cp313-cp313-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:c59d6e989d07460165cc5ad3c61f9fd8f1b4796eacbd81cee78957842b834af4", size = 471200, upload-time = "2024-09-04T20:44:36.743Z" }, + { url = "https://files.pythonhosted.org/packages/26/9f/1aab65a6c0db35f43c4d1b4f580e8df53914310afc10ae0397d29d697af4/cffi-1.17.1-cp313-cp313-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:dd398dbc6773384a17fe0d3e7eeb8d1a21c2200473ee6806bb5e6a8e62bb73dd", size = 479447, upload-time = "2024-09-04T20:44:38.492Z" }, + { url = "https://files.pythonhosted.org/packages/5f/e4/fb8b3dd8dc0e98edf1135ff067ae070bb32ef9d509d6cb0f538cd6f7483f/cffi-1.17.1-cp313-cp313-musllinux_1_1_aarch64.whl", hash = "sha256:3edc8d958eb099c634dace3c7e16560ae474aa3803a5df240542b305d14e14ed", size = 484358, upload-time = "2024-09-04T20:44:40.046Z" }, + { url = "https://files.pythonhosted.org/packages/f1/47/d7145bf2dc04684935d57d67dff9d6d795b2ba2796806bb109864be3a151/cffi-1.17.1-cp313-cp313-musllinux_1_1_x86_64.whl", hash = "sha256:72e72408cad3d5419375fc87d289076ee319835bdfa2caad331e377589aebba9", size = 488469, upload-time = "2024-09-04T20:44:41.616Z" }, + { url = "https://files.pythonhosted.org/packages/bf/ee/f94057fa6426481d663b88637a9a10e859e492c73d0384514a17d78ee205/cffi-1.17.1-cp313-cp313-win32.whl", hash = "sha256:e03eab0a8677fa80d646b5ddece1cbeaf556c313dcfac435ba11f107ba117b5d", size = 172475, upload-time = "2024-09-04T20:44:43.733Z" }, + { url = "https://files.pythonhosted.org/packages/7c/fc/6a8cb64e5f0324877d503c854da15d76c1e50eb722e320b15345c4d0c6de/cffi-1.17.1-cp313-cp313-win_amd64.whl", hash = "sha256:f6a16c31041f09ead72d69f583767292f750d24913dadacf5756b966aacb3f1a", size = 182009, upload-time = "2024-09-04T20:44:45.309Z" }, ] [[package]] name = "charset-normalizer" version = "3.4.2" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/e4/33/89c2ced2b67d1c2a61c19c6751aa8902d46ce3dacb23600a283619f5a12d/charset_normalizer-3.4.2.tar.gz", hash = "sha256:5baececa9ecba31eff645232d59845c07aa030f0c81ee70184a90d35099a0e63", size = 126367 } -wheels = [ - { url = "https://files.pythonhosted.org/packages/95/28/9901804da60055b406e1a1c5ba7aac1276fb77f1dde635aabfc7fd84b8ab/charset_normalizer-3.4.2-cp310-cp310-macosx_10_9_universal2.whl", hash = "sha256:7c48ed483eb946e6c04ccbe02c6b4d1d48e51944b6db70f697e089c193404941", size = 201818 }, - { url = "https://files.pythonhosted.org/packages/d9/9b/892a8c8af9110935e5adcbb06d9c6fe741b6bb02608c6513983048ba1a18/charset_normalizer-3.4.2-cp310-cp310-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:b2d318c11350e10662026ad0eb71bb51c7812fc8590825304ae0bdd4ac283acd", size = 144649 }, - { url = "https://files.pythonhosted.org/packages/7b/a5/4179abd063ff6414223575e008593861d62abfc22455b5d1a44995b7c101/charset_normalizer-3.4.2-cp310-cp310-manylinux_2_17_ppc64le.manylinux2014_ppc64le.whl", hash = "sha256:9cbfacf36cb0ec2897ce0ebc5d08ca44213af24265bd56eca54bee7923c48fd6", size = 155045 }, - { url = "https://files.pythonhosted.org/packages/3b/95/bc08c7dfeddd26b4be8c8287b9bb055716f31077c8b0ea1cd09553794665/charset_normalizer-3.4.2-cp310-cp310-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:18dd2e350387c87dabe711b86f83c9c78af772c748904d372ade190b5c7c9d4d", size = 147356 }, - { url = "https://files.pythonhosted.org/packages/a8/2d/7a5b635aa65284bf3eab7653e8b4151ab420ecbae918d3e359d1947b4d61/charset_normalizer-3.4.2-cp310-cp310-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:8075c35cd58273fee266c58c0c9b670947c19df5fb98e7b66710e04ad4e9ff86", size = 149471 }, - { url = "https://files.pythonhosted.org/packages/ae/38/51fc6ac74251fd331a8cfdb7ec57beba8c23fd5493f1050f71c87ef77ed0/charset_normalizer-3.4.2-cp310-cp310-manylinux_2_5_i686.manylinux1_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:5bf4545e3b962767e5c06fe1738f951f77d27967cb2caa64c28be7c4563e162c", size = 151317 }, - { url = "https://files.pythonhosted.org/packages/b7/17/edee1e32215ee6e9e46c3e482645b46575a44a2d72c7dfd49e49f60ce6bf/charset_normalizer-3.4.2-cp310-cp310-musllinux_1_2_aarch64.whl", hash = "sha256:7a6ab32f7210554a96cd9e33abe3ddd86732beeafc7a28e9955cdf22ffadbab0", size = 146368 }, - { url = "https://files.pythonhosted.org/packages/26/2c/ea3e66f2b5f21fd00b2825c94cafb8c326ea6240cd80a91eb09e4a285830/charset_normalizer-3.4.2-cp310-cp310-musllinux_1_2_i686.whl", hash = "sha256:b33de11b92e9f75a2b545d6e9b6f37e398d86c3e9e9653c4864eb7e89c5773ef", size = 154491 }, - { url = "https://files.pythonhosted.org/packages/52/47/7be7fa972422ad062e909fd62460d45c3ef4c141805b7078dbab15904ff7/charset_normalizer-3.4.2-cp310-cp310-musllinux_1_2_ppc64le.whl", hash = "sha256:8755483f3c00d6c9a77f490c17e6ab0c8729e39e6390328e42521ef175380ae6", size = 157695 }, - { url = "https://files.pythonhosted.org/packages/2f/42/9f02c194da282b2b340f28e5fb60762de1151387a36842a92b533685c61e/charset_normalizer-3.4.2-cp310-cp310-musllinux_1_2_s390x.whl", hash = "sha256:68a328e5f55ec37c57f19ebb1fdc56a248db2e3e9ad769919a58672958e8f366", size = 154849 }, - { url = "https://files.pythonhosted.org/packages/67/44/89cacd6628f31fb0b63201a618049be4be2a7435a31b55b5eb1c3674547a/charset_normalizer-3.4.2-cp310-cp310-musllinux_1_2_x86_64.whl", hash = "sha256:21b2899062867b0e1fde9b724f8aecb1af14f2778d69aacd1a5a1853a597a5db", size = 150091 }, - { url = "https://files.pythonhosted.org/packages/1f/79/4b8da9f712bc079c0f16b6d67b099b0b8d808c2292c937f267d816ec5ecc/charset_normalizer-3.4.2-cp310-cp310-win32.whl", hash = "sha256:e8082b26888e2f8b36a042a58307d5b917ef2b1cacab921ad3323ef91901c71a", size = 98445 }, - { url = "https://files.pythonhosted.org/packages/7d/d7/96970afb4fb66497a40761cdf7bd4f6fca0fc7bafde3a84f836c1f57a926/charset_normalizer-3.4.2-cp310-cp310-win_amd64.whl", hash = "sha256:f69a27e45c43520f5487f27627059b64aaf160415589230992cec34c5e18a509", size = 105782 }, - { url = "https://files.pythonhosted.org/packages/05/85/4c40d00dcc6284a1c1ad5de5e0996b06f39d8232f1031cd23c2f5c07ee86/charset_normalizer-3.4.2-cp311-cp311-macosx_10_9_universal2.whl", hash = "sha256:be1e352acbe3c78727a16a455126d9ff83ea2dfdcbc83148d2982305a04714c2", size = 198794 }, - { url = "https://files.pythonhosted.org/packages/41/d9/7a6c0b9db952598e97e93cbdfcb91bacd89b9b88c7c983250a77c008703c/charset_normalizer-3.4.2-cp311-cp311-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:aa88ca0b1932e93f2d961bf3addbb2db902198dca337d88c89e1559e066e7645", size = 142846 }, - { url = "https://files.pythonhosted.org/packages/66/82/a37989cda2ace7e37f36c1a8ed16c58cf48965a79c2142713244bf945c89/charset_normalizer-3.4.2-cp311-cp311-manylinux_2_17_ppc64le.manylinux2014_ppc64le.whl", hash = "sha256:d524ba3f1581b35c03cb42beebab4a13e6cdad7b36246bd22541fa585a56cccd", size = 153350 }, - { url = "https://files.pythonhosted.org/packages/df/68/a576b31b694d07b53807269d05ec3f6f1093e9545e8607121995ba7a8313/charset_normalizer-3.4.2-cp311-cp311-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:28a1005facc94196e1fb3e82a3d442a9d9110b8434fc1ded7a24a2983c9888d8", size = 145657 }, - { url = "https://files.pythonhosted.org/packages/92/9b/ad67f03d74554bed3aefd56fe836e1623a50780f7c998d00ca128924a499/charset_normalizer-3.4.2-cp311-cp311-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:fdb20a30fe1175ecabed17cbf7812f7b804b8a315a25f24678bcdf120a90077f", size = 147260 }, - { url = "https://files.pythonhosted.org/packages/a6/e6/8aebae25e328160b20e31a7e9929b1578bbdc7f42e66f46595a432f8539e/charset_normalizer-3.4.2-cp311-cp311-manylinux_2_5_i686.manylinux1_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:0f5d9ed7f254402c9e7d35d2f5972c9bbea9040e99cd2861bd77dc68263277c7", size = 149164 }, - { url = "https://files.pythonhosted.org/packages/8b/f2/b3c2f07dbcc248805f10e67a0262c93308cfa149a4cd3d1fe01f593e5fd2/charset_normalizer-3.4.2-cp311-cp311-musllinux_1_2_aarch64.whl", hash = "sha256:efd387a49825780ff861998cd959767800d54f8308936b21025326de4b5a42b9", size = 144571 }, - { url = "https://files.pythonhosted.org/packages/60/5b/c3f3a94bc345bc211622ea59b4bed9ae63c00920e2e8f11824aa5708e8b7/charset_normalizer-3.4.2-cp311-cp311-musllinux_1_2_i686.whl", hash = "sha256:f0aa37f3c979cf2546b73e8222bbfa3dc07a641585340179d768068e3455e544", size = 151952 }, - { url = "https://files.pythonhosted.org/packages/e2/4d/ff460c8b474122334c2fa394a3f99a04cf11c646da895f81402ae54f5c42/charset_normalizer-3.4.2-cp311-cp311-musllinux_1_2_ppc64le.whl", hash = "sha256:e70e990b2137b29dc5564715de1e12701815dacc1d056308e2b17e9095372a82", size = 155959 }, - { url = "https://files.pythonhosted.org/packages/a2/2b/b964c6a2fda88611a1fe3d4c400d39c66a42d6c169c924818c848f922415/charset_normalizer-3.4.2-cp311-cp311-musllinux_1_2_s390x.whl", hash = "sha256:0c8c57f84ccfc871a48a47321cfa49ae1df56cd1d965a09abe84066f6853b9c0", size = 153030 }, - { url = "https://files.pythonhosted.org/packages/59/2e/d3b9811db26a5ebf444bc0fa4f4be5aa6d76fc6e1c0fd537b16c14e849b6/charset_normalizer-3.4.2-cp311-cp311-musllinux_1_2_x86_64.whl", hash = "sha256:6b66f92b17849b85cad91259efc341dce9c1af48e2173bf38a85c6329f1033e5", size = 148015 }, - { url = "https://files.pythonhosted.org/packages/90/07/c5fd7c11eafd561bb51220d600a788f1c8d77c5eef37ee49454cc5c35575/charset_normalizer-3.4.2-cp311-cp311-win32.whl", hash = "sha256:daac4765328a919a805fa5e2720f3e94767abd632ae410a9062dff5412bae65a", size = 98106 }, - { url = "https://files.pythonhosted.org/packages/a8/05/5e33dbef7e2f773d672b6d79f10ec633d4a71cd96db6673625838a4fd532/charset_normalizer-3.4.2-cp311-cp311-win_amd64.whl", hash = "sha256:e53efc7c7cee4c1e70661e2e112ca46a575f90ed9ae3fef200f2a25e954f4b28", size = 105402 }, - { url = "https://files.pythonhosted.org/packages/d7/a4/37f4d6035c89cac7930395a35cc0f1b872e652eaafb76a6075943754f095/charset_normalizer-3.4.2-cp312-cp312-macosx_10_13_universal2.whl", hash = "sha256:0c29de6a1a95f24b9a1aa7aefd27d2487263f00dfd55a77719b530788f75cff7", size = 199936 }, - { url = "https://files.pythonhosted.org/packages/ee/8a/1a5e33b73e0d9287274f899d967907cd0bf9c343e651755d9307e0dbf2b3/charset_normalizer-3.4.2-cp312-cp312-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:cddf7bd982eaa998934a91f69d182aec997c6c468898efe6679af88283b498d3", size = 143790 }, - { url = "https://files.pythonhosted.org/packages/66/52/59521f1d8e6ab1482164fa21409c5ef44da3e9f653c13ba71becdd98dec3/charset_normalizer-3.4.2-cp312-cp312-manylinux_2_17_ppc64le.manylinux2014_ppc64le.whl", hash = "sha256:fcbe676a55d7445b22c10967bceaaf0ee69407fbe0ece4d032b6eb8d4565982a", size = 153924 }, - { url = "https://files.pythonhosted.org/packages/86/2d/fb55fdf41964ec782febbf33cb64be480a6b8f16ded2dbe8db27a405c09f/charset_normalizer-3.4.2-cp312-cp312-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:d41c4d287cfc69060fa91cae9683eacffad989f1a10811995fa309df656ec214", size = 146626 }, - { url = "https://files.pythonhosted.org/packages/8c/73/6ede2ec59bce19b3edf4209d70004253ec5f4e319f9a2e3f2f15601ed5f7/charset_normalizer-3.4.2-cp312-cp312-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:4e594135de17ab3866138f496755f302b72157d115086d100c3f19370839dd3a", size = 148567 }, - { url = "https://files.pythonhosted.org/packages/09/14/957d03c6dc343c04904530b6bef4e5efae5ec7d7990a7cbb868e4595ee30/charset_normalizer-3.4.2-cp312-cp312-manylinux_2_5_i686.manylinux1_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:cf713fe9a71ef6fd5adf7a79670135081cd4431c2943864757f0fa3a65b1fafd", size = 150957 }, - { url = "https://files.pythonhosted.org/packages/0d/c8/8174d0e5c10ccebdcb1b53cc959591c4c722a3ad92461a273e86b9f5a302/charset_normalizer-3.4.2-cp312-cp312-musllinux_1_2_aarch64.whl", hash = "sha256:a370b3e078e418187da8c3674eddb9d983ec09445c99a3a263c2011993522981", size = 145408 }, - { url = "https://files.pythonhosted.org/packages/58/aa/8904b84bc8084ac19dc52feb4f5952c6df03ffb460a887b42615ee1382e8/charset_normalizer-3.4.2-cp312-cp312-musllinux_1_2_i686.whl", hash = "sha256:a955b438e62efdf7e0b7b52a64dc5c3396e2634baa62471768a64bc2adb73d5c", size = 153399 }, - { url = "https://files.pythonhosted.org/packages/c2/26/89ee1f0e264d201cb65cf054aca6038c03b1a0c6b4ae998070392a3ce605/charset_normalizer-3.4.2-cp312-cp312-musllinux_1_2_ppc64le.whl", hash = "sha256:7222ffd5e4de8e57e03ce2cef95a4c43c98fcb72ad86909abdfc2c17d227fc1b", size = 156815 }, - { url = "https://files.pythonhosted.org/packages/fd/07/68e95b4b345bad3dbbd3a8681737b4338ff2c9df29856a6d6d23ac4c73cb/charset_normalizer-3.4.2-cp312-cp312-musllinux_1_2_s390x.whl", hash = "sha256:bee093bf902e1d8fc0ac143c88902c3dfc8941f7ea1d6a8dd2bcb786d33db03d", size = 154537 }, - { url = "https://files.pythonhosted.org/packages/77/1a/5eefc0ce04affb98af07bc05f3bac9094513c0e23b0562d64af46a06aae4/charset_normalizer-3.4.2-cp312-cp312-musllinux_1_2_x86_64.whl", hash = "sha256:dedb8adb91d11846ee08bec4c8236c8549ac721c245678282dcb06b221aab59f", size = 149565 }, - { url = "https://files.pythonhosted.org/packages/37/a0/2410e5e6032a174c95e0806b1a6585eb21e12f445ebe239fac441995226a/charset_normalizer-3.4.2-cp312-cp312-win32.whl", hash = "sha256:db4c7bf0e07fc3b7d89ac2a5880a6a8062056801b83ff56d8464b70f65482b6c", size = 98357 }, - { url = "https://files.pythonhosted.org/packages/6c/4f/c02d5c493967af3eda9c771ad4d2bbc8df6f99ddbeb37ceea6e8716a32bc/charset_normalizer-3.4.2-cp312-cp312-win_amd64.whl", hash = "sha256:5a9979887252a82fefd3d3ed2a8e3b937a7a809f65dcb1e068b090e165bbe99e", size = 105776 }, - { url = "https://files.pythonhosted.org/packages/ea/12/a93df3366ed32db1d907d7593a94f1fe6293903e3e92967bebd6950ed12c/charset_normalizer-3.4.2-cp313-cp313-macosx_10_13_universal2.whl", hash = "sha256:926ca93accd5d36ccdabd803392ddc3e03e6d4cd1cf17deff3b989ab8e9dbcf0", size = 199622 }, - { url = "https://files.pythonhosted.org/packages/04/93/bf204e6f344c39d9937d3c13c8cd5bbfc266472e51fc8c07cb7f64fcd2de/charset_normalizer-3.4.2-cp313-cp313-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:eba9904b0f38a143592d9fc0e19e2df0fa2e41c3c3745554761c5f6447eedabf", size = 143435 }, - { url = "https://files.pythonhosted.org/packages/22/2a/ea8a2095b0bafa6c5b5a55ffdc2f924455233ee7b91c69b7edfcc9e02284/charset_normalizer-3.4.2-cp313-cp313-manylinux_2_17_ppc64le.manylinux2014_ppc64le.whl", hash = "sha256:3fddb7e2c84ac87ac3a947cb4e66d143ca5863ef48e4a5ecb83bd48619e4634e", size = 153653 }, - { url = "https://files.pythonhosted.org/packages/b6/57/1b090ff183d13cef485dfbe272e2fe57622a76694061353c59da52c9a659/charset_normalizer-3.4.2-cp313-cp313-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:98f862da73774290f251b9df8d11161b6cf25b599a66baf087c1ffe340e9bfd1", size = 146231 }, - { url = "https://files.pythonhosted.org/packages/e2/28/ffc026b26f441fc67bd21ab7f03b313ab3fe46714a14b516f931abe1a2d8/charset_normalizer-3.4.2-cp313-cp313-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:6c9379d65defcab82d07b2a9dfbfc2e95bc8fe0ebb1b176a3190230a3ef0e07c", size = 148243 }, - { url = "https://files.pythonhosted.org/packages/c0/0f/9abe9bd191629c33e69e47c6ef45ef99773320e9ad8e9cb08b8ab4a8d4cb/charset_normalizer-3.4.2-cp313-cp313-manylinux_2_5_i686.manylinux1_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:e635b87f01ebc977342e2697d05b56632f5f879a4f15955dfe8cef2448b51691", size = 150442 }, - { url = "https://files.pythonhosted.org/packages/67/7c/a123bbcedca91d5916c056407f89a7f5e8fdfce12ba825d7d6b9954a1a3c/charset_normalizer-3.4.2-cp313-cp313-musllinux_1_2_aarch64.whl", hash = "sha256:1c95a1e2902a8b722868587c0e1184ad5c55631de5afc0eb96bc4b0d738092c0", size = 145147 }, - { url = "https://files.pythonhosted.org/packages/ec/fe/1ac556fa4899d967b83e9893788e86b6af4d83e4726511eaaad035e36595/charset_normalizer-3.4.2-cp313-cp313-musllinux_1_2_i686.whl", hash = "sha256:ef8de666d6179b009dce7bcb2ad4c4a779f113f12caf8dc77f0162c29d20490b", size = 153057 }, - { url = "https://files.pythonhosted.org/packages/2b/ff/acfc0b0a70b19e3e54febdd5301a98b72fa07635e56f24f60502e954c461/charset_normalizer-3.4.2-cp313-cp313-musllinux_1_2_ppc64le.whl", hash = "sha256:32fc0341d72e0f73f80acb0a2c94216bd704f4f0bce10aedea38f30502b271ff", size = 156454 }, - { url = "https://files.pythonhosted.org/packages/92/08/95b458ce9c740d0645feb0e96cea1f5ec946ea9c580a94adfe0b617f3573/charset_normalizer-3.4.2-cp313-cp313-musllinux_1_2_s390x.whl", hash = "sha256:289200a18fa698949d2b39c671c2cc7a24d44096784e76614899a7ccf2574b7b", size = 154174 }, - { url = "https://files.pythonhosted.org/packages/78/be/8392efc43487ac051eee6c36d5fbd63032d78f7728cb37aebcc98191f1ff/charset_normalizer-3.4.2-cp313-cp313-musllinux_1_2_x86_64.whl", hash = "sha256:4a476b06fbcf359ad25d34a057b7219281286ae2477cc5ff5e3f70a246971148", size = 149166 }, - { url = "https://files.pythonhosted.org/packages/44/96/392abd49b094d30b91d9fbda6a69519e95802250b777841cf3bda8fe136c/charset_normalizer-3.4.2-cp313-cp313-win32.whl", hash = "sha256:aaeeb6a479c7667fbe1099af9617c83aaca22182d6cf8c53966491a0f1b7ffb7", size = 98064 }, - { url = "https://files.pythonhosted.org/packages/e9/b0/0200da600134e001d91851ddc797809e2fe0ea72de90e09bec5a2fbdaccb/charset_normalizer-3.4.2-cp313-cp313-win_amd64.whl", hash = "sha256:aa6af9e7d59f9c12b33ae4e9450619cf2488e2bbe9b44030905877f0b2324980", size = 105641 }, - { url = "https://files.pythonhosted.org/packages/20/94/c5790835a017658cbfabd07f3bfb549140c3ac458cfc196323996b10095a/charset_normalizer-3.4.2-py3-none-any.whl", hash = "sha256:7f56930ab0abd1c45cd15be65cc741c28b1c9a34876ce8c17a2fa107810c0af0", size = 52626 }, +sdist = { url = "https://files.pythonhosted.org/packages/e4/33/89c2ced2b67d1c2a61c19c6751aa8902d46ce3dacb23600a283619f5a12d/charset_normalizer-3.4.2.tar.gz", hash = "sha256:5baececa9ecba31eff645232d59845c07aa030f0c81ee70184a90d35099a0e63", size = 126367, upload-time = "2025-05-02T08:34:42.01Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/95/28/9901804da60055b406e1a1c5ba7aac1276fb77f1dde635aabfc7fd84b8ab/charset_normalizer-3.4.2-cp310-cp310-macosx_10_9_universal2.whl", hash = "sha256:7c48ed483eb946e6c04ccbe02c6b4d1d48e51944b6db70f697e089c193404941", size = 201818, upload-time = "2025-05-02T08:31:46.725Z" }, + { url = "https://files.pythonhosted.org/packages/d9/9b/892a8c8af9110935e5adcbb06d9c6fe741b6bb02608c6513983048ba1a18/charset_normalizer-3.4.2-cp310-cp310-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:b2d318c11350e10662026ad0eb71bb51c7812fc8590825304ae0bdd4ac283acd", size = 144649, upload-time = "2025-05-02T08:31:48.889Z" }, + { url = "https://files.pythonhosted.org/packages/7b/a5/4179abd063ff6414223575e008593861d62abfc22455b5d1a44995b7c101/charset_normalizer-3.4.2-cp310-cp310-manylinux_2_17_ppc64le.manylinux2014_ppc64le.whl", hash = "sha256:9cbfacf36cb0ec2897ce0ebc5d08ca44213af24265bd56eca54bee7923c48fd6", size = 155045, upload-time = "2025-05-02T08:31:50.757Z" }, + { url = "https://files.pythonhosted.org/packages/3b/95/bc08c7dfeddd26b4be8c8287b9bb055716f31077c8b0ea1cd09553794665/charset_normalizer-3.4.2-cp310-cp310-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:18dd2e350387c87dabe711b86f83c9c78af772c748904d372ade190b5c7c9d4d", size = 147356, upload-time = "2025-05-02T08:31:52.634Z" }, + { url = "https://files.pythonhosted.org/packages/a8/2d/7a5b635aa65284bf3eab7653e8b4151ab420ecbae918d3e359d1947b4d61/charset_normalizer-3.4.2-cp310-cp310-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:8075c35cd58273fee266c58c0c9b670947c19df5fb98e7b66710e04ad4e9ff86", size = 149471, upload-time = "2025-05-02T08:31:56.207Z" }, + { url = "https://files.pythonhosted.org/packages/ae/38/51fc6ac74251fd331a8cfdb7ec57beba8c23fd5493f1050f71c87ef77ed0/charset_normalizer-3.4.2-cp310-cp310-manylinux_2_5_i686.manylinux1_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:5bf4545e3b962767e5c06fe1738f951f77d27967cb2caa64c28be7c4563e162c", size = 151317, upload-time = "2025-05-02T08:31:57.613Z" }, + { url = "https://files.pythonhosted.org/packages/b7/17/edee1e32215ee6e9e46c3e482645b46575a44a2d72c7dfd49e49f60ce6bf/charset_normalizer-3.4.2-cp310-cp310-musllinux_1_2_aarch64.whl", hash = "sha256:7a6ab32f7210554a96cd9e33abe3ddd86732beeafc7a28e9955cdf22ffadbab0", size = 146368, upload-time = "2025-05-02T08:31:59.468Z" }, + { url = "https://files.pythonhosted.org/packages/26/2c/ea3e66f2b5f21fd00b2825c94cafb8c326ea6240cd80a91eb09e4a285830/charset_normalizer-3.4.2-cp310-cp310-musllinux_1_2_i686.whl", hash = "sha256:b33de11b92e9f75a2b545d6e9b6f37e398d86c3e9e9653c4864eb7e89c5773ef", size = 154491, upload-time = "2025-05-02T08:32:01.219Z" }, + { url = "https://files.pythonhosted.org/packages/52/47/7be7fa972422ad062e909fd62460d45c3ef4c141805b7078dbab15904ff7/charset_normalizer-3.4.2-cp310-cp310-musllinux_1_2_ppc64le.whl", hash = "sha256:8755483f3c00d6c9a77f490c17e6ab0c8729e39e6390328e42521ef175380ae6", size = 157695, upload-time = "2025-05-02T08:32:03.045Z" }, + { url = "https://files.pythonhosted.org/packages/2f/42/9f02c194da282b2b340f28e5fb60762de1151387a36842a92b533685c61e/charset_normalizer-3.4.2-cp310-cp310-musllinux_1_2_s390x.whl", hash = "sha256:68a328e5f55ec37c57f19ebb1fdc56a248db2e3e9ad769919a58672958e8f366", size = 154849, upload-time = "2025-05-02T08:32:04.651Z" }, + { url = "https://files.pythonhosted.org/packages/67/44/89cacd6628f31fb0b63201a618049be4be2a7435a31b55b5eb1c3674547a/charset_normalizer-3.4.2-cp310-cp310-musllinux_1_2_x86_64.whl", hash = "sha256:21b2899062867b0e1fde9b724f8aecb1af14f2778d69aacd1a5a1853a597a5db", size = 150091, upload-time = "2025-05-02T08:32:06.719Z" }, + { url = "https://files.pythonhosted.org/packages/1f/79/4b8da9f712bc079c0f16b6d67b099b0b8d808c2292c937f267d816ec5ecc/charset_normalizer-3.4.2-cp310-cp310-win32.whl", hash = "sha256:e8082b26888e2f8b36a042a58307d5b917ef2b1cacab921ad3323ef91901c71a", size = 98445, upload-time = "2025-05-02T08:32:08.66Z" }, + { url = "https://files.pythonhosted.org/packages/7d/d7/96970afb4fb66497a40761cdf7bd4f6fca0fc7bafde3a84f836c1f57a926/charset_normalizer-3.4.2-cp310-cp310-win_amd64.whl", hash = "sha256:f69a27e45c43520f5487f27627059b64aaf160415589230992cec34c5e18a509", size = 105782, upload-time = "2025-05-02T08:32:10.46Z" }, + { url = "https://files.pythonhosted.org/packages/05/85/4c40d00dcc6284a1c1ad5de5e0996b06f39d8232f1031cd23c2f5c07ee86/charset_normalizer-3.4.2-cp311-cp311-macosx_10_9_universal2.whl", hash = "sha256:be1e352acbe3c78727a16a455126d9ff83ea2dfdcbc83148d2982305a04714c2", size = 198794, upload-time = "2025-05-02T08:32:11.945Z" }, + { url = "https://files.pythonhosted.org/packages/41/d9/7a6c0b9db952598e97e93cbdfcb91bacd89b9b88c7c983250a77c008703c/charset_normalizer-3.4.2-cp311-cp311-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:aa88ca0b1932e93f2d961bf3addbb2db902198dca337d88c89e1559e066e7645", size = 142846, upload-time = "2025-05-02T08:32:13.946Z" }, + { url = "https://files.pythonhosted.org/packages/66/82/a37989cda2ace7e37f36c1a8ed16c58cf48965a79c2142713244bf945c89/charset_normalizer-3.4.2-cp311-cp311-manylinux_2_17_ppc64le.manylinux2014_ppc64le.whl", hash = "sha256:d524ba3f1581b35c03cb42beebab4a13e6cdad7b36246bd22541fa585a56cccd", size = 153350, upload-time = "2025-05-02T08:32:15.873Z" }, + { url = "https://files.pythonhosted.org/packages/df/68/a576b31b694d07b53807269d05ec3f6f1093e9545e8607121995ba7a8313/charset_normalizer-3.4.2-cp311-cp311-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:28a1005facc94196e1fb3e82a3d442a9d9110b8434fc1ded7a24a2983c9888d8", size = 145657, upload-time = "2025-05-02T08:32:17.283Z" }, + { url = "https://files.pythonhosted.org/packages/92/9b/ad67f03d74554bed3aefd56fe836e1623a50780f7c998d00ca128924a499/charset_normalizer-3.4.2-cp311-cp311-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:fdb20a30fe1175ecabed17cbf7812f7b804b8a315a25f24678bcdf120a90077f", size = 147260, upload-time = "2025-05-02T08:32:18.807Z" }, + { url = "https://files.pythonhosted.org/packages/a6/e6/8aebae25e328160b20e31a7e9929b1578bbdc7f42e66f46595a432f8539e/charset_normalizer-3.4.2-cp311-cp311-manylinux_2_5_i686.manylinux1_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:0f5d9ed7f254402c9e7d35d2f5972c9bbea9040e99cd2861bd77dc68263277c7", size = 149164, upload-time = "2025-05-02T08:32:20.333Z" }, + { url = "https://files.pythonhosted.org/packages/8b/f2/b3c2f07dbcc248805f10e67a0262c93308cfa149a4cd3d1fe01f593e5fd2/charset_normalizer-3.4.2-cp311-cp311-musllinux_1_2_aarch64.whl", hash = "sha256:efd387a49825780ff861998cd959767800d54f8308936b21025326de4b5a42b9", size = 144571, upload-time = "2025-05-02T08:32:21.86Z" }, + { url = "https://files.pythonhosted.org/packages/60/5b/c3f3a94bc345bc211622ea59b4bed9ae63c00920e2e8f11824aa5708e8b7/charset_normalizer-3.4.2-cp311-cp311-musllinux_1_2_i686.whl", hash = "sha256:f0aa37f3c979cf2546b73e8222bbfa3dc07a641585340179d768068e3455e544", size = 151952, upload-time = "2025-05-02T08:32:23.434Z" }, + { url = "https://files.pythonhosted.org/packages/e2/4d/ff460c8b474122334c2fa394a3f99a04cf11c646da895f81402ae54f5c42/charset_normalizer-3.4.2-cp311-cp311-musllinux_1_2_ppc64le.whl", hash = "sha256:e70e990b2137b29dc5564715de1e12701815dacc1d056308e2b17e9095372a82", size = 155959, upload-time = "2025-05-02T08:32:24.993Z" }, + { url = "https://files.pythonhosted.org/packages/a2/2b/b964c6a2fda88611a1fe3d4c400d39c66a42d6c169c924818c848f922415/charset_normalizer-3.4.2-cp311-cp311-musllinux_1_2_s390x.whl", hash = "sha256:0c8c57f84ccfc871a48a47321cfa49ae1df56cd1d965a09abe84066f6853b9c0", size = 153030, upload-time = "2025-05-02T08:32:26.435Z" }, + { url = "https://files.pythonhosted.org/packages/59/2e/d3b9811db26a5ebf444bc0fa4f4be5aa6d76fc6e1c0fd537b16c14e849b6/charset_normalizer-3.4.2-cp311-cp311-musllinux_1_2_x86_64.whl", hash = "sha256:6b66f92b17849b85cad91259efc341dce9c1af48e2173bf38a85c6329f1033e5", size = 148015, upload-time = "2025-05-02T08:32:28.376Z" }, + { url = "https://files.pythonhosted.org/packages/90/07/c5fd7c11eafd561bb51220d600a788f1c8d77c5eef37ee49454cc5c35575/charset_normalizer-3.4.2-cp311-cp311-win32.whl", hash = "sha256:daac4765328a919a805fa5e2720f3e94767abd632ae410a9062dff5412bae65a", size = 98106, upload-time = "2025-05-02T08:32:30.281Z" }, + { url = "https://files.pythonhosted.org/packages/a8/05/5e33dbef7e2f773d672b6d79f10ec633d4a71cd96db6673625838a4fd532/charset_normalizer-3.4.2-cp311-cp311-win_amd64.whl", hash = "sha256:e53efc7c7cee4c1e70661e2e112ca46a575f90ed9ae3fef200f2a25e954f4b28", size = 105402, upload-time = "2025-05-02T08:32:32.191Z" }, + { url = "https://files.pythonhosted.org/packages/d7/a4/37f4d6035c89cac7930395a35cc0f1b872e652eaafb76a6075943754f095/charset_normalizer-3.4.2-cp312-cp312-macosx_10_13_universal2.whl", hash = "sha256:0c29de6a1a95f24b9a1aa7aefd27d2487263f00dfd55a77719b530788f75cff7", size = 199936, upload-time = "2025-05-02T08:32:33.712Z" }, + { url = "https://files.pythonhosted.org/packages/ee/8a/1a5e33b73e0d9287274f899d967907cd0bf9c343e651755d9307e0dbf2b3/charset_normalizer-3.4.2-cp312-cp312-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:cddf7bd982eaa998934a91f69d182aec997c6c468898efe6679af88283b498d3", size = 143790, upload-time = "2025-05-02T08:32:35.768Z" }, + { url = "https://files.pythonhosted.org/packages/66/52/59521f1d8e6ab1482164fa21409c5ef44da3e9f653c13ba71becdd98dec3/charset_normalizer-3.4.2-cp312-cp312-manylinux_2_17_ppc64le.manylinux2014_ppc64le.whl", hash = "sha256:fcbe676a55d7445b22c10967bceaaf0ee69407fbe0ece4d032b6eb8d4565982a", size = 153924, upload-time = "2025-05-02T08:32:37.284Z" }, + { url = "https://files.pythonhosted.org/packages/86/2d/fb55fdf41964ec782febbf33cb64be480a6b8f16ded2dbe8db27a405c09f/charset_normalizer-3.4.2-cp312-cp312-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:d41c4d287cfc69060fa91cae9683eacffad989f1a10811995fa309df656ec214", size = 146626, upload-time = "2025-05-02T08:32:38.803Z" }, + { url = "https://files.pythonhosted.org/packages/8c/73/6ede2ec59bce19b3edf4209d70004253ec5f4e319f9a2e3f2f15601ed5f7/charset_normalizer-3.4.2-cp312-cp312-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:4e594135de17ab3866138f496755f302b72157d115086d100c3f19370839dd3a", size = 148567, upload-time = "2025-05-02T08:32:40.251Z" }, + { url = "https://files.pythonhosted.org/packages/09/14/957d03c6dc343c04904530b6bef4e5efae5ec7d7990a7cbb868e4595ee30/charset_normalizer-3.4.2-cp312-cp312-manylinux_2_5_i686.manylinux1_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:cf713fe9a71ef6fd5adf7a79670135081cd4431c2943864757f0fa3a65b1fafd", size = 150957, upload-time = "2025-05-02T08:32:41.705Z" }, + { url = "https://files.pythonhosted.org/packages/0d/c8/8174d0e5c10ccebdcb1b53cc959591c4c722a3ad92461a273e86b9f5a302/charset_normalizer-3.4.2-cp312-cp312-musllinux_1_2_aarch64.whl", hash = "sha256:a370b3e078e418187da8c3674eddb9d983ec09445c99a3a263c2011993522981", size = 145408, upload-time = "2025-05-02T08:32:43.709Z" }, + { url = "https://files.pythonhosted.org/packages/58/aa/8904b84bc8084ac19dc52feb4f5952c6df03ffb460a887b42615ee1382e8/charset_normalizer-3.4.2-cp312-cp312-musllinux_1_2_i686.whl", hash = "sha256:a955b438e62efdf7e0b7b52a64dc5c3396e2634baa62471768a64bc2adb73d5c", size = 153399, upload-time = "2025-05-02T08:32:46.197Z" }, + { url = "https://files.pythonhosted.org/packages/c2/26/89ee1f0e264d201cb65cf054aca6038c03b1a0c6b4ae998070392a3ce605/charset_normalizer-3.4.2-cp312-cp312-musllinux_1_2_ppc64le.whl", hash = "sha256:7222ffd5e4de8e57e03ce2cef95a4c43c98fcb72ad86909abdfc2c17d227fc1b", size = 156815, upload-time = "2025-05-02T08:32:48.105Z" }, + { url = "https://files.pythonhosted.org/packages/fd/07/68e95b4b345bad3dbbd3a8681737b4338ff2c9df29856a6d6d23ac4c73cb/charset_normalizer-3.4.2-cp312-cp312-musllinux_1_2_s390x.whl", hash = "sha256:bee093bf902e1d8fc0ac143c88902c3dfc8941f7ea1d6a8dd2bcb786d33db03d", size = 154537, upload-time = "2025-05-02T08:32:49.719Z" }, + { url = "https://files.pythonhosted.org/packages/77/1a/5eefc0ce04affb98af07bc05f3bac9094513c0e23b0562d64af46a06aae4/charset_normalizer-3.4.2-cp312-cp312-musllinux_1_2_x86_64.whl", hash = "sha256:dedb8adb91d11846ee08bec4c8236c8549ac721c245678282dcb06b221aab59f", size = 149565, upload-time = "2025-05-02T08:32:51.404Z" }, + { url = "https://files.pythonhosted.org/packages/37/a0/2410e5e6032a174c95e0806b1a6585eb21e12f445ebe239fac441995226a/charset_normalizer-3.4.2-cp312-cp312-win32.whl", hash = "sha256:db4c7bf0e07fc3b7d89ac2a5880a6a8062056801b83ff56d8464b70f65482b6c", size = 98357, upload-time = "2025-05-02T08:32:53.079Z" }, + { url = "https://files.pythonhosted.org/packages/6c/4f/c02d5c493967af3eda9c771ad4d2bbc8df6f99ddbeb37ceea6e8716a32bc/charset_normalizer-3.4.2-cp312-cp312-win_amd64.whl", hash = "sha256:5a9979887252a82fefd3d3ed2a8e3b937a7a809f65dcb1e068b090e165bbe99e", size = 105776, upload-time = "2025-05-02T08:32:54.573Z" }, + { url = "https://files.pythonhosted.org/packages/ea/12/a93df3366ed32db1d907d7593a94f1fe6293903e3e92967bebd6950ed12c/charset_normalizer-3.4.2-cp313-cp313-macosx_10_13_universal2.whl", hash = "sha256:926ca93accd5d36ccdabd803392ddc3e03e6d4cd1cf17deff3b989ab8e9dbcf0", size = 199622, upload-time = "2025-05-02T08:32:56.363Z" }, + { url = "https://files.pythonhosted.org/packages/04/93/bf204e6f344c39d9937d3c13c8cd5bbfc266472e51fc8c07cb7f64fcd2de/charset_normalizer-3.4.2-cp313-cp313-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:eba9904b0f38a143592d9fc0e19e2df0fa2e41c3c3745554761c5f6447eedabf", size = 143435, upload-time = "2025-05-02T08:32:58.551Z" }, + { url = "https://files.pythonhosted.org/packages/22/2a/ea8a2095b0bafa6c5b5a55ffdc2f924455233ee7b91c69b7edfcc9e02284/charset_normalizer-3.4.2-cp313-cp313-manylinux_2_17_ppc64le.manylinux2014_ppc64le.whl", hash = "sha256:3fddb7e2c84ac87ac3a947cb4e66d143ca5863ef48e4a5ecb83bd48619e4634e", size = 153653, upload-time = "2025-05-02T08:33:00.342Z" }, + { url = "https://files.pythonhosted.org/packages/b6/57/1b090ff183d13cef485dfbe272e2fe57622a76694061353c59da52c9a659/charset_normalizer-3.4.2-cp313-cp313-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:98f862da73774290f251b9df8d11161b6cf25b599a66baf087c1ffe340e9bfd1", size = 146231, upload-time = "2025-05-02T08:33:02.081Z" }, + { url = "https://files.pythonhosted.org/packages/e2/28/ffc026b26f441fc67bd21ab7f03b313ab3fe46714a14b516f931abe1a2d8/charset_normalizer-3.4.2-cp313-cp313-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:6c9379d65defcab82d07b2a9dfbfc2e95bc8fe0ebb1b176a3190230a3ef0e07c", size = 148243, upload-time = "2025-05-02T08:33:04.063Z" }, + { url = "https://files.pythonhosted.org/packages/c0/0f/9abe9bd191629c33e69e47c6ef45ef99773320e9ad8e9cb08b8ab4a8d4cb/charset_normalizer-3.4.2-cp313-cp313-manylinux_2_5_i686.manylinux1_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:e635b87f01ebc977342e2697d05b56632f5f879a4f15955dfe8cef2448b51691", size = 150442, upload-time = "2025-05-02T08:33:06.418Z" }, + { url = "https://files.pythonhosted.org/packages/67/7c/a123bbcedca91d5916c056407f89a7f5e8fdfce12ba825d7d6b9954a1a3c/charset_normalizer-3.4.2-cp313-cp313-musllinux_1_2_aarch64.whl", hash = "sha256:1c95a1e2902a8b722868587c0e1184ad5c55631de5afc0eb96bc4b0d738092c0", size = 145147, upload-time = "2025-05-02T08:33:08.183Z" }, + { url = "https://files.pythonhosted.org/packages/ec/fe/1ac556fa4899d967b83e9893788e86b6af4d83e4726511eaaad035e36595/charset_normalizer-3.4.2-cp313-cp313-musllinux_1_2_i686.whl", hash = "sha256:ef8de666d6179b009dce7bcb2ad4c4a779f113f12caf8dc77f0162c29d20490b", size = 153057, upload-time = "2025-05-02T08:33:09.986Z" }, + { url = "https://files.pythonhosted.org/packages/2b/ff/acfc0b0a70b19e3e54febdd5301a98b72fa07635e56f24f60502e954c461/charset_normalizer-3.4.2-cp313-cp313-musllinux_1_2_ppc64le.whl", hash = "sha256:32fc0341d72e0f73f80acb0a2c94216bd704f4f0bce10aedea38f30502b271ff", size = 156454, upload-time = "2025-05-02T08:33:11.814Z" }, + { url = "https://files.pythonhosted.org/packages/92/08/95b458ce9c740d0645feb0e96cea1f5ec946ea9c580a94adfe0b617f3573/charset_normalizer-3.4.2-cp313-cp313-musllinux_1_2_s390x.whl", hash = "sha256:289200a18fa698949d2b39c671c2cc7a24d44096784e76614899a7ccf2574b7b", size = 154174, upload-time = "2025-05-02T08:33:13.707Z" }, + { url = "https://files.pythonhosted.org/packages/78/be/8392efc43487ac051eee6c36d5fbd63032d78f7728cb37aebcc98191f1ff/charset_normalizer-3.4.2-cp313-cp313-musllinux_1_2_x86_64.whl", hash = "sha256:4a476b06fbcf359ad25d34a057b7219281286ae2477cc5ff5e3f70a246971148", size = 149166, upload-time = "2025-05-02T08:33:15.458Z" }, + { url = "https://files.pythonhosted.org/packages/44/96/392abd49b094d30b91d9fbda6a69519e95802250b777841cf3bda8fe136c/charset_normalizer-3.4.2-cp313-cp313-win32.whl", hash = "sha256:aaeeb6a479c7667fbe1099af9617c83aaca22182d6cf8c53966491a0f1b7ffb7", size = 98064, upload-time = "2025-05-02T08:33:17.06Z" }, + { url = "https://files.pythonhosted.org/packages/e9/b0/0200da600134e001d91851ddc797809e2fe0ea72de90e09bec5a2fbdaccb/charset_normalizer-3.4.2-cp313-cp313-win_amd64.whl", hash = "sha256:aa6af9e7d59f9c12b33ae4e9450619cf2488e2bbe9b44030905877f0b2324980", size = 105641, upload-time = "2025-05-02T08:33:18.753Z" }, + { url = "https://files.pythonhosted.org/packages/20/94/c5790835a017658cbfabd07f3bfb549140c3ac458cfc196323996b10095a/charset_normalizer-3.4.2-py3-none-any.whl", hash = "sha256:7f56930ab0abd1c45cd15be65cc741c28b1c9a34876ce8c17a2fa107810c0af0", size = 52626, upload-time = "2025-05-02T08:34:40.053Z" }, ] [[package]] @@ -395,91 +396,91 @@ source = { registry = "https://pypi.org/simple" } dependencies = [ { name = "colorama", marker = "sys_platform == 'win32'" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/60/6c/8ca2efa64cf75a977a0d7fac081354553ebe483345c734fb6b6515d96bbc/click-8.2.1.tar.gz", hash = "sha256:27c491cc05d968d271d5a1db13e3b5a184636d9d930f148c50b038f0d0646202", size = 286342 } +sdist = { url = "https://files.pythonhosted.org/packages/60/6c/8ca2efa64cf75a977a0d7fac081354553ebe483345c734fb6b6515d96bbc/click-8.2.1.tar.gz", hash = "sha256:27c491cc05d968d271d5a1db13e3b5a184636d9d930f148c50b038f0d0646202", size = 286342, upload-time = "2025-05-20T23:19:49.832Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/85/32/10bb5764d90a8eee674e9dc6f4db6a0ab47c8c4d0d83c27f7c39ac415a4d/click-8.2.1-py3-none-any.whl", hash = "sha256:61a3265b914e850b85317d0b3109c7f8cd35a670f963866005d6ef1d5175a12b", size = 102215 }, + { url = "https://files.pythonhosted.org/packages/85/32/10bb5764d90a8eee674e9dc6f4db6a0ab47c8c4d0d83c27f7c39ac415a4d/click-8.2.1-py3-none-any.whl", hash = "sha256:61a3265b914e850b85317d0b3109c7f8cd35a670f963866005d6ef1d5175a12b", size = 102215, upload-time = "2025-05-20T23:19:47.796Z" }, ] [[package]] name = "codespell" version = "2.4.1" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/15/e0/709453393c0ea77d007d907dd436b3ee262e28b30995ea1aa36c6ffbccaf/codespell-2.4.1.tar.gz", hash = "sha256:299fcdcb09d23e81e35a671bbe746d5ad7e8385972e65dbb833a2eaac33c01e5", size = 344740 } +sdist = { url = "https://files.pythonhosted.org/packages/15/e0/709453393c0ea77d007d907dd436b3ee262e28b30995ea1aa36c6ffbccaf/codespell-2.4.1.tar.gz", hash = "sha256:299fcdcb09d23e81e35a671bbe746d5ad7e8385972e65dbb833a2eaac33c01e5", size = 344740, upload-time = "2025-01-28T18:52:39.411Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/20/01/b394922252051e97aab231d416c86da3d8a6d781eeadcdca1082867de64e/codespell-2.4.1-py3-none-any.whl", hash = "sha256:3dadafa67df7e4a3dbf51e0d7315061b80d265f9552ebd699b3dd6834b47e425", size = 344501 }, + { url = "https://files.pythonhosted.org/packages/20/01/b394922252051e97aab231d416c86da3d8a6d781eeadcdca1082867de64e/codespell-2.4.1-py3-none-any.whl", hash = "sha256:3dadafa67df7e4a3dbf51e0d7315061b80d265f9552ebd699b3dd6834b47e425", size = 344501, upload-time = "2025-01-28T18:52:37.057Z" }, ] [[package]] name = "colorama" version = "0.4.6" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/d8/53/6f443c9a4a8358a93a6792e2acffb9d9d5cb0a5cfd8802644b7b1c9a02e4/colorama-0.4.6.tar.gz", hash = "sha256:08695f5cb7ed6e0531a20572697297273c47b8cae5a63ffc6d6ed5c201be6e44", size = 27697 } +sdist = { url = "https://files.pythonhosted.org/packages/d8/53/6f443c9a4a8358a93a6792e2acffb9d9d5cb0a5cfd8802644b7b1c9a02e4/colorama-0.4.6.tar.gz", hash = "sha256:08695f5cb7ed6e0531a20572697297273c47b8cae5a63ffc6d6ed5c201be6e44", size = 27697, upload-time = "2022-10-25T02:36:22.414Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/d1/d6/3965ed04c63042e047cb6a3e6ed1a63a35087b6a609aa3a15ed8ac56c221/colorama-0.4.6-py2.py3-none-any.whl", hash = "sha256:4f1d9991f5acc0ca119f9d443620b77f9d6b33703e51011c16baf57afb285fc6", size = 25335 }, + { url = "https://files.pythonhosted.org/packages/d1/d6/3965ed04c63042e047cb6a3e6ed1a63a35087b6a609aa3a15ed8ac56c221/colorama-0.4.6-py2.py3-none-any.whl", hash = "sha256:4f1d9991f5acc0ca119f9d443620b77f9d6b33703e51011c16baf57afb285fc6", size = 25335, upload-time = "2022-10-25T02:36:20.889Z" }, ] [[package]] name = "coverage" version = "7.8.2" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/ba/07/998afa4a0ecdf9b1981ae05415dad2d4e7716e1b1f00abbd91691ac09ac9/coverage-7.8.2.tar.gz", hash = "sha256:a886d531373a1f6ff9fad2a2ba4a045b68467b779ae729ee0b3b10ac20033b27", size = 812759 } -wheels = [ - { url = "https://files.pythonhosted.org/packages/26/6b/7dd06399a5c0b81007e3a6af0395cd60e6a30f959f8d407d3ee04642e896/coverage-7.8.2-cp310-cp310-macosx_10_9_x86_64.whl", hash = "sha256:bd8ec21e1443fd7a447881332f7ce9d35b8fbd2849e761bb290b584535636b0a", size = 211573 }, - { url = "https://files.pythonhosted.org/packages/f0/df/2b24090820a0bac1412955fb1a4dade6bc3b8dcef7b899c277ffaf16916d/coverage-7.8.2-cp310-cp310-macosx_11_0_arm64.whl", hash = "sha256:4c26c2396674816deaeae7ded0e2b42c26537280f8fe313335858ffff35019be", size = 212006 }, - { url = "https://files.pythonhosted.org/packages/c5/c4/e4e3b998e116625562a872a342419652fa6ca73f464d9faf9f52f1aff427/coverage-7.8.2-cp310-cp310-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:1aec326ed237e5880bfe69ad41616d333712c7937bcefc1343145e972938f9b3", size = 241128 }, - { url = "https://files.pythonhosted.org/packages/b1/67/b28904afea3e87a895da850ba587439a61699bf4b73d04d0dfd99bbd33b4/coverage-7.8.2-cp310-cp310-manylinux_2_5_i686.manylinux1_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:5e818796f71702d7a13e50c70de2a1924f729228580bcba1607cccf32eea46e6", size = 239026 }, - { url = "https://files.pythonhosted.org/packages/8c/0f/47bf7c5630d81bc2cd52b9e13043685dbb7c79372a7f5857279cc442b37c/coverage-7.8.2-cp310-cp310-manylinux_2_5_x86_64.manylinux1_x86_64.manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:546e537d9e24efc765c9c891328f30f826e3e4808e31f5d0f87c4ba12bbd1622", size = 240172 }, - { url = "https://files.pythonhosted.org/packages/ba/38/af3eb9d36d85abc881f5aaecf8209383dbe0fa4cac2d804c55d05c51cb04/coverage-7.8.2-cp310-cp310-musllinux_1_2_aarch64.whl", hash = "sha256:ab9b09a2349f58e73f8ebc06fac546dd623e23b063e5398343c5270072e3201c", size = 240086 }, - { url = "https://files.pythonhosted.org/packages/9e/64/c40c27c2573adeba0fe16faf39a8aa57368a1f2148865d6bb24c67eadb41/coverage-7.8.2-cp310-cp310-musllinux_1_2_i686.whl", hash = "sha256:fd51355ab8a372d89fb0e6a31719e825cf8df8b6724bee942fb5b92c3f016ba3", size = 238792 }, - { url = "https://files.pythonhosted.org/packages/8e/ab/b7c85146f15457671c1412afca7c25a5696d7625e7158002aa017e2d7e3c/coverage-7.8.2-cp310-cp310-musllinux_1_2_x86_64.whl", hash = "sha256:0774df1e093acb6c9e4d58bce7f86656aeed6c132a16e2337692c12786b32404", size = 239096 }, - { url = "https://files.pythonhosted.org/packages/d3/50/9446dad1310905fb1dc284d60d4320a5b25d4e3e33f9ea08b8d36e244e23/coverage-7.8.2-cp310-cp310-win32.whl", hash = "sha256:00f2e2f2e37f47e5f54423aeefd6c32a7dbcedc033fcd3928a4f4948e8b96af7", size = 214144 }, - { url = "https://files.pythonhosted.org/packages/23/ed/792e66ad7b8b0df757db8d47af0c23659cdb5a65ef7ace8b111cacdbee89/coverage-7.8.2-cp310-cp310-win_amd64.whl", hash = "sha256:145b07bea229821d51811bf15eeab346c236d523838eda395ea969d120d13347", size = 215043 }, - { url = "https://files.pythonhosted.org/packages/6a/4d/1ff618ee9f134d0de5cc1661582c21a65e06823f41caf801aadf18811a8e/coverage-7.8.2-cp311-cp311-macosx_10_9_x86_64.whl", hash = "sha256:b99058eef42e6a8dcd135afb068b3d53aff3921ce699e127602efff9956457a9", size = 211692 }, - { url = "https://files.pythonhosted.org/packages/96/fa/c3c1b476de96f2bc7a8ca01a9f1fcb51c01c6b60a9d2c3e66194b2bdb4af/coverage-7.8.2-cp311-cp311-macosx_11_0_arm64.whl", hash = "sha256:5feb7f2c3e6ea94d3b877def0270dff0947b8d8c04cfa34a17be0a4dc1836879", size = 212115 }, - { url = "https://files.pythonhosted.org/packages/f7/c2/5414c5a1b286c0f3881ae5adb49be1854ac5b7e99011501f81c8c1453065/coverage-7.8.2-cp311-cp311-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:670a13249b957bb9050fab12d86acef7bf8f6a879b9d1a883799276e0d4c674a", size = 244740 }, - { url = "https://files.pythonhosted.org/packages/cd/46/1ae01912dfb06a642ef3dd9cf38ed4996fda8fe884dab8952da616f81a2b/coverage-7.8.2-cp311-cp311-manylinux_2_5_i686.manylinux1_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:0bdc8bf760459a4a4187b452213e04d039990211f98644c7292adf1e471162b5", size = 242429 }, - { url = "https://files.pythonhosted.org/packages/06/58/38c676aec594bfe2a87c7683942e5a30224791d8df99bcc8439fde140377/coverage-7.8.2-cp311-cp311-manylinux_2_5_x86_64.manylinux1_x86_64.manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:07a989c867986c2a75f158f03fdb413128aad29aca9d4dbce5fc755672d96f11", size = 244218 }, - { url = "https://files.pythonhosted.org/packages/80/0c/95b1023e881ce45006d9abc250f76c6cdab7134a1c182d9713878dfefcb2/coverage-7.8.2-cp311-cp311-musllinux_1_2_aarch64.whl", hash = "sha256:2db10dedeb619a771ef0e2949ccba7b75e33905de959c2643a4607bef2f3fb3a", size = 243865 }, - { url = "https://files.pythonhosted.org/packages/57/37/0ae95989285a39e0839c959fe854a3ae46c06610439350d1ab860bf020ac/coverage-7.8.2-cp311-cp311-musllinux_1_2_i686.whl", hash = "sha256:e6ea7dba4e92926b7b5f0990634b78ea02f208d04af520c73a7c876d5a8d36cb", size = 242038 }, - { url = "https://files.pythonhosted.org/packages/4d/82/40e55f7c0eb5e97cc62cbd9d0746fd24e8caf57be5a408b87529416e0c70/coverage-7.8.2-cp311-cp311-musllinux_1_2_x86_64.whl", hash = "sha256:ef2f22795a7aca99fc3c84393a55a53dd18ab8c93fb431004e4d8f0774150f54", size = 242567 }, - { url = "https://files.pythonhosted.org/packages/f9/35/66a51adc273433a253989f0d9cc7aa6bcdb4855382cf0858200afe578861/coverage-7.8.2-cp311-cp311-win32.whl", hash = "sha256:641988828bc18a6368fe72355df5f1703e44411adbe49bba5644b941ce6f2e3a", size = 214194 }, - { url = "https://files.pythonhosted.org/packages/f6/8f/a543121f9f5f150eae092b08428cb4e6b6d2d134152c3357b77659d2a605/coverage-7.8.2-cp311-cp311-win_amd64.whl", hash = "sha256:8ab4a51cb39dc1933ba627e0875046d150e88478dbe22ce145a68393e9652975", size = 215109 }, - { url = "https://files.pythonhosted.org/packages/77/65/6cc84b68d4f35186463cd7ab1da1169e9abb59870c0f6a57ea6aba95f861/coverage-7.8.2-cp311-cp311-win_arm64.whl", hash = "sha256:8966a821e2083c74d88cca5b7dcccc0a3a888a596a04c0b9668a891de3a0cc53", size = 213521 }, - { url = "https://files.pythonhosted.org/packages/8d/2a/1da1ada2e3044fcd4a3254fb3576e160b8fe5b36d705c8a31f793423f763/coverage-7.8.2-cp312-cp312-macosx_10_13_x86_64.whl", hash = "sha256:e2f6fe3654468d061942591aef56686131335b7a8325684eda85dacdf311356c", size = 211876 }, - { url = "https://files.pythonhosted.org/packages/70/e9/3d715ffd5b6b17a8be80cd14a8917a002530a99943cc1939ad5bb2aa74b9/coverage-7.8.2-cp312-cp312-macosx_11_0_arm64.whl", hash = "sha256:76090fab50610798cc05241bf83b603477c40ee87acd358b66196ab0ca44ffa1", size = 212130 }, - { url = "https://files.pythonhosted.org/packages/a0/02/fdce62bb3c21649abfd91fbdcf041fb99be0d728ff00f3f9d54d97ed683e/coverage-7.8.2-cp312-cp312-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:2bd0a0a5054be160777a7920b731a0570284db5142abaaf81bcbb282b8d99279", size = 246176 }, - { url = "https://files.pythonhosted.org/packages/a7/52/decbbed61e03b6ffe85cd0fea360a5e04a5a98a7423f292aae62423b8557/coverage-7.8.2-cp312-cp312-manylinux_2_5_i686.manylinux1_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:da23ce9a3d356d0affe9c7036030b5c8f14556bd970c9b224f9c8205505e3b99", size = 243068 }, - { url = "https://files.pythonhosted.org/packages/38/6c/d0e9c0cce18faef79a52778219a3c6ee8e336437da8eddd4ab3dbd8fadff/coverage-7.8.2-cp312-cp312-manylinux_2_5_x86_64.manylinux1_x86_64.manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:c9392773cffeb8d7e042a7b15b82a414011e9d2b5fdbbd3f7e6a6b17d5e21b20", size = 245328 }, - { url = "https://files.pythonhosted.org/packages/f0/70/f703b553a2f6b6c70568c7e398ed0789d47f953d67fbba36a327714a7bca/coverage-7.8.2-cp312-cp312-musllinux_1_2_aarch64.whl", hash = "sha256:876cbfd0b09ce09d81585d266c07a32657beb3eaec896f39484b631555be0fe2", size = 245099 }, - { url = "https://files.pythonhosted.org/packages/ec/fb/4cbb370dedae78460c3aacbdad9d249e853f3bc4ce5ff0e02b1983d03044/coverage-7.8.2-cp312-cp312-musllinux_1_2_i686.whl", hash = "sha256:3da9b771c98977a13fbc3830f6caa85cae6c9c83911d24cb2d218e9394259c57", size = 243314 }, - { url = "https://files.pythonhosted.org/packages/39/9f/1afbb2cb9c8699b8bc38afdce00a3b4644904e6a38c7bf9005386c9305ec/coverage-7.8.2-cp312-cp312-musllinux_1_2_x86_64.whl", hash = "sha256:9a990f6510b3292686713bfef26d0049cd63b9c7bb17e0864f133cbfd2e6167f", size = 244489 }, - { url = "https://files.pythonhosted.org/packages/79/fa/f3e7ec7d220bff14aba7a4786ae47043770cbdceeea1803083059c878837/coverage-7.8.2-cp312-cp312-win32.whl", hash = "sha256:bf8111cddd0f2b54d34e96613e7fbdd59a673f0cf5574b61134ae75b6f5a33b8", size = 214366 }, - { url = "https://files.pythonhosted.org/packages/54/aa/9cbeade19b7e8e853e7ffc261df885d66bf3a782c71cba06c17df271f9e6/coverage-7.8.2-cp312-cp312-win_amd64.whl", hash = "sha256:86a323a275e9e44cdf228af9b71c5030861d4d2610886ab920d9945672a81223", size = 215165 }, - { url = "https://files.pythonhosted.org/packages/c4/73/e2528bf1237d2448f882bbebaec5c3500ef07301816c5c63464b9da4d88a/coverage-7.8.2-cp312-cp312-win_arm64.whl", hash = "sha256:820157de3a589e992689ffcda8639fbabb313b323d26388d02e154164c57b07f", size = 213548 }, - { url = "https://files.pythonhosted.org/packages/1a/93/eb6400a745ad3b265bac36e8077fdffcf0268bdbbb6c02b7220b624c9b31/coverage-7.8.2-cp313-cp313-macosx_10_13_x86_64.whl", hash = "sha256:ea561010914ec1c26ab4188aef8b1567272ef6de096312716f90e5baa79ef8ca", size = 211898 }, - { url = "https://files.pythonhosted.org/packages/1b/7c/bdbf113f92683024406a1cd226a199e4200a2001fc85d6a6e7e299e60253/coverage-7.8.2-cp313-cp313-macosx_11_0_arm64.whl", hash = "sha256:cb86337a4fcdd0e598ff2caeb513ac604d2f3da6d53df2c8e368e07ee38e277d", size = 212171 }, - { url = "https://files.pythonhosted.org/packages/91/22/594513f9541a6b88eb0dba4d5da7d71596dadef6b17a12dc2c0e859818a9/coverage-7.8.2-cp313-cp313-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:26a4636ddb666971345541b59899e969f3b301143dd86b0ddbb570bd591f1e85", size = 245564 }, - { url = "https://files.pythonhosted.org/packages/1f/f4/2860fd6abeebd9f2efcfe0fd376226938f22afc80c1943f363cd3c28421f/coverage-7.8.2-cp313-cp313-manylinux_2_5_i686.manylinux1_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:5040536cf9b13fb033f76bcb5e1e5cb3b57c4807fef37db9e0ed129c6a094257", size = 242719 }, - { url = "https://files.pythonhosted.org/packages/89/60/f5f50f61b6332451520e6cdc2401700c48310c64bc2dd34027a47d6ab4ca/coverage-7.8.2-cp313-cp313-manylinux_2_5_x86_64.manylinux1_x86_64.manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:dc67994df9bcd7e0150a47ef41278b9e0a0ea187caba72414b71dc590b99a108", size = 244634 }, - { url = "https://files.pythonhosted.org/packages/3b/70/7f4e919039ab7d944276c446b603eea84da29ebcf20984fb1fdf6e602028/coverage-7.8.2-cp313-cp313-musllinux_1_2_aarch64.whl", hash = "sha256:6e6c86888fd076d9e0fe848af0a2142bf606044dc5ceee0aa9eddb56e26895a0", size = 244824 }, - { url = "https://files.pythonhosted.org/packages/26/45/36297a4c0cea4de2b2c442fe32f60c3991056c59cdc3cdd5346fbb995c97/coverage-7.8.2-cp313-cp313-musllinux_1_2_i686.whl", hash = "sha256:684ca9f58119b8e26bef860db33524ae0365601492e86ba0b71d513f525e7050", size = 242872 }, - { url = "https://files.pythonhosted.org/packages/a4/71/e041f1b9420f7b786b1367fa2a375703889ef376e0d48de9f5723fb35f11/coverage-7.8.2-cp313-cp313-musllinux_1_2_x86_64.whl", hash = "sha256:8165584ddedb49204c4e18da083913bdf6a982bfb558632a79bdaadcdafd0d48", size = 244179 }, - { url = "https://files.pythonhosted.org/packages/bd/db/3c2bf49bdc9de76acf2491fc03130c4ffc51469ce2f6889d2640eb563d77/coverage-7.8.2-cp313-cp313-win32.whl", hash = "sha256:34759ee2c65362163699cc917bdb2a54114dd06d19bab860725f94ef45a3d9b7", size = 214393 }, - { url = "https://files.pythonhosted.org/packages/c6/dc/947e75d47ebbb4b02d8babb1fad4ad381410d5bc9da7cfca80b7565ef401/coverage-7.8.2-cp313-cp313-win_amd64.whl", hash = "sha256:2f9bc608fbafaee40eb60a9a53dbfb90f53cc66d3d32c2849dc27cf5638a21e3", size = 215194 }, - { url = "https://files.pythonhosted.org/packages/90/31/a980f7df8a37eaf0dc60f932507fda9656b3a03f0abf188474a0ea188d6d/coverage-7.8.2-cp313-cp313-win_arm64.whl", hash = "sha256:9fe449ee461a3b0c7105690419d0b0aba1232f4ff6d120a9e241e58a556733f7", size = 213580 }, - { url = "https://files.pythonhosted.org/packages/8a/6a/25a37dd90f6c95f59355629417ebcb74e1c34e38bb1eddf6ca9b38b0fc53/coverage-7.8.2-cp313-cp313t-macosx_10_13_x86_64.whl", hash = "sha256:8369a7c8ef66bded2b6484053749ff220dbf83cba84f3398c84c51a6f748a008", size = 212734 }, - { url = "https://files.pythonhosted.org/packages/36/8b/3a728b3118988725f40950931abb09cd7f43b3c740f4640a59f1db60e372/coverage-7.8.2-cp313-cp313t-macosx_11_0_arm64.whl", hash = "sha256:159b81df53a5fcbc7d45dae3adad554fdbde9829a994e15227b3f9d816d00b36", size = 212959 }, - { url = "https://files.pythonhosted.org/packages/53/3c/212d94e6add3a3c3f412d664aee452045ca17a066def8b9421673e9482c4/coverage-7.8.2-cp313-cp313t-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:e6fcbbd35a96192d042c691c9e0c49ef54bd7ed865846a3c9d624c30bb67ce46", size = 257024 }, - { url = "https://files.pythonhosted.org/packages/a4/40/afc03f0883b1e51bbe804707aae62e29c4e8c8bbc365c75e3e4ddeee9ead/coverage-7.8.2-cp313-cp313t-manylinux_2_5_i686.manylinux1_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:05364b9cc82f138cc86128dc4e2e1251c2981a2218bfcd556fe6b0fbaa3501be", size = 252867 }, - { url = "https://files.pythonhosted.org/packages/18/a2/3699190e927b9439c6ded4998941a3c1d6fa99e14cb28d8536729537e307/coverage-7.8.2-cp313-cp313t-manylinux_2_5_x86_64.manylinux1_x86_64.manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:46d532db4e5ff3979ce47d18e2fe8ecad283eeb7367726da0e5ef88e4fe64740", size = 255096 }, - { url = "https://files.pythonhosted.org/packages/b4/06/16e3598b9466456b718eb3e789457d1a5b8bfb22e23b6e8bbc307df5daf0/coverage-7.8.2-cp313-cp313t-musllinux_1_2_aarch64.whl", hash = "sha256:4000a31c34932e7e4fa0381a3d6deb43dc0c8f458e3e7ea6502e6238e10be625", size = 256276 }, - { url = "https://files.pythonhosted.org/packages/a7/d5/4b5a120d5d0223050a53d2783c049c311eea1709fa9de12d1c358e18b707/coverage-7.8.2-cp313-cp313t-musllinux_1_2_i686.whl", hash = "sha256:43ff5033d657cd51f83015c3b7a443287250dc14e69910577c3e03bd2e06f27b", size = 254478 }, - { url = "https://files.pythonhosted.org/packages/ba/85/f9ecdb910ecdb282b121bfcaa32fa8ee8cbd7699f83330ee13ff9bbf1a85/coverage-7.8.2-cp313-cp313t-musllinux_1_2_x86_64.whl", hash = "sha256:94316e13f0981cbbba132c1f9f365cac1d26716aaac130866ca812006f662199", size = 255255 }, - { url = "https://files.pythonhosted.org/packages/50/63/2d624ac7d7ccd4ebbd3c6a9eba9d7fc4491a1226071360d59dd84928ccb2/coverage-7.8.2-cp313-cp313t-win32.whl", hash = "sha256:3f5673888d3676d0a745c3d0e16da338c5eea300cb1f4ada9c872981265e76d8", size = 215109 }, - { url = "https://files.pythonhosted.org/packages/22/5e/7053b71462e970e869111c1853afd642212568a350eba796deefdfbd0770/coverage-7.8.2-cp313-cp313t-win_amd64.whl", hash = "sha256:2c08b05ee8d7861e45dc5a2cc4195c8c66dca5ac613144eb6ebeaff2d502e73d", size = 216268 }, - { url = "https://files.pythonhosted.org/packages/07/69/afa41aa34147655543dbe96994f8a246daf94b361ccf5edfd5df62ce066a/coverage-7.8.2-cp313-cp313t-win_arm64.whl", hash = "sha256:1e1448bb72b387755e1ff3ef1268a06617afd94188164960dba8d0245a46004b", size = 214071 }, - { url = "https://files.pythonhosted.org/packages/69/2f/572b29496d8234e4a7773200dd835a0d32d9e171f2d974f3fe04a9dbc271/coverage-7.8.2-pp39.pp310.pp311-none-any.whl", hash = "sha256:ec455eedf3ba0bbdf8f5a570012617eb305c63cb9f03428d39bf544cb2b94837", size = 203636 }, - { url = "https://files.pythonhosted.org/packages/a0/1a/0b9c32220ad694d66062f571cc5cedfa9997b64a591e8a500bb63de1bd40/coverage-7.8.2-py3-none-any.whl", hash = "sha256:726f32ee3713f7359696331a18daf0c3b3a70bb0ae71141b9d3c52be7c595e32", size = 203623 }, +sdist = { url = "https://files.pythonhosted.org/packages/ba/07/998afa4a0ecdf9b1981ae05415dad2d4e7716e1b1f00abbd91691ac09ac9/coverage-7.8.2.tar.gz", hash = "sha256:a886d531373a1f6ff9fad2a2ba4a045b68467b779ae729ee0b3b10ac20033b27", size = 812759, upload-time = "2025-05-23T11:39:57.856Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/26/6b/7dd06399a5c0b81007e3a6af0395cd60e6a30f959f8d407d3ee04642e896/coverage-7.8.2-cp310-cp310-macosx_10_9_x86_64.whl", hash = "sha256:bd8ec21e1443fd7a447881332f7ce9d35b8fbd2849e761bb290b584535636b0a", size = 211573, upload-time = "2025-05-23T11:37:47.207Z" }, + { url = "https://files.pythonhosted.org/packages/f0/df/2b24090820a0bac1412955fb1a4dade6bc3b8dcef7b899c277ffaf16916d/coverage-7.8.2-cp310-cp310-macosx_11_0_arm64.whl", hash = "sha256:4c26c2396674816deaeae7ded0e2b42c26537280f8fe313335858ffff35019be", size = 212006, upload-time = "2025-05-23T11:37:50.289Z" }, + { url = "https://files.pythonhosted.org/packages/c5/c4/e4e3b998e116625562a872a342419652fa6ca73f464d9faf9f52f1aff427/coverage-7.8.2-cp310-cp310-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:1aec326ed237e5880bfe69ad41616d333712c7937bcefc1343145e972938f9b3", size = 241128, upload-time = "2025-05-23T11:37:52.229Z" }, + { url = "https://files.pythonhosted.org/packages/b1/67/b28904afea3e87a895da850ba587439a61699bf4b73d04d0dfd99bbd33b4/coverage-7.8.2-cp310-cp310-manylinux_2_5_i686.manylinux1_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:5e818796f71702d7a13e50c70de2a1924f729228580bcba1607cccf32eea46e6", size = 239026, upload-time = "2025-05-23T11:37:53.846Z" }, + { url = "https://files.pythonhosted.org/packages/8c/0f/47bf7c5630d81bc2cd52b9e13043685dbb7c79372a7f5857279cc442b37c/coverage-7.8.2-cp310-cp310-manylinux_2_5_x86_64.manylinux1_x86_64.manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:546e537d9e24efc765c9c891328f30f826e3e4808e31f5d0f87c4ba12bbd1622", size = 240172, upload-time = "2025-05-23T11:37:55.711Z" }, + { url = "https://files.pythonhosted.org/packages/ba/38/af3eb9d36d85abc881f5aaecf8209383dbe0fa4cac2d804c55d05c51cb04/coverage-7.8.2-cp310-cp310-musllinux_1_2_aarch64.whl", hash = "sha256:ab9b09a2349f58e73f8ebc06fac546dd623e23b063e5398343c5270072e3201c", size = 240086, upload-time = "2025-05-23T11:37:57.724Z" }, + { url = "https://files.pythonhosted.org/packages/9e/64/c40c27c2573adeba0fe16faf39a8aa57368a1f2148865d6bb24c67eadb41/coverage-7.8.2-cp310-cp310-musllinux_1_2_i686.whl", hash = "sha256:fd51355ab8a372d89fb0e6a31719e825cf8df8b6724bee942fb5b92c3f016ba3", size = 238792, upload-time = "2025-05-23T11:37:59.737Z" }, + { url = "https://files.pythonhosted.org/packages/8e/ab/b7c85146f15457671c1412afca7c25a5696d7625e7158002aa017e2d7e3c/coverage-7.8.2-cp310-cp310-musllinux_1_2_x86_64.whl", hash = "sha256:0774df1e093acb6c9e4d58bce7f86656aeed6c132a16e2337692c12786b32404", size = 239096, upload-time = "2025-05-23T11:38:01.693Z" }, + { url = "https://files.pythonhosted.org/packages/d3/50/9446dad1310905fb1dc284d60d4320a5b25d4e3e33f9ea08b8d36e244e23/coverage-7.8.2-cp310-cp310-win32.whl", hash = "sha256:00f2e2f2e37f47e5f54423aeefd6c32a7dbcedc033fcd3928a4f4948e8b96af7", size = 214144, upload-time = "2025-05-23T11:38:03.68Z" }, + { url = "https://files.pythonhosted.org/packages/23/ed/792e66ad7b8b0df757db8d47af0c23659cdb5a65ef7ace8b111cacdbee89/coverage-7.8.2-cp310-cp310-win_amd64.whl", hash = "sha256:145b07bea229821d51811bf15eeab346c236d523838eda395ea969d120d13347", size = 215043, upload-time = "2025-05-23T11:38:05.217Z" }, + { url = "https://files.pythonhosted.org/packages/6a/4d/1ff618ee9f134d0de5cc1661582c21a65e06823f41caf801aadf18811a8e/coverage-7.8.2-cp311-cp311-macosx_10_9_x86_64.whl", hash = "sha256:b99058eef42e6a8dcd135afb068b3d53aff3921ce699e127602efff9956457a9", size = 211692, upload-time = "2025-05-23T11:38:08.485Z" }, + { url = "https://files.pythonhosted.org/packages/96/fa/c3c1b476de96f2bc7a8ca01a9f1fcb51c01c6b60a9d2c3e66194b2bdb4af/coverage-7.8.2-cp311-cp311-macosx_11_0_arm64.whl", hash = "sha256:5feb7f2c3e6ea94d3b877def0270dff0947b8d8c04cfa34a17be0a4dc1836879", size = 212115, upload-time = "2025-05-23T11:38:09.989Z" }, + { url = "https://files.pythonhosted.org/packages/f7/c2/5414c5a1b286c0f3881ae5adb49be1854ac5b7e99011501f81c8c1453065/coverage-7.8.2-cp311-cp311-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:670a13249b957bb9050fab12d86acef7bf8f6a879b9d1a883799276e0d4c674a", size = 244740, upload-time = "2025-05-23T11:38:11.947Z" }, + { url = "https://files.pythonhosted.org/packages/cd/46/1ae01912dfb06a642ef3dd9cf38ed4996fda8fe884dab8952da616f81a2b/coverage-7.8.2-cp311-cp311-manylinux_2_5_i686.manylinux1_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:0bdc8bf760459a4a4187b452213e04d039990211f98644c7292adf1e471162b5", size = 242429, upload-time = "2025-05-23T11:38:13.955Z" }, + { url = "https://files.pythonhosted.org/packages/06/58/38c676aec594bfe2a87c7683942e5a30224791d8df99bcc8439fde140377/coverage-7.8.2-cp311-cp311-manylinux_2_5_x86_64.manylinux1_x86_64.manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:07a989c867986c2a75f158f03fdb413128aad29aca9d4dbce5fc755672d96f11", size = 244218, upload-time = "2025-05-23T11:38:15.631Z" }, + { url = "https://files.pythonhosted.org/packages/80/0c/95b1023e881ce45006d9abc250f76c6cdab7134a1c182d9713878dfefcb2/coverage-7.8.2-cp311-cp311-musllinux_1_2_aarch64.whl", hash = "sha256:2db10dedeb619a771ef0e2949ccba7b75e33905de959c2643a4607bef2f3fb3a", size = 243865, upload-time = "2025-05-23T11:38:17.622Z" }, + { url = "https://files.pythonhosted.org/packages/57/37/0ae95989285a39e0839c959fe854a3ae46c06610439350d1ab860bf020ac/coverage-7.8.2-cp311-cp311-musllinux_1_2_i686.whl", hash = "sha256:e6ea7dba4e92926b7b5f0990634b78ea02f208d04af520c73a7c876d5a8d36cb", size = 242038, upload-time = "2025-05-23T11:38:19.966Z" }, + { url = "https://files.pythonhosted.org/packages/4d/82/40e55f7c0eb5e97cc62cbd9d0746fd24e8caf57be5a408b87529416e0c70/coverage-7.8.2-cp311-cp311-musllinux_1_2_x86_64.whl", hash = "sha256:ef2f22795a7aca99fc3c84393a55a53dd18ab8c93fb431004e4d8f0774150f54", size = 242567, upload-time = "2025-05-23T11:38:21.912Z" }, + { url = "https://files.pythonhosted.org/packages/f9/35/66a51adc273433a253989f0d9cc7aa6bcdb4855382cf0858200afe578861/coverage-7.8.2-cp311-cp311-win32.whl", hash = "sha256:641988828bc18a6368fe72355df5f1703e44411adbe49bba5644b941ce6f2e3a", size = 214194, upload-time = "2025-05-23T11:38:23.571Z" }, + { url = "https://files.pythonhosted.org/packages/f6/8f/a543121f9f5f150eae092b08428cb4e6b6d2d134152c3357b77659d2a605/coverage-7.8.2-cp311-cp311-win_amd64.whl", hash = "sha256:8ab4a51cb39dc1933ba627e0875046d150e88478dbe22ce145a68393e9652975", size = 215109, upload-time = "2025-05-23T11:38:25.137Z" }, + { url = "https://files.pythonhosted.org/packages/77/65/6cc84b68d4f35186463cd7ab1da1169e9abb59870c0f6a57ea6aba95f861/coverage-7.8.2-cp311-cp311-win_arm64.whl", hash = "sha256:8966a821e2083c74d88cca5b7dcccc0a3a888a596a04c0b9668a891de3a0cc53", size = 213521, upload-time = "2025-05-23T11:38:27.123Z" }, + { url = "https://files.pythonhosted.org/packages/8d/2a/1da1ada2e3044fcd4a3254fb3576e160b8fe5b36d705c8a31f793423f763/coverage-7.8.2-cp312-cp312-macosx_10_13_x86_64.whl", hash = "sha256:e2f6fe3654468d061942591aef56686131335b7a8325684eda85dacdf311356c", size = 211876, upload-time = "2025-05-23T11:38:29.01Z" }, + { url = "https://files.pythonhosted.org/packages/70/e9/3d715ffd5b6b17a8be80cd14a8917a002530a99943cc1939ad5bb2aa74b9/coverage-7.8.2-cp312-cp312-macosx_11_0_arm64.whl", hash = "sha256:76090fab50610798cc05241bf83b603477c40ee87acd358b66196ab0ca44ffa1", size = 212130, upload-time = "2025-05-23T11:38:30.675Z" }, + { url = "https://files.pythonhosted.org/packages/a0/02/fdce62bb3c21649abfd91fbdcf041fb99be0d728ff00f3f9d54d97ed683e/coverage-7.8.2-cp312-cp312-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:2bd0a0a5054be160777a7920b731a0570284db5142abaaf81bcbb282b8d99279", size = 246176, upload-time = "2025-05-23T11:38:32.395Z" }, + { url = "https://files.pythonhosted.org/packages/a7/52/decbbed61e03b6ffe85cd0fea360a5e04a5a98a7423f292aae62423b8557/coverage-7.8.2-cp312-cp312-manylinux_2_5_i686.manylinux1_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:da23ce9a3d356d0affe9c7036030b5c8f14556bd970c9b224f9c8205505e3b99", size = 243068, upload-time = "2025-05-23T11:38:33.989Z" }, + { url = "https://files.pythonhosted.org/packages/38/6c/d0e9c0cce18faef79a52778219a3c6ee8e336437da8eddd4ab3dbd8fadff/coverage-7.8.2-cp312-cp312-manylinux_2_5_x86_64.manylinux1_x86_64.manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:c9392773cffeb8d7e042a7b15b82a414011e9d2b5fdbbd3f7e6a6b17d5e21b20", size = 245328, upload-time = "2025-05-23T11:38:35.568Z" }, + { url = "https://files.pythonhosted.org/packages/f0/70/f703b553a2f6b6c70568c7e398ed0789d47f953d67fbba36a327714a7bca/coverage-7.8.2-cp312-cp312-musllinux_1_2_aarch64.whl", hash = "sha256:876cbfd0b09ce09d81585d266c07a32657beb3eaec896f39484b631555be0fe2", size = 245099, upload-time = "2025-05-23T11:38:37.627Z" }, + { url = "https://files.pythonhosted.org/packages/ec/fb/4cbb370dedae78460c3aacbdad9d249e853f3bc4ce5ff0e02b1983d03044/coverage-7.8.2-cp312-cp312-musllinux_1_2_i686.whl", hash = "sha256:3da9b771c98977a13fbc3830f6caa85cae6c9c83911d24cb2d218e9394259c57", size = 243314, upload-time = "2025-05-23T11:38:39.238Z" }, + { url = "https://files.pythonhosted.org/packages/39/9f/1afbb2cb9c8699b8bc38afdce00a3b4644904e6a38c7bf9005386c9305ec/coverage-7.8.2-cp312-cp312-musllinux_1_2_x86_64.whl", hash = "sha256:9a990f6510b3292686713bfef26d0049cd63b9c7bb17e0864f133cbfd2e6167f", size = 244489, upload-time = "2025-05-23T11:38:40.845Z" }, + { url = "https://files.pythonhosted.org/packages/79/fa/f3e7ec7d220bff14aba7a4786ae47043770cbdceeea1803083059c878837/coverage-7.8.2-cp312-cp312-win32.whl", hash = "sha256:bf8111cddd0f2b54d34e96613e7fbdd59a673f0cf5574b61134ae75b6f5a33b8", size = 214366, upload-time = "2025-05-23T11:38:43.551Z" }, + { url = "https://files.pythonhosted.org/packages/54/aa/9cbeade19b7e8e853e7ffc261df885d66bf3a782c71cba06c17df271f9e6/coverage-7.8.2-cp312-cp312-win_amd64.whl", hash = "sha256:86a323a275e9e44cdf228af9b71c5030861d4d2610886ab920d9945672a81223", size = 215165, upload-time = "2025-05-23T11:38:45.148Z" }, + { url = "https://files.pythonhosted.org/packages/c4/73/e2528bf1237d2448f882bbebaec5c3500ef07301816c5c63464b9da4d88a/coverage-7.8.2-cp312-cp312-win_arm64.whl", hash = "sha256:820157de3a589e992689ffcda8639fbabb313b323d26388d02e154164c57b07f", size = 213548, upload-time = "2025-05-23T11:38:46.74Z" }, + { url = "https://files.pythonhosted.org/packages/1a/93/eb6400a745ad3b265bac36e8077fdffcf0268bdbbb6c02b7220b624c9b31/coverage-7.8.2-cp313-cp313-macosx_10_13_x86_64.whl", hash = "sha256:ea561010914ec1c26ab4188aef8b1567272ef6de096312716f90e5baa79ef8ca", size = 211898, upload-time = "2025-05-23T11:38:49.066Z" }, + { url = "https://files.pythonhosted.org/packages/1b/7c/bdbf113f92683024406a1cd226a199e4200a2001fc85d6a6e7e299e60253/coverage-7.8.2-cp313-cp313-macosx_11_0_arm64.whl", hash = "sha256:cb86337a4fcdd0e598ff2caeb513ac604d2f3da6d53df2c8e368e07ee38e277d", size = 212171, upload-time = "2025-05-23T11:38:51.207Z" }, + { url = "https://files.pythonhosted.org/packages/91/22/594513f9541a6b88eb0dba4d5da7d71596dadef6b17a12dc2c0e859818a9/coverage-7.8.2-cp313-cp313-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:26a4636ddb666971345541b59899e969f3b301143dd86b0ddbb570bd591f1e85", size = 245564, upload-time = "2025-05-23T11:38:52.857Z" }, + { url = "https://files.pythonhosted.org/packages/1f/f4/2860fd6abeebd9f2efcfe0fd376226938f22afc80c1943f363cd3c28421f/coverage-7.8.2-cp313-cp313-manylinux_2_5_i686.manylinux1_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:5040536cf9b13fb033f76bcb5e1e5cb3b57c4807fef37db9e0ed129c6a094257", size = 242719, upload-time = "2025-05-23T11:38:54.529Z" }, + { url = "https://files.pythonhosted.org/packages/89/60/f5f50f61b6332451520e6cdc2401700c48310c64bc2dd34027a47d6ab4ca/coverage-7.8.2-cp313-cp313-manylinux_2_5_x86_64.manylinux1_x86_64.manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:dc67994df9bcd7e0150a47ef41278b9e0a0ea187caba72414b71dc590b99a108", size = 244634, upload-time = "2025-05-23T11:38:57.326Z" }, + { url = "https://files.pythonhosted.org/packages/3b/70/7f4e919039ab7d944276c446b603eea84da29ebcf20984fb1fdf6e602028/coverage-7.8.2-cp313-cp313-musllinux_1_2_aarch64.whl", hash = "sha256:6e6c86888fd076d9e0fe848af0a2142bf606044dc5ceee0aa9eddb56e26895a0", size = 244824, upload-time = "2025-05-23T11:38:59.421Z" }, + { url = "https://files.pythonhosted.org/packages/26/45/36297a4c0cea4de2b2c442fe32f60c3991056c59cdc3cdd5346fbb995c97/coverage-7.8.2-cp313-cp313-musllinux_1_2_i686.whl", hash = "sha256:684ca9f58119b8e26bef860db33524ae0365601492e86ba0b71d513f525e7050", size = 242872, upload-time = "2025-05-23T11:39:01.049Z" }, + { url = "https://files.pythonhosted.org/packages/a4/71/e041f1b9420f7b786b1367fa2a375703889ef376e0d48de9f5723fb35f11/coverage-7.8.2-cp313-cp313-musllinux_1_2_x86_64.whl", hash = "sha256:8165584ddedb49204c4e18da083913bdf6a982bfb558632a79bdaadcdafd0d48", size = 244179, upload-time = "2025-05-23T11:39:02.709Z" }, + { url = "https://files.pythonhosted.org/packages/bd/db/3c2bf49bdc9de76acf2491fc03130c4ffc51469ce2f6889d2640eb563d77/coverage-7.8.2-cp313-cp313-win32.whl", hash = "sha256:34759ee2c65362163699cc917bdb2a54114dd06d19bab860725f94ef45a3d9b7", size = 214393, upload-time = "2025-05-23T11:39:05.457Z" }, + { url = "https://files.pythonhosted.org/packages/c6/dc/947e75d47ebbb4b02d8babb1fad4ad381410d5bc9da7cfca80b7565ef401/coverage-7.8.2-cp313-cp313-win_amd64.whl", hash = "sha256:2f9bc608fbafaee40eb60a9a53dbfb90f53cc66d3d32c2849dc27cf5638a21e3", size = 215194, upload-time = "2025-05-23T11:39:07.171Z" }, + { url = "https://files.pythonhosted.org/packages/90/31/a980f7df8a37eaf0dc60f932507fda9656b3a03f0abf188474a0ea188d6d/coverage-7.8.2-cp313-cp313-win_arm64.whl", hash = "sha256:9fe449ee461a3b0c7105690419d0b0aba1232f4ff6d120a9e241e58a556733f7", size = 213580, upload-time = "2025-05-23T11:39:08.862Z" }, + { url = "https://files.pythonhosted.org/packages/8a/6a/25a37dd90f6c95f59355629417ebcb74e1c34e38bb1eddf6ca9b38b0fc53/coverage-7.8.2-cp313-cp313t-macosx_10_13_x86_64.whl", hash = "sha256:8369a7c8ef66bded2b6484053749ff220dbf83cba84f3398c84c51a6f748a008", size = 212734, upload-time = "2025-05-23T11:39:11.109Z" }, + { url = "https://files.pythonhosted.org/packages/36/8b/3a728b3118988725f40950931abb09cd7f43b3c740f4640a59f1db60e372/coverage-7.8.2-cp313-cp313t-macosx_11_0_arm64.whl", hash = "sha256:159b81df53a5fcbc7d45dae3adad554fdbde9829a994e15227b3f9d816d00b36", size = 212959, upload-time = "2025-05-23T11:39:12.751Z" }, + { url = "https://files.pythonhosted.org/packages/53/3c/212d94e6add3a3c3f412d664aee452045ca17a066def8b9421673e9482c4/coverage-7.8.2-cp313-cp313t-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:e6fcbbd35a96192d042c691c9e0c49ef54bd7ed865846a3c9d624c30bb67ce46", size = 257024, upload-time = "2025-05-23T11:39:15.569Z" }, + { url = "https://files.pythonhosted.org/packages/a4/40/afc03f0883b1e51bbe804707aae62e29c4e8c8bbc365c75e3e4ddeee9ead/coverage-7.8.2-cp313-cp313t-manylinux_2_5_i686.manylinux1_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:05364b9cc82f138cc86128dc4e2e1251c2981a2218bfcd556fe6b0fbaa3501be", size = 252867, upload-time = "2025-05-23T11:39:17.64Z" }, + { url = "https://files.pythonhosted.org/packages/18/a2/3699190e927b9439c6ded4998941a3c1d6fa99e14cb28d8536729537e307/coverage-7.8.2-cp313-cp313t-manylinux_2_5_x86_64.manylinux1_x86_64.manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:46d532db4e5ff3979ce47d18e2fe8ecad283eeb7367726da0e5ef88e4fe64740", size = 255096, upload-time = "2025-05-23T11:39:19.328Z" }, + { url = "https://files.pythonhosted.org/packages/b4/06/16e3598b9466456b718eb3e789457d1a5b8bfb22e23b6e8bbc307df5daf0/coverage-7.8.2-cp313-cp313t-musllinux_1_2_aarch64.whl", hash = "sha256:4000a31c34932e7e4fa0381a3d6deb43dc0c8f458e3e7ea6502e6238e10be625", size = 256276, upload-time = "2025-05-23T11:39:21.077Z" }, + { url = "https://files.pythonhosted.org/packages/a7/d5/4b5a120d5d0223050a53d2783c049c311eea1709fa9de12d1c358e18b707/coverage-7.8.2-cp313-cp313t-musllinux_1_2_i686.whl", hash = "sha256:43ff5033d657cd51f83015c3b7a443287250dc14e69910577c3e03bd2e06f27b", size = 254478, upload-time = "2025-05-23T11:39:22.838Z" }, + { url = "https://files.pythonhosted.org/packages/ba/85/f9ecdb910ecdb282b121bfcaa32fa8ee8cbd7699f83330ee13ff9bbf1a85/coverage-7.8.2-cp313-cp313t-musllinux_1_2_x86_64.whl", hash = "sha256:94316e13f0981cbbba132c1f9f365cac1d26716aaac130866ca812006f662199", size = 255255, upload-time = "2025-05-23T11:39:24.644Z" }, + { url = "https://files.pythonhosted.org/packages/50/63/2d624ac7d7ccd4ebbd3c6a9eba9d7fc4491a1226071360d59dd84928ccb2/coverage-7.8.2-cp313-cp313t-win32.whl", hash = "sha256:3f5673888d3676d0a745c3d0e16da338c5eea300cb1f4ada9c872981265e76d8", size = 215109, upload-time = "2025-05-23T11:39:26.722Z" }, + { url = "https://files.pythonhosted.org/packages/22/5e/7053b71462e970e869111c1853afd642212568a350eba796deefdfbd0770/coverage-7.8.2-cp313-cp313t-win_amd64.whl", hash = "sha256:2c08b05ee8d7861e45dc5a2cc4195c8c66dca5ac613144eb6ebeaff2d502e73d", size = 216268, upload-time = "2025-05-23T11:39:28.429Z" }, + { url = "https://files.pythonhosted.org/packages/07/69/afa41aa34147655543dbe96994f8a246daf94b361ccf5edfd5df62ce066a/coverage-7.8.2-cp313-cp313t-win_arm64.whl", hash = "sha256:1e1448bb72b387755e1ff3ef1268a06617afd94188164960dba8d0245a46004b", size = 214071, upload-time = "2025-05-23T11:39:30.55Z" }, + { url = "https://files.pythonhosted.org/packages/69/2f/572b29496d8234e4a7773200dd835a0d32d9e171f2d974f3fe04a9dbc271/coverage-7.8.2-pp39.pp310.pp311-none-any.whl", hash = "sha256:ec455eedf3ba0bbdf8f5a570012617eb305c63cb9f03428d39bf544cb2b94837", size = 203636, upload-time = "2025-05-23T11:39:52.002Z" }, + { url = "https://files.pythonhosted.org/packages/a0/1a/0b9c32220ad694d66062f571cc5cedfa9997b64a591e8a500bb63de1bd40/coverage-7.8.2-py3-none-any.whl", hash = "sha256:726f32ee3713f7359696331a18daf0c3b3a70bb0ae71141b9d3c52be7c595e32", size = 203623, upload-time = "2025-05-23T11:39:53.846Z" }, ] [package.optional-dependencies] @@ -494,62 +495,62 @@ source = { registry = "https://pypi.org/simple" } dependencies = [ { name = "cffi", marker = "platform_python_implementation != 'PyPy'" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/fe/c8/a2a376a8711c1e11708b9c9972e0c3223f5fc682552c82d8db844393d6ce/cryptography-45.0.4.tar.gz", hash = "sha256:7405ade85c83c37682c8fe65554759800a4a8c54b2d96e0f8ad114d31b808d57", size = 744890 } -wheels = [ - { url = "https://files.pythonhosted.org/packages/cc/1c/92637793de053832523b410dbe016d3f5c11b41d0cf6eef8787aabb51d41/cryptography-45.0.4-cp311-abi3-macosx_10_9_universal2.whl", hash = "sha256:425a9a6ac2823ee6e46a76a21a4e8342d8fa5c01e08b823c1f19a8b74f096069", size = 7055712 }, - { url = "https://files.pythonhosted.org/packages/ba/14/93b69f2af9ba832ad6618a03f8a034a5851dc9a3314336a3d71c252467e1/cryptography-45.0.4-cp311-abi3-manylinux2014_aarch64.manylinux_2_17_aarch64.whl", hash = "sha256:680806cf63baa0039b920f4976f5f31b10e772de42f16310a6839d9f21a26b0d", size = 4205335 }, - { url = "https://files.pythonhosted.org/packages/67/30/fae1000228634bf0b647fca80403db5ca9e3933b91dd060570689f0bd0f7/cryptography-45.0.4-cp311-abi3-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:4ca0f52170e821bc8da6fc0cc565b7bb8ff8d90d36b5e9fdd68e8a86bdf72036", size = 4431487 }, - { url = "https://files.pythonhosted.org/packages/6d/5a/7dffcf8cdf0cb3c2430de7404b327e3db64735747d641fc492539978caeb/cryptography-45.0.4-cp311-abi3-manylinux_2_28_aarch64.whl", hash = "sha256:f3fe7a5ae34d5a414957cc7f457e2b92076e72938423ac64d215722f6cf49a9e", size = 4208922 }, - { url = "https://files.pythonhosted.org/packages/c6/f3/528729726eb6c3060fa3637253430547fbaaea95ab0535ea41baa4a6fbd8/cryptography-45.0.4-cp311-abi3-manylinux_2_28_armv7l.manylinux_2_31_armv7l.whl", hash = "sha256:25eb4d4d3e54595dc8adebc6bbd5623588991d86591a78c2548ffb64797341e2", size = 3900433 }, - { url = "https://files.pythonhosted.org/packages/d9/4a/67ba2e40f619e04d83c32f7e1d484c1538c0800a17c56a22ff07d092ccc1/cryptography-45.0.4-cp311-abi3-manylinux_2_28_x86_64.whl", hash = "sha256:ce1678a2ccbe696cf3af15a75bb72ee008d7ff183c9228592ede9db467e64f1b", size = 4464163 }, - { url = "https://files.pythonhosted.org/packages/7e/9a/b4d5aa83661483ac372464809c4b49b5022dbfe36b12fe9e323ca8512420/cryptography-45.0.4-cp311-abi3-manylinux_2_34_aarch64.whl", hash = "sha256:49fe9155ab32721b9122975e168a6760d8ce4cffe423bcd7ca269ba41b5dfac1", size = 4208687 }, - { url = "https://files.pythonhosted.org/packages/db/b7/a84bdcd19d9c02ec5807f2ec2d1456fd8451592c5ee353816c09250e3561/cryptography-45.0.4-cp311-abi3-manylinux_2_34_x86_64.whl", hash = "sha256:2882338b2a6e0bd337052e8b9007ced85c637da19ef9ecaf437744495c8c2999", size = 4463623 }, - { url = "https://files.pythonhosted.org/packages/d8/84/69707d502d4d905021cac3fb59a316344e9f078b1da7fb43ecde5e10840a/cryptography-45.0.4-cp311-abi3-musllinux_1_2_aarch64.whl", hash = "sha256:23b9c3ea30c3ed4db59e7b9619272e94891f8a3a5591d0b656a7582631ccf750", size = 4332447 }, - { url = "https://files.pythonhosted.org/packages/f3/ee/d4f2ab688e057e90ded24384e34838086a9b09963389a5ba6854b5876598/cryptography-45.0.4-cp311-abi3-musllinux_1_2_x86_64.whl", hash = "sha256:b0a97c927497e3bc36b33987abb99bf17a9a175a19af38a892dc4bbb844d7ee2", size = 4572830 }, - { url = "https://files.pythonhosted.org/packages/70/d4/994773a261d7ff98034f72c0e8251fe2755eac45e2265db4c866c1c6829c/cryptography-45.0.4-cp311-abi3-win32.whl", hash = "sha256:e00a6c10a5c53979d6242f123c0a97cff9f3abed7f064fc412c36dc521b5f257", size = 2932769 }, - { url = "https://files.pythonhosted.org/packages/5a/42/c80bd0b67e9b769b364963b5252b17778a397cefdd36fa9aa4a5f34c599a/cryptography-45.0.4-cp311-abi3-win_amd64.whl", hash = "sha256:817ee05c6c9f7a69a16200f0c90ab26d23a87701e2a284bd15156783e46dbcc8", size = 3410441 }, - { url = "https://files.pythonhosted.org/packages/ce/0b/2488c89f3a30bc821c9d96eeacfcab6ff3accc08a9601ba03339c0fd05e5/cryptography-45.0.4-cp37-abi3-macosx_10_9_universal2.whl", hash = "sha256:964bcc28d867e0f5491a564b7debb3ffdd8717928d315d12e0d7defa9e43b723", size = 7031836 }, - { url = "https://files.pythonhosted.org/packages/fe/51/8c584ed426093aac257462ae62d26ad61ef1cbf5b58d8b67e6e13c39960e/cryptography-45.0.4-cp37-abi3-manylinux2014_aarch64.manylinux_2_17_aarch64.whl", hash = "sha256:6a5bf57554e80f75a7db3d4b1dacaa2764611ae166ab42ea9a72bcdb5d577637", size = 4195746 }, - { url = "https://files.pythonhosted.org/packages/5c/7d/4b0ca4d7af95a704eef2f8f80a8199ed236aaf185d55385ae1d1610c03c2/cryptography-45.0.4-cp37-abi3-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:46cf7088bf91bdc9b26f9c55636492c1cce3e7aaf8041bbf0243f5e5325cfb2d", size = 4424456 }, - { url = "https://files.pythonhosted.org/packages/1d/45/5fabacbc6e76ff056f84d9f60eeac18819badf0cefc1b6612ee03d4ab678/cryptography-45.0.4-cp37-abi3-manylinux_2_28_aarch64.whl", hash = "sha256:7bedbe4cc930fa4b100fc845ea1ea5788fcd7ae9562e669989c11618ae8d76ee", size = 4198495 }, - { url = "https://files.pythonhosted.org/packages/55/b7/ffc9945b290eb0a5d4dab9b7636706e3b5b92f14ee5d9d4449409d010d54/cryptography-45.0.4-cp37-abi3-manylinux_2_28_armv7l.manylinux_2_31_armv7l.whl", hash = "sha256:eaa3e28ea2235b33220b949c5a0d6cf79baa80eab2eb5607ca8ab7525331b9ff", size = 3885540 }, - { url = "https://files.pythonhosted.org/packages/7f/e3/57b010282346980475e77d414080acdcb3dab9a0be63071efc2041a2c6bd/cryptography-45.0.4-cp37-abi3-manylinux_2_28_x86_64.whl", hash = "sha256:7ef2dde4fa9408475038fc9aadfc1fb2676b174e68356359632e980c661ec8f6", size = 4452052 }, - { url = "https://files.pythonhosted.org/packages/37/e6/ddc4ac2558bf2ef517a358df26f45bc774a99bf4653e7ee34b5e749c03e3/cryptography-45.0.4-cp37-abi3-manylinux_2_34_aarch64.whl", hash = "sha256:6a3511ae33f09094185d111160fd192c67aa0a2a8d19b54d36e4c78f651dc5ad", size = 4198024 }, - { url = "https://files.pythonhosted.org/packages/3a/c0/85fa358ddb063ec588aed4a6ea1df57dc3e3bc1712d87c8fa162d02a65fc/cryptography-45.0.4-cp37-abi3-manylinux_2_34_x86_64.whl", hash = "sha256:06509dc70dd71fa56eaa138336244e2fbaf2ac164fc9b5e66828fccfd2b680d6", size = 4451442 }, - { url = "https://files.pythonhosted.org/packages/33/67/362d6ec1492596e73da24e669a7fbbaeb1c428d6bf49a29f7a12acffd5dc/cryptography-45.0.4-cp37-abi3-musllinux_1_2_aarch64.whl", hash = "sha256:5f31e6b0a5a253f6aa49be67279be4a7e5a4ef259a9f33c69f7d1b1191939872", size = 4325038 }, - { url = "https://files.pythonhosted.org/packages/53/75/82a14bf047a96a1b13ebb47fb9811c4f73096cfa2e2b17c86879687f9027/cryptography-45.0.4-cp37-abi3-musllinux_1_2_x86_64.whl", hash = "sha256:944e9ccf67a9594137f942d5b52c8d238b1b4e46c7a0c2891b7ae6e01e7c80a4", size = 4560964 }, - { url = "https://files.pythonhosted.org/packages/cd/37/1a3cba4c5a468ebf9b95523a5ef5651244693dc712001e276682c278fc00/cryptography-45.0.4-cp37-abi3-win32.whl", hash = "sha256:c22fe01e53dc65edd1945a2e6f0015e887f84ced233acecb64b4daadb32f5c97", size = 2924557 }, - { url = "https://files.pythonhosted.org/packages/2a/4b/3256759723b7e66380397d958ca07c59cfc3fb5c794fb5516758afd05d41/cryptography-45.0.4-cp37-abi3-win_amd64.whl", hash = "sha256:627ba1bc94f6adf0b0a2e35d87020285ead22d9f648c7e75bb64f367375f3b22", size = 3395508 }, - { url = "https://files.pythonhosted.org/packages/16/33/b38e9d372afde56906a23839302c19abdac1c505bfb4776c1e4b07c3e145/cryptography-45.0.4-pp310-pypy310_pp73-macosx_10_9_x86_64.whl", hash = "sha256:a77c6fb8d76e9c9f99f2f3437c1a4ac287b34eaf40997cfab1e9bd2be175ac39", size = 3580103 }, - { url = "https://files.pythonhosted.org/packages/c4/b9/357f18064ec09d4807800d05a48f92f3b369056a12f995ff79549fbb31f1/cryptography-45.0.4-pp310-pypy310_pp73-manylinux_2_28_aarch64.whl", hash = "sha256:7aad98a25ed8ac917fdd8a9c1e706e5a0956e06c498be1f713b61734333a4507", size = 4143732 }, - { url = "https://files.pythonhosted.org/packages/c4/9c/7f7263b03d5db329093617648b9bd55c953de0b245e64e866e560f9aac07/cryptography-45.0.4-pp310-pypy310_pp73-manylinux_2_28_x86_64.whl", hash = "sha256:3530382a43a0e524bc931f187fc69ef4c42828cf7d7f592f7f249f602b5a4ab0", size = 4385424 }, - { url = "https://files.pythonhosted.org/packages/a6/5a/6aa9d8d5073d5acc0e04e95b2860ef2684b2bd2899d8795fc443013e263b/cryptography-45.0.4-pp310-pypy310_pp73-manylinux_2_34_aarch64.whl", hash = "sha256:6b613164cb8425e2f8db5849ffb84892e523bf6d26deb8f9bb76ae86181fa12b", size = 4142438 }, - { url = "https://files.pythonhosted.org/packages/42/1c/71c638420f2cdd96d9c2b287fec515faf48679b33a2b583d0f1eda3a3375/cryptography-45.0.4-pp310-pypy310_pp73-manylinux_2_34_x86_64.whl", hash = "sha256:96d4819e25bf3b685199b304a0029ce4a3caf98947ce8a066c9137cc78ad2c58", size = 4384622 }, - { url = "https://files.pythonhosted.org/packages/ef/ab/e3a055c34e97deadbf0d846e189237d3385dca99e1a7e27384c3b2292041/cryptography-45.0.4-pp310-pypy310_pp73-win_amd64.whl", hash = "sha256:b97737a3ffbea79eebb062eb0d67d72307195035332501722a9ca86bab9e3ab2", size = 3328911 }, - { url = "https://files.pythonhosted.org/packages/ea/ba/cf442ae99ef363855ed84b39e0fb3c106ac66b7a7703f3c9c9cfe05412cb/cryptography-45.0.4-pp311-pypy311_pp73-macosx_10_9_x86_64.whl", hash = "sha256:4828190fb6c4bcb6ebc6331f01fe66ae838bb3bd58e753b59d4b22eb444b996c", size = 3590512 }, - { url = "https://files.pythonhosted.org/packages/28/9a/a7d5bb87d149eb99a5abdc69a41e4e47b8001d767e5f403f78bfaafc7aa7/cryptography-45.0.4-pp311-pypy311_pp73-manylinux_2_28_aarch64.whl", hash = "sha256:03dbff8411206713185b8cebe31bc5c0eb544799a50c09035733716b386e61a4", size = 4146899 }, - { url = "https://files.pythonhosted.org/packages/17/11/9361c2c71c42cc5c465cf294c8030e72fb0c87752bacbd7a3675245e3db3/cryptography-45.0.4-pp311-pypy311_pp73-manylinux_2_28_x86_64.whl", hash = "sha256:51dfbd4d26172d31150d84c19bbe06c68ea4b7f11bbc7b3a5e146b367c311349", size = 4388900 }, - { url = "https://files.pythonhosted.org/packages/c0/76/f95b83359012ee0e670da3e41c164a0c256aeedd81886f878911581d852f/cryptography-45.0.4-pp311-pypy311_pp73-manylinux_2_34_aarch64.whl", hash = "sha256:0339a692de47084969500ee455e42c58e449461e0ec845a34a6a9b9bf7df7fb8", size = 4146422 }, - { url = "https://files.pythonhosted.org/packages/09/ad/5429fcc4def93e577a5407988f89cf15305e64920203d4ac14601a9dc876/cryptography-45.0.4-pp311-pypy311_pp73-manylinux_2_34_x86_64.whl", hash = "sha256:0cf13c77d710131d33e63626bd55ae7c0efb701ebdc2b3a7952b9b23a0412862", size = 4388475 }, - { url = "https://files.pythonhosted.org/packages/99/49/0ab9774f64555a1b50102757811508f5ace451cf5dc0a2d074a4b9deca6a/cryptography-45.0.4-pp311-pypy311_pp73-win_amd64.whl", hash = "sha256:bbc505d1dc469ac12a0a064214879eac6294038d6b24ae9f71faae1448a9608d", size = 3337594 }, +sdist = { url = "https://files.pythonhosted.org/packages/fe/c8/a2a376a8711c1e11708b9c9972e0c3223f5fc682552c82d8db844393d6ce/cryptography-45.0.4.tar.gz", hash = "sha256:7405ade85c83c37682c8fe65554759800a4a8c54b2d96e0f8ad114d31b808d57", size = 744890, upload-time = "2025-06-10T00:03:51.297Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/cc/1c/92637793de053832523b410dbe016d3f5c11b41d0cf6eef8787aabb51d41/cryptography-45.0.4-cp311-abi3-macosx_10_9_universal2.whl", hash = "sha256:425a9a6ac2823ee6e46a76a21a4e8342d8fa5c01e08b823c1f19a8b74f096069", size = 7055712, upload-time = "2025-06-10T00:02:38.826Z" }, + { url = "https://files.pythonhosted.org/packages/ba/14/93b69f2af9ba832ad6618a03f8a034a5851dc9a3314336a3d71c252467e1/cryptography-45.0.4-cp311-abi3-manylinux2014_aarch64.manylinux_2_17_aarch64.whl", hash = "sha256:680806cf63baa0039b920f4976f5f31b10e772de42f16310a6839d9f21a26b0d", size = 4205335, upload-time = "2025-06-10T00:02:41.64Z" }, + { url = "https://files.pythonhosted.org/packages/67/30/fae1000228634bf0b647fca80403db5ca9e3933b91dd060570689f0bd0f7/cryptography-45.0.4-cp311-abi3-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:4ca0f52170e821bc8da6fc0cc565b7bb8ff8d90d36b5e9fdd68e8a86bdf72036", size = 4431487, upload-time = "2025-06-10T00:02:43.696Z" }, + { url = "https://files.pythonhosted.org/packages/6d/5a/7dffcf8cdf0cb3c2430de7404b327e3db64735747d641fc492539978caeb/cryptography-45.0.4-cp311-abi3-manylinux_2_28_aarch64.whl", hash = "sha256:f3fe7a5ae34d5a414957cc7f457e2b92076e72938423ac64d215722f6cf49a9e", size = 4208922, upload-time = "2025-06-10T00:02:45.334Z" }, + { url = "https://files.pythonhosted.org/packages/c6/f3/528729726eb6c3060fa3637253430547fbaaea95ab0535ea41baa4a6fbd8/cryptography-45.0.4-cp311-abi3-manylinux_2_28_armv7l.manylinux_2_31_armv7l.whl", hash = "sha256:25eb4d4d3e54595dc8adebc6bbd5623588991d86591a78c2548ffb64797341e2", size = 3900433, upload-time = "2025-06-10T00:02:47.359Z" }, + { url = "https://files.pythonhosted.org/packages/d9/4a/67ba2e40f619e04d83c32f7e1d484c1538c0800a17c56a22ff07d092ccc1/cryptography-45.0.4-cp311-abi3-manylinux_2_28_x86_64.whl", hash = "sha256:ce1678a2ccbe696cf3af15a75bb72ee008d7ff183c9228592ede9db467e64f1b", size = 4464163, upload-time = "2025-06-10T00:02:49.412Z" }, + { url = "https://files.pythonhosted.org/packages/7e/9a/b4d5aa83661483ac372464809c4b49b5022dbfe36b12fe9e323ca8512420/cryptography-45.0.4-cp311-abi3-manylinux_2_34_aarch64.whl", hash = "sha256:49fe9155ab32721b9122975e168a6760d8ce4cffe423bcd7ca269ba41b5dfac1", size = 4208687, upload-time = "2025-06-10T00:02:50.976Z" }, + { url = "https://files.pythonhosted.org/packages/db/b7/a84bdcd19d9c02ec5807f2ec2d1456fd8451592c5ee353816c09250e3561/cryptography-45.0.4-cp311-abi3-manylinux_2_34_x86_64.whl", hash = "sha256:2882338b2a6e0bd337052e8b9007ced85c637da19ef9ecaf437744495c8c2999", size = 4463623, upload-time = "2025-06-10T00:02:52.542Z" }, + { url = "https://files.pythonhosted.org/packages/d8/84/69707d502d4d905021cac3fb59a316344e9f078b1da7fb43ecde5e10840a/cryptography-45.0.4-cp311-abi3-musllinux_1_2_aarch64.whl", hash = "sha256:23b9c3ea30c3ed4db59e7b9619272e94891f8a3a5591d0b656a7582631ccf750", size = 4332447, upload-time = "2025-06-10T00:02:54.63Z" }, + { url = "https://files.pythonhosted.org/packages/f3/ee/d4f2ab688e057e90ded24384e34838086a9b09963389a5ba6854b5876598/cryptography-45.0.4-cp311-abi3-musllinux_1_2_x86_64.whl", hash = "sha256:b0a97c927497e3bc36b33987abb99bf17a9a175a19af38a892dc4bbb844d7ee2", size = 4572830, upload-time = "2025-06-10T00:02:56.689Z" }, + { url = "https://files.pythonhosted.org/packages/70/d4/994773a261d7ff98034f72c0e8251fe2755eac45e2265db4c866c1c6829c/cryptography-45.0.4-cp311-abi3-win32.whl", hash = "sha256:e00a6c10a5c53979d6242f123c0a97cff9f3abed7f064fc412c36dc521b5f257", size = 2932769, upload-time = "2025-06-10T00:02:58.467Z" }, + { url = "https://files.pythonhosted.org/packages/5a/42/c80bd0b67e9b769b364963b5252b17778a397cefdd36fa9aa4a5f34c599a/cryptography-45.0.4-cp311-abi3-win_amd64.whl", hash = "sha256:817ee05c6c9f7a69a16200f0c90ab26d23a87701e2a284bd15156783e46dbcc8", size = 3410441, upload-time = "2025-06-10T00:03:00.14Z" }, + { url = "https://files.pythonhosted.org/packages/ce/0b/2488c89f3a30bc821c9d96eeacfcab6ff3accc08a9601ba03339c0fd05e5/cryptography-45.0.4-cp37-abi3-macosx_10_9_universal2.whl", hash = "sha256:964bcc28d867e0f5491a564b7debb3ffdd8717928d315d12e0d7defa9e43b723", size = 7031836, upload-time = "2025-06-10T00:03:01.726Z" }, + { url = "https://files.pythonhosted.org/packages/fe/51/8c584ed426093aac257462ae62d26ad61ef1cbf5b58d8b67e6e13c39960e/cryptography-45.0.4-cp37-abi3-manylinux2014_aarch64.manylinux_2_17_aarch64.whl", hash = "sha256:6a5bf57554e80f75a7db3d4b1dacaa2764611ae166ab42ea9a72bcdb5d577637", size = 4195746, upload-time = "2025-06-10T00:03:03.94Z" }, + { url = "https://files.pythonhosted.org/packages/5c/7d/4b0ca4d7af95a704eef2f8f80a8199ed236aaf185d55385ae1d1610c03c2/cryptography-45.0.4-cp37-abi3-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:46cf7088bf91bdc9b26f9c55636492c1cce3e7aaf8041bbf0243f5e5325cfb2d", size = 4424456, upload-time = "2025-06-10T00:03:05.589Z" }, + { url = "https://files.pythonhosted.org/packages/1d/45/5fabacbc6e76ff056f84d9f60eeac18819badf0cefc1b6612ee03d4ab678/cryptography-45.0.4-cp37-abi3-manylinux_2_28_aarch64.whl", hash = "sha256:7bedbe4cc930fa4b100fc845ea1ea5788fcd7ae9562e669989c11618ae8d76ee", size = 4198495, upload-time = "2025-06-10T00:03:09.172Z" }, + { url = "https://files.pythonhosted.org/packages/55/b7/ffc9945b290eb0a5d4dab9b7636706e3b5b92f14ee5d9d4449409d010d54/cryptography-45.0.4-cp37-abi3-manylinux_2_28_armv7l.manylinux_2_31_armv7l.whl", hash = "sha256:eaa3e28ea2235b33220b949c5a0d6cf79baa80eab2eb5607ca8ab7525331b9ff", size = 3885540, upload-time = "2025-06-10T00:03:10.835Z" }, + { url = "https://files.pythonhosted.org/packages/7f/e3/57b010282346980475e77d414080acdcb3dab9a0be63071efc2041a2c6bd/cryptography-45.0.4-cp37-abi3-manylinux_2_28_x86_64.whl", hash = "sha256:7ef2dde4fa9408475038fc9aadfc1fb2676b174e68356359632e980c661ec8f6", size = 4452052, upload-time = "2025-06-10T00:03:12.448Z" }, + { url = "https://files.pythonhosted.org/packages/37/e6/ddc4ac2558bf2ef517a358df26f45bc774a99bf4653e7ee34b5e749c03e3/cryptography-45.0.4-cp37-abi3-manylinux_2_34_aarch64.whl", hash = "sha256:6a3511ae33f09094185d111160fd192c67aa0a2a8d19b54d36e4c78f651dc5ad", size = 4198024, upload-time = "2025-06-10T00:03:13.976Z" }, + { url = "https://files.pythonhosted.org/packages/3a/c0/85fa358ddb063ec588aed4a6ea1df57dc3e3bc1712d87c8fa162d02a65fc/cryptography-45.0.4-cp37-abi3-manylinux_2_34_x86_64.whl", hash = "sha256:06509dc70dd71fa56eaa138336244e2fbaf2ac164fc9b5e66828fccfd2b680d6", size = 4451442, upload-time = "2025-06-10T00:03:16.248Z" }, + { url = "https://files.pythonhosted.org/packages/33/67/362d6ec1492596e73da24e669a7fbbaeb1c428d6bf49a29f7a12acffd5dc/cryptography-45.0.4-cp37-abi3-musllinux_1_2_aarch64.whl", hash = "sha256:5f31e6b0a5a253f6aa49be67279be4a7e5a4ef259a9f33c69f7d1b1191939872", size = 4325038, upload-time = "2025-06-10T00:03:18.4Z" }, + { url = "https://files.pythonhosted.org/packages/53/75/82a14bf047a96a1b13ebb47fb9811c4f73096cfa2e2b17c86879687f9027/cryptography-45.0.4-cp37-abi3-musllinux_1_2_x86_64.whl", hash = "sha256:944e9ccf67a9594137f942d5b52c8d238b1b4e46c7a0c2891b7ae6e01e7c80a4", size = 4560964, upload-time = "2025-06-10T00:03:20.06Z" }, + { url = "https://files.pythonhosted.org/packages/cd/37/1a3cba4c5a468ebf9b95523a5ef5651244693dc712001e276682c278fc00/cryptography-45.0.4-cp37-abi3-win32.whl", hash = "sha256:c22fe01e53dc65edd1945a2e6f0015e887f84ced233acecb64b4daadb32f5c97", size = 2924557, upload-time = "2025-06-10T00:03:22.563Z" }, + { url = "https://files.pythonhosted.org/packages/2a/4b/3256759723b7e66380397d958ca07c59cfc3fb5c794fb5516758afd05d41/cryptography-45.0.4-cp37-abi3-win_amd64.whl", hash = "sha256:627ba1bc94f6adf0b0a2e35d87020285ead22d9f648c7e75bb64f367375f3b22", size = 3395508, upload-time = "2025-06-10T00:03:24.586Z" }, + { url = "https://files.pythonhosted.org/packages/16/33/b38e9d372afde56906a23839302c19abdac1c505bfb4776c1e4b07c3e145/cryptography-45.0.4-pp310-pypy310_pp73-macosx_10_9_x86_64.whl", hash = "sha256:a77c6fb8d76e9c9f99f2f3437c1a4ac287b34eaf40997cfab1e9bd2be175ac39", size = 3580103, upload-time = "2025-06-10T00:03:26.207Z" }, + { url = "https://files.pythonhosted.org/packages/c4/b9/357f18064ec09d4807800d05a48f92f3b369056a12f995ff79549fbb31f1/cryptography-45.0.4-pp310-pypy310_pp73-manylinux_2_28_aarch64.whl", hash = "sha256:7aad98a25ed8ac917fdd8a9c1e706e5a0956e06c498be1f713b61734333a4507", size = 4143732, upload-time = "2025-06-10T00:03:27.896Z" }, + { url = "https://files.pythonhosted.org/packages/c4/9c/7f7263b03d5db329093617648b9bd55c953de0b245e64e866e560f9aac07/cryptography-45.0.4-pp310-pypy310_pp73-manylinux_2_28_x86_64.whl", hash = "sha256:3530382a43a0e524bc931f187fc69ef4c42828cf7d7f592f7f249f602b5a4ab0", size = 4385424, upload-time = "2025-06-10T00:03:29.992Z" }, + { url = "https://files.pythonhosted.org/packages/a6/5a/6aa9d8d5073d5acc0e04e95b2860ef2684b2bd2899d8795fc443013e263b/cryptography-45.0.4-pp310-pypy310_pp73-manylinux_2_34_aarch64.whl", hash = "sha256:6b613164cb8425e2f8db5849ffb84892e523bf6d26deb8f9bb76ae86181fa12b", size = 4142438, upload-time = "2025-06-10T00:03:31.782Z" }, + { url = "https://files.pythonhosted.org/packages/42/1c/71c638420f2cdd96d9c2b287fec515faf48679b33a2b583d0f1eda3a3375/cryptography-45.0.4-pp310-pypy310_pp73-manylinux_2_34_x86_64.whl", hash = "sha256:96d4819e25bf3b685199b304a0029ce4a3caf98947ce8a066c9137cc78ad2c58", size = 4384622, upload-time = "2025-06-10T00:03:33.491Z" }, + { url = "https://files.pythonhosted.org/packages/ef/ab/e3a055c34e97deadbf0d846e189237d3385dca99e1a7e27384c3b2292041/cryptography-45.0.4-pp310-pypy310_pp73-win_amd64.whl", hash = "sha256:b97737a3ffbea79eebb062eb0d67d72307195035332501722a9ca86bab9e3ab2", size = 3328911, upload-time = "2025-06-10T00:03:35.035Z" }, + { url = "https://files.pythonhosted.org/packages/ea/ba/cf442ae99ef363855ed84b39e0fb3c106ac66b7a7703f3c9c9cfe05412cb/cryptography-45.0.4-pp311-pypy311_pp73-macosx_10_9_x86_64.whl", hash = "sha256:4828190fb6c4bcb6ebc6331f01fe66ae838bb3bd58e753b59d4b22eb444b996c", size = 3590512, upload-time = "2025-06-10T00:03:36.982Z" }, + { url = "https://files.pythonhosted.org/packages/28/9a/a7d5bb87d149eb99a5abdc69a41e4e47b8001d767e5f403f78bfaafc7aa7/cryptography-45.0.4-pp311-pypy311_pp73-manylinux_2_28_aarch64.whl", hash = "sha256:03dbff8411206713185b8cebe31bc5c0eb544799a50c09035733716b386e61a4", size = 4146899, upload-time = "2025-06-10T00:03:38.659Z" }, + { url = "https://files.pythonhosted.org/packages/17/11/9361c2c71c42cc5c465cf294c8030e72fb0c87752bacbd7a3675245e3db3/cryptography-45.0.4-pp311-pypy311_pp73-manylinux_2_28_x86_64.whl", hash = "sha256:51dfbd4d26172d31150d84c19bbe06c68ea4b7f11bbc7b3a5e146b367c311349", size = 4388900, upload-time = "2025-06-10T00:03:40.233Z" }, + { url = "https://files.pythonhosted.org/packages/c0/76/f95b83359012ee0e670da3e41c164a0c256aeedd81886f878911581d852f/cryptography-45.0.4-pp311-pypy311_pp73-manylinux_2_34_aarch64.whl", hash = "sha256:0339a692de47084969500ee455e42c58e449461e0ec845a34a6a9b9bf7df7fb8", size = 4146422, upload-time = "2025-06-10T00:03:41.827Z" }, + { url = "https://files.pythonhosted.org/packages/09/ad/5429fcc4def93e577a5407988f89cf15305e64920203d4ac14601a9dc876/cryptography-45.0.4-pp311-pypy311_pp73-manylinux_2_34_x86_64.whl", hash = "sha256:0cf13c77d710131d33e63626bd55ae7c0efb701ebdc2b3a7952b9b23a0412862", size = 4388475, upload-time = "2025-06-10T00:03:43.493Z" }, + { url = "https://files.pythonhosted.org/packages/99/49/0ab9774f64555a1b50102757811508f5ace451cf5dc0a2d074a4b9deca6a/cryptography-45.0.4-pp311-pypy311_pp73-win_amd64.whl", hash = "sha256:bbc505d1dc469ac12a0a064214879eac6294038d6b24ae9f71faae1448a9608d", size = 3337594, upload-time = "2025-06-10T00:03:45.523Z" }, ] [[package]] name = "decorator" version = "5.2.1" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/43/fa/6d96a0978d19e17b68d634497769987b16c8f4cd0a7a05048bec693caa6b/decorator-5.2.1.tar.gz", hash = "sha256:65f266143752f734b0a7cc83c46f4618af75b8c5911b00ccb61d0ac9b6da0360", size = 56711 } +sdist = { url = "https://files.pythonhosted.org/packages/43/fa/6d96a0978d19e17b68d634497769987b16c8f4cd0a7a05048bec693caa6b/decorator-5.2.1.tar.gz", hash = "sha256:65f266143752f734b0a7cc83c46f4618af75b8c5911b00ccb61d0ac9b6da0360", size = 56711, upload-time = "2025-02-24T04:41:34.073Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/4e/8c/f3147f5c4b73e7550fe5f9352eaa956ae838d5c51eb58e7a25b9f3e2643b/decorator-5.2.1-py3-none-any.whl", hash = "sha256:d316bb415a2d9e2d2b3abcc4084c6502fc09240e292cd76a76afc106a1c8e04a", size = 9190 }, + { url = "https://files.pythonhosted.org/packages/4e/8c/f3147f5c4b73e7550fe5f9352eaa956ae838d5c51eb58e7a25b9f3e2643b/decorator-5.2.1-py3-none-any.whl", hash = "sha256:d316bb415a2d9e2d2b3abcc4084c6502fc09240e292cd76a76afc106a1c8e04a", size = 9190, upload-time = "2025-02-24T04:41:32.565Z" }, ] [[package]] name = "docutils" version = "0.21.2" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/ae/ed/aefcc8cd0ba62a0560c3c18c33925362d46c6075480bfa4df87b28e169a9/docutils-0.21.2.tar.gz", hash = "sha256:3a6b18732edf182daa3cd12775bbb338cf5691468f91eeeb109deff6ebfa986f", size = 2204444 } +sdist = { url = "https://files.pythonhosted.org/packages/ae/ed/aefcc8cd0ba62a0560c3c18c33925362d46c6075480bfa4df87b28e169a9/docutils-0.21.2.tar.gz", hash = "sha256:3a6b18732edf182daa3cd12775bbb338cf5691468f91eeeb109deff6ebfa986f", size = 2204444, upload-time = "2024-04-23T18:57:18.24Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/8f/d7/9322c609343d929e75e7e5e6255e614fcc67572cfd083959cdef3b7aad79/docutils-0.21.2-py3-none-any.whl", hash = "sha256:dafca5b9e384f0e419294eb4d2ff9fa826435bf15f15b7bd45723e8ad76811b2", size = 587408 }, + { url = "https://files.pythonhosted.org/packages/8f/d7/9322c609343d929e75e7e5e6255e614fcc67572cfd083959cdef3b7aad79/docutils-0.21.2-py3-none-any.whl", hash = "sha256:dafca5b9e384f0e419294eb4d2ff9fa826435bf15f15b7bd45723e8ad76811b2", size = 587408, upload-time = "2024-04-23T18:57:14.835Z" }, ] [[package]] @@ -559,27 +560,27 @@ source = { registry = "https://pypi.org/simple" } dependencies = [ { name = "typing-extensions", marker = "python_full_version < '3.11'" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/0b/9f/a65090624ecf468cdca03533906e7c69ed7588582240cfe7cc9e770b50eb/exceptiongroup-1.3.0.tar.gz", hash = "sha256:b241f5885f560bc56a59ee63ca4c6a8bfa46ae4ad651af316d4e81817bb9fd88", size = 29749 } +sdist = { url = "https://files.pythonhosted.org/packages/0b/9f/a65090624ecf468cdca03533906e7c69ed7588582240cfe7cc9e770b50eb/exceptiongroup-1.3.0.tar.gz", hash = "sha256:b241f5885f560bc56a59ee63ca4c6a8bfa46ae4ad651af316d4e81817bb9fd88", size = 29749, upload-time = "2025-05-10T17:42:51.123Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/36/f4/c6e662dade71f56cd2f3735141b265c3c79293c109549c1e6933b0651ffc/exceptiongroup-1.3.0-py3-none-any.whl", hash = "sha256:4d111e6e0c13d0644cad6ddaa7ed0261a0b36971f6d23e7ec9b4b9097da78a10", size = 16674 }, + { url = "https://files.pythonhosted.org/packages/36/f4/c6e662dade71f56cd2f3735141b265c3c79293c109549c1e6933b0651ffc/exceptiongroup-1.3.0-py3-none-any.whl", hash = "sha256:4d111e6e0c13d0644cad6ddaa7ed0261a0b36971f6d23e7ec9b4b9097da78a10", size = 16674, upload-time = "2025-05-10T17:42:49.33Z" }, ] [[package]] name = "execnet" version = "2.1.1" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/bb/ff/b4c0dc78fbe20c3e59c0c7334de0c27eb4001a2b2017999af398bf730817/execnet-2.1.1.tar.gz", hash = "sha256:5189b52c6121c24feae288166ab41b32549c7e2348652736540b9e6e7d4e72e3", size = 166524 } +sdist = { url = "https://files.pythonhosted.org/packages/bb/ff/b4c0dc78fbe20c3e59c0c7334de0c27eb4001a2b2017999af398bf730817/execnet-2.1.1.tar.gz", hash = "sha256:5189b52c6121c24feae288166ab41b32549c7e2348652736540b9e6e7d4e72e3", size = 166524, upload-time = "2024-04-08T09:04:19.245Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/43/09/2aea36ff60d16dd8879bdb2f5b3ee0ba8d08cbbdcdfe870e695ce3784385/execnet-2.1.1-py3-none-any.whl", hash = "sha256:26dee51f1b80cebd6d0ca8e74dd8745419761d3bef34163928cbebbdc4749fdc", size = 40612 }, + { url = "https://files.pythonhosted.org/packages/43/09/2aea36ff60d16dd8879bdb2f5b3ee0ba8d08cbbdcdfe870e695ce3784385/execnet-2.1.1-py3-none-any.whl", hash = "sha256:26dee51f1b80cebd6d0ca8e74dd8745419761d3bef34163928cbebbdc4749fdc", size = 40612, upload-time = "2024-04-08T09:04:17.414Z" }, ] [[package]] name = "executing" version = "2.2.0" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/91/50/a9d80c47ff289c611ff12e63f7c5d13942c65d68125160cefd768c73e6e4/executing-2.2.0.tar.gz", hash = "sha256:5d108c028108fe2551d1a7b2e8b713341e2cb4fc0aa7dcf966fa4327a5226755", size = 978693 } +sdist = { url = "https://files.pythonhosted.org/packages/91/50/a9d80c47ff289c611ff12e63f7c5d13942c65d68125160cefd768c73e6e4/executing-2.2.0.tar.gz", hash = "sha256:5d108c028108fe2551d1a7b2e8b713341e2cb4fc0aa7dcf966fa4327a5226755", size = 978693, upload-time = "2025-01-22T15:41:29.403Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/7b/8f/c4d9bafc34ad7ad5d8dc16dd1347ee0e507a52c3adb6bfa8887e1c6a26ba/executing-2.2.0-py2.py3-none-any.whl", hash = "sha256:11387150cad388d62750327a53d3339fad4888b39a6fe233c3afbb54ecffd3aa", size = 26702 }, + { url = "https://files.pythonhosted.org/packages/7b/8f/c4d9bafc34ad7ad5d8dc16dd1347ee0e507a52c3adb6bfa8887e1c6a26ba/executing-2.2.0-py2.py3-none-any.whl", hash = "sha256:11387150cad388d62750327a53d3339fad4888b39a6fe233c3afbb54ecffd3aa", size = 26702, upload-time = "2025-01-22T15:41:25.929Z" }, ] [[package]] @@ -592,9 +593,9 @@ dependencies = [ { name = "sphinx" }, { name = "sphinx-basic-ng" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/a0/e2/d351d69a9a9e4badb4a5be062c2d0e87bd9e6c23b5e57337fef14bef34c8/furo-2024.8.6.tar.gz", hash = "sha256:b63e4cee8abfc3136d3bc03a3d45a76a850bada4d6374d24c1716b0e01394a01", size = 1661506 } +sdist = { url = "https://files.pythonhosted.org/packages/a0/e2/d351d69a9a9e4badb4a5be062c2d0e87bd9e6c23b5e57337fef14bef34c8/furo-2024.8.6.tar.gz", hash = "sha256:b63e4cee8abfc3136d3bc03a3d45a76a850bada4d6374d24c1716b0e01394a01", size = 1661506, upload-time = "2024-08-06T08:07:57.567Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/27/48/e791a7ed487dbb9729ef32bb5d1af16693d8925f4366befef54119b2e576/furo-2024.8.6-py3-none-any.whl", hash = "sha256:6cd97c58b47813d3619e63e9081169880fbe331f0ca883c871ff1f3f11814f5c", size = 341333 }, + { url = "https://files.pythonhosted.org/packages/27/48/e791a7ed487dbb9729ef32bb5d1af16693d8925f4366befef54119b2e576/furo-2024.8.6-py3-none-any.whl", hash = "sha256:6cd97c58b47813d3619e63e9081169880fbe331f0ca883c871ff1f3f11814f5c", size = 341333, upload-time = "2024-08-06T08:07:54.44Z" }, ] [[package]] @@ -604,9 +605,9 @@ source = { registry = "https://pypi.org/simple" } dependencies = [ { name = "smmap" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/72/94/63b0fc47eb32792c7ba1fe1b694daec9a63620db1e313033d18140c2320a/gitdb-4.0.12.tar.gz", hash = "sha256:5ef71f855d191a3326fcfbc0d5da835f26b13fbcba60c32c21091c349ffdb571", size = 394684 } +sdist = { url = "https://files.pythonhosted.org/packages/72/94/63b0fc47eb32792c7ba1fe1b694daec9a63620db1e313033d18140c2320a/gitdb-4.0.12.tar.gz", hash = "sha256:5ef71f855d191a3326fcfbc0d5da835f26b13fbcba60c32c21091c349ffdb571", size = 394684, upload-time = "2025-01-02T07:20:46.413Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/a0/61/5c78b91c3143ed5c14207f463aecfc8f9dbb5092fb2869baf37c273b2705/gitdb-4.0.12-py3-none-any.whl", hash = "sha256:67073e15955400952c6565cc3e707c554a4eea2e428946f7a4c162fab9bd9bcf", size = 62794 }, + { url = "https://files.pythonhosted.org/packages/a0/61/5c78b91c3143ed5c14207f463aecfc8f9dbb5092fb2869baf37c273b2705/gitdb-4.0.12-py3-none-any.whl", hash = "sha256:67073e15955400952c6565cc3e707c554a4eea2e428946f7a4c162fab9bd9bcf", size = 62794, upload-time = "2025-01-02T07:20:43.624Z" }, ] [[package]] @@ -616,9 +617,9 @@ source = { registry = "https://pypi.org/simple" } dependencies = [ { name = "gitdb" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/c0/89/37df0b71473153574a5cdef8f242de422a0f5d26d7a9e231e6f169b4ad14/gitpython-3.1.44.tar.gz", hash = "sha256:c87e30b26253bf5418b01b0660f818967f3c503193838337fe5e573331249269", size = 214196 } +sdist = { url = "https://files.pythonhosted.org/packages/c0/89/37df0b71473153574a5cdef8f242de422a0f5d26d7a9e231e6f169b4ad14/gitpython-3.1.44.tar.gz", hash = "sha256:c87e30b26253bf5418b01b0660f818967f3c503193838337fe5e573331249269", size = 214196, upload-time = "2025-01-02T07:32:43.59Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/1d/9a/4114a9057db2f1462d5c8f8390ab7383925fe1ac012eaa42402ad65c2963/GitPython-3.1.44-py3-none-any.whl", hash = "sha256:9e0e10cda9bed1ee64bc9a6de50e7e38a9c9943241cd7f585f6df3ed28011110", size = 207599 }, + { url = "https://files.pythonhosted.org/packages/1d/9a/4114a9057db2f1462d5c8f8390ab7383925fe1ac012eaa42402ad65c2963/GitPython-3.1.44-py3-none-any.whl", hash = "sha256:9e0e10cda9bed1ee64bc9a6de50e7e38a9c9943241cd7f585f6df3ed28011110", size = 207599, upload-time = "2025-01-02T07:32:40.731Z" }, ] [[package]] @@ -630,18 +631,18 @@ dependencies = [ { name = "pyasn1-modules" }, { name = "rsa" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/9e/9b/e92ef23b84fa10a64ce4831390b7a4c2e53c0132568d99d4ae61d04c8855/google_auth-2.40.3.tar.gz", hash = "sha256:500c3a29adedeb36ea9cf24b8d10858e152f2412e3ca37829b3fa18e33d63b77", size = 281029 } +sdist = { url = "https://files.pythonhosted.org/packages/9e/9b/e92ef23b84fa10a64ce4831390b7a4c2e53c0132568d99d4ae61d04c8855/google_auth-2.40.3.tar.gz", hash = "sha256:500c3a29adedeb36ea9cf24b8d10858e152f2412e3ca37829b3fa18e33d63b77", size = 281029, upload-time = "2025-06-04T18:04:57.577Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/17/63/b19553b658a1692443c62bd07e5868adaa0ad746a0751ba62c59568cd45b/google_auth-2.40.3-py2.py3-none-any.whl", hash = "sha256:1370d4593e86213563547f97a92752fc658456fe4514c809544f330fed45a7ca", size = 216137 }, + { url = "https://files.pythonhosted.org/packages/17/63/b19553b658a1692443c62bd07e5868adaa0ad746a0751ba62c59568cd45b/google_auth-2.40.3-py2.py3-none-any.whl", hash = "sha256:1370d4593e86213563547f97a92752fc658456fe4514c809544f330fed45a7ca", size = 216137, upload-time = "2025-06-04T18:04:55.573Z" }, ] [[package]] name = "h11" version = "0.16.0" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/01/ee/02a2c011bdab74c6fb3c75474d40b3052059d95df7e73351460c8588d963/h11-0.16.0.tar.gz", hash = "sha256:4e35b956cf45792e4caa5885e69fba00bdbc6ffafbfa020300e549b208ee5ff1", size = 101250 } +sdist = { url = "https://files.pythonhosted.org/packages/01/ee/02a2c011bdab74c6fb3c75474d40b3052059d95df7e73351460c8588d963/h11-0.16.0.tar.gz", hash = "sha256:4e35b956cf45792e4caa5885e69fba00bdbc6ffafbfa020300e549b208ee5ff1", size = 101250, upload-time = "2025-04-24T03:35:25.427Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/04/4b/29cac41a4d98d144bf5f6d33995617b185d14b22401f75ca86f384e87ff1/h11-0.16.0-py3-none-any.whl", hash = "sha256:63cf8bbe7522de3bf65932fda1d9c2772064ffb3dae62d55932da54b31cb6c86", size = 37515 }, + { url = "https://files.pythonhosted.org/packages/04/4b/29cac41a4d98d144bf5f6d33995617b185d14b22401f75ca86f384e87ff1/h11-0.16.0-py3-none-any.whl", hash = "sha256:63cf8bbe7522de3bf65932fda1d9c2772064ffb3dae62d55932da54b31cb6c86", size = 37515, upload-time = "2025-04-24T03:35:24.344Z" }, ] [[package]] @@ -652,9 +653,9 @@ dependencies = [ { name = "six" }, { name = "webencodings" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/ac/b6/b55c3f49042f1df3dcd422b7f224f939892ee94f22abcf503a9b7339eaf2/html5lib-1.1.tar.gz", hash = "sha256:b2e5b40261e20f354d198eae92afc10d750afb487ed5e50f9c4eaf07c184146f", size = 272215 } +sdist = { url = "https://files.pythonhosted.org/packages/ac/b6/b55c3f49042f1df3dcd422b7f224f939892ee94f22abcf503a9b7339eaf2/html5lib-1.1.tar.gz", hash = "sha256:b2e5b40261e20f354d198eae92afc10d750afb487ed5e50f9c4eaf07c184146f", size = 272215, upload-time = "2020-06-22T23:32:38.834Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/6c/dd/a834df6482147d48e225a49515aabc28974ad5a4ca3215c18a882565b028/html5lib-1.1-py2.py3-none-any.whl", hash = "sha256:0d78f8fde1c230e99fe37986a60526d7049ed4bf8a9fadbad5f00e22e58e041d", size = 112173 }, + { url = "https://files.pythonhosted.org/packages/6c/dd/a834df6482147d48e225a49515aabc28974ad5a4ca3215c18a882565b028/html5lib-1.1-py2.py3-none-any.whl", hash = "sha256:0d78f8fde1c230e99fe37986a60526d7049ed4bf8a9fadbad5f00e22e58e041d", size = 112173, upload-time = "2020-06-22T23:32:36.781Z" }, ] [[package]] @@ -665,9 +666,9 @@ dependencies = [ { name = "certifi" }, { name = "h11" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/06/94/82699a10bca87a5556c9c59b5963f2d039dbd239f25bc2a63907a05a14cb/httpcore-1.0.9.tar.gz", hash = "sha256:6e34463af53fd2ab5d807f399a9b45ea31c3dfa2276f15a2c3f00afff6e176e8", size = 85484 } +sdist = { url = "https://files.pythonhosted.org/packages/06/94/82699a10bca87a5556c9c59b5963f2d039dbd239f25bc2a63907a05a14cb/httpcore-1.0.9.tar.gz", hash = "sha256:6e34463af53fd2ab5d807f399a9b45ea31c3dfa2276f15a2c3f00afff6e176e8", size = 85484, upload-time = "2025-04-24T22:06:22.219Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/7e/f5/f66802a942d491edb555dd61e3a9961140fd64c90bce1eafd741609d334d/httpcore-1.0.9-py3-none-any.whl", hash = "sha256:2d400746a40668fc9dec9810239072b40b4484b640a8c38fd654a024c7a1bf55", size = 78784 }, + { url = "https://files.pythonhosted.org/packages/7e/f5/f66802a942d491edb555dd61e3a9961140fd64c90bce1eafd741609d334d/httpcore-1.0.9-py3-none-any.whl", hash = "sha256:2d400746a40668fc9dec9810239072b40b4484b640a8c38fd654a024c7a1bf55", size = 78784, upload-time = "2025-04-24T22:06:20.566Z" }, ] [[package]] @@ -680,9 +681,9 @@ dependencies = [ { name = "httpcore" }, { name = "idna" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/b1/df/48c586a5fe32a0f01324ee087459e112ebb7224f646c0b5023f5e79e9956/httpx-0.28.1.tar.gz", hash = "sha256:75e98c5f16b0f35b567856f597f06ff2270a374470a5c2392242528e3e3e42fc", size = 141406 } +sdist = { url = "https://files.pythonhosted.org/packages/b1/df/48c586a5fe32a0f01324ee087459e112ebb7224f646c0b5023f5e79e9956/httpx-0.28.1.tar.gz", hash = "sha256:75e98c5f16b0f35b567856f597f06ff2270a374470a5c2392242528e3e3e42fc", size = 141406, upload-time = "2024-12-06T15:37:23.222Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/2a/39/e50c7c3a983047577ee07d2a9e53faf5a69493943ec3f6a384bdc792deb2/httpx-0.28.1-py3-none-any.whl", hash = "sha256:d909fcccc110f8c7faf814ca82a9a4d816bc5a6dbfea25d6591d6985b8ba59ad", size = 73517 }, + { url = "https://files.pythonhosted.org/packages/2a/39/e50c7c3a983047577ee07d2a9e53faf5a69493943ec3f6a384bdc792deb2/httpx-0.28.1-py3-none-any.whl", hash = "sha256:d909fcccc110f8c7faf814ca82a9a4d816bc5a6dbfea25d6591d6985b8ba59ad", size = 73517, upload-time = "2024-12-06T15:37:21.509Z" }, ] [[package]] @@ -692,27 +693,27 @@ source = { registry = "https://pypi.org/simple" } dependencies = [ { name = "requests" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/48/a4/c0b698a7250b7a5c2956427406560701862215c646e079a7907846608f44/hvac-2.3.0.tar.gz", hash = "sha256:1b85e3320e8642dd82f234db63253cda169a817589e823713dc5fca83119b1e2", size = 332660 } +sdist = { url = "https://files.pythonhosted.org/packages/48/a4/c0b698a7250b7a5c2956427406560701862215c646e079a7907846608f44/hvac-2.3.0.tar.gz", hash = "sha256:1b85e3320e8642dd82f234db63253cda169a817589e823713dc5fca83119b1e2", size = 332660, upload-time = "2024-06-18T14:46:09.748Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/0b/34/56facf52e2ea14ce640f434ccf00311af6f3a1df0019d4682ba28ea09948/hvac-2.3.0-py3-none-any.whl", hash = "sha256:a3afc5710760b6ee9b3571769df87a0333da45da05a5f9f963e1d3925a84be7d", size = 155860 }, + { url = "https://files.pythonhosted.org/packages/0b/34/56facf52e2ea14ce640f434ccf00311af6f3a1df0019d4682ba28ea09948/hvac-2.3.0-py3-none-any.whl", hash = "sha256:a3afc5710760b6ee9b3571769df87a0333da45da05a5f9f963e1d3925a84be7d", size = 155860, upload-time = "2024-06-18T14:46:05.399Z" }, ] [[package]] name = "idna" version = "3.10" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/f1/70/7703c29685631f5a7590aa73f1f1d3fa9a380e654b86af429e0934a32f7d/idna-3.10.tar.gz", hash = "sha256:12f65c9b470abda6dc35cf8e63cc574b1c52b11df2c86030af0ac09b01b13ea9", size = 190490 } +sdist = { url = "https://files.pythonhosted.org/packages/f1/70/7703c29685631f5a7590aa73f1f1d3fa9a380e654b86af429e0934a32f7d/idna-3.10.tar.gz", hash = "sha256:12f65c9b470abda6dc35cf8e63cc574b1c52b11df2c86030af0ac09b01b13ea9", size = 190490, upload-time = "2024-09-15T18:07:39.745Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/76/c6/c88e154df9c4e1a2a66ccf0005a88dfb2650c1dffb6f5ce603dfbd452ce3/idna-3.10-py3-none-any.whl", hash = "sha256:946d195a0d259cbba61165e88e65941f16e9b36ea6ddb97f00452bae8b1287d3", size = 70442 }, + { url = "https://files.pythonhosted.org/packages/76/c6/c88e154df9c4e1a2a66ccf0005a88dfb2650c1dffb6f5ce603dfbd452ce3/idna-3.10-py3-none-any.whl", hash = "sha256:946d195a0d259cbba61165e88e65941f16e9b36ea6ddb97f00452bae8b1287d3", size = 70442, upload-time = "2024-09-15T18:07:37.964Z" }, ] [[package]] name = "imagesize" version = "1.4.1" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/a7/84/62473fb57d61e31fef6e36d64a179c8781605429fd927b5dd608c997be31/imagesize-1.4.1.tar.gz", hash = "sha256:69150444affb9cb0d5cc5a92b3676f0b2fb7cd9ae39e947a5e11a36b4497cd4a", size = 1280026 } +sdist = { url = "https://files.pythonhosted.org/packages/a7/84/62473fb57d61e31fef6e36d64a179c8781605429fd927b5dd608c997be31/imagesize-1.4.1.tar.gz", hash = "sha256:69150444affb9cb0d5cc5a92b3676f0b2fb7cd9ae39e947a5e11a36b4497cd4a", size = 1280026, upload-time = "2022-07-01T12:21:05.687Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/ff/62/85c4c919272577931d407be5ba5d71c20f0b616d31a0befe0ae45bb79abd/imagesize-1.4.1-py2.py3-none-any.whl", hash = "sha256:0d8d18d08f840c19d0ee7ca1fd82490fdc3729b7ac93f49870406ddde8ef8d8b", size = 8769 }, + { url = "https://files.pythonhosted.org/packages/ff/62/85c4c919272577931d407be5ba5d71c20f0b616d31a0befe0ae45bb79abd/imagesize-1.4.1-py2.py3-none-any.whl", hash = "sha256:0d8d18d08f840c19d0ee7ca1fd82490fdc3729b7ac93f49870406ddde8ef8d8b", size = 8769, upload-time = "2022-07-01T12:21:02.467Z" }, ] [[package]] @@ -722,18 +723,18 @@ source = { registry = "https://pypi.org/simple" } dependencies = [ { name = "zipp" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/76/66/650a33bd90f786193e4de4b3ad86ea60b53c89b669a5c7be931fac31cdb0/importlib_metadata-8.7.0.tar.gz", hash = "sha256:d13b81ad223b890aa16c5471f2ac3056cf76c5f10f82d6f9292f0b415f389000", size = 56641 } +sdist = { url = "https://files.pythonhosted.org/packages/76/66/650a33bd90f786193e4de4b3ad86ea60b53c89b669a5c7be931fac31cdb0/importlib_metadata-8.7.0.tar.gz", hash = "sha256:d13b81ad223b890aa16c5471f2ac3056cf76c5f10f82d6f9292f0b415f389000", size = 56641, upload-time = "2025-04-27T15:29:01.736Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/20/b0/36bd937216ec521246249be3bf9855081de4c5e06a0c9b4219dbeda50373/importlib_metadata-8.7.0-py3-none-any.whl", hash = "sha256:e5dd1551894c77868a30651cef00984d50e1002d06942a7101d34870c5f02afd", size = 27656 }, + { url = "https://files.pythonhosted.org/packages/20/b0/36bd937216ec521246249be3bf9855081de4c5e06a0c9b4219dbeda50373/importlib_metadata-8.7.0-py3-none-any.whl", hash = "sha256:e5dd1551894c77868a30651cef00984d50e1002d06942a7101d34870c5f02afd", size = 27656, upload-time = "2025-04-27T15:29:00.214Z" }, ] [[package]] name = "iniconfig" version = "2.1.0" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/f2/97/ebf4da567aa6827c909642694d71c9fcf53e5b504f2d96afea02718862f3/iniconfig-2.1.0.tar.gz", hash = "sha256:3abbd2e30b36733fee78f9c7f7308f2d0050e88f0087fd25c2645f63c773e1c7", size = 4793 } +sdist = { url = "https://files.pythonhosted.org/packages/f2/97/ebf4da567aa6827c909642694d71c9fcf53e5b504f2d96afea02718862f3/iniconfig-2.1.0.tar.gz", hash = "sha256:3abbd2e30b36733fee78f9c7f7308f2d0050e88f0087fd25c2645f63c773e1c7", size = 4793, upload-time = "2025-03-19T20:09:59.721Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/2c/e1/e6716421ea10d38022b952c159d5161ca1193197fb744506875fbb87ea7b/iniconfig-2.1.0-py3-none-any.whl", hash = "sha256:9deba5723312380e77435581c6bf4935c94cbfab9b1ed33ef8d238ea168eb760", size = 6050 }, + { url = "https://files.pythonhosted.org/packages/2c/e1/e6716421ea10d38022b952c159d5161ca1193197fb744506875fbb87ea7b/iniconfig-2.1.0-py3-none-any.whl", hash = "sha256:9deba5723312380e77435581c6bf4935c94cbfab9b1ed33ef8d238ea168eb760", size = 6050, upload-time = "2025-03-19T20:10:01.071Z" }, ] [[package]] @@ -746,9 +747,9 @@ dependencies = [ { name = "ipython", version = "9.3.0", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version >= '3.11'" }, { name = "tomli", marker = "python_full_version < '3.11'" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/3d/1b/7e07e7b752017f7693a0f4d41c13e5ca29ce8cbcfdcc1fd6c4ad8c0a27a0/ipdb-0.13.13.tar.gz", hash = "sha256:e3ac6018ef05126d442af680aad863006ec19d02290561ac88b8b1c0b0cfc726", size = 17042 } +sdist = { url = "https://files.pythonhosted.org/packages/3d/1b/7e07e7b752017f7693a0f4d41c13e5ca29ce8cbcfdcc1fd6c4ad8c0a27a0/ipdb-0.13.13.tar.gz", hash = "sha256:e3ac6018ef05126d442af680aad863006ec19d02290561ac88b8b1c0b0cfc726", size = 17042, upload-time = "2023-03-09T15:40:57.487Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/0c/4c/b075da0092003d9a55cf2ecc1cae9384a1ca4f650d51b00fc59875fe76f6/ipdb-0.13.13-py3-none-any.whl", hash = "sha256:45529994741c4ab6d2388bfa5d7b725c2cf7fe9deffabdb8a6113aa5ed449ed4", size = 12130 }, + { url = "https://files.pythonhosted.org/packages/0c/4c/b075da0092003d9a55cf2ecc1cae9384a1ca4f650d51b00fc59875fe76f6/ipdb-0.13.13-py3-none-any.whl", hash = "sha256:45529994741c4ab6d2388bfa5d7b725c2cf7fe9deffabdb8a6113aa5ed449ed4", size = 12130, upload-time = "2023-03-09T15:40:55.021Z" }, ] [[package]] @@ -771,9 +772,9 @@ dependencies = [ { name = "traitlets", marker = "python_full_version < '3.11'" }, { name = "typing-extensions", marker = "python_full_version < '3.11'" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/85/31/10ac88f3357fc276dc8a64e8880c82e80e7459326ae1d0a211b40abf6665/ipython-8.37.0.tar.gz", hash = "sha256:ca815841e1a41a1e6b73a0b08f3038af9b2252564d01fc405356d34033012216", size = 5606088 } +sdist = { url = "https://files.pythonhosted.org/packages/85/31/10ac88f3357fc276dc8a64e8880c82e80e7459326ae1d0a211b40abf6665/ipython-8.37.0.tar.gz", hash = "sha256:ca815841e1a41a1e6b73a0b08f3038af9b2252564d01fc405356d34033012216", size = 5606088, upload-time = "2025-05-31T16:39:09.613Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/91/d0/274fbf7b0b12643cbbc001ce13e6a5b1607ac4929d1b11c72460152c9fc3/ipython-8.37.0-py3-none-any.whl", hash = "sha256:ed87326596b878932dbcb171e3e698845434d8c61b8d8cd474bf663041a9dcf2", size = 831864 }, + { url = "https://files.pythonhosted.org/packages/91/d0/274fbf7b0b12643cbbc001ce13e6a5b1607ac4929d1b11c72460152c9fc3/ipython-8.37.0-py3-none-any.whl", hash = "sha256:ed87326596b878932dbcb171e3e698845434d8c61b8d8cd474bf663041a9dcf2", size = 831864, upload-time = "2025-05-31T16:39:06.38Z" }, ] [[package]] @@ -796,9 +797,9 @@ dependencies = [ { name = "traitlets", marker = "python_full_version >= '3.11'" }, { name = "typing-extensions", marker = "python_full_version == '3.11.*'" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/dc/09/4c7e06b96fbd203e06567b60fb41b06db606b6a82db6db7b2c85bb72a15c/ipython-9.3.0.tar.gz", hash = "sha256:79eb896f9f23f50ad16c3bc205f686f6e030ad246cc309c6279a242b14afe9d8", size = 4426460 } +sdist = { url = "https://files.pythonhosted.org/packages/dc/09/4c7e06b96fbd203e06567b60fb41b06db606b6a82db6db7b2c85bb72a15c/ipython-9.3.0.tar.gz", hash = "sha256:79eb896f9f23f50ad16c3bc205f686f6e030ad246cc309c6279a242b14afe9d8", size = 4426460, upload-time = "2025-05-31T16:34:55.678Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/3c/99/9ed3d52d00f1846679e3aa12e2326ac7044b5e7f90dc822b60115fa533ca/ipython-9.3.0-py3-none-any.whl", hash = "sha256:1a0b6dd9221a1f5dddf725b57ac0cb6fddc7b5f470576231ae9162b9b3455a04", size = 605320 }, + { url = "https://files.pythonhosted.org/packages/3c/99/9ed3d52d00f1846679e3aa12e2326ac7044b5e7f90dc822b60115fa533ca/ipython-9.3.0-py3-none-any.whl", hash = "sha256:1a0b6dd9221a1f5dddf725b57ac0cb6fddc7b5f470576231ae9162b9b3455a04", size = 605320, upload-time = "2025-05-31T16:34:52.154Z" }, ] [[package]] @@ -808,9 +809,9 @@ source = { registry = "https://pypi.org/simple" } dependencies = [ { name = "pygments", marker = "python_full_version >= '3.11'" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/ef/4c/5dd1d8af08107f88c7f741ead7a40854b8ac24ddf9ae850afbcf698aa552/ipython_pygments_lexers-1.1.1.tar.gz", hash = "sha256:09c0138009e56b6854f9535736f4171d855c8c08a563a0dcd8022f78355c7e81", size = 8393 } +sdist = { url = "https://files.pythonhosted.org/packages/ef/4c/5dd1d8af08107f88c7f741ead7a40854b8ac24ddf9ae850afbcf698aa552/ipython_pygments_lexers-1.1.1.tar.gz", hash = "sha256:09c0138009e56b6854f9535736f4171d855c8c08a563a0dcd8022f78355c7e81", size = 8393, upload-time = "2025-01-17T11:24:34.505Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/d9/33/1f075bf72b0b747cb3288d011319aaf64083cf2efef8354174e3ed4540e2/ipython_pygments_lexers-1.1.1-py3-none-any.whl", hash = "sha256:a9462224a505ade19a605f71f8fa63c2048833ce50abc86768a0d81d876dc81c", size = 8074 }, + { url = "https://files.pythonhosted.org/packages/d9/33/1f075bf72b0b747cb3288d011319aaf64083cf2efef8354174e3ed4540e2/ipython_pygments_lexers-1.1.1-py3-none-any.whl", hash = "sha256:a9462224a505ade19a605f71f8fa63c2048833ce50abc86768a0d81d876dc81c", size = 8074, upload-time = "2025-01-17T11:24:33.271Z" }, ] [[package]] @@ -820,9 +821,9 @@ source = { registry = "https://pypi.org/simple" } dependencies = [ { name = "parso" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/72/3a/79a912fbd4d8dd6fbb02bf69afd3bb72cf0c729bb3063c6f4498603db17a/jedi-0.19.2.tar.gz", hash = "sha256:4770dc3de41bde3966b02eb84fbcf557fb33cce26ad23da12c742fb50ecb11f0", size = 1231287 } +sdist = { url = "https://files.pythonhosted.org/packages/72/3a/79a912fbd4d8dd6fbb02bf69afd3bb72cf0c729bb3063c6f4498603db17a/jedi-0.19.2.tar.gz", hash = "sha256:4770dc3de41bde3966b02eb84fbcf557fb33cce26ad23da12c742fb50ecb11f0", size = 1231287, upload-time = "2024-11-11T01:41:42.873Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/c0/5a/9cac0c82afec3d09ccd97c8b6502d48f165f9124db81b4bcb90b4af974ee/jedi-0.19.2-py2.py3-none-any.whl", hash = "sha256:a8ef22bde8490f57fe5c7681a3c83cb58874daf72b4784de3cce5b6ef6edb5b9", size = 1572278 }, + { url = "https://files.pythonhosted.org/packages/c0/5a/9cac0c82afec3d09ccd97c8b6502d48f165f9124db81b4bcb90b4af974ee/jedi-0.19.2-py2.py3-none-any.whl", hash = "sha256:a8ef22bde8490f57fe5c7681a3c83cb58874daf72b4784de3cce5b6ef6edb5b9", size = 1572278, upload-time = "2024-11-11T01:41:40.175Z" }, ] [[package]] @@ -832,9 +833,9 @@ source = { registry = "https://pypi.org/simple" } dependencies = [ { name = "markupsafe" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/df/bf/f7da0350254c0ed7c72f3e33cef02e048281fec7ecec5f032d4aac52226b/jinja2-3.1.6.tar.gz", hash = "sha256:0137fb05990d35f1275a587e9aee6d56da821fc83491a0fb838183be43f66d6d", size = 245115 } +sdist = { url = "https://files.pythonhosted.org/packages/df/bf/f7da0350254c0ed7c72f3e33cef02e048281fec7ecec5f032d4aac52226b/jinja2-3.1.6.tar.gz", hash = "sha256:0137fb05990d35f1275a587e9aee6d56da821fc83491a0fb838183be43f66d6d", size = 245115, upload-time = "2025-03-05T20:05:02.478Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/62/a1/3d680cbfd5f4b8f15abc1d571870c5fc3e594bb582bc3b64ea099db13e56/jinja2-3.1.6-py3-none-any.whl", hash = "sha256:85ece4451f492d0c13c5dd7c13a64681a86afae63a5f347908daf103ce6d2f67", size = 134899 }, + { url = "https://files.pythonhosted.org/packages/62/a1/3d680cbfd5f4b8f15abc1d571870c5fc3e594bb582bc3b64ea099db13e56/jinja2-3.1.6-py3-none-any.whl", hash = "sha256:85ece4451f492d0c13c5dd7c13a64681a86afae63a5f347908daf103ce6d2f67", size = 134899, upload-time = "2025-03-05T20:05:00.369Z" }, ] [[package]] @@ -844,18 +845,18 @@ source = { registry = "https://pypi.org/simple" } dependencies = [ { name = "jsonpointer" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/42/78/18813351fe5d63acad16aec57f94ec2b70a09e53ca98145589e185423873/jsonpatch-1.33.tar.gz", hash = "sha256:9fcd4009c41e6d12348b4a0ff2563ba56a2923a7dfee731d004e212e1ee5030c", size = 21699 } +sdist = { url = "https://files.pythonhosted.org/packages/42/78/18813351fe5d63acad16aec57f94ec2b70a09e53ca98145589e185423873/jsonpatch-1.33.tar.gz", hash = "sha256:9fcd4009c41e6d12348b4a0ff2563ba56a2923a7dfee731d004e212e1ee5030c", size = 21699, upload-time = "2023-06-26T12:07:29.144Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/73/07/02e16ed01e04a374e644b575638ec7987ae846d25ad97bcc9945a3ee4b0e/jsonpatch-1.33-py2.py3-none-any.whl", hash = "sha256:0ae28c0cd062bbd8b8ecc26d7d164fbbea9652a1a3693f3b956c1eae5145dade", size = 12898 }, + { url = "https://files.pythonhosted.org/packages/73/07/02e16ed01e04a374e644b575638ec7987ae846d25ad97bcc9945a3ee4b0e/jsonpatch-1.33-py2.py3-none-any.whl", hash = "sha256:0ae28c0cd062bbd8b8ecc26d7d164fbbea9652a1a3693f3b956c1eae5145dade", size = 12898, upload-time = "2023-06-16T21:01:28.466Z" }, ] [[package]] name = "jsonpointer" version = "3.0.0" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/6a/0a/eebeb1fa92507ea94016a2a790b93c2ae41a7e18778f85471dc54475ed25/jsonpointer-3.0.0.tar.gz", hash = "sha256:2b2d729f2091522d61c3b31f82e11870f60b68f43fbc705cb76bf4b832af59ef", size = 9114 } +sdist = { url = "https://files.pythonhosted.org/packages/6a/0a/eebeb1fa92507ea94016a2a790b93c2ae41a7e18778f85471dc54475ed25/jsonpointer-3.0.0.tar.gz", hash = "sha256:2b2d729f2091522d61c3b31f82e11870f60b68f43fbc705cb76bf4b832af59ef", size = 9114, upload-time = "2024-06-10T19:24:42.462Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/71/92/5e77f98553e9e75130c78900d000368476aed74276eb8ae8796f65f00918/jsonpointer-3.0.0-py2.py3-none-any.whl", hash = "sha256:13e088adc14fca8b6aa8177c044e12701e6ad4b28ff10e65f2267a90109c9942", size = 7595 }, + { url = "https://files.pythonhosted.org/packages/71/92/5e77f98553e9e75130c78900d000368476aed74276eb8ae8796f65f00918/jsonpointer-3.0.0-py2.py3-none-any.whl", hash = "sha256:13e088adc14fca8b6aa8177c044e12701e6ad4b28ff10e65f2267a90109c9942", size = 7595, upload-time = "2024-06-10T19:24:40.698Z" }, ] [[package]] @@ -865,9 +866,9 @@ source = { registry = "https://pypi.org/simple" } dependencies = [ { name = "pyyaml" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/e3/2a/6f01a32b2821cfbdb4c4a1506a845ead11fbb3099568c40be0f40791254f/jubilant-1.2.0.tar.gz", hash = "sha256:966c2aef620ecaac84655fed2d179cfe4407ada08cf028c57a88116cec9fcc16", size = 24490 } +sdist = { url = "https://files.pythonhosted.org/packages/e3/2a/6f01a32b2821cfbdb4c4a1506a845ead11fbb3099568c40be0f40791254f/jubilant-1.2.0.tar.gz", hash = "sha256:966c2aef620ecaac84655fed2d179cfe4407ada08cf028c57a88116cec9fcc16", size = 24490, upload-time = "2025-06-12T01:22:38.953Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/b8/f8/9facac17df370d13eb701ff5bb5c132716f2034181aa51bfac103154c08d/jubilant-1.2.0-py3-none-any.whl", hash = "sha256:a43833e7c4d88ea6709a179d9ea5856a233beca9788479f533acdb1c1ab2a707", size = 23700 }, + { url = "https://files.pythonhosted.org/packages/b8/f8/9facac17df370d13eb701ff5bb5c132716f2034181aa51bfac103154c08d/jubilant-1.2.0-py3-none-any.whl", hash = "sha256:a43833e7c4d88ea6709a179d9ea5856a233beca9788479f533acdb1c1ab2a707", size = 23700, upload-time = "2025-06-12T01:22:37.409Z" }, ] [[package]] @@ -889,7 +890,7 @@ dependencies = [ { name = "typing-inspect" }, { name = "websockets" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/27/c8/8166486f28f470ea0af062b7494d9a33b5ee471cc6bceb4547d7b5638fd3/juju-3.6.1.2.tar.gz", hash = "sha256:01ff58b8590b2ea19ace024c124a29d470c9e38431f5a9688ef990eef2b86889", size = 304682 } +sdist = { url = "https://files.pythonhosted.org/packages/27/c8/8166486f28f470ea0af062b7494d9a33b5ee471cc6bceb4547d7b5638fd3/juju-3.6.1.2.tar.gz", hash = "sha256:01ff58b8590b2ea19ace024c124a29d470c9e38431f5a9688ef990eef2b86889", size = 304682, upload-time = "2025-05-26T00:50:03.326Z" } [[package]] name = "kubernetes" @@ -907,9 +908,9 @@ dependencies = [ { name = "urllib3" }, { name = "websocket-client" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/82/3c/9f29f6cab7f35df8e54f019e5719465fa97b877be2454e99f989270b4f34/kubernetes-30.1.0.tar.gz", hash = "sha256:41e4c77af9f28e7a6c314e3bd06a8c6229ddd787cad684e0ab9f69b498e98ebc", size = 887810 } +sdist = { url = "https://files.pythonhosted.org/packages/82/3c/9f29f6cab7f35df8e54f019e5719465fa97b877be2454e99f989270b4f34/kubernetes-30.1.0.tar.gz", hash = "sha256:41e4c77af9f28e7a6c314e3bd06a8c6229ddd787cad684e0ab9f69b498e98ebc", size = 887810, upload-time = "2024-06-06T15:58:30.031Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/62/a1/2027ddede72d33be2effc087580aeba07e733a7360780ae87226f1f91bd8/kubernetes-30.1.0-py2.py3-none-any.whl", hash = "sha256:e212e8b7579031dd2e512168b617373bc1e03888d41ac4e04039240a292d478d", size = 1706042 }, + { url = "https://files.pythonhosted.org/packages/62/a1/2027ddede72d33be2effc087580aeba07e733a7360780ae87226f1f91bd8/kubernetes-30.1.0-py2.py3-none-any.whl", hash = "sha256:e212e8b7579031dd2e512168b617373bc1e03888d41ac4e04039240a292d478d", size = 1706042, upload-time = "2024-06-06T15:58:27.13Z" }, ] [[package]] @@ -919,91 +920,91 @@ source = { registry = "https://pypi.org/simple" } dependencies = [ { name = "uc-micro-py" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/2a/ae/bb56c6828e4797ba5a4821eec7c43b8bf40f69cda4d4f5f8c8a2810ec96a/linkify-it-py-2.0.3.tar.gz", hash = "sha256:68cda27e162e9215c17d786649d1da0021a451bdc436ef9e0fa0ba5234b9b048", size = 27946 } +sdist = { url = "https://files.pythonhosted.org/packages/2a/ae/bb56c6828e4797ba5a4821eec7c43b8bf40f69cda4d4f5f8c8a2810ec96a/linkify-it-py-2.0.3.tar.gz", hash = "sha256:68cda27e162e9215c17d786649d1da0021a451bdc436ef9e0fa0ba5234b9b048", size = 27946, upload-time = "2024-02-04T14:48:04.179Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/04/1e/b832de447dee8b582cac175871d2f6c3d5077cc56d5575cadba1fd1cccfa/linkify_it_py-2.0.3-py3-none-any.whl", hash = "sha256:6bcbc417b0ac14323382aef5c5192c0075bf8a9d6b41820a2b66371eac6b6d79", size = 19820 }, + { url = "https://files.pythonhosted.org/packages/04/1e/b832de447dee8b582cac175871d2f6c3d5077cc56d5575cadba1fd1cccfa/linkify_it_py-2.0.3-py3-none-any.whl", hash = "sha256:6bcbc417b0ac14323382aef5c5192c0075bf8a9d6b41820a2b66371eac6b6d79", size = 19820, upload-time = "2024-02-04T14:48:02.496Z" }, ] [[package]] name = "lxml" version = "5.4.0" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/76/3d/14e82fc7c8fb1b7761f7e748fd47e2ec8276d137b6acfe5a4bb73853e08f/lxml-5.4.0.tar.gz", hash = "sha256:d12832e1dbea4be280b22fd0ea7c9b87f0d8fc51ba06e92dc62d52f804f78ebd", size = 3679479 } -wheels = [ - { url = "https://files.pythonhosted.org/packages/f5/1f/a3b6b74a451ceb84b471caa75c934d2430a4d84395d38ef201d539f38cd1/lxml-5.4.0-cp310-cp310-macosx_10_9_universal2.whl", hash = "sha256:e7bc6df34d42322c5289e37e9971d6ed114e3776b45fa879f734bded9d1fea9c", size = 8076838 }, - { url = "https://files.pythonhosted.org/packages/36/af/a567a55b3e47135b4d1f05a1118c24529104c003f95851374b3748139dc1/lxml-5.4.0-cp310-cp310-macosx_10_9_x86_64.whl", hash = "sha256:6854f8bd8a1536f8a1d9a3655e6354faa6406621cf857dc27b681b69860645c7", size = 4381827 }, - { url = "https://files.pythonhosted.org/packages/50/ba/4ee47d24c675932b3eb5b6de77d0f623c2db6dc466e7a1f199792c5e3e3a/lxml-5.4.0-cp310-cp310-manylinux_2_12_i686.manylinux2010_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:696ea9e87442467819ac22394ca36cb3d01848dad1be6fac3fb612d3bd5a12cf", size = 5204098 }, - { url = "https://files.pythonhosted.org/packages/f2/0f/b4db6dfebfefe3abafe360f42a3d471881687fd449a0b86b70f1f2683438/lxml-5.4.0-cp310-cp310-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:6ef80aeac414f33c24b3815ecd560cee272786c3adfa5f31316d8b349bfade28", size = 4930261 }, - { url = "https://files.pythonhosted.org/packages/0b/1f/0bb1bae1ce056910f8db81c6aba80fec0e46c98d77c0f59298c70cd362a3/lxml-5.4.0-cp310-cp310-manylinux_2_17_ppc64le.manylinux2014_ppc64le.whl", hash = "sha256:3b9c2754cef6963f3408ab381ea55f47dabc6f78f4b8ebb0f0b25cf1ac1f7609", size = 5529621 }, - { url = "https://files.pythonhosted.org/packages/21/f5/e7b66a533fc4a1e7fa63dd22a1ab2ec4d10319b909211181e1ab3e539295/lxml-5.4.0-cp310-cp310-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:7a62cc23d754bb449d63ff35334acc9f5c02e6dae830d78dab4dd12b78a524f4", size = 4983231 }, - { url = "https://files.pythonhosted.org/packages/11/39/a38244b669c2d95a6a101a84d3c85ba921fea827e9e5483e93168bf1ccb2/lxml-5.4.0-cp310-cp310-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:8f82125bc7203c5ae8633a7d5d20bcfdff0ba33e436e4ab0abc026a53a8960b7", size = 5084279 }, - { url = "https://files.pythonhosted.org/packages/db/64/48cac242347a09a07740d6cee7b7fd4663d5c1abd65f2e3c60420e231b27/lxml-5.4.0-cp310-cp310-manylinux_2_28_aarch64.whl", hash = "sha256:b67319b4aef1a6c56576ff544b67a2a6fbd7eaee485b241cabf53115e8908b8f", size = 4927405 }, - { url = "https://files.pythonhosted.org/packages/98/89/97442835fbb01d80b72374f9594fe44f01817d203fa056e9906128a5d896/lxml-5.4.0-cp310-cp310-manylinux_2_28_ppc64le.whl", hash = "sha256:a8ef956fce64c8551221f395ba21d0724fed6b9b6242ca4f2f7beb4ce2f41997", size = 5550169 }, - { url = "https://files.pythonhosted.org/packages/f1/97/164ca398ee654eb21f29c6b582685c6c6b9d62d5213abc9b8380278e9c0a/lxml-5.4.0-cp310-cp310-manylinux_2_28_s390x.whl", hash = "sha256:0a01ce7d8479dce84fc03324e3b0c9c90b1ece9a9bb6a1b6c9025e7e4520e78c", size = 5062691 }, - { url = "https://files.pythonhosted.org/packages/d0/bc/712b96823d7feb53482d2e4f59c090fb18ec7b0d0b476f353b3085893cda/lxml-5.4.0-cp310-cp310-manylinux_2_28_x86_64.whl", hash = "sha256:91505d3ddebf268bb1588eb0f63821f738d20e1e7f05d3c647a5ca900288760b", size = 5133503 }, - { url = "https://files.pythonhosted.org/packages/d4/55/a62a39e8f9da2a8b6002603475e3c57c870cd9c95fd4b94d4d9ac9036055/lxml-5.4.0-cp310-cp310-musllinux_1_2_aarch64.whl", hash = "sha256:a3bcdde35d82ff385f4ede021df801b5c4a5bcdfb61ea87caabcebfc4945dc1b", size = 4999346 }, - { url = "https://files.pythonhosted.org/packages/ea/47/a393728ae001b92bb1a9e095e570bf71ec7f7fbae7688a4792222e56e5b9/lxml-5.4.0-cp310-cp310-musllinux_1_2_ppc64le.whl", hash = "sha256:aea7c06667b987787c7d1f5e1dfcd70419b711cdb47d6b4bb4ad4b76777a0563", size = 5627139 }, - { url = "https://files.pythonhosted.org/packages/5e/5f/9dcaaad037c3e642a7ea64b479aa082968de46dd67a8293c541742b6c9db/lxml-5.4.0-cp310-cp310-musllinux_1_2_s390x.whl", hash = "sha256:a7fb111eef4d05909b82152721a59c1b14d0f365e2be4c742a473c5d7372f4f5", size = 5465609 }, - { url = "https://files.pythonhosted.org/packages/a7/0a/ebcae89edf27e61c45023005171d0ba95cb414ee41c045ae4caf1b8487fd/lxml-5.4.0-cp310-cp310-musllinux_1_2_x86_64.whl", hash = "sha256:43d549b876ce64aa18b2328faff70f5877f8c6dede415f80a2f799d31644d776", size = 5192285 }, - { url = "https://files.pythonhosted.org/packages/42/ad/cc8140ca99add7d85c92db8b2354638ed6d5cc0e917b21d36039cb15a238/lxml-5.4.0-cp310-cp310-win32.whl", hash = "sha256:75133890e40d229d6c5837b0312abbe5bac1c342452cf0e12523477cd3aa21e7", size = 3477507 }, - { url = "https://files.pythonhosted.org/packages/e9/39/597ce090da1097d2aabd2f9ef42187a6c9c8546d67c419ce61b88b336c85/lxml-5.4.0-cp310-cp310-win_amd64.whl", hash = "sha256:de5b4e1088523e2b6f730d0509a9a813355b7f5659d70eb4f319c76beea2e250", size = 3805104 }, - { url = "https://files.pythonhosted.org/packages/81/2d/67693cc8a605a12e5975380d7ff83020dcc759351b5a066e1cced04f797b/lxml-5.4.0-cp311-cp311-macosx_10_9_universal2.whl", hash = "sha256:98a3912194c079ef37e716ed228ae0dcb960992100461b704aea4e93af6b0bb9", size = 8083240 }, - { url = "https://files.pythonhosted.org/packages/73/53/b5a05ab300a808b72e848efd152fe9c022c0181b0a70b8bca1199f1bed26/lxml-5.4.0-cp311-cp311-macosx_10_9_x86_64.whl", hash = "sha256:0ea0252b51d296a75f6118ed0d8696888e7403408ad42345d7dfd0d1e93309a7", size = 4387685 }, - { url = "https://files.pythonhosted.org/packages/d8/cb/1a3879c5f512bdcd32995c301886fe082b2edd83c87d41b6d42d89b4ea4d/lxml-5.4.0-cp311-cp311-manylinux_2_12_i686.manylinux2010_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:b92b69441d1bd39f4940f9eadfa417a25862242ca2c396b406f9272ef09cdcaa", size = 4991164 }, - { url = "https://files.pythonhosted.org/packages/f9/94/bbc66e42559f9d04857071e3b3d0c9abd88579367fd2588a4042f641f57e/lxml-5.4.0-cp311-cp311-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:20e16c08254b9b6466526bc1828d9370ee6c0d60a4b64836bc3ac2917d1e16df", size = 4746206 }, - { url = "https://files.pythonhosted.org/packages/66/95/34b0679bee435da2d7cae895731700e519a8dfcab499c21662ebe671603e/lxml-5.4.0-cp311-cp311-manylinux_2_17_ppc64le.manylinux2014_ppc64le.whl", hash = "sha256:7605c1c32c3d6e8c990dd28a0970a3cbbf1429d5b92279e37fda05fb0c92190e", size = 5342144 }, - { url = "https://files.pythonhosted.org/packages/e0/5d/abfcc6ab2fa0be72b2ba938abdae1f7cad4c632f8d552683ea295d55adfb/lxml-5.4.0-cp311-cp311-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:ecf4c4b83f1ab3d5a7ace10bafcb6f11df6156857a3c418244cef41ca9fa3e44", size = 4825124 }, - { url = "https://files.pythonhosted.org/packages/5a/78/6bd33186c8863b36e084f294fc0a5e5eefe77af95f0663ef33809cc1c8aa/lxml-5.4.0-cp311-cp311-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:0cef4feae82709eed352cd7e97ae062ef6ae9c7b5dbe3663f104cd2c0e8d94ba", size = 4876520 }, - { url = "https://files.pythonhosted.org/packages/3b/74/4d7ad4839bd0fc64e3d12da74fc9a193febb0fae0ba6ebd5149d4c23176a/lxml-5.4.0-cp311-cp311-manylinux_2_28_aarch64.whl", hash = "sha256:df53330a3bff250f10472ce96a9af28628ff1f4efc51ccba351a8820bca2a8ba", size = 4765016 }, - { url = "https://files.pythonhosted.org/packages/24/0d/0a98ed1f2471911dadfc541003ac6dd6879fc87b15e1143743ca20f3e973/lxml-5.4.0-cp311-cp311-manylinux_2_28_ppc64le.whl", hash = "sha256:aefe1a7cb852fa61150fcb21a8c8fcea7b58c4cb11fbe59c97a0a4b31cae3c8c", size = 5362884 }, - { url = "https://files.pythonhosted.org/packages/48/de/d4f7e4c39740a6610f0f6959052b547478107967362e8424e1163ec37ae8/lxml-5.4.0-cp311-cp311-manylinux_2_28_s390x.whl", hash = "sha256:ef5a7178fcc73b7d8c07229e89f8eb45b2908a9238eb90dcfc46571ccf0383b8", size = 4902690 }, - { url = "https://files.pythonhosted.org/packages/07/8c/61763abd242af84f355ca4ef1ee096d3c1b7514819564cce70fd18c22e9a/lxml-5.4.0-cp311-cp311-manylinux_2_28_x86_64.whl", hash = "sha256:d2ed1b3cb9ff1c10e6e8b00941bb2e5bb568b307bfc6b17dffbbe8be5eecba86", size = 4944418 }, - { url = "https://files.pythonhosted.org/packages/f9/c5/6d7e3b63e7e282619193961a570c0a4c8a57fe820f07ca3fe2f6bd86608a/lxml-5.4.0-cp311-cp311-musllinux_1_2_aarch64.whl", hash = "sha256:72ac9762a9f8ce74c9eed4a4e74306f2f18613a6b71fa065495a67ac227b3056", size = 4827092 }, - { url = "https://files.pythonhosted.org/packages/71/4a/e60a306df54680b103348545706a98a7514a42c8b4fbfdcaa608567bb065/lxml-5.4.0-cp311-cp311-musllinux_1_2_ppc64le.whl", hash = "sha256:f5cb182f6396706dc6cc1896dd02b1c889d644c081b0cdec38747573db88a7d7", size = 5418231 }, - { url = "https://files.pythonhosted.org/packages/27/f2/9754aacd6016c930875854f08ac4b192a47fe19565f776a64004aa167521/lxml-5.4.0-cp311-cp311-musllinux_1_2_s390x.whl", hash = "sha256:3a3178b4873df8ef9457a4875703488eb1622632a9cee6d76464b60e90adbfcd", size = 5261798 }, - { url = "https://files.pythonhosted.org/packages/38/a2/0c49ec6941428b1bd4f280650d7b11a0f91ace9db7de32eb7aa23bcb39ff/lxml-5.4.0-cp311-cp311-musllinux_1_2_x86_64.whl", hash = "sha256:e094ec83694b59d263802ed03a8384594fcce477ce484b0cbcd0008a211ca751", size = 4988195 }, - { url = "https://files.pythonhosted.org/packages/7a/75/87a3963a08eafc46a86c1131c6e28a4de103ba30b5ae903114177352a3d7/lxml-5.4.0-cp311-cp311-win32.whl", hash = "sha256:4329422de653cdb2b72afa39b0aa04252fca9071550044904b2e7036d9d97fe4", size = 3474243 }, - { url = "https://files.pythonhosted.org/packages/fa/f9/1f0964c4f6c2be861c50db380c554fb8befbea98c6404744ce243a3c87ef/lxml-5.4.0-cp311-cp311-win_amd64.whl", hash = "sha256:fd3be6481ef54b8cfd0e1e953323b7aa9d9789b94842d0e5b142ef4bb7999539", size = 3815197 }, - { url = "https://files.pythonhosted.org/packages/f8/4c/d101ace719ca6a4ec043eb516fcfcb1b396a9fccc4fcd9ef593df34ba0d5/lxml-5.4.0-cp312-cp312-macosx_10_9_universal2.whl", hash = "sha256:b5aff6f3e818e6bdbbb38e5967520f174b18f539c2b9de867b1e7fde6f8d95a4", size = 8127392 }, - { url = "https://files.pythonhosted.org/packages/11/84/beddae0cec4dd9ddf46abf156f0af451c13019a0fa25d7445b655ba5ccb7/lxml-5.4.0-cp312-cp312-macosx_10_9_x86_64.whl", hash = "sha256:942a5d73f739ad7c452bf739a62a0f83e2578afd6b8e5406308731f4ce78b16d", size = 4415103 }, - { url = "https://files.pythonhosted.org/packages/d0/25/d0d93a4e763f0462cccd2b8a665bf1e4343dd788c76dcfefa289d46a38a9/lxml-5.4.0-cp312-cp312-manylinux_2_12_i686.manylinux2010_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:460508a4b07364d6abf53acaa0a90b6d370fafde5693ef37602566613a9b0779", size = 5024224 }, - { url = "https://files.pythonhosted.org/packages/31/ce/1df18fb8f7946e7f3388af378b1f34fcf253b94b9feedb2cec5969da8012/lxml-5.4.0-cp312-cp312-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:529024ab3a505fed78fe3cc5ddc079464e709f6c892733e3f5842007cec8ac6e", size = 4769913 }, - { url = "https://files.pythonhosted.org/packages/4e/62/f4a6c60ae7c40d43657f552f3045df05118636be1165b906d3423790447f/lxml-5.4.0-cp312-cp312-manylinux_2_17_ppc64le.manylinux2014_ppc64le.whl", hash = "sha256:7ca56ebc2c474e8f3d5761debfd9283b8b18c76c4fc0967b74aeafba1f5647f9", size = 5290441 }, - { url = "https://files.pythonhosted.org/packages/9e/aa/04f00009e1e3a77838c7fc948f161b5d2d5de1136b2b81c712a263829ea4/lxml-5.4.0-cp312-cp312-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:a81e1196f0a5b4167a8dafe3a66aa67c4addac1b22dc47947abd5d5c7a3f24b5", size = 4820165 }, - { url = "https://files.pythonhosted.org/packages/c9/1f/e0b2f61fa2404bf0f1fdf1898377e5bd1b74cc9b2cf2c6ba8509b8f27990/lxml-5.4.0-cp312-cp312-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:00b8686694423ddae324cf614e1b9659c2edb754de617703c3d29ff568448df5", size = 4932580 }, - { url = "https://files.pythonhosted.org/packages/24/a2/8263f351b4ffe0ed3e32ea7b7830f845c795349034f912f490180d88a877/lxml-5.4.0-cp312-cp312-manylinux_2_28_aarch64.whl", hash = "sha256:c5681160758d3f6ac5b4fea370495c48aac0989d6a0f01bb9a72ad8ef5ab75c4", size = 4759493 }, - { url = "https://files.pythonhosted.org/packages/05/00/41db052f279995c0e35c79d0f0fc9f8122d5b5e9630139c592a0b58c71b4/lxml-5.4.0-cp312-cp312-manylinux_2_28_ppc64le.whl", hash = "sha256:2dc191e60425ad70e75a68c9fd90ab284df64d9cd410ba8d2b641c0c45bc006e", size = 5324679 }, - { url = "https://files.pythonhosted.org/packages/1d/be/ee99e6314cdef4587617d3b3b745f9356d9b7dd12a9663c5f3b5734b64ba/lxml-5.4.0-cp312-cp312-manylinux_2_28_s390x.whl", hash = "sha256:67f779374c6b9753ae0a0195a892a1c234ce8416e4448fe1e9f34746482070a7", size = 4890691 }, - { url = "https://files.pythonhosted.org/packages/ad/36/239820114bf1d71f38f12208b9c58dec033cbcf80101cde006b9bde5cffd/lxml-5.4.0-cp312-cp312-manylinux_2_28_x86_64.whl", hash = "sha256:79d5bfa9c1b455336f52343130b2067164040604e41f6dc4d8313867ed540079", size = 4955075 }, - { url = "https://files.pythonhosted.org/packages/d4/e1/1b795cc0b174efc9e13dbd078a9ff79a58728a033142bc6d70a1ee8fc34d/lxml-5.4.0-cp312-cp312-musllinux_1_2_aarch64.whl", hash = "sha256:3d3c30ba1c9b48c68489dc1829a6eede9873f52edca1dda900066542528d6b20", size = 4838680 }, - { url = "https://files.pythonhosted.org/packages/72/48/3c198455ca108cec5ae3662ae8acd7fd99476812fd712bb17f1b39a0b589/lxml-5.4.0-cp312-cp312-musllinux_1_2_ppc64le.whl", hash = "sha256:1af80c6316ae68aded77e91cd9d80648f7dd40406cef73df841aa3c36f6907c8", size = 5391253 }, - { url = "https://files.pythonhosted.org/packages/d6/10/5bf51858971c51ec96cfc13e800a9951f3fd501686f4c18d7d84fe2d6352/lxml-5.4.0-cp312-cp312-musllinux_1_2_s390x.whl", hash = "sha256:4d885698f5019abe0de3d352caf9466d5de2baded00a06ef3f1216c1a58ae78f", size = 5261651 }, - { url = "https://files.pythonhosted.org/packages/2b/11/06710dd809205377da380546f91d2ac94bad9ff735a72b64ec029f706c85/lxml-5.4.0-cp312-cp312-musllinux_1_2_x86_64.whl", hash = "sha256:aea53d51859b6c64e7c51d522c03cc2c48b9b5d6172126854cc7f01aa11f52bc", size = 5024315 }, - { url = "https://files.pythonhosted.org/packages/f5/b0/15b6217834b5e3a59ebf7f53125e08e318030e8cc0d7310355e6edac98ef/lxml-5.4.0-cp312-cp312-win32.whl", hash = "sha256:d90b729fd2732df28130c064aac9bb8aff14ba20baa4aee7bd0795ff1187545f", size = 3486149 }, - { url = "https://files.pythonhosted.org/packages/91/1e/05ddcb57ad2f3069101611bd5f5084157d90861a2ef460bf42f45cced944/lxml-5.4.0-cp312-cp312-win_amd64.whl", hash = "sha256:1dc4ca99e89c335a7ed47d38964abcb36c5910790f9bd106f2a8fa2ee0b909d2", size = 3817095 }, - { url = "https://files.pythonhosted.org/packages/87/cb/2ba1e9dd953415f58548506fa5549a7f373ae55e80c61c9041b7fd09a38a/lxml-5.4.0-cp313-cp313-macosx_10_13_universal2.whl", hash = "sha256:773e27b62920199c6197130632c18fb7ead3257fce1ffb7d286912e56ddb79e0", size = 8110086 }, - { url = "https://files.pythonhosted.org/packages/b5/3e/6602a4dca3ae344e8609914d6ab22e52ce42e3e1638c10967568c5c1450d/lxml-5.4.0-cp313-cp313-macosx_10_13_x86_64.whl", hash = "sha256:ce9c671845de9699904b1e9df95acfe8dfc183f2310f163cdaa91a3535af95de", size = 4404613 }, - { url = "https://files.pythonhosted.org/packages/4c/72/bf00988477d3bb452bef9436e45aeea82bb40cdfb4684b83c967c53909c7/lxml-5.4.0-cp313-cp313-manylinux_2_12_i686.manylinux2010_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:9454b8d8200ec99a224df8854786262b1bd6461f4280064c807303c642c05e76", size = 5012008 }, - { url = "https://files.pythonhosted.org/packages/92/1f/93e42d93e9e7a44b2d3354c462cd784dbaaf350f7976b5d7c3f85d68d1b1/lxml-5.4.0-cp313-cp313-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:cccd007d5c95279e529c146d095f1d39ac05139de26c098166c4beb9374b0f4d", size = 4760915 }, - { url = "https://files.pythonhosted.org/packages/45/0b/363009390d0b461cf9976a499e83b68f792e4c32ecef092f3f9ef9c4ba54/lxml-5.4.0-cp313-cp313-manylinux_2_17_ppc64le.manylinux2014_ppc64le.whl", hash = "sha256:0fce1294a0497edb034cb416ad3e77ecc89b313cff7adbee5334e4dc0d11f422", size = 5283890 }, - { url = "https://files.pythonhosted.org/packages/19/dc/6056c332f9378ab476c88e301e6549a0454dbee8f0ae16847414f0eccb74/lxml-5.4.0-cp313-cp313-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:24974f774f3a78ac12b95e3a20ef0931795ff04dbb16db81a90c37f589819551", size = 4812644 }, - { url = "https://files.pythonhosted.org/packages/ee/8a/f8c66bbb23ecb9048a46a5ef9b495fd23f7543df642dabeebcb2eeb66592/lxml-5.4.0-cp313-cp313-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:497cab4d8254c2a90bf988f162ace2ddbfdd806fce3bda3f581b9d24c852e03c", size = 4921817 }, - { url = "https://files.pythonhosted.org/packages/04/57/2e537083c3f381f83d05d9b176f0d838a9e8961f7ed8ddce3f0217179ce3/lxml-5.4.0-cp313-cp313-manylinux_2_28_aarch64.whl", hash = "sha256:e794f698ae4c5084414efea0f5cc9f4ac562ec02d66e1484ff822ef97c2cadff", size = 4753916 }, - { url = "https://files.pythonhosted.org/packages/d8/80/ea8c4072109a350848f1157ce83ccd9439601274035cd045ac31f47f3417/lxml-5.4.0-cp313-cp313-manylinux_2_28_ppc64le.whl", hash = "sha256:2c62891b1ea3094bb12097822b3d44b93fc6c325f2043c4d2736a8ff09e65f60", size = 5289274 }, - { url = "https://files.pythonhosted.org/packages/b3/47/c4be287c48cdc304483457878a3f22999098b9a95f455e3c4bda7ec7fc72/lxml-5.4.0-cp313-cp313-manylinux_2_28_s390x.whl", hash = "sha256:142accb3e4d1edae4b392bd165a9abdee8a3c432a2cca193df995bc3886249c8", size = 4874757 }, - { url = "https://files.pythonhosted.org/packages/2f/04/6ef935dc74e729932e39478e44d8cfe6a83550552eaa072b7c05f6f22488/lxml-5.4.0-cp313-cp313-manylinux_2_28_x86_64.whl", hash = "sha256:1a42b3a19346e5601d1b8296ff6ef3d76038058f311902edd574461e9c036982", size = 4947028 }, - { url = "https://files.pythonhosted.org/packages/cb/f9/c33fc8daa373ef8a7daddb53175289024512b6619bc9de36d77dca3df44b/lxml-5.4.0-cp313-cp313-musllinux_1_2_aarch64.whl", hash = "sha256:4291d3c409a17febf817259cb37bc62cb7eb398bcc95c1356947e2871911ae61", size = 4834487 }, - { url = "https://files.pythonhosted.org/packages/8d/30/fc92bb595bcb878311e01b418b57d13900f84c2b94f6eca9e5073ea756e6/lxml-5.4.0-cp313-cp313-musllinux_1_2_ppc64le.whl", hash = "sha256:4f5322cf38fe0e21c2d73901abf68e6329dc02a4994e483adbcf92b568a09a54", size = 5381688 }, - { url = "https://files.pythonhosted.org/packages/43/d1/3ba7bd978ce28bba8e3da2c2e9d5ae3f8f521ad3f0ca6ea4788d086ba00d/lxml-5.4.0-cp313-cp313-musllinux_1_2_s390x.whl", hash = "sha256:0be91891bdb06ebe65122aa6bf3fc94489960cf7e03033c6f83a90863b23c58b", size = 5242043 }, - { url = "https://files.pythonhosted.org/packages/ee/cd/95fa2201041a610c4d08ddaf31d43b98ecc4b1d74b1e7245b1abdab443cb/lxml-5.4.0-cp313-cp313-musllinux_1_2_x86_64.whl", hash = "sha256:15a665ad90054a3d4f397bc40f73948d48e36e4c09f9bcffc7d90c87410e478a", size = 5021569 }, - { url = "https://files.pythonhosted.org/packages/2d/a6/31da006fead660b9512d08d23d31e93ad3477dd47cc42e3285f143443176/lxml-5.4.0-cp313-cp313-win32.whl", hash = "sha256:d5663bc1b471c79f5c833cffbc9b87d7bf13f87e055a5c86c363ccd2348d7e82", size = 3485270 }, - { url = "https://files.pythonhosted.org/packages/fc/14/c115516c62a7d2499781d2d3d7215218c0731b2c940753bf9f9b7b73924d/lxml-5.4.0-cp313-cp313-win_amd64.whl", hash = "sha256:bcb7a1096b4b6b24ce1ac24d4942ad98f983cd3810f9711bcd0293f43a9d8b9f", size = 3814606 }, - { url = "https://files.pythonhosted.org/packages/c6/b0/e4d1cbb8c078bc4ae44de9c6a79fec4e2b4151b1b4d50af71d799e76b177/lxml-5.4.0-pp310-pypy310_pp73-macosx_10_15_x86_64.whl", hash = "sha256:1b717b00a71b901b4667226bba282dd462c42ccf618ade12f9ba3674e1fabc55", size = 3892319 }, - { url = "https://files.pythonhosted.org/packages/5b/aa/e2bdefba40d815059bcb60b371a36fbfcce970a935370e1b367ba1cc8f74/lxml-5.4.0-pp310-pypy310_pp73-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:27a9ded0f0b52098ff89dd4c418325b987feed2ea5cc86e8860b0f844285d740", size = 4211614 }, - { url = "https://files.pythonhosted.org/packages/3c/5f/91ff89d1e092e7cfdd8453a939436ac116db0a665e7f4be0cd8e65c7dc5a/lxml-5.4.0-pp310-pypy310_pp73-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:4b7ce10634113651d6f383aa712a194179dcd496bd8c41e191cec2099fa09de5", size = 4306273 }, - { url = "https://files.pythonhosted.org/packages/be/7c/8c3f15df2ca534589717bfd19d1e3482167801caedfa4d90a575facf68a6/lxml-5.4.0-pp310-pypy310_pp73-manylinux_2_28_aarch64.whl", hash = "sha256:53370c26500d22b45182f98847243efb518d268374a9570409d2e2276232fd37", size = 4208552 }, - { url = "https://files.pythonhosted.org/packages/7d/d8/9567afb1665f64d73fc54eb904e418d1138d7f011ed00647121b4dd60b38/lxml-5.4.0-pp310-pypy310_pp73-manylinux_2_28_x86_64.whl", hash = "sha256:c6364038c519dffdbe07e3cf42e6a7f8b90c275d4d1617a69bb59734c1a2d571", size = 4331091 }, - { url = "https://files.pythonhosted.org/packages/f1/ab/fdbbd91d8d82bf1a723ba88ec3e3d76c022b53c391b0c13cad441cdb8f9e/lxml-5.4.0-pp310-pypy310_pp73-win_amd64.whl", hash = "sha256:b12cb6527599808ada9eb2cd6e0e7d3d8f13fe7bbb01c6311255a15ded4c7ab4", size = 3487862 }, +sdist = { url = "https://files.pythonhosted.org/packages/76/3d/14e82fc7c8fb1b7761f7e748fd47e2ec8276d137b6acfe5a4bb73853e08f/lxml-5.4.0.tar.gz", hash = "sha256:d12832e1dbea4be280b22fd0ea7c9b87f0d8fc51ba06e92dc62d52f804f78ebd", size = 3679479, upload-time = "2025-04-23T01:50:29.322Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/f5/1f/a3b6b74a451ceb84b471caa75c934d2430a4d84395d38ef201d539f38cd1/lxml-5.4.0-cp310-cp310-macosx_10_9_universal2.whl", hash = "sha256:e7bc6df34d42322c5289e37e9971d6ed114e3776b45fa879f734bded9d1fea9c", size = 8076838, upload-time = "2025-04-23T01:44:29.325Z" }, + { url = "https://files.pythonhosted.org/packages/36/af/a567a55b3e47135b4d1f05a1118c24529104c003f95851374b3748139dc1/lxml-5.4.0-cp310-cp310-macosx_10_9_x86_64.whl", hash = "sha256:6854f8bd8a1536f8a1d9a3655e6354faa6406621cf857dc27b681b69860645c7", size = 4381827, upload-time = "2025-04-23T01:44:33.345Z" }, + { url = "https://files.pythonhosted.org/packages/50/ba/4ee47d24c675932b3eb5b6de77d0f623c2db6dc466e7a1f199792c5e3e3a/lxml-5.4.0-cp310-cp310-manylinux_2_12_i686.manylinux2010_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:696ea9e87442467819ac22394ca36cb3d01848dad1be6fac3fb612d3bd5a12cf", size = 5204098, upload-time = "2025-04-23T01:44:35.809Z" }, + { url = "https://files.pythonhosted.org/packages/f2/0f/b4db6dfebfefe3abafe360f42a3d471881687fd449a0b86b70f1f2683438/lxml-5.4.0-cp310-cp310-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:6ef80aeac414f33c24b3815ecd560cee272786c3adfa5f31316d8b349bfade28", size = 4930261, upload-time = "2025-04-23T01:44:38.271Z" }, + { url = "https://files.pythonhosted.org/packages/0b/1f/0bb1bae1ce056910f8db81c6aba80fec0e46c98d77c0f59298c70cd362a3/lxml-5.4.0-cp310-cp310-manylinux_2_17_ppc64le.manylinux2014_ppc64le.whl", hash = "sha256:3b9c2754cef6963f3408ab381ea55f47dabc6f78f4b8ebb0f0b25cf1ac1f7609", size = 5529621, upload-time = "2025-04-23T01:44:40.921Z" }, + { url = "https://files.pythonhosted.org/packages/21/f5/e7b66a533fc4a1e7fa63dd22a1ab2ec4d10319b909211181e1ab3e539295/lxml-5.4.0-cp310-cp310-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:7a62cc23d754bb449d63ff35334acc9f5c02e6dae830d78dab4dd12b78a524f4", size = 4983231, upload-time = "2025-04-23T01:44:43.871Z" }, + { url = "https://files.pythonhosted.org/packages/11/39/a38244b669c2d95a6a101a84d3c85ba921fea827e9e5483e93168bf1ccb2/lxml-5.4.0-cp310-cp310-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:8f82125bc7203c5ae8633a7d5d20bcfdff0ba33e436e4ab0abc026a53a8960b7", size = 5084279, upload-time = "2025-04-23T01:44:46.632Z" }, + { url = "https://files.pythonhosted.org/packages/db/64/48cac242347a09a07740d6cee7b7fd4663d5c1abd65f2e3c60420e231b27/lxml-5.4.0-cp310-cp310-manylinux_2_28_aarch64.whl", hash = "sha256:b67319b4aef1a6c56576ff544b67a2a6fbd7eaee485b241cabf53115e8908b8f", size = 4927405, upload-time = "2025-04-23T01:44:49.843Z" }, + { url = "https://files.pythonhosted.org/packages/98/89/97442835fbb01d80b72374f9594fe44f01817d203fa056e9906128a5d896/lxml-5.4.0-cp310-cp310-manylinux_2_28_ppc64le.whl", hash = "sha256:a8ef956fce64c8551221f395ba21d0724fed6b9b6242ca4f2f7beb4ce2f41997", size = 5550169, upload-time = "2025-04-23T01:44:52.791Z" }, + { url = "https://files.pythonhosted.org/packages/f1/97/164ca398ee654eb21f29c6b582685c6c6b9d62d5213abc9b8380278e9c0a/lxml-5.4.0-cp310-cp310-manylinux_2_28_s390x.whl", hash = "sha256:0a01ce7d8479dce84fc03324e3b0c9c90b1ece9a9bb6a1b6c9025e7e4520e78c", size = 5062691, upload-time = "2025-04-23T01:44:56.108Z" }, + { url = "https://files.pythonhosted.org/packages/d0/bc/712b96823d7feb53482d2e4f59c090fb18ec7b0d0b476f353b3085893cda/lxml-5.4.0-cp310-cp310-manylinux_2_28_x86_64.whl", hash = "sha256:91505d3ddebf268bb1588eb0f63821f738d20e1e7f05d3c647a5ca900288760b", size = 5133503, upload-time = "2025-04-23T01:44:59.222Z" }, + { url = "https://files.pythonhosted.org/packages/d4/55/a62a39e8f9da2a8b6002603475e3c57c870cd9c95fd4b94d4d9ac9036055/lxml-5.4.0-cp310-cp310-musllinux_1_2_aarch64.whl", hash = "sha256:a3bcdde35d82ff385f4ede021df801b5c4a5bcdfb61ea87caabcebfc4945dc1b", size = 4999346, upload-time = "2025-04-23T01:45:02.088Z" }, + { url = "https://files.pythonhosted.org/packages/ea/47/a393728ae001b92bb1a9e095e570bf71ec7f7fbae7688a4792222e56e5b9/lxml-5.4.0-cp310-cp310-musllinux_1_2_ppc64le.whl", hash = "sha256:aea7c06667b987787c7d1f5e1dfcd70419b711cdb47d6b4bb4ad4b76777a0563", size = 5627139, upload-time = "2025-04-23T01:45:04.582Z" }, + { url = "https://files.pythonhosted.org/packages/5e/5f/9dcaaad037c3e642a7ea64b479aa082968de46dd67a8293c541742b6c9db/lxml-5.4.0-cp310-cp310-musllinux_1_2_s390x.whl", hash = "sha256:a7fb111eef4d05909b82152721a59c1b14d0f365e2be4c742a473c5d7372f4f5", size = 5465609, upload-time = "2025-04-23T01:45:07.649Z" }, + { url = "https://files.pythonhosted.org/packages/a7/0a/ebcae89edf27e61c45023005171d0ba95cb414ee41c045ae4caf1b8487fd/lxml-5.4.0-cp310-cp310-musllinux_1_2_x86_64.whl", hash = "sha256:43d549b876ce64aa18b2328faff70f5877f8c6dede415f80a2f799d31644d776", size = 5192285, upload-time = "2025-04-23T01:45:10.456Z" }, + { url = "https://files.pythonhosted.org/packages/42/ad/cc8140ca99add7d85c92db8b2354638ed6d5cc0e917b21d36039cb15a238/lxml-5.4.0-cp310-cp310-win32.whl", hash = "sha256:75133890e40d229d6c5837b0312abbe5bac1c342452cf0e12523477cd3aa21e7", size = 3477507, upload-time = "2025-04-23T01:45:12.474Z" }, + { url = "https://files.pythonhosted.org/packages/e9/39/597ce090da1097d2aabd2f9ef42187a6c9c8546d67c419ce61b88b336c85/lxml-5.4.0-cp310-cp310-win_amd64.whl", hash = "sha256:de5b4e1088523e2b6f730d0509a9a813355b7f5659d70eb4f319c76beea2e250", size = 3805104, upload-time = "2025-04-23T01:45:15.104Z" }, + { url = "https://files.pythonhosted.org/packages/81/2d/67693cc8a605a12e5975380d7ff83020dcc759351b5a066e1cced04f797b/lxml-5.4.0-cp311-cp311-macosx_10_9_universal2.whl", hash = "sha256:98a3912194c079ef37e716ed228ae0dcb960992100461b704aea4e93af6b0bb9", size = 8083240, upload-time = "2025-04-23T01:45:18.566Z" }, + { url = "https://files.pythonhosted.org/packages/73/53/b5a05ab300a808b72e848efd152fe9c022c0181b0a70b8bca1199f1bed26/lxml-5.4.0-cp311-cp311-macosx_10_9_x86_64.whl", hash = "sha256:0ea0252b51d296a75f6118ed0d8696888e7403408ad42345d7dfd0d1e93309a7", size = 4387685, upload-time = "2025-04-23T01:45:21.387Z" }, + { url = "https://files.pythonhosted.org/packages/d8/cb/1a3879c5f512bdcd32995c301886fe082b2edd83c87d41b6d42d89b4ea4d/lxml-5.4.0-cp311-cp311-manylinux_2_12_i686.manylinux2010_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:b92b69441d1bd39f4940f9eadfa417a25862242ca2c396b406f9272ef09cdcaa", size = 4991164, upload-time = "2025-04-23T01:45:23.849Z" }, + { url = "https://files.pythonhosted.org/packages/f9/94/bbc66e42559f9d04857071e3b3d0c9abd88579367fd2588a4042f641f57e/lxml-5.4.0-cp311-cp311-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:20e16c08254b9b6466526bc1828d9370ee6c0d60a4b64836bc3ac2917d1e16df", size = 4746206, upload-time = "2025-04-23T01:45:26.361Z" }, + { url = "https://files.pythonhosted.org/packages/66/95/34b0679bee435da2d7cae895731700e519a8dfcab499c21662ebe671603e/lxml-5.4.0-cp311-cp311-manylinux_2_17_ppc64le.manylinux2014_ppc64le.whl", hash = "sha256:7605c1c32c3d6e8c990dd28a0970a3cbbf1429d5b92279e37fda05fb0c92190e", size = 5342144, upload-time = "2025-04-23T01:45:28.939Z" }, + { url = "https://files.pythonhosted.org/packages/e0/5d/abfcc6ab2fa0be72b2ba938abdae1f7cad4c632f8d552683ea295d55adfb/lxml-5.4.0-cp311-cp311-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:ecf4c4b83f1ab3d5a7ace10bafcb6f11df6156857a3c418244cef41ca9fa3e44", size = 4825124, upload-time = "2025-04-23T01:45:31.361Z" }, + { url = "https://files.pythonhosted.org/packages/5a/78/6bd33186c8863b36e084f294fc0a5e5eefe77af95f0663ef33809cc1c8aa/lxml-5.4.0-cp311-cp311-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:0cef4feae82709eed352cd7e97ae062ef6ae9c7b5dbe3663f104cd2c0e8d94ba", size = 4876520, upload-time = "2025-04-23T01:45:34.191Z" }, + { url = "https://files.pythonhosted.org/packages/3b/74/4d7ad4839bd0fc64e3d12da74fc9a193febb0fae0ba6ebd5149d4c23176a/lxml-5.4.0-cp311-cp311-manylinux_2_28_aarch64.whl", hash = "sha256:df53330a3bff250f10472ce96a9af28628ff1f4efc51ccba351a8820bca2a8ba", size = 4765016, upload-time = "2025-04-23T01:45:36.7Z" }, + { url = "https://files.pythonhosted.org/packages/24/0d/0a98ed1f2471911dadfc541003ac6dd6879fc87b15e1143743ca20f3e973/lxml-5.4.0-cp311-cp311-manylinux_2_28_ppc64le.whl", hash = "sha256:aefe1a7cb852fa61150fcb21a8c8fcea7b58c4cb11fbe59c97a0a4b31cae3c8c", size = 5362884, upload-time = "2025-04-23T01:45:39.291Z" }, + { url = "https://files.pythonhosted.org/packages/48/de/d4f7e4c39740a6610f0f6959052b547478107967362e8424e1163ec37ae8/lxml-5.4.0-cp311-cp311-manylinux_2_28_s390x.whl", hash = "sha256:ef5a7178fcc73b7d8c07229e89f8eb45b2908a9238eb90dcfc46571ccf0383b8", size = 4902690, upload-time = "2025-04-23T01:45:42.386Z" }, + { url = "https://files.pythonhosted.org/packages/07/8c/61763abd242af84f355ca4ef1ee096d3c1b7514819564cce70fd18c22e9a/lxml-5.4.0-cp311-cp311-manylinux_2_28_x86_64.whl", hash = "sha256:d2ed1b3cb9ff1c10e6e8b00941bb2e5bb568b307bfc6b17dffbbe8be5eecba86", size = 4944418, upload-time = "2025-04-23T01:45:46.051Z" }, + { url = "https://files.pythonhosted.org/packages/f9/c5/6d7e3b63e7e282619193961a570c0a4c8a57fe820f07ca3fe2f6bd86608a/lxml-5.4.0-cp311-cp311-musllinux_1_2_aarch64.whl", hash = "sha256:72ac9762a9f8ce74c9eed4a4e74306f2f18613a6b71fa065495a67ac227b3056", size = 4827092, upload-time = "2025-04-23T01:45:48.943Z" }, + { url = "https://files.pythonhosted.org/packages/71/4a/e60a306df54680b103348545706a98a7514a42c8b4fbfdcaa608567bb065/lxml-5.4.0-cp311-cp311-musllinux_1_2_ppc64le.whl", hash = "sha256:f5cb182f6396706dc6cc1896dd02b1c889d644c081b0cdec38747573db88a7d7", size = 5418231, upload-time = "2025-04-23T01:45:51.481Z" }, + { url = "https://files.pythonhosted.org/packages/27/f2/9754aacd6016c930875854f08ac4b192a47fe19565f776a64004aa167521/lxml-5.4.0-cp311-cp311-musllinux_1_2_s390x.whl", hash = "sha256:3a3178b4873df8ef9457a4875703488eb1622632a9cee6d76464b60e90adbfcd", size = 5261798, upload-time = "2025-04-23T01:45:54.146Z" }, + { url = "https://files.pythonhosted.org/packages/38/a2/0c49ec6941428b1bd4f280650d7b11a0f91ace9db7de32eb7aa23bcb39ff/lxml-5.4.0-cp311-cp311-musllinux_1_2_x86_64.whl", hash = "sha256:e094ec83694b59d263802ed03a8384594fcce477ce484b0cbcd0008a211ca751", size = 4988195, upload-time = "2025-04-23T01:45:56.685Z" }, + { url = "https://files.pythonhosted.org/packages/7a/75/87a3963a08eafc46a86c1131c6e28a4de103ba30b5ae903114177352a3d7/lxml-5.4.0-cp311-cp311-win32.whl", hash = "sha256:4329422de653cdb2b72afa39b0aa04252fca9071550044904b2e7036d9d97fe4", size = 3474243, upload-time = "2025-04-23T01:45:58.863Z" }, + { url = "https://files.pythonhosted.org/packages/fa/f9/1f0964c4f6c2be861c50db380c554fb8befbea98c6404744ce243a3c87ef/lxml-5.4.0-cp311-cp311-win_amd64.whl", hash = "sha256:fd3be6481ef54b8cfd0e1e953323b7aa9d9789b94842d0e5b142ef4bb7999539", size = 3815197, upload-time = "2025-04-23T01:46:01.096Z" }, + { url = "https://files.pythonhosted.org/packages/f8/4c/d101ace719ca6a4ec043eb516fcfcb1b396a9fccc4fcd9ef593df34ba0d5/lxml-5.4.0-cp312-cp312-macosx_10_9_universal2.whl", hash = "sha256:b5aff6f3e818e6bdbbb38e5967520f174b18f539c2b9de867b1e7fde6f8d95a4", size = 8127392, upload-time = "2025-04-23T01:46:04.09Z" }, + { url = "https://files.pythonhosted.org/packages/11/84/beddae0cec4dd9ddf46abf156f0af451c13019a0fa25d7445b655ba5ccb7/lxml-5.4.0-cp312-cp312-macosx_10_9_x86_64.whl", hash = "sha256:942a5d73f739ad7c452bf739a62a0f83e2578afd6b8e5406308731f4ce78b16d", size = 4415103, upload-time = "2025-04-23T01:46:07.227Z" }, + { url = "https://files.pythonhosted.org/packages/d0/25/d0d93a4e763f0462cccd2b8a665bf1e4343dd788c76dcfefa289d46a38a9/lxml-5.4.0-cp312-cp312-manylinux_2_12_i686.manylinux2010_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:460508a4b07364d6abf53acaa0a90b6d370fafde5693ef37602566613a9b0779", size = 5024224, upload-time = "2025-04-23T01:46:10.237Z" }, + { url = "https://files.pythonhosted.org/packages/31/ce/1df18fb8f7946e7f3388af378b1f34fcf253b94b9feedb2cec5969da8012/lxml-5.4.0-cp312-cp312-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:529024ab3a505fed78fe3cc5ddc079464e709f6c892733e3f5842007cec8ac6e", size = 4769913, upload-time = "2025-04-23T01:46:12.757Z" }, + { url = "https://files.pythonhosted.org/packages/4e/62/f4a6c60ae7c40d43657f552f3045df05118636be1165b906d3423790447f/lxml-5.4.0-cp312-cp312-manylinux_2_17_ppc64le.manylinux2014_ppc64le.whl", hash = "sha256:7ca56ebc2c474e8f3d5761debfd9283b8b18c76c4fc0967b74aeafba1f5647f9", size = 5290441, upload-time = "2025-04-23T01:46:16.037Z" }, + { url = "https://files.pythonhosted.org/packages/9e/aa/04f00009e1e3a77838c7fc948f161b5d2d5de1136b2b81c712a263829ea4/lxml-5.4.0-cp312-cp312-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:a81e1196f0a5b4167a8dafe3a66aa67c4addac1b22dc47947abd5d5c7a3f24b5", size = 4820165, upload-time = "2025-04-23T01:46:19.137Z" }, + { url = "https://files.pythonhosted.org/packages/c9/1f/e0b2f61fa2404bf0f1fdf1898377e5bd1b74cc9b2cf2c6ba8509b8f27990/lxml-5.4.0-cp312-cp312-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:00b8686694423ddae324cf614e1b9659c2edb754de617703c3d29ff568448df5", size = 4932580, upload-time = "2025-04-23T01:46:21.963Z" }, + { url = "https://files.pythonhosted.org/packages/24/a2/8263f351b4ffe0ed3e32ea7b7830f845c795349034f912f490180d88a877/lxml-5.4.0-cp312-cp312-manylinux_2_28_aarch64.whl", hash = "sha256:c5681160758d3f6ac5b4fea370495c48aac0989d6a0f01bb9a72ad8ef5ab75c4", size = 4759493, upload-time = "2025-04-23T01:46:24.316Z" }, + { url = "https://files.pythonhosted.org/packages/05/00/41db052f279995c0e35c79d0f0fc9f8122d5b5e9630139c592a0b58c71b4/lxml-5.4.0-cp312-cp312-manylinux_2_28_ppc64le.whl", hash = "sha256:2dc191e60425ad70e75a68c9fd90ab284df64d9cd410ba8d2b641c0c45bc006e", size = 5324679, upload-time = "2025-04-23T01:46:27.097Z" }, + { url = "https://files.pythonhosted.org/packages/1d/be/ee99e6314cdef4587617d3b3b745f9356d9b7dd12a9663c5f3b5734b64ba/lxml-5.4.0-cp312-cp312-manylinux_2_28_s390x.whl", hash = "sha256:67f779374c6b9753ae0a0195a892a1c234ce8416e4448fe1e9f34746482070a7", size = 4890691, upload-time = "2025-04-23T01:46:30.009Z" }, + { url = "https://files.pythonhosted.org/packages/ad/36/239820114bf1d71f38f12208b9c58dec033cbcf80101cde006b9bde5cffd/lxml-5.4.0-cp312-cp312-manylinux_2_28_x86_64.whl", hash = "sha256:79d5bfa9c1b455336f52343130b2067164040604e41f6dc4d8313867ed540079", size = 4955075, upload-time = "2025-04-23T01:46:32.33Z" }, + { url = "https://files.pythonhosted.org/packages/d4/e1/1b795cc0b174efc9e13dbd078a9ff79a58728a033142bc6d70a1ee8fc34d/lxml-5.4.0-cp312-cp312-musllinux_1_2_aarch64.whl", hash = "sha256:3d3c30ba1c9b48c68489dc1829a6eede9873f52edca1dda900066542528d6b20", size = 4838680, upload-time = "2025-04-23T01:46:34.852Z" }, + { url = "https://files.pythonhosted.org/packages/72/48/3c198455ca108cec5ae3662ae8acd7fd99476812fd712bb17f1b39a0b589/lxml-5.4.0-cp312-cp312-musllinux_1_2_ppc64le.whl", hash = "sha256:1af80c6316ae68aded77e91cd9d80648f7dd40406cef73df841aa3c36f6907c8", size = 5391253, upload-time = "2025-04-23T01:46:37.608Z" }, + { url = "https://files.pythonhosted.org/packages/d6/10/5bf51858971c51ec96cfc13e800a9951f3fd501686f4c18d7d84fe2d6352/lxml-5.4.0-cp312-cp312-musllinux_1_2_s390x.whl", hash = "sha256:4d885698f5019abe0de3d352caf9466d5de2baded00a06ef3f1216c1a58ae78f", size = 5261651, upload-time = "2025-04-23T01:46:40.183Z" }, + { url = "https://files.pythonhosted.org/packages/2b/11/06710dd809205377da380546f91d2ac94bad9ff735a72b64ec029f706c85/lxml-5.4.0-cp312-cp312-musllinux_1_2_x86_64.whl", hash = "sha256:aea53d51859b6c64e7c51d522c03cc2c48b9b5d6172126854cc7f01aa11f52bc", size = 5024315, upload-time = "2025-04-23T01:46:43.333Z" }, + { url = "https://files.pythonhosted.org/packages/f5/b0/15b6217834b5e3a59ebf7f53125e08e318030e8cc0d7310355e6edac98ef/lxml-5.4.0-cp312-cp312-win32.whl", hash = "sha256:d90b729fd2732df28130c064aac9bb8aff14ba20baa4aee7bd0795ff1187545f", size = 3486149, upload-time = "2025-04-23T01:46:45.684Z" }, + { url = "https://files.pythonhosted.org/packages/91/1e/05ddcb57ad2f3069101611bd5f5084157d90861a2ef460bf42f45cced944/lxml-5.4.0-cp312-cp312-win_amd64.whl", hash = "sha256:1dc4ca99e89c335a7ed47d38964abcb36c5910790f9bd106f2a8fa2ee0b909d2", size = 3817095, upload-time = "2025-04-23T01:46:48.521Z" }, + { url = "https://files.pythonhosted.org/packages/87/cb/2ba1e9dd953415f58548506fa5549a7f373ae55e80c61c9041b7fd09a38a/lxml-5.4.0-cp313-cp313-macosx_10_13_universal2.whl", hash = "sha256:773e27b62920199c6197130632c18fb7ead3257fce1ffb7d286912e56ddb79e0", size = 8110086, upload-time = "2025-04-23T01:46:52.218Z" }, + { url = "https://files.pythonhosted.org/packages/b5/3e/6602a4dca3ae344e8609914d6ab22e52ce42e3e1638c10967568c5c1450d/lxml-5.4.0-cp313-cp313-macosx_10_13_x86_64.whl", hash = "sha256:ce9c671845de9699904b1e9df95acfe8dfc183f2310f163cdaa91a3535af95de", size = 4404613, upload-time = "2025-04-23T01:46:55.281Z" }, + { url = "https://files.pythonhosted.org/packages/4c/72/bf00988477d3bb452bef9436e45aeea82bb40cdfb4684b83c967c53909c7/lxml-5.4.0-cp313-cp313-manylinux_2_12_i686.manylinux2010_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:9454b8d8200ec99a224df8854786262b1bd6461f4280064c807303c642c05e76", size = 5012008, upload-time = "2025-04-23T01:46:57.817Z" }, + { url = "https://files.pythonhosted.org/packages/92/1f/93e42d93e9e7a44b2d3354c462cd784dbaaf350f7976b5d7c3f85d68d1b1/lxml-5.4.0-cp313-cp313-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:cccd007d5c95279e529c146d095f1d39ac05139de26c098166c4beb9374b0f4d", size = 4760915, upload-time = "2025-04-23T01:47:00.745Z" }, + { url = "https://files.pythonhosted.org/packages/45/0b/363009390d0b461cf9976a499e83b68f792e4c32ecef092f3f9ef9c4ba54/lxml-5.4.0-cp313-cp313-manylinux_2_17_ppc64le.manylinux2014_ppc64le.whl", hash = "sha256:0fce1294a0497edb034cb416ad3e77ecc89b313cff7adbee5334e4dc0d11f422", size = 5283890, upload-time = "2025-04-23T01:47:04.702Z" }, + { url = "https://files.pythonhosted.org/packages/19/dc/6056c332f9378ab476c88e301e6549a0454dbee8f0ae16847414f0eccb74/lxml-5.4.0-cp313-cp313-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:24974f774f3a78ac12b95e3a20ef0931795ff04dbb16db81a90c37f589819551", size = 4812644, upload-time = "2025-04-23T01:47:07.833Z" }, + { url = "https://files.pythonhosted.org/packages/ee/8a/f8c66bbb23ecb9048a46a5ef9b495fd23f7543df642dabeebcb2eeb66592/lxml-5.4.0-cp313-cp313-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:497cab4d8254c2a90bf988f162ace2ddbfdd806fce3bda3f581b9d24c852e03c", size = 4921817, upload-time = "2025-04-23T01:47:10.317Z" }, + { url = "https://files.pythonhosted.org/packages/04/57/2e537083c3f381f83d05d9b176f0d838a9e8961f7ed8ddce3f0217179ce3/lxml-5.4.0-cp313-cp313-manylinux_2_28_aarch64.whl", hash = "sha256:e794f698ae4c5084414efea0f5cc9f4ac562ec02d66e1484ff822ef97c2cadff", size = 4753916, upload-time = "2025-04-23T01:47:12.823Z" }, + { url = "https://files.pythonhosted.org/packages/d8/80/ea8c4072109a350848f1157ce83ccd9439601274035cd045ac31f47f3417/lxml-5.4.0-cp313-cp313-manylinux_2_28_ppc64le.whl", hash = "sha256:2c62891b1ea3094bb12097822b3d44b93fc6c325f2043c4d2736a8ff09e65f60", size = 5289274, upload-time = "2025-04-23T01:47:15.916Z" }, + { url = "https://files.pythonhosted.org/packages/b3/47/c4be287c48cdc304483457878a3f22999098b9a95f455e3c4bda7ec7fc72/lxml-5.4.0-cp313-cp313-manylinux_2_28_s390x.whl", hash = "sha256:142accb3e4d1edae4b392bd165a9abdee8a3c432a2cca193df995bc3886249c8", size = 4874757, upload-time = "2025-04-23T01:47:19.793Z" }, + { url = "https://files.pythonhosted.org/packages/2f/04/6ef935dc74e729932e39478e44d8cfe6a83550552eaa072b7c05f6f22488/lxml-5.4.0-cp313-cp313-manylinux_2_28_x86_64.whl", hash = "sha256:1a42b3a19346e5601d1b8296ff6ef3d76038058f311902edd574461e9c036982", size = 4947028, upload-time = "2025-04-23T01:47:22.401Z" }, + { url = "https://files.pythonhosted.org/packages/cb/f9/c33fc8daa373ef8a7daddb53175289024512b6619bc9de36d77dca3df44b/lxml-5.4.0-cp313-cp313-musllinux_1_2_aarch64.whl", hash = "sha256:4291d3c409a17febf817259cb37bc62cb7eb398bcc95c1356947e2871911ae61", size = 4834487, upload-time = "2025-04-23T01:47:25.513Z" }, + { url = "https://files.pythonhosted.org/packages/8d/30/fc92bb595bcb878311e01b418b57d13900f84c2b94f6eca9e5073ea756e6/lxml-5.4.0-cp313-cp313-musllinux_1_2_ppc64le.whl", hash = "sha256:4f5322cf38fe0e21c2d73901abf68e6329dc02a4994e483adbcf92b568a09a54", size = 5381688, upload-time = "2025-04-23T01:47:28.454Z" }, + { url = "https://files.pythonhosted.org/packages/43/d1/3ba7bd978ce28bba8e3da2c2e9d5ae3f8f521ad3f0ca6ea4788d086ba00d/lxml-5.4.0-cp313-cp313-musllinux_1_2_s390x.whl", hash = "sha256:0be91891bdb06ebe65122aa6bf3fc94489960cf7e03033c6f83a90863b23c58b", size = 5242043, upload-time = "2025-04-23T01:47:31.208Z" }, + { url = "https://files.pythonhosted.org/packages/ee/cd/95fa2201041a610c4d08ddaf31d43b98ecc4b1d74b1e7245b1abdab443cb/lxml-5.4.0-cp313-cp313-musllinux_1_2_x86_64.whl", hash = "sha256:15a665ad90054a3d4f397bc40f73948d48e36e4c09f9bcffc7d90c87410e478a", size = 5021569, upload-time = "2025-04-23T01:47:33.805Z" }, + { url = "https://files.pythonhosted.org/packages/2d/a6/31da006fead660b9512d08d23d31e93ad3477dd47cc42e3285f143443176/lxml-5.4.0-cp313-cp313-win32.whl", hash = "sha256:d5663bc1b471c79f5c833cffbc9b87d7bf13f87e055a5c86c363ccd2348d7e82", size = 3485270, upload-time = "2025-04-23T01:47:36.133Z" }, + { url = "https://files.pythonhosted.org/packages/fc/14/c115516c62a7d2499781d2d3d7215218c0731b2c940753bf9f9b7b73924d/lxml-5.4.0-cp313-cp313-win_amd64.whl", hash = "sha256:bcb7a1096b4b6b24ce1ac24d4942ad98f983cd3810f9711bcd0293f43a9d8b9f", size = 3814606, upload-time = "2025-04-23T01:47:39.028Z" }, + { url = "https://files.pythonhosted.org/packages/c6/b0/e4d1cbb8c078bc4ae44de9c6a79fec4e2b4151b1b4d50af71d799e76b177/lxml-5.4.0-pp310-pypy310_pp73-macosx_10_15_x86_64.whl", hash = "sha256:1b717b00a71b901b4667226bba282dd462c42ccf618ade12f9ba3674e1fabc55", size = 3892319, upload-time = "2025-04-23T01:49:22.069Z" }, + { url = "https://files.pythonhosted.org/packages/5b/aa/e2bdefba40d815059bcb60b371a36fbfcce970a935370e1b367ba1cc8f74/lxml-5.4.0-pp310-pypy310_pp73-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:27a9ded0f0b52098ff89dd4c418325b987feed2ea5cc86e8860b0f844285d740", size = 4211614, upload-time = "2025-04-23T01:49:24.599Z" }, + { url = "https://files.pythonhosted.org/packages/3c/5f/91ff89d1e092e7cfdd8453a939436ac116db0a665e7f4be0cd8e65c7dc5a/lxml-5.4.0-pp310-pypy310_pp73-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:4b7ce10634113651d6f383aa712a194179dcd496bd8c41e191cec2099fa09de5", size = 4306273, upload-time = "2025-04-23T01:49:27.355Z" }, + { url = "https://files.pythonhosted.org/packages/be/7c/8c3f15df2ca534589717bfd19d1e3482167801caedfa4d90a575facf68a6/lxml-5.4.0-pp310-pypy310_pp73-manylinux_2_28_aarch64.whl", hash = "sha256:53370c26500d22b45182f98847243efb518d268374a9570409d2e2276232fd37", size = 4208552, upload-time = "2025-04-23T01:49:29.949Z" }, + { url = "https://files.pythonhosted.org/packages/7d/d8/9567afb1665f64d73fc54eb904e418d1138d7f011ed00647121b4dd60b38/lxml-5.4.0-pp310-pypy310_pp73-manylinux_2_28_x86_64.whl", hash = "sha256:c6364038c519dffdbe07e3cf42e6a7f8b90c275d4d1617a69bb59734c1a2d571", size = 4331091, upload-time = "2025-04-23T01:49:32.842Z" }, + { url = "https://files.pythonhosted.org/packages/f1/ab/fdbbd91d8d82bf1a723ba88ec3e3d76c022b53c391b0c13cad441cdb8f9e/lxml-5.4.0-pp310-pypy310_pp73-win_amd64.whl", hash = "sha256:b12cb6527599808ada9eb2cd6e0e7d3d8f13fe7bbb01c6311255a15ded4c7ab4", size = 3487862, upload-time = "2025-04-23T01:49:36.296Z" }, ] [[package]] @@ -1018,18 +1019,18 @@ dependencies = [ { name = "requests" }, { name = "six" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/4b/ae/59f5ab870640bd43673b708e5f24aed592dc2673cc72caa49b0053b4af37/macaroonbakery-1.3.4.tar.gz", hash = "sha256:41ca993a23e4f8ef2fe7723b5cd4a30c759735f1d5021e990770c8a0e0f33970", size = 82143 } +sdist = { url = "https://files.pythonhosted.org/packages/4b/ae/59f5ab870640bd43673b708e5f24aed592dc2673cc72caa49b0053b4af37/macaroonbakery-1.3.4.tar.gz", hash = "sha256:41ca993a23e4f8ef2fe7723b5cd4a30c759735f1d5021e990770c8a0e0f33970", size = 82143, upload-time = "2023-12-13T14:22:22.539Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/60/42/227f748dc222b7a1c5cb40c7c74ab4162c7fc146b88980776b490ab673a1/macaroonbakery-1.3.4-py2.py3-none-any.whl", hash = "sha256:1e952a189f5c1e96ef82b081b2852c770d7daa20987e2088e762dd5689fb253b", size = 103184 }, + { url = "https://files.pythonhosted.org/packages/60/42/227f748dc222b7a1c5cb40c7c74ab4162c7fc146b88980776b490ab673a1/macaroonbakery-1.3.4-py2.py3-none-any.whl", hash = "sha256:1e952a189f5c1e96ef82b081b2852c770d7daa20987e2088e762dd5689fb253b", size = 103184, upload-time = "2023-12-13T14:22:20.159Z" }, ] [[package]] name = "markdown" version = "3.8" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/2f/15/222b423b0b88689c266d9eac4e61396fe2cc53464459d6a37618ac863b24/markdown-3.8.tar.gz", hash = "sha256:7df81e63f0df5c4b24b7d156eb81e4690595239b7d70937d0409f1b0de319c6f", size = 360906 } +sdist = { url = "https://files.pythonhosted.org/packages/2f/15/222b423b0b88689c266d9eac4e61396fe2cc53464459d6a37618ac863b24/markdown-3.8.tar.gz", hash = "sha256:7df81e63f0df5c4b24b7d156eb81e4690595239b7d70937d0409f1b0de319c6f", size = 360906, upload-time = "2025-04-11T14:42:50.928Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/51/3f/afe76f8e2246ffbc867440cbcf90525264df0e658f8a5ca1f872b3f6192a/markdown-3.8-py3-none-any.whl", hash = "sha256:794a929b79c5af141ef5ab0f2f642d0f7b1872981250230e72682346f7cc90dc", size = 106210 }, + { url = "https://files.pythonhosted.org/packages/51/3f/afe76f8e2246ffbc867440cbcf90525264df0e658f8a5ca1f872b3f6192a/markdown-3.8-py3-none-any.whl", hash = "sha256:794a929b79c5af141ef5ab0f2f642d0f7b1872981250230e72682346f7cc90dc", size = 106210, upload-time = "2025-04-11T14:42:49.178Z" }, ] [[package]] @@ -1039,67 +1040,67 @@ source = { registry = "https://pypi.org/simple" } dependencies = [ { name = "mdurl" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/38/71/3b932df36c1a044d397a1f92d1cf91ee0a503d91e470cbd670aa66b07ed0/markdown-it-py-3.0.0.tar.gz", hash = "sha256:e3f60a94fa066dc52ec76661e37c851cb232d92f9886b15cb560aaada2df8feb", size = 74596 } +sdist = { url = "https://files.pythonhosted.org/packages/38/71/3b932df36c1a044d397a1f92d1cf91ee0a503d91e470cbd670aa66b07ed0/markdown-it-py-3.0.0.tar.gz", hash = "sha256:e3f60a94fa066dc52ec76661e37c851cb232d92f9886b15cb560aaada2df8feb", size = 74596, upload-time = "2023-06-03T06:41:14.443Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/42/d7/1ec15b46af6af88f19b8e5ffea08fa375d433c998b8a7639e76935c14f1f/markdown_it_py-3.0.0-py3-none-any.whl", hash = "sha256:355216845c60bd96232cd8d8c40e8f9765cc86f46880e43a8fd22dc1a1a8cab1", size = 87528 }, + { url = "https://files.pythonhosted.org/packages/42/d7/1ec15b46af6af88f19b8e5ffea08fa375d433c998b8a7639e76935c14f1f/markdown_it_py-3.0.0-py3-none-any.whl", hash = "sha256:355216845c60bd96232cd8d8c40e8f9765cc86f46880e43a8fd22dc1a1a8cab1", size = 87528, upload-time = "2023-06-03T06:41:11.019Z" }, ] [[package]] name = "markupsafe" version = "3.0.2" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/b2/97/5d42485e71dfc078108a86d6de8fa46db44a1a9295e89c5d6d4a06e23a62/markupsafe-3.0.2.tar.gz", hash = "sha256:ee55d3edf80167e48ea11a923c7386f4669df67d7994554387f84e7d8b0a2bf0", size = 20537 } -wheels = [ - { url = "https://files.pythonhosted.org/packages/04/90/d08277ce111dd22f77149fd1a5d4653eeb3b3eaacbdfcbae5afb2600eebd/MarkupSafe-3.0.2-cp310-cp310-macosx_10_9_universal2.whl", hash = "sha256:7e94c425039cde14257288fd61dcfb01963e658efbc0ff54f5306b06054700f8", size = 14357 }, - { url = "https://files.pythonhosted.org/packages/04/e1/6e2194baeae0bca1fae6629dc0cbbb968d4d941469cbab11a3872edff374/MarkupSafe-3.0.2-cp310-cp310-macosx_11_0_arm64.whl", hash = "sha256:9e2d922824181480953426608b81967de705c3cef4d1af983af849d7bd619158", size = 12393 }, - { url = "https://files.pythonhosted.org/packages/1d/69/35fa85a8ece0a437493dc61ce0bb6d459dcba482c34197e3efc829aa357f/MarkupSafe-3.0.2-cp310-cp310-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:38a9ef736c01fccdd6600705b09dc574584b89bea478200c5fbf112a6b0d5579", size = 21732 }, - { url = "https://files.pythonhosted.org/packages/22/35/137da042dfb4720b638d2937c38a9c2df83fe32d20e8c8f3185dbfef05f7/MarkupSafe-3.0.2-cp310-cp310-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:bbcb445fa71794da8f178f0f6d66789a28d7319071af7a496d4d507ed566270d", size = 20866 }, - { url = "https://files.pythonhosted.org/packages/29/28/6d029a903727a1b62edb51863232152fd335d602def598dade38996887f0/MarkupSafe-3.0.2-cp310-cp310-manylinux_2_5_i686.manylinux1_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:57cb5a3cf367aeb1d316576250f65edec5bb3be939e9247ae594b4bcbc317dfb", size = 20964 }, - { url = "https://files.pythonhosted.org/packages/cc/cd/07438f95f83e8bc028279909d9c9bd39e24149b0d60053a97b2bc4f8aa51/MarkupSafe-3.0.2-cp310-cp310-musllinux_1_2_aarch64.whl", hash = "sha256:3809ede931876f5b2ec92eef964286840ed3540dadf803dd570c3b7e13141a3b", size = 21977 }, - { url = "https://files.pythonhosted.org/packages/29/01/84b57395b4cc062f9c4c55ce0df7d3108ca32397299d9df00fedd9117d3d/MarkupSafe-3.0.2-cp310-cp310-musllinux_1_2_i686.whl", hash = "sha256:e07c3764494e3776c602c1e78e298937c3315ccc9043ead7e685b7f2b8d47b3c", size = 21366 }, - { url = "https://files.pythonhosted.org/packages/bd/6e/61ebf08d8940553afff20d1fb1ba7294b6f8d279df9fd0c0db911b4bbcfd/MarkupSafe-3.0.2-cp310-cp310-musllinux_1_2_x86_64.whl", hash = "sha256:b424c77b206d63d500bcb69fa55ed8d0e6a3774056bdc4839fc9298a7edca171", size = 21091 }, - { url = "https://files.pythonhosted.org/packages/11/23/ffbf53694e8c94ebd1e7e491de185124277964344733c45481f32ede2499/MarkupSafe-3.0.2-cp310-cp310-win32.whl", hash = "sha256:fcabf5ff6eea076f859677f5f0b6b5c1a51e70a376b0579e0eadef8db48c6b50", size = 15065 }, - { url = "https://files.pythonhosted.org/packages/44/06/e7175d06dd6e9172d4a69a72592cb3f7a996a9c396eee29082826449bbc3/MarkupSafe-3.0.2-cp310-cp310-win_amd64.whl", hash = "sha256:6af100e168aa82a50e186c82875a5893c5597a0c1ccdb0d8b40240b1f28b969a", size = 15514 }, - { url = "https://files.pythonhosted.org/packages/6b/28/bbf83e3f76936960b850435576dd5e67034e200469571be53f69174a2dfd/MarkupSafe-3.0.2-cp311-cp311-macosx_10_9_universal2.whl", hash = "sha256:9025b4018f3a1314059769c7bf15441064b2207cb3f065e6ea1e7359cb46db9d", size = 14353 }, - { url = "https://files.pythonhosted.org/packages/6c/30/316d194b093cde57d448a4c3209f22e3046c5bb2fb0820b118292b334be7/MarkupSafe-3.0.2-cp311-cp311-macosx_11_0_arm64.whl", hash = "sha256:93335ca3812df2f366e80509ae119189886b0f3c2b81325d39efdb84a1e2ae93", size = 12392 }, - { url = "https://files.pythonhosted.org/packages/f2/96/9cdafba8445d3a53cae530aaf83c38ec64c4d5427d975c974084af5bc5d2/MarkupSafe-3.0.2-cp311-cp311-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:2cb8438c3cbb25e220c2ab33bb226559e7afb3baec11c4f218ffa7308603c832", size = 23984 }, - { url = "https://files.pythonhosted.org/packages/f1/a4/aefb044a2cd8d7334c8a47d3fb2c9f328ac48cb349468cc31c20b539305f/MarkupSafe-3.0.2-cp311-cp311-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:a123e330ef0853c6e822384873bef7507557d8e4a082961e1defa947aa59ba84", size = 23120 }, - { url = "https://files.pythonhosted.org/packages/8d/21/5e4851379f88f3fad1de30361db501300d4f07bcad047d3cb0449fc51f8c/MarkupSafe-3.0.2-cp311-cp311-manylinux_2_5_i686.manylinux1_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:1e084f686b92e5b83186b07e8a17fc09e38fff551f3602b249881fec658d3eca", size = 23032 }, - { url = "https://files.pythonhosted.org/packages/00/7b/e92c64e079b2d0d7ddf69899c98842f3f9a60a1ae72657c89ce2655c999d/MarkupSafe-3.0.2-cp311-cp311-musllinux_1_2_aarch64.whl", hash = "sha256:d8213e09c917a951de9d09ecee036d5c7d36cb6cb7dbaece4c71a60d79fb9798", size = 24057 }, - { url = "https://files.pythonhosted.org/packages/f9/ac/46f960ca323037caa0a10662ef97d0a4728e890334fc156b9f9e52bcc4ca/MarkupSafe-3.0.2-cp311-cp311-musllinux_1_2_i686.whl", hash = "sha256:5b02fb34468b6aaa40dfc198d813a641e3a63b98c2b05a16b9f80b7ec314185e", size = 23359 }, - { url = "https://files.pythonhosted.org/packages/69/84/83439e16197337b8b14b6a5b9c2105fff81d42c2a7c5b58ac7b62ee2c3b1/MarkupSafe-3.0.2-cp311-cp311-musllinux_1_2_x86_64.whl", hash = "sha256:0bff5e0ae4ef2e1ae4fdf2dfd5b76c75e5c2fa4132d05fc1b0dabcd20c7e28c4", size = 23306 }, - { url = "https://files.pythonhosted.org/packages/9a/34/a15aa69f01e2181ed8d2b685c0d2f6655d5cca2c4db0ddea775e631918cd/MarkupSafe-3.0.2-cp311-cp311-win32.whl", hash = "sha256:6c89876f41da747c8d3677a2b540fb32ef5715f97b66eeb0c6b66f5e3ef6f59d", size = 15094 }, - { url = "https://files.pythonhosted.org/packages/da/b8/3a3bd761922d416f3dc5d00bfbed11f66b1ab89a0c2b6e887240a30b0f6b/MarkupSafe-3.0.2-cp311-cp311-win_amd64.whl", hash = "sha256:70a87b411535ccad5ef2f1df5136506a10775d267e197e4cf531ced10537bd6b", size = 15521 }, - { url = "https://files.pythonhosted.org/packages/22/09/d1f21434c97fc42f09d290cbb6350d44eb12f09cc62c9476effdb33a18aa/MarkupSafe-3.0.2-cp312-cp312-macosx_10_13_universal2.whl", hash = "sha256:9778bd8ab0a994ebf6f84c2b949e65736d5575320a17ae8984a77fab08db94cf", size = 14274 }, - { url = "https://files.pythonhosted.org/packages/6b/b0/18f76bba336fa5aecf79d45dcd6c806c280ec44538b3c13671d49099fdd0/MarkupSafe-3.0.2-cp312-cp312-macosx_11_0_arm64.whl", hash = "sha256:846ade7b71e3536c4e56b386c2a47adf5741d2d8b94ec9dc3e92e5e1ee1e2225", size = 12348 }, - { url = "https://files.pythonhosted.org/packages/e0/25/dd5c0f6ac1311e9b40f4af06c78efde0f3b5cbf02502f8ef9501294c425b/MarkupSafe-3.0.2-cp312-cp312-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:1c99d261bd2d5f6b59325c92c73df481e05e57f19837bdca8413b9eac4bd8028", size = 24149 }, - { url = "https://files.pythonhosted.org/packages/f3/f0/89e7aadfb3749d0f52234a0c8c7867877876e0a20b60e2188e9850794c17/MarkupSafe-3.0.2-cp312-cp312-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:e17c96c14e19278594aa4841ec148115f9c7615a47382ecb6b82bd8fea3ab0c8", size = 23118 }, - { url = "https://files.pythonhosted.org/packages/d5/da/f2eeb64c723f5e3777bc081da884b414671982008c47dcc1873d81f625b6/MarkupSafe-3.0.2-cp312-cp312-manylinux_2_5_i686.manylinux1_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:88416bd1e65dcea10bc7569faacb2c20ce071dd1f87539ca2ab364bf6231393c", size = 22993 }, - { url = "https://files.pythonhosted.org/packages/da/0e/1f32af846df486dce7c227fe0f2398dc7e2e51d4a370508281f3c1c5cddc/MarkupSafe-3.0.2-cp312-cp312-musllinux_1_2_aarch64.whl", hash = "sha256:2181e67807fc2fa785d0592dc2d6206c019b9502410671cc905d132a92866557", size = 24178 }, - { url = "https://files.pythonhosted.org/packages/c4/f6/bb3ca0532de8086cbff5f06d137064c8410d10779c4c127e0e47d17c0b71/MarkupSafe-3.0.2-cp312-cp312-musllinux_1_2_i686.whl", hash = "sha256:52305740fe773d09cffb16f8ed0427942901f00adedac82ec8b67752f58a1b22", size = 23319 }, - { url = "https://files.pythonhosted.org/packages/a2/82/8be4c96ffee03c5b4a034e60a31294daf481e12c7c43ab8e34a1453ee48b/MarkupSafe-3.0.2-cp312-cp312-musllinux_1_2_x86_64.whl", hash = "sha256:ad10d3ded218f1039f11a75f8091880239651b52e9bb592ca27de44eed242a48", size = 23352 }, - { url = "https://files.pythonhosted.org/packages/51/ae/97827349d3fcffee7e184bdf7f41cd6b88d9919c80f0263ba7acd1bbcb18/MarkupSafe-3.0.2-cp312-cp312-win32.whl", hash = "sha256:0f4ca02bea9a23221c0182836703cbf8930c5e9454bacce27e767509fa286a30", size = 15097 }, - { url = "https://files.pythonhosted.org/packages/c1/80/a61f99dc3a936413c3ee4e1eecac96c0da5ed07ad56fd975f1a9da5bc630/MarkupSafe-3.0.2-cp312-cp312-win_amd64.whl", hash = "sha256:8e06879fc22a25ca47312fbe7c8264eb0b662f6db27cb2d3bbbc74b1df4b9b87", size = 15601 }, - { url = "https://files.pythonhosted.org/packages/83/0e/67eb10a7ecc77a0c2bbe2b0235765b98d164d81600746914bebada795e97/MarkupSafe-3.0.2-cp313-cp313-macosx_10_13_universal2.whl", hash = "sha256:ba9527cdd4c926ed0760bc301f6728ef34d841f405abf9d4f959c478421e4efd", size = 14274 }, - { url = "https://files.pythonhosted.org/packages/2b/6d/9409f3684d3335375d04e5f05744dfe7e9f120062c9857df4ab490a1031a/MarkupSafe-3.0.2-cp313-cp313-macosx_11_0_arm64.whl", hash = "sha256:f8b3d067f2e40fe93e1ccdd6b2e1d16c43140e76f02fb1319a05cf2b79d99430", size = 12352 }, - { url = "https://files.pythonhosted.org/packages/d2/f5/6eadfcd3885ea85fe2a7c128315cc1bb7241e1987443d78c8fe712d03091/MarkupSafe-3.0.2-cp313-cp313-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:569511d3b58c8791ab4c2e1285575265991e6d8f8700c7be0e88f86cb0672094", size = 24122 }, - { url = "https://files.pythonhosted.org/packages/0c/91/96cf928db8236f1bfab6ce15ad070dfdd02ed88261c2afafd4b43575e9e9/MarkupSafe-3.0.2-cp313-cp313-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:15ab75ef81add55874e7ab7055e9c397312385bd9ced94920f2802310c930396", size = 23085 }, - { url = "https://files.pythonhosted.org/packages/c2/cf/c9d56af24d56ea04daae7ac0940232d31d5a8354f2b457c6d856b2057d69/MarkupSafe-3.0.2-cp313-cp313-manylinux_2_5_i686.manylinux1_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:f3818cb119498c0678015754eba762e0d61e5b52d34c8b13d770f0719f7b1d79", size = 22978 }, - { url = "https://files.pythonhosted.org/packages/2a/9f/8619835cd6a711d6272d62abb78c033bda638fdc54c4e7f4272cf1c0962b/MarkupSafe-3.0.2-cp313-cp313-musllinux_1_2_aarch64.whl", hash = "sha256:cdb82a876c47801bb54a690c5ae105a46b392ac6099881cdfb9f6e95e4014c6a", size = 24208 }, - { url = "https://files.pythonhosted.org/packages/f9/bf/176950a1792b2cd2102b8ffeb5133e1ed984547b75db47c25a67d3359f77/MarkupSafe-3.0.2-cp313-cp313-musllinux_1_2_i686.whl", hash = "sha256:cabc348d87e913db6ab4aa100f01b08f481097838bdddf7c7a84b7575b7309ca", size = 23357 }, - { url = "https://files.pythonhosted.org/packages/ce/4f/9a02c1d335caabe5c4efb90e1b6e8ee944aa245c1aaaab8e8a618987d816/MarkupSafe-3.0.2-cp313-cp313-musllinux_1_2_x86_64.whl", hash = "sha256:444dcda765c8a838eaae23112db52f1efaf750daddb2d9ca300bcae1039adc5c", size = 23344 }, - { url = "https://files.pythonhosted.org/packages/ee/55/c271b57db36f748f0e04a759ace9f8f759ccf22b4960c270c78a394f58be/MarkupSafe-3.0.2-cp313-cp313-win32.whl", hash = "sha256:bcf3e58998965654fdaff38e58584d8937aa3096ab5354d493c77d1fdd66d7a1", size = 15101 }, - { url = "https://files.pythonhosted.org/packages/29/88/07df22d2dd4df40aba9f3e402e6dc1b8ee86297dddbad4872bd5e7b0094f/MarkupSafe-3.0.2-cp313-cp313-win_amd64.whl", hash = "sha256:e6a2a455bd412959b57a172ce6328d2dd1f01cb2135efda2e4576e8a23fa3b0f", size = 15603 }, - { url = "https://files.pythonhosted.org/packages/62/6a/8b89d24db2d32d433dffcd6a8779159da109842434f1dd2f6e71f32f738c/MarkupSafe-3.0.2-cp313-cp313t-macosx_10_13_universal2.whl", hash = "sha256:b5a6b3ada725cea8a5e634536b1b01c30bcdcd7f9c6fff4151548d5bf6b3a36c", size = 14510 }, - { url = "https://files.pythonhosted.org/packages/7a/06/a10f955f70a2e5a9bf78d11a161029d278eeacbd35ef806c3fd17b13060d/MarkupSafe-3.0.2-cp313-cp313t-macosx_11_0_arm64.whl", hash = "sha256:a904af0a6162c73e3edcb969eeeb53a63ceeb5d8cf642fade7d39e7963a22ddb", size = 12486 }, - { url = "https://files.pythonhosted.org/packages/34/cf/65d4a571869a1a9078198ca28f39fba5fbb910f952f9dbc5220afff9f5e6/MarkupSafe-3.0.2-cp313-cp313t-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:4aa4e5faecf353ed117801a068ebab7b7e09ffb6e1d5e412dc852e0da018126c", size = 25480 }, - { url = "https://files.pythonhosted.org/packages/0c/e3/90e9651924c430b885468b56b3d597cabf6d72be4b24a0acd1fa0e12af67/MarkupSafe-3.0.2-cp313-cp313t-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:c0ef13eaeee5b615fb07c9a7dadb38eac06a0608b41570d8ade51c56539e509d", size = 23914 }, - { url = "https://files.pythonhosted.org/packages/66/8c/6c7cf61f95d63bb866db39085150df1f2a5bd3335298f14a66b48e92659c/MarkupSafe-3.0.2-cp313-cp313t-manylinux_2_5_i686.manylinux1_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:d16a81a06776313e817c951135cf7340a3e91e8c1ff2fac444cfd75fffa04afe", size = 23796 }, - { url = "https://files.pythonhosted.org/packages/bb/35/cbe9238ec3f47ac9a7c8b3df7a808e7cb50fe149dc7039f5f454b3fba218/MarkupSafe-3.0.2-cp313-cp313t-musllinux_1_2_aarch64.whl", hash = "sha256:6381026f158fdb7c72a168278597a5e3a5222e83ea18f543112b2662a9b699c5", size = 25473 }, - { url = "https://files.pythonhosted.org/packages/e6/32/7621a4382488aa283cc05e8984a9c219abad3bca087be9ec77e89939ded9/MarkupSafe-3.0.2-cp313-cp313t-musllinux_1_2_i686.whl", hash = "sha256:3d79d162e7be8f996986c064d1c7c817f6df3a77fe3d6859f6f9e7be4b8c213a", size = 24114 }, - { url = "https://files.pythonhosted.org/packages/0d/80/0985960e4b89922cb5a0bac0ed39c5b96cbc1a536a99f30e8c220a996ed9/MarkupSafe-3.0.2-cp313-cp313t-musllinux_1_2_x86_64.whl", hash = "sha256:131a3c7689c85f5ad20f9f6fb1b866f402c445b220c19fe4308c0b147ccd2ad9", size = 24098 }, - { url = "https://files.pythonhosted.org/packages/82/78/fedb03c7d5380df2427038ec8d973587e90561b2d90cd472ce9254cf348b/MarkupSafe-3.0.2-cp313-cp313t-win32.whl", hash = "sha256:ba8062ed2cf21c07a9e295d5b8a2a5ce678b913b45fdf68c32d95d6c1291e0b6", size = 15208 }, - { url = "https://files.pythonhosted.org/packages/4f/65/6079a46068dfceaeabb5dcad6d674f5f5c61a6fa5673746f42a9f4c233b3/MarkupSafe-3.0.2-cp313-cp313t-win_amd64.whl", hash = "sha256:e444a31f8db13eb18ada366ab3cf45fd4b31e4db1236a4448f68778c1d1a5a2f", size = 15739 }, +sdist = { url = "https://files.pythonhosted.org/packages/b2/97/5d42485e71dfc078108a86d6de8fa46db44a1a9295e89c5d6d4a06e23a62/markupsafe-3.0.2.tar.gz", hash = "sha256:ee55d3edf80167e48ea11a923c7386f4669df67d7994554387f84e7d8b0a2bf0", size = 20537, upload-time = "2024-10-18T15:21:54.129Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/04/90/d08277ce111dd22f77149fd1a5d4653eeb3b3eaacbdfcbae5afb2600eebd/MarkupSafe-3.0.2-cp310-cp310-macosx_10_9_universal2.whl", hash = "sha256:7e94c425039cde14257288fd61dcfb01963e658efbc0ff54f5306b06054700f8", size = 14357, upload-time = "2024-10-18T15:20:51.44Z" }, + { url = "https://files.pythonhosted.org/packages/04/e1/6e2194baeae0bca1fae6629dc0cbbb968d4d941469cbab11a3872edff374/MarkupSafe-3.0.2-cp310-cp310-macosx_11_0_arm64.whl", hash = "sha256:9e2d922824181480953426608b81967de705c3cef4d1af983af849d7bd619158", size = 12393, upload-time = "2024-10-18T15:20:52.426Z" }, + { url = "https://files.pythonhosted.org/packages/1d/69/35fa85a8ece0a437493dc61ce0bb6d459dcba482c34197e3efc829aa357f/MarkupSafe-3.0.2-cp310-cp310-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:38a9ef736c01fccdd6600705b09dc574584b89bea478200c5fbf112a6b0d5579", size = 21732, upload-time = "2024-10-18T15:20:53.578Z" }, + { url = "https://files.pythonhosted.org/packages/22/35/137da042dfb4720b638d2937c38a9c2df83fe32d20e8c8f3185dbfef05f7/MarkupSafe-3.0.2-cp310-cp310-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:bbcb445fa71794da8f178f0f6d66789a28d7319071af7a496d4d507ed566270d", size = 20866, upload-time = "2024-10-18T15:20:55.06Z" }, + { url = "https://files.pythonhosted.org/packages/29/28/6d029a903727a1b62edb51863232152fd335d602def598dade38996887f0/MarkupSafe-3.0.2-cp310-cp310-manylinux_2_5_i686.manylinux1_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:57cb5a3cf367aeb1d316576250f65edec5bb3be939e9247ae594b4bcbc317dfb", size = 20964, upload-time = "2024-10-18T15:20:55.906Z" }, + { url = "https://files.pythonhosted.org/packages/cc/cd/07438f95f83e8bc028279909d9c9bd39e24149b0d60053a97b2bc4f8aa51/MarkupSafe-3.0.2-cp310-cp310-musllinux_1_2_aarch64.whl", hash = "sha256:3809ede931876f5b2ec92eef964286840ed3540dadf803dd570c3b7e13141a3b", size = 21977, upload-time = "2024-10-18T15:20:57.189Z" }, + { url = "https://files.pythonhosted.org/packages/29/01/84b57395b4cc062f9c4c55ce0df7d3108ca32397299d9df00fedd9117d3d/MarkupSafe-3.0.2-cp310-cp310-musllinux_1_2_i686.whl", hash = "sha256:e07c3764494e3776c602c1e78e298937c3315ccc9043ead7e685b7f2b8d47b3c", size = 21366, upload-time = "2024-10-18T15:20:58.235Z" }, + { url = "https://files.pythonhosted.org/packages/bd/6e/61ebf08d8940553afff20d1fb1ba7294b6f8d279df9fd0c0db911b4bbcfd/MarkupSafe-3.0.2-cp310-cp310-musllinux_1_2_x86_64.whl", hash = "sha256:b424c77b206d63d500bcb69fa55ed8d0e6a3774056bdc4839fc9298a7edca171", size = 21091, upload-time = "2024-10-18T15:20:59.235Z" }, + { url = "https://files.pythonhosted.org/packages/11/23/ffbf53694e8c94ebd1e7e491de185124277964344733c45481f32ede2499/MarkupSafe-3.0.2-cp310-cp310-win32.whl", hash = "sha256:fcabf5ff6eea076f859677f5f0b6b5c1a51e70a376b0579e0eadef8db48c6b50", size = 15065, upload-time = "2024-10-18T15:21:00.307Z" }, + { url = "https://files.pythonhosted.org/packages/44/06/e7175d06dd6e9172d4a69a72592cb3f7a996a9c396eee29082826449bbc3/MarkupSafe-3.0.2-cp310-cp310-win_amd64.whl", hash = "sha256:6af100e168aa82a50e186c82875a5893c5597a0c1ccdb0d8b40240b1f28b969a", size = 15514, upload-time = "2024-10-18T15:21:01.122Z" }, + { url = "https://files.pythonhosted.org/packages/6b/28/bbf83e3f76936960b850435576dd5e67034e200469571be53f69174a2dfd/MarkupSafe-3.0.2-cp311-cp311-macosx_10_9_universal2.whl", hash = "sha256:9025b4018f3a1314059769c7bf15441064b2207cb3f065e6ea1e7359cb46db9d", size = 14353, upload-time = "2024-10-18T15:21:02.187Z" }, + { url = "https://files.pythonhosted.org/packages/6c/30/316d194b093cde57d448a4c3209f22e3046c5bb2fb0820b118292b334be7/MarkupSafe-3.0.2-cp311-cp311-macosx_11_0_arm64.whl", hash = "sha256:93335ca3812df2f366e80509ae119189886b0f3c2b81325d39efdb84a1e2ae93", size = 12392, upload-time = "2024-10-18T15:21:02.941Z" }, + { url = "https://files.pythonhosted.org/packages/f2/96/9cdafba8445d3a53cae530aaf83c38ec64c4d5427d975c974084af5bc5d2/MarkupSafe-3.0.2-cp311-cp311-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:2cb8438c3cbb25e220c2ab33bb226559e7afb3baec11c4f218ffa7308603c832", size = 23984, upload-time = "2024-10-18T15:21:03.953Z" }, + { url = "https://files.pythonhosted.org/packages/f1/a4/aefb044a2cd8d7334c8a47d3fb2c9f328ac48cb349468cc31c20b539305f/MarkupSafe-3.0.2-cp311-cp311-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:a123e330ef0853c6e822384873bef7507557d8e4a082961e1defa947aa59ba84", size = 23120, upload-time = "2024-10-18T15:21:06.495Z" }, + { url = "https://files.pythonhosted.org/packages/8d/21/5e4851379f88f3fad1de30361db501300d4f07bcad047d3cb0449fc51f8c/MarkupSafe-3.0.2-cp311-cp311-manylinux_2_5_i686.manylinux1_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:1e084f686b92e5b83186b07e8a17fc09e38fff551f3602b249881fec658d3eca", size = 23032, upload-time = "2024-10-18T15:21:07.295Z" }, + { url = "https://files.pythonhosted.org/packages/00/7b/e92c64e079b2d0d7ddf69899c98842f3f9a60a1ae72657c89ce2655c999d/MarkupSafe-3.0.2-cp311-cp311-musllinux_1_2_aarch64.whl", hash = "sha256:d8213e09c917a951de9d09ecee036d5c7d36cb6cb7dbaece4c71a60d79fb9798", size = 24057, upload-time = "2024-10-18T15:21:08.073Z" }, + { url = "https://files.pythonhosted.org/packages/f9/ac/46f960ca323037caa0a10662ef97d0a4728e890334fc156b9f9e52bcc4ca/MarkupSafe-3.0.2-cp311-cp311-musllinux_1_2_i686.whl", hash = "sha256:5b02fb34468b6aaa40dfc198d813a641e3a63b98c2b05a16b9f80b7ec314185e", size = 23359, upload-time = "2024-10-18T15:21:09.318Z" }, + { url = "https://files.pythonhosted.org/packages/69/84/83439e16197337b8b14b6a5b9c2105fff81d42c2a7c5b58ac7b62ee2c3b1/MarkupSafe-3.0.2-cp311-cp311-musllinux_1_2_x86_64.whl", hash = "sha256:0bff5e0ae4ef2e1ae4fdf2dfd5b76c75e5c2fa4132d05fc1b0dabcd20c7e28c4", size = 23306, upload-time = "2024-10-18T15:21:10.185Z" }, + { url = "https://files.pythonhosted.org/packages/9a/34/a15aa69f01e2181ed8d2b685c0d2f6655d5cca2c4db0ddea775e631918cd/MarkupSafe-3.0.2-cp311-cp311-win32.whl", hash = "sha256:6c89876f41da747c8d3677a2b540fb32ef5715f97b66eeb0c6b66f5e3ef6f59d", size = 15094, upload-time = "2024-10-18T15:21:11.005Z" }, + { url = "https://files.pythonhosted.org/packages/da/b8/3a3bd761922d416f3dc5d00bfbed11f66b1ab89a0c2b6e887240a30b0f6b/MarkupSafe-3.0.2-cp311-cp311-win_amd64.whl", hash = "sha256:70a87b411535ccad5ef2f1df5136506a10775d267e197e4cf531ced10537bd6b", size = 15521, upload-time = "2024-10-18T15:21:12.911Z" }, + { url = "https://files.pythonhosted.org/packages/22/09/d1f21434c97fc42f09d290cbb6350d44eb12f09cc62c9476effdb33a18aa/MarkupSafe-3.0.2-cp312-cp312-macosx_10_13_universal2.whl", hash = "sha256:9778bd8ab0a994ebf6f84c2b949e65736d5575320a17ae8984a77fab08db94cf", size = 14274, upload-time = "2024-10-18T15:21:13.777Z" }, + { url = "https://files.pythonhosted.org/packages/6b/b0/18f76bba336fa5aecf79d45dcd6c806c280ec44538b3c13671d49099fdd0/MarkupSafe-3.0.2-cp312-cp312-macosx_11_0_arm64.whl", hash = "sha256:846ade7b71e3536c4e56b386c2a47adf5741d2d8b94ec9dc3e92e5e1ee1e2225", size = 12348, upload-time = "2024-10-18T15:21:14.822Z" }, + { url = "https://files.pythonhosted.org/packages/e0/25/dd5c0f6ac1311e9b40f4af06c78efde0f3b5cbf02502f8ef9501294c425b/MarkupSafe-3.0.2-cp312-cp312-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:1c99d261bd2d5f6b59325c92c73df481e05e57f19837bdca8413b9eac4bd8028", size = 24149, upload-time = "2024-10-18T15:21:15.642Z" }, + { url = "https://files.pythonhosted.org/packages/f3/f0/89e7aadfb3749d0f52234a0c8c7867877876e0a20b60e2188e9850794c17/MarkupSafe-3.0.2-cp312-cp312-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:e17c96c14e19278594aa4841ec148115f9c7615a47382ecb6b82bd8fea3ab0c8", size = 23118, upload-time = "2024-10-18T15:21:17.133Z" }, + { url = "https://files.pythonhosted.org/packages/d5/da/f2eeb64c723f5e3777bc081da884b414671982008c47dcc1873d81f625b6/MarkupSafe-3.0.2-cp312-cp312-manylinux_2_5_i686.manylinux1_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:88416bd1e65dcea10bc7569faacb2c20ce071dd1f87539ca2ab364bf6231393c", size = 22993, upload-time = "2024-10-18T15:21:18.064Z" }, + { url = "https://files.pythonhosted.org/packages/da/0e/1f32af846df486dce7c227fe0f2398dc7e2e51d4a370508281f3c1c5cddc/MarkupSafe-3.0.2-cp312-cp312-musllinux_1_2_aarch64.whl", hash = "sha256:2181e67807fc2fa785d0592dc2d6206c019b9502410671cc905d132a92866557", size = 24178, upload-time = "2024-10-18T15:21:18.859Z" }, + { url = "https://files.pythonhosted.org/packages/c4/f6/bb3ca0532de8086cbff5f06d137064c8410d10779c4c127e0e47d17c0b71/MarkupSafe-3.0.2-cp312-cp312-musllinux_1_2_i686.whl", hash = "sha256:52305740fe773d09cffb16f8ed0427942901f00adedac82ec8b67752f58a1b22", size = 23319, upload-time = "2024-10-18T15:21:19.671Z" }, + { url = "https://files.pythonhosted.org/packages/a2/82/8be4c96ffee03c5b4a034e60a31294daf481e12c7c43ab8e34a1453ee48b/MarkupSafe-3.0.2-cp312-cp312-musllinux_1_2_x86_64.whl", hash = "sha256:ad10d3ded218f1039f11a75f8091880239651b52e9bb592ca27de44eed242a48", size = 23352, upload-time = "2024-10-18T15:21:20.971Z" }, + { url = "https://files.pythonhosted.org/packages/51/ae/97827349d3fcffee7e184bdf7f41cd6b88d9919c80f0263ba7acd1bbcb18/MarkupSafe-3.0.2-cp312-cp312-win32.whl", hash = "sha256:0f4ca02bea9a23221c0182836703cbf8930c5e9454bacce27e767509fa286a30", size = 15097, upload-time = "2024-10-18T15:21:22.646Z" }, + { url = "https://files.pythonhosted.org/packages/c1/80/a61f99dc3a936413c3ee4e1eecac96c0da5ed07ad56fd975f1a9da5bc630/MarkupSafe-3.0.2-cp312-cp312-win_amd64.whl", hash = "sha256:8e06879fc22a25ca47312fbe7c8264eb0b662f6db27cb2d3bbbc74b1df4b9b87", size = 15601, upload-time = "2024-10-18T15:21:23.499Z" }, + { url = "https://files.pythonhosted.org/packages/83/0e/67eb10a7ecc77a0c2bbe2b0235765b98d164d81600746914bebada795e97/MarkupSafe-3.0.2-cp313-cp313-macosx_10_13_universal2.whl", hash = "sha256:ba9527cdd4c926ed0760bc301f6728ef34d841f405abf9d4f959c478421e4efd", size = 14274, upload-time = "2024-10-18T15:21:24.577Z" }, + { url = "https://files.pythonhosted.org/packages/2b/6d/9409f3684d3335375d04e5f05744dfe7e9f120062c9857df4ab490a1031a/MarkupSafe-3.0.2-cp313-cp313-macosx_11_0_arm64.whl", hash = "sha256:f8b3d067f2e40fe93e1ccdd6b2e1d16c43140e76f02fb1319a05cf2b79d99430", size = 12352, upload-time = "2024-10-18T15:21:25.382Z" }, + { url = "https://files.pythonhosted.org/packages/d2/f5/6eadfcd3885ea85fe2a7c128315cc1bb7241e1987443d78c8fe712d03091/MarkupSafe-3.0.2-cp313-cp313-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:569511d3b58c8791ab4c2e1285575265991e6d8f8700c7be0e88f86cb0672094", size = 24122, upload-time = "2024-10-18T15:21:26.199Z" }, + { url = "https://files.pythonhosted.org/packages/0c/91/96cf928db8236f1bfab6ce15ad070dfdd02ed88261c2afafd4b43575e9e9/MarkupSafe-3.0.2-cp313-cp313-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:15ab75ef81add55874e7ab7055e9c397312385bd9ced94920f2802310c930396", size = 23085, upload-time = "2024-10-18T15:21:27.029Z" }, + { url = "https://files.pythonhosted.org/packages/c2/cf/c9d56af24d56ea04daae7ac0940232d31d5a8354f2b457c6d856b2057d69/MarkupSafe-3.0.2-cp313-cp313-manylinux_2_5_i686.manylinux1_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:f3818cb119498c0678015754eba762e0d61e5b52d34c8b13d770f0719f7b1d79", size = 22978, upload-time = "2024-10-18T15:21:27.846Z" }, + { url = "https://files.pythonhosted.org/packages/2a/9f/8619835cd6a711d6272d62abb78c033bda638fdc54c4e7f4272cf1c0962b/MarkupSafe-3.0.2-cp313-cp313-musllinux_1_2_aarch64.whl", hash = "sha256:cdb82a876c47801bb54a690c5ae105a46b392ac6099881cdfb9f6e95e4014c6a", size = 24208, upload-time = "2024-10-18T15:21:28.744Z" }, + { url = "https://files.pythonhosted.org/packages/f9/bf/176950a1792b2cd2102b8ffeb5133e1ed984547b75db47c25a67d3359f77/MarkupSafe-3.0.2-cp313-cp313-musllinux_1_2_i686.whl", hash = "sha256:cabc348d87e913db6ab4aa100f01b08f481097838bdddf7c7a84b7575b7309ca", size = 23357, upload-time = "2024-10-18T15:21:29.545Z" }, + { url = "https://files.pythonhosted.org/packages/ce/4f/9a02c1d335caabe5c4efb90e1b6e8ee944aa245c1aaaab8e8a618987d816/MarkupSafe-3.0.2-cp313-cp313-musllinux_1_2_x86_64.whl", hash = "sha256:444dcda765c8a838eaae23112db52f1efaf750daddb2d9ca300bcae1039adc5c", size = 23344, upload-time = "2024-10-18T15:21:30.366Z" }, + { url = "https://files.pythonhosted.org/packages/ee/55/c271b57db36f748f0e04a759ace9f8f759ccf22b4960c270c78a394f58be/MarkupSafe-3.0.2-cp313-cp313-win32.whl", hash = "sha256:bcf3e58998965654fdaff38e58584d8937aa3096ab5354d493c77d1fdd66d7a1", size = 15101, upload-time = "2024-10-18T15:21:31.207Z" }, + { url = "https://files.pythonhosted.org/packages/29/88/07df22d2dd4df40aba9f3e402e6dc1b8ee86297dddbad4872bd5e7b0094f/MarkupSafe-3.0.2-cp313-cp313-win_amd64.whl", hash = "sha256:e6a2a455bd412959b57a172ce6328d2dd1f01cb2135efda2e4576e8a23fa3b0f", size = 15603, upload-time = "2024-10-18T15:21:32.032Z" }, + { url = "https://files.pythonhosted.org/packages/62/6a/8b89d24db2d32d433dffcd6a8779159da109842434f1dd2f6e71f32f738c/MarkupSafe-3.0.2-cp313-cp313t-macosx_10_13_universal2.whl", hash = "sha256:b5a6b3ada725cea8a5e634536b1b01c30bcdcd7f9c6fff4151548d5bf6b3a36c", size = 14510, upload-time = "2024-10-18T15:21:33.625Z" }, + { url = "https://files.pythonhosted.org/packages/7a/06/a10f955f70a2e5a9bf78d11a161029d278eeacbd35ef806c3fd17b13060d/MarkupSafe-3.0.2-cp313-cp313t-macosx_11_0_arm64.whl", hash = "sha256:a904af0a6162c73e3edcb969eeeb53a63ceeb5d8cf642fade7d39e7963a22ddb", size = 12486, upload-time = "2024-10-18T15:21:34.611Z" }, + { url = "https://files.pythonhosted.org/packages/34/cf/65d4a571869a1a9078198ca28f39fba5fbb910f952f9dbc5220afff9f5e6/MarkupSafe-3.0.2-cp313-cp313t-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:4aa4e5faecf353ed117801a068ebab7b7e09ffb6e1d5e412dc852e0da018126c", size = 25480, upload-time = "2024-10-18T15:21:35.398Z" }, + { url = "https://files.pythonhosted.org/packages/0c/e3/90e9651924c430b885468b56b3d597cabf6d72be4b24a0acd1fa0e12af67/MarkupSafe-3.0.2-cp313-cp313t-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:c0ef13eaeee5b615fb07c9a7dadb38eac06a0608b41570d8ade51c56539e509d", size = 23914, upload-time = "2024-10-18T15:21:36.231Z" }, + { url = "https://files.pythonhosted.org/packages/66/8c/6c7cf61f95d63bb866db39085150df1f2a5bd3335298f14a66b48e92659c/MarkupSafe-3.0.2-cp313-cp313t-manylinux_2_5_i686.manylinux1_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:d16a81a06776313e817c951135cf7340a3e91e8c1ff2fac444cfd75fffa04afe", size = 23796, upload-time = "2024-10-18T15:21:37.073Z" }, + { url = "https://files.pythonhosted.org/packages/bb/35/cbe9238ec3f47ac9a7c8b3df7a808e7cb50fe149dc7039f5f454b3fba218/MarkupSafe-3.0.2-cp313-cp313t-musllinux_1_2_aarch64.whl", hash = "sha256:6381026f158fdb7c72a168278597a5e3a5222e83ea18f543112b2662a9b699c5", size = 25473, upload-time = "2024-10-18T15:21:37.932Z" }, + { url = "https://files.pythonhosted.org/packages/e6/32/7621a4382488aa283cc05e8984a9c219abad3bca087be9ec77e89939ded9/MarkupSafe-3.0.2-cp313-cp313t-musllinux_1_2_i686.whl", hash = "sha256:3d79d162e7be8f996986c064d1c7c817f6df3a77fe3d6859f6f9e7be4b8c213a", size = 24114, upload-time = "2024-10-18T15:21:39.799Z" }, + { url = "https://files.pythonhosted.org/packages/0d/80/0985960e4b89922cb5a0bac0ed39c5b96cbc1a536a99f30e8c220a996ed9/MarkupSafe-3.0.2-cp313-cp313t-musllinux_1_2_x86_64.whl", hash = "sha256:131a3c7689c85f5ad20f9f6fb1b866f402c445b220c19fe4308c0b147ccd2ad9", size = 24098, upload-time = "2024-10-18T15:21:40.813Z" }, + { url = "https://files.pythonhosted.org/packages/82/78/fedb03c7d5380df2427038ec8d973587e90561b2d90cd472ce9254cf348b/MarkupSafe-3.0.2-cp313-cp313t-win32.whl", hash = "sha256:ba8062ed2cf21c07a9e295d5b8a2a5ce678b913b45fdf68c32d95d6c1291e0b6", size = 15208, upload-time = "2024-10-18T15:21:41.814Z" }, + { url = "https://files.pythonhosted.org/packages/4f/65/6079a46068dfceaeabb5dcad6d674f5f5c61a6fa5673746f42a9f4c233b3/MarkupSafe-3.0.2-cp313-cp313t-win_amd64.whl", hash = "sha256:e444a31f8db13eb18ada366ab3cf45fd4b31e4db1236a4448f68778c1d1a5a2f", size = 15739, upload-time = "2024-10-18T15:21:42.784Z" }, ] [[package]] @@ -1109,9 +1110,9 @@ source = { registry = "https://pypi.org/simple" } dependencies = [ { name = "traitlets" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/99/5b/a36a337438a14116b16480db471ad061c36c3694df7c2084a0da7ba538b7/matplotlib_inline-0.1.7.tar.gz", hash = "sha256:8423b23ec666be3d16e16b60bdd8ac4e86e840ebd1dd11a30b9f117f2fa0ab90", size = 8159 } +sdist = { url = "https://files.pythonhosted.org/packages/99/5b/a36a337438a14116b16480db471ad061c36c3694df7c2084a0da7ba538b7/matplotlib_inline-0.1.7.tar.gz", hash = "sha256:8423b23ec666be3d16e16b60bdd8ac4e86e840ebd1dd11a30b9f117f2fa0ab90", size = 8159, upload-time = "2024-04-15T13:44:44.803Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/8f/8e/9ad090d3553c280a8060fbf6e24dc1c0c29704ee7d1c372f0c174aa59285/matplotlib_inline-0.1.7-py3-none-any.whl", hash = "sha256:df192d39a4ff8f21b1895d72e6a13f5fcc5099f00fa84384e0ea28c2cc0653ca", size = 9899 }, + { url = "https://files.pythonhosted.org/packages/8f/8e/9ad090d3553c280a8060fbf6e24dc1c0c29704ee7d1c372f0c174aa59285/matplotlib_inline-0.1.7-py3-none-any.whl", hash = "sha256:df192d39a4ff8f21b1895d72e6a13f5fcc5099f00fa84384e0ea28c2cc0653ca", size = 9899, upload-time = "2024-04-15T13:44:43.265Z" }, ] [[package]] @@ -1121,18 +1122,18 @@ source = { registry = "https://pypi.org/simple" } dependencies = [ { name = "markdown-it-py" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/19/03/a2ecab526543b152300717cf232bb4bb8605b6edb946c845016fa9c9c9fd/mdit_py_plugins-0.4.2.tar.gz", hash = "sha256:5f2cd1fdb606ddf152d37ec30e46101a60512bc0e5fa1a7002c36647b09e26b5", size = 43542 } +sdist = { url = "https://files.pythonhosted.org/packages/19/03/a2ecab526543b152300717cf232bb4bb8605b6edb946c845016fa9c9c9fd/mdit_py_plugins-0.4.2.tar.gz", hash = "sha256:5f2cd1fdb606ddf152d37ec30e46101a60512bc0e5fa1a7002c36647b09e26b5", size = 43542, upload-time = "2024-09-09T20:27:49.564Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/a7/f7/7782a043553ee469c1ff49cfa1cdace2d6bf99a1f333cf38676b3ddf30da/mdit_py_plugins-0.4.2-py3-none-any.whl", hash = "sha256:0c673c3f889399a33b95e88d2f0d111b4447bdfea7f237dab2d488f459835636", size = 55316 }, + { url = "https://files.pythonhosted.org/packages/a7/f7/7782a043553ee469c1ff49cfa1cdace2d6bf99a1f333cf38676b3ddf30da/mdit_py_plugins-0.4.2-py3-none-any.whl", hash = "sha256:0c673c3f889399a33b95e88d2f0d111b4447bdfea7f237dab2d488f459835636", size = 55316, upload-time = "2024-09-09T20:27:48.397Z" }, ] [[package]] name = "mdurl" version = "0.1.2" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/d6/54/cfe61301667036ec958cb99bd3efefba235e65cdeb9c84d24a8293ba1d90/mdurl-0.1.2.tar.gz", hash = "sha256:bb413d29f5eea38f31dd4754dd7377d4465116fb207585f97bf925588687c1ba", size = 8729 } +sdist = { url = "https://files.pythonhosted.org/packages/d6/54/cfe61301667036ec958cb99bd3efefba235e65cdeb9c84d24a8293ba1d90/mdurl-0.1.2.tar.gz", hash = "sha256:bb413d29f5eea38f31dd4754dd7377d4465116fb207585f97bf925588687c1ba", size = 8729, upload-time = "2022-08-14T12:40:10.846Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/b3/38/89ba8ad64ae25be8de66a6d463314cf1eb366222074cfda9ee839c56a4b4/mdurl-0.1.2-py3-none-any.whl", hash = "sha256:84008a41e51615a49fc9966191ff91509e3c40b939176e643fd50a5c2196b8f8", size = 9979 }, + { url = "https://files.pythonhosted.org/packages/b3/38/89ba8ad64ae25be8de66a6d463314cf1eb366222074cfda9ee839c56a4b4/mdurl-0.1.2-py3-none-any.whl", hash = "sha256:84008a41e51615a49fc9966191ff91509e3c40b939176e643fd50a5c2196b8f8", size = 9979, upload-time = "2022-08-14T12:40:09.779Z" }, ] [[package]] @@ -1146,18 +1147,18 @@ dependencies = [ { name = "typing-extensions" }, { name = "urllib3" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/9e/68/86a1cef80396e6a35a6fc4fafee5d28578c1a137bddd3ca2aa86f9b26a22/minio-7.2.15.tar.gz", hash = "sha256:5247df5d4dca7bfa4c9b20093acd5ad43e82d8710ceb059d79c6eea970f49f79", size = 138040 } +sdist = { url = "https://files.pythonhosted.org/packages/9e/68/86a1cef80396e6a35a6fc4fafee5d28578c1a137bddd3ca2aa86f9b26a22/minio-7.2.15.tar.gz", hash = "sha256:5247df5d4dca7bfa4c9b20093acd5ad43e82d8710ceb059d79c6eea970f49f79", size = 138040, upload-time = "2025-01-19T08:57:26.626Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/fb/6f/3690028e846fe432bfa5ba724a0dc37ec9c914965b7733e19d8ca2c4c48d/minio-7.2.15-py3-none-any.whl", hash = "sha256:c06ef7a43e5d67107067f77b6c07ebdd68733e5aa7eed03076472410ca19d876", size = 95075 }, + { url = "https://files.pythonhosted.org/packages/fb/6f/3690028e846fe432bfa5ba724a0dc37ec9c914965b7733e19d8ca2c4c48d/minio-7.2.15-py3-none-any.whl", hash = "sha256:c06ef7a43e5d67107067f77b6c07ebdd68733e5aa7eed03076472410ca19d876", size = 95075, upload-time = "2025-01-19T08:57:24.169Z" }, ] [[package]] name = "mypy-extensions" version = "1.1.0" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/a2/6e/371856a3fb9d31ca8dac321cda606860fa4548858c0cc45d9d1d4ca2628b/mypy_extensions-1.1.0.tar.gz", hash = "sha256:52e68efc3284861e772bbcd66823fde5ae21fd2fdb51c62a211403730b916558", size = 6343 } +sdist = { url = "https://files.pythonhosted.org/packages/a2/6e/371856a3fb9d31ca8dac321cda606860fa4548858c0cc45d9d1d4ca2628b/mypy_extensions-1.1.0.tar.gz", hash = "sha256:52e68efc3284861e772bbcd66823fde5ae21fd2fdb51c62a211403730b916558", size = 6343, upload-time = "2025-04-22T14:54:24.164Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/79/7b/2c79738432f5c924bef5071f933bcc9efd0473bac3b4aa584a6f7c1c8df8/mypy_extensions-1.1.0-py3-none-any.whl", hash = "sha256:1be4cccdb0f2482337c4743e60421de3a356cd97508abadd57d47403e94f5505", size = 4963 }, + { url = "https://files.pythonhosted.org/packages/79/7b/2c79738432f5c924bef5071f933bcc9efd0473bac3b4aa584a6f7c1c8df8/mypy_extensions-1.1.0-py3-none-any.whl", hash = "sha256:1be4cccdb0f2482337c4743e60421de3a356cd97508abadd57d47403e94f5505", size = 4963, upload-time = "2025-04-22T14:54:22.983Z" }, ] [[package]] @@ -1172,27 +1173,27 @@ dependencies = [ { name = "pyyaml" }, { name = "sphinx" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/66/a5/9626ba4f73555b3735ad86247a8077d4603aa8628537687c839ab08bfe44/myst_parser-4.0.1.tar.gz", hash = "sha256:5cfea715e4f3574138aecbf7d54132296bfd72bb614d31168f48c477a830a7c4", size = 93985 } +sdist = { url = "https://files.pythonhosted.org/packages/66/a5/9626ba4f73555b3735ad86247a8077d4603aa8628537687c839ab08bfe44/myst_parser-4.0.1.tar.gz", hash = "sha256:5cfea715e4f3574138aecbf7d54132296bfd72bb614d31168f48c477a830a7c4", size = 93985, upload-time = "2025-02-12T10:53:03.833Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/5f/df/76d0321c3797b54b60fef9ec3bd6f4cfd124b9e422182156a1dd418722cf/myst_parser-4.0.1-py3-none-any.whl", hash = "sha256:9134e88959ec3b5780aedf8a99680ea242869d012e8821db3126d427edc9c95d", size = 84579 }, + { url = "https://files.pythonhosted.org/packages/5f/df/76d0321c3797b54b60fef9ec3bd6f4cfd124b9e422182156a1dd418722cf/myst_parser-4.0.1-py3-none-any.whl", hash = "sha256:9134e88959ec3b5780aedf8a99680ea242869d012e8821db3126d427edc9c95d", size = 84579, upload-time = "2025-02-12T10:53:02.078Z" }, ] [[package]] name = "nodeenv" version = "1.9.1" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/43/16/fc88b08840de0e0a72a2f9d8c6bae36be573e475a6326ae854bcc549fc45/nodeenv-1.9.1.tar.gz", hash = "sha256:6ec12890a2dab7946721edbfbcd91f3319c6ccc9aec47be7c7e6b7011ee6645f", size = 47437 } +sdist = { url = "https://files.pythonhosted.org/packages/43/16/fc88b08840de0e0a72a2f9d8c6bae36be573e475a6326ae854bcc549fc45/nodeenv-1.9.1.tar.gz", hash = "sha256:6ec12890a2dab7946721edbfbcd91f3319c6ccc9aec47be7c7e6b7011ee6645f", size = 47437, upload-time = "2024-06-04T18:44:11.171Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/d2/1d/1b658dbd2b9fa9c4c9f32accbfc0205d532c8c6194dc0f2a4c0428e7128a/nodeenv-1.9.1-py2.py3-none-any.whl", hash = "sha256:ba11c9782d29c27c70ffbdda2d7415098754709be8a7056d79a737cd901155c9", size = 22314 }, + { url = "https://files.pythonhosted.org/packages/d2/1d/1b658dbd2b9fa9c4c9f32accbfc0205d532c8c6194dc0f2a4c0428e7128a/nodeenv-1.9.1-py2.py3-none-any.whl", hash = "sha256:ba11c9782d29c27c70ffbdda2d7415098754709be8a7056d79a737cd901155c9", size = 22314, upload-time = "2024-06-04T18:44:08.352Z" }, ] [[package]] name = "oauthlib" version = "3.2.2" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/6d/fa/fbf4001037904031639e6bfbfc02badfc7e12f137a8afa254df6c4c8a670/oauthlib-3.2.2.tar.gz", hash = "sha256:9859c40929662bec5d64f34d01c99e093149682a3f38915dc0655d5a633dd918", size = 177352 } +sdist = { url = "https://files.pythonhosted.org/packages/6d/fa/fbf4001037904031639e6bfbfc02badfc7e12f137a8afa254df6c4c8a670/oauthlib-3.2.2.tar.gz", hash = "sha256:9859c40929662bec5d64f34d01c99e093149682a3f38915dc0655d5a633dd918", size = 177352, upload-time = "2022-10-17T20:04:27.471Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/7e/80/cab10959dc1faead58dc8384a781dfbf93cb4d33d50988f7a69f1b7c9bbe/oauthlib-3.2.2-py3-none-any.whl", hash = "sha256:8139f29aac13e25d502680e9e19963e83f16838d48a0d71c287fe40e7067fbca", size = 151688 }, + { url = "https://files.pythonhosted.org/packages/7e/80/cab10959dc1faead58dc8384a781dfbf93cb4d33d50988f7a69f1b7c9bbe/oauthlib-3.2.2-py3-none-any.whl", hash = "sha256:8139f29aac13e25d502680e9e19963e83f16838d48a0d71c287fe40e7067fbca", size = 151688, upload-time = "2022-10-17T20:04:24.037Z" }, ] [[package]] @@ -1203,9 +1204,9 @@ dependencies = [ { name = "importlib-metadata" }, { name = "typing-extensions" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/4d/5e/94a8cb759e4e409022229418294e098ca7feca00eb3c467bb20cbd329bda/opentelemetry_api-1.34.1.tar.gz", hash = "sha256:64f0bd06d42824843731d05beea88d4d4b6ae59f9fe347ff7dfa2cc14233bbb3", size = 64987 } +sdist = { url = "https://files.pythonhosted.org/packages/4d/5e/94a8cb759e4e409022229418294e098ca7feca00eb3c467bb20cbd329bda/opentelemetry_api-1.34.1.tar.gz", hash = "sha256:64f0bd06d42824843731d05beea88d4d4b6ae59f9fe347ff7dfa2cc14233bbb3", size = 64987, upload-time = "2025-06-10T08:55:19.818Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/a5/3a/2ba85557e8dc024c0842ad22c570418dc02c36cbd1ab4b832a93edf071b8/opentelemetry_api-1.34.1-py3-none-any.whl", hash = "sha256:b7df4cb0830d5a6c29ad0c0691dbae874d8daefa934b8b1d642de48323d32a8c", size = 65767 }, + { url = "https://files.pythonhosted.org/packages/a5/3a/2ba85557e8dc024c0842ad22c570418dc02c36cbd1ab4b832a93edf071b8/opentelemetry_api-1.34.1-py3-none-any.whl", hash = "sha256:b7df4cb0830d5a6c29ad0c0691dbae874d8daefa934b8b1d642de48323d32a8c", size = 65767, upload-time = "2025-06-10T08:54:56.717Z" }, ] [[package]] @@ -1217,9 +1218,9 @@ dependencies = [ { name = "opentelemetry-semantic-conventions" }, { name = "typing-extensions" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/6f/41/fe20f9036433da8e0fcef568984da4c1d1c771fa072ecd1a4d98779dccdd/opentelemetry_sdk-1.34.1.tar.gz", hash = "sha256:8091db0d763fcd6098d4781bbc80ff0971f94e260739aa6afe6fd379cdf3aa4d", size = 159441 } +sdist = { url = "https://files.pythonhosted.org/packages/6f/41/fe20f9036433da8e0fcef568984da4c1d1c771fa072ecd1a4d98779dccdd/opentelemetry_sdk-1.34.1.tar.gz", hash = "sha256:8091db0d763fcd6098d4781bbc80ff0971f94e260739aa6afe6fd379cdf3aa4d", size = 159441, upload-time = "2025-06-10T08:55:33.028Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/07/1b/def4fe6aa73f483cabf4c748f4c25070d5f7604dcc8b52e962983491b29e/opentelemetry_sdk-1.34.1-py3-none-any.whl", hash = "sha256:308effad4059562f1d92163c61c8141df649da24ce361827812c40abb2a1e96e", size = 118477 }, + { url = "https://files.pythonhosted.org/packages/07/1b/def4fe6aa73f483cabf4c748f4c25070d5f7604dcc8b52e962983491b29e/opentelemetry_sdk-1.34.1-py3-none-any.whl", hash = "sha256:308effad4059562f1d92163c61c8141df649da24ce361827812c40abb2a1e96e", size = 118477, upload-time = "2025-06-10T08:55:16.02Z" }, ] [[package]] @@ -1230,9 +1231,9 @@ dependencies = [ { name = "opentelemetry-api" }, { name = "typing-extensions" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/5d/f0/f33458486da911f47c4aa6db9bda308bb80f3236c111bf848bd870c16b16/opentelemetry_semantic_conventions-0.55b1.tar.gz", hash = "sha256:ef95b1f009159c28d7a7849f5cbc71c4c34c845bb514d66adfdf1b3fff3598b3", size = 119829 } +sdist = { url = "https://files.pythonhosted.org/packages/5d/f0/f33458486da911f47c4aa6db9bda308bb80f3236c111bf848bd870c16b16/opentelemetry_semantic_conventions-0.55b1.tar.gz", hash = "sha256:ef95b1f009159c28d7a7849f5cbc71c4c34c845bb514d66adfdf1b3fff3598b3", size = 119829, upload-time = "2025-06-10T08:55:33.881Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/1a/89/267b0af1b1d0ba828f0e60642b6a5116ac1fd917cde7fc02821627029bd1/opentelemetry_semantic_conventions-0.55b1-py3-none-any.whl", hash = "sha256:5da81dfdf7d52e3d37f8fe88d5e771e191de924cfff5f550ab0b8f7b2409baed", size = 196223 }, + { url = "https://files.pythonhosted.org/packages/1a/89/267b0af1b1d0ba828f0e60642b6a5116ac1fd917cde7fc02821627029bd1/opentelemetry_semantic_conventions-0.55b1-py3-none-any.whl", hash = "sha256:5da81dfdf7d52e3d37f8fe88d5e771e191de924cfff5f550ab0b8f7b2409baed", size = 196223, upload-time = "2025-06-10T08:55:17.638Z" }, ] [[package]] @@ -1266,6 +1267,7 @@ docs = [ { name = "linkify-it-py" }, { name = "myst-parser" }, { name = "ops", extra = ["testing", "tracing"] }, + { name = "ops-tools" }, { name = "pyspelling" }, { name = "sphinx" }, { name = "sphinx-autobuild" }, @@ -1283,6 +1285,7 @@ integration = [ { name = "juju" }, { name = "minio" }, { name = "ops", extra = ["testing", "tracing"] }, + { name = "ops-tools" }, { name = "pytest" }, { name = "pytest-operator" }, ] @@ -1292,12 +1295,14 @@ lint = [ ] static = [ { name = "ops", extra = ["testing", "tracing"] }, + { name = "ops-tools" }, { name = "pyright" }, { name = "typing-extensions" }, ] unit = [ { name = "jsonpatch" }, { name = "ops", extra = ["testing", "tracing"] }, + { name = "ops-tools" }, { name = "pydantic" }, { name = "pytest" }, ] @@ -1325,6 +1330,7 @@ docs = [ { name = "linkify-it-py" }, { name = "myst-parser", marker = "python_full_version >= '3.10'" }, { name = "ops", extras = ["testing", "tracing"], editable = "." }, + { name = "ops-tools", editable = "tools" }, { name = "pyspelling" }, { name = "sphinx", marker = "python_full_version >= '3.10'", specifier = "~=8.0.0" }, { name = "sphinx-autobuild" }, @@ -1342,6 +1348,7 @@ integration = [ { name = "juju", specifier = ">=2.9,<4" }, { name = "minio", specifier = "~=7.2" }, { name = "ops", extras = ["testing", "tracing"], editable = "." }, + { name = "ops-tools", editable = "tools" }, { name = "pytest", specifier = "~=8.4" }, { name = "pytest-operator", specifier = "~=0.23" }, ] @@ -1351,6 +1358,7 @@ lint = [ ] static = [ { name = "ops", extras = ["testing", "tracing"], editable = "." }, + { name = "ops-tools", editable = "tools" }, { name = "pyright", specifier = "==1.1.385" }, { name = "typing-extensions", specifier = "~=4.2" }, ] @@ -1358,6 +1366,7 @@ unit = [ { name = "eval-type-backport", marker = "python_full_version < '3.10'", specifier = "~=0.2" }, { name = "jsonpatch", specifier = "~=1.33" }, { name = "ops", extras = ["testing", "tracing"], editable = "." }, + { name = "ops-tools", editable = "tools" }, { name = "pydantic", specifier = "~=2.10" }, { name = "pytest", specifier = "~=8.4" }, ] @@ -1378,6 +1387,23 @@ requires-dist = [ { name = "pyyaml", specifier = ">=6.0.1" }, ] +[[package]] +name = "ops-tools" +version = "1.2.0.dev0" +source = { editable = "tools" } +dependencies = [ + { name = "ops" }, + { name = "pyyaml" }, + { name = "typing-extensions" }, +] + +[package.metadata] +requires-dist = [ + { name = "ops", editable = "." }, + { name = "pyyaml", specifier = ">=6.0.1" }, + { name = "typing-extensions", specifier = "~=4.2" }, +] + [[package]] name = "ops-tracing" version = "3.1.0.dev0" @@ -1417,9 +1443,9 @@ testing = [{ name = "pytest", specifier = "~=8.4" }] name = "packaging" version = "25.0" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/a1/d4/1fc4078c65507b51b96ca8f8c3ba19e6a61c8253c72794544580a7b6c24d/packaging-25.0.tar.gz", hash = "sha256:d443872c98d677bf60f6a1f2f8c1cb748e8fe762d2bf9d3148b5599295b0fc4f", size = 165727 } +sdist = { url = "https://files.pythonhosted.org/packages/a1/d4/1fc4078c65507b51b96ca8f8c3ba19e6a61c8253c72794544580a7b6c24d/packaging-25.0.tar.gz", hash = "sha256:d443872c98d677bf60f6a1f2f8c1cb748e8fe762d2bf9d3148b5599295b0fc4f", size = 165727, upload-time = "2025-04-19T11:48:59.673Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/20/12/38679034af332785aac8774540895e234f4d07f7545804097de4b666afd8/packaging-25.0-py3-none-any.whl", hash = "sha256:29572ef2b1f17581046b3a2227d5c611fb25ec70ca1ba8554b24b0e69331a484", size = 66469 }, + { url = "https://files.pythonhosted.org/packages/20/12/38679034af332785aac8774540895e234f4d07f7545804097de4b666afd8/packaging-25.0-py3-none-any.whl", hash = "sha256:29572ef2b1f17581046b3a2227d5c611fb25ec70ca1ba8554b24b0e69331a484", size = 66469, upload-time = "2025-04-19T11:48:57.875Z" }, ] [[package]] @@ -1431,18 +1457,18 @@ dependencies = [ { name = "cryptography" }, { name = "pynacl" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/7d/15/ad6ce226e8138315f2451c2aeea985bf35ee910afb477bae7477dc3a8f3b/paramiko-3.5.1.tar.gz", hash = "sha256:b2c665bc45b2b215bd7d7f039901b14b067da00f3a11e6640995fd58f2664822", size = 1566110 } +sdist = { url = "https://files.pythonhosted.org/packages/7d/15/ad6ce226e8138315f2451c2aeea985bf35ee910afb477bae7477dc3a8f3b/paramiko-3.5.1.tar.gz", hash = "sha256:b2c665bc45b2b215bd7d7f039901b14b067da00f3a11e6640995fd58f2664822", size = 1566110, upload-time = "2025-02-04T02:37:59.783Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/15/f8/c7bd0ef12954a81a1d3cea60a13946bd9a49a0036a5927770c461eade7ae/paramiko-3.5.1-py3-none-any.whl", hash = "sha256:43b9a0501fc2b5e70680388d9346cf252cfb7d00b0667c39e80eb43a408b8f61", size = 227298 }, + { url = "https://files.pythonhosted.org/packages/15/f8/c7bd0ef12954a81a1d3cea60a13946bd9a49a0036a5927770c461eade7ae/paramiko-3.5.1-py3-none-any.whl", hash = "sha256:43b9a0501fc2b5e70680388d9346cf252cfb7d00b0667c39e80eb43a408b8f61", size = 227298, upload-time = "2025-02-04T02:37:57.672Z" }, ] [[package]] name = "parso" version = "0.8.4" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/66/94/68e2e17afaa9169cf6412ab0f28623903be73d1b32e208d9e8e541bb086d/parso-0.8.4.tar.gz", hash = "sha256:eb3a7b58240fb99099a345571deecc0f9540ea5f4dd2fe14c2a99d6b281ab92d", size = 400609 } +sdist = { url = "https://files.pythonhosted.org/packages/66/94/68e2e17afaa9169cf6412ab0f28623903be73d1b32e208d9e8e541bb086d/parso-0.8.4.tar.gz", hash = "sha256:eb3a7b58240fb99099a345571deecc0f9540ea5f4dd2fe14c2a99d6b281ab92d", size = 400609, upload-time = "2024-04-05T09:43:55.897Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/c6/ac/dac4a63f978e4dcb3c6d3a78c4d8e0192a113d288502a1216950c41b1027/parso-0.8.4-py2.py3-none-any.whl", hash = "sha256:a418670a20291dacd2dddc80c377c5c3791378ee1e8d12bffc35420643d43f18", size = 103650 }, + { url = "https://files.pythonhosted.org/packages/c6/ac/dac4a63f978e4dcb3c6d3a78c4d8e0192a113d288502a1216950c41b1027/parso-0.8.4-py2.py3-none-any.whl", hash = "sha256:a418670a20291dacd2dddc80c377c5c3791378ee1e8d12bffc35420643d43f18", size = 103650, upload-time = "2024-04-05T09:43:53.299Z" }, ] [[package]] @@ -1452,18 +1478,18 @@ source = { registry = "https://pypi.org/simple" } dependencies = [ { name = "ptyprocess" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/42/92/cc564bf6381ff43ce1f4d06852fc19a2f11d180f23dc32d9588bee2f149d/pexpect-4.9.0.tar.gz", hash = "sha256:ee7d41123f3c9911050ea2c2dac107568dc43b2d3b0c7557a33212c398ead30f", size = 166450 } +sdist = { url = "https://files.pythonhosted.org/packages/42/92/cc564bf6381ff43ce1f4d06852fc19a2f11d180f23dc32d9588bee2f149d/pexpect-4.9.0.tar.gz", hash = "sha256:ee7d41123f3c9911050ea2c2dac107568dc43b2d3b0c7557a33212c398ead30f", size = 166450, upload-time = "2023-11-25T09:07:26.339Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/9e/c3/059298687310d527a58bb01f3b1965787ee3b40dce76752eda8b44e9a2c5/pexpect-4.9.0-py2.py3-none-any.whl", hash = "sha256:7236d1e080e4936be2dc3e326cec0af72acf9212a7e1d060210e70a47e253523", size = 63772 }, + { url = "https://files.pythonhosted.org/packages/9e/c3/059298687310d527a58bb01f3b1965787ee3b40dce76752eda8b44e9a2c5/pexpect-4.9.0-py2.py3-none-any.whl", hash = "sha256:7236d1e080e4936be2dc3e326cec0af72acf9212a7e1d060210e70a47e253523", size = 63772, upload-time = "2023-11-25T06:56:14.81Z" }, ] [[package]] name = "pluggy" version = "1.6.0" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/f9/e2/3e91f31a7d2b083fe6ef3fa267035b518369d9511ffab804f839851d2779/pluggy-1.6.0.tar.gz", hash = "sha256:7dcc130b76258d33b90f61b658791dede3486c3e6bfb003ee5c9bfb396dd22f3", size = 69412 } +sdist = { url = "https://files.pythonhosted.org/packages/f9/e2/3e91f31a7d2b083fe6ef3fa267035b518369d9511ffab804f839851d2779/pluggy-1.6.0.tar.gz", hash = "sha256:7dcc130b76258d33b90f61b658791dede3486c3e6bfb003ee5c9bfb396dd22f3", size = 69412, upload-time = "2025-05-15T12:30:07.975Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/54/20/4d324d65cc6d9205fabedc306948156824eb9f0ee1633355a8f7ec5c66bf/pluggy-1.6.0-py3-none-any.whl", hash = "sha256:e920276dd6813095e9377c0bc5566d94c932c33b27a3e3945d8389c374dd4746", size = 20538 }, + { url = "https://files.pythonhosted.org/packages/54/20/4d324d65cc6d9205fabedc306948156824eb9f0ee1633355a8f7ec5c66bf/pluggy-1.6.0-py3-none-any.whl", hash = "sha256:e920276dd6813095e9377c0bc5566d94c932c33b27a3e3945d8389c374dd4746", size = 20538, upload-time = "2025-05-15T12:30:06.134Z" }, ] [[package]] @@ -1473,59 +1499,59 @@ source = { registry = "https://pypi.org/simple" } dependencies = [ { name = "wcwidth" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/bb/6e/9d084c929dfe9e3bfe0c6a47e31f78a25c54627d64a66e884a8bf5474f1c/prompt_toolkit-3.0.51.tar.gz", hash = "sha256:931a162e3b27fc90c86f1b48bb1fb2c528c2761475e57c9c06de13311c7b54ed", size = 428940 } +sdist = { url = "https://files.pythonhosted.org/packages/bb/6e/9d084c929dfe9e3bfe0c6a47e31f78a25c54627d64a66e884a8bf5474f1c/prompt_toolkit-3.0.51.tar.gz", hash = "sha256:931a162e3b27fc90c86f1b48bb1fb2c528c2761475e57c9c06de13311c7b54ed", size = 428940, upload-time = "2025-04-15T09:18:47.731Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/ce/4f/5249960887b1fbe561d9ff265496d170b55a735b76724f10ef19f9e40716/prompt_toolkit-3.0.51-py3-none-any.whl", hash = "sha256:52742911fde84e2d423e2f9a4cf1de7d7ac4e51958f648d9540e0fb8db077b07", size = 387810 }, + { url = "https://files.pythonhosted.org/packages/ce/4f/5249960887b1fbe561d9ff265496d170b55a735b76724f10ef19f9e40716/prompt_toolkit-3.0.51-py3-none-any.whl", hash = "sha256:52742911fde84e2d423e2f9a4cf1de7d7ac4e51958f648d9540e0fb8db077b07", size = 387810, upload-time = "2025-04-15T09:18:44.753Z" }, ] [[package]] name = "protobuf" version = "6.31.1" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/52/f3/b9655a711b32c19720253f6f06326faf90580834e2e83f840472d752bc8b/protobuf-6.31.1.tar.gz", hash = "sha256:d8cac4c982f0b957a4dc73a80e2ea24fab08e679c0de9deb835f4a12d69aca9a", size = 441797 } +sdist = { url = "https://files.pythonhosted.org/packages/52/f3/b9655a711b32c19720253f6f06326faf90580834e2e83f840472d752bc8b/protobuf-6.31.1.tar.gz", hash = "sha256:d8cac4c982f0b957a4dc73a80e2ea24fab08e679c0de9deb835f4a12d69aca9a", size = 441797, upload-time = "2025-05-28T19:25:54.947Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/f3/6f/6ab8e4bf962fd5570d3deaa2d5c38f0a363f57b4501047b5ebeb83ab1125/protobuf-6.31.1-cp310-abi3-win32.whl", hash = "sha256:7fa17d5a29c2e04b7d90e5e32388b8bfd0e7107cd8e616feef7ed3fa6bdab5c9", size = 423603 }, - { url = "https://files.pythonhosted.org/packages/44/3a/b15c4347dd4bf3a1b0ee882f384623e2063bb5cf9fa9d57990a4f7df2fb6/protobuf-6.31.1-cp310-abi3-win_amd64.whl", hash = "sha256:426f59d2964864a1a366254fa703b8632dcec0790d8862d30034d8245e1cd447", size = 435283 }, - { url = "https://files.pythonhosted.org/packages/6a/c9/b9689a2a250264a84e66c46d8862ba788ee7a641cdca39bccf64f59284b7/protobuf-6.31.1-cp39-abi3-macosx_10_9_universal2.whl", hash = "sha256:6f1227473dc43d44ed644425268eb7c2e488ae245d51c6866d19fe158e207402", size = 425604 }, - { url = "https://files.pythonhosted.org/packages/76/a1/7a5a94032c83375e4fe7e7f56e3976ea6ac90c5e85fac8576409e25c39c3/protobuf-6.31.1-cp39-abi3-manylinux2014_aarch64.whl", hash = "sha256:a40fc12b84c154884d7d4c4ebd675d5b3b5283e155f324049ae396b95ddebc39", size = 322115 }, - { url = "https://files.pythonhosted.org/packages/fa/b1/b59d405d64d31999244643d88c45c8241c58f17cc887e73bcb90602327f8/protobuf-6.31.1-cp39-abi3-manylinux2014_x86_64.whl", hash = "sha256:4ee898bf66f7a8b0bd21bce523814e6fbd8c6add948045ce958b73af7e8878c6", size = 321070 }, - { url = "https://files.pythonhosted.org/packages/f7/af/ab3c51ab7507a7325e98ffe691d9495ee3d3aa5f589afad65ec920d39821/protobuf-6.31.1-py3-none-any.whl", hash = "sha256:720a6c7e6b77288b85063569baae8536671b39f15cc22037ec7045658d80489e", size = 168724 }, + { url = "https://files.pythonhosted.org/packages/f3/6f/6ab8e4bf962fd5570d3deaa2d5c38f0a363f57b4501047b5ebeb83ab1125/protobuf-6.31.1-cp310-abi3-win32.whl", hash = "sha256:7fa17d5a29c2e04b7d90e5e32388b8bfd0e7107cd8e616feef7ed3fa6bdab5c9", size = 423603, upload-time = "2025-05-28T19:25:41.198Z" }, + { url = "https://files.pythonhosted.org/packages/44/3a/b15c4347dd4bf3a1b0ee882f384623e2063bb5cf9fa9d57990a4f7df2fb6/protobuf-6.31.1-cp310-abi3-win_amd64.whl", hash = "sha256:426f59d2964864a1a366254fa703b8632dcec0790d8862d30034d8245e1cd447", size = 435283, upload-time = "2025-05-28T19:25:44.275Z" }, + { url = "https://files.pythonhosted.org/packages/6a/c9/b9689a2a250264a84e66c46d8862ba788ee7a641cdca39bccf64f59284b7/protobuf-6.31.1-cp39-abi3-macosx_10_9_universal2.whl", hash = "sha256:6f1227473dc43d44ed644425268eb7c2e488ae245d51c6866d19fe158e207402", size = 425604, upload-time = "2025-05-28T19:25:45.702Z" }, + { url = "https://files.pythonhosted.org/packages/76/a1/7a5a94032c83375e4fe7e7f56e3976ea6ac90c5e85fac8576409e25c39c3/protobuf-6.31.1-cp39-abi3-manylinux2014_aarch64.whl", hash = "sha256:a40fc12b84c154884d7d4c4ebd675d5b3b5283e155f324049ae396b95ddebc39", size = 322115, upload-time = "2025-05-28T19:25:47.128Z" }, + { url = "https://files.pythonhosted.org/packages/fa/b1/b59d405d64d31999244643d88c45c8241c58f17cc887e73bcb90602327f8/protobuf-6.31.1-cp39-abi3-manylinux2014_x86_64.whl", hash = "sha256:4ee898bf66f7a8b0bd21bce523814e6fbd8c6add948045ce958b73af7e8878c6", size = 321070, upload-time = "2025-05-28T19:25:50.036Z" }, + { url = "https://files.pythonhosted.org/packages/f7/af/ab3c51ab7507a7325e98ffe691d9495ee3d3aa5f589afad65ec920d39821/protobuf-6.31.1-py3-none-any.whl", hash = "sha256:720a6c7e6b77288b85063569baae8536671b39f15cc22037ec7045658d80489e", size = 168724, upload-time = "2025-05-28T19:25:53.926Z" }, ] [[package]] name = "ptyprocess" version = "0.7.0" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/20/e5/16ff212c1e452235a90aeb09066144d0c5a6a8c0834397e03f5224495c4e/ptyprocess-0.7.0.tar.gz", hash = "sha256:5c5d0a3b48ceee0b48485e0c26037c0acd7d29765ca3fbb5cb3831d347423220", size = 70762 } +sdist = { url = "https://files.pythonhosted.org/packages/20/e5/16ff212c1e452235a90aeb09066144d0c5a6a8c0834397e03f5224495c4e/ptyprocess-0.7.0.tar.gz", hash = "sha256:5c5d0a3b48ceee0b48485e0c26037c0acd7d29765ca3fbb5cb3831d347423220", size = 70762, upload-time = "2020-12-28T15:15:30.155Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/22/a6/858897256d0deac81a172289110f31629fc4cee19b6f01283303e18c8db3/ptyprocess-0.7.0-py2.py3-none-any.whl", hash = "sha256:4b41f3967fce3af57cc7e94b888626c18bf37a083e3651ca8feeb66d492fef35", size = 13993 }, + { url = "https://files.pythonhosted.org/packages/22/a6/858897256d0deac81a172289110f31629fc4cee19b6f01283303e18c8db3/ptyprocess-0.7.0-py2.py3-none-any.whl", hash = "sha256:4b41f3967fce3af57cc7e94b888626c18bf37a083e3651ca8feeb66d492fef35", size = 13993, upload-time = "2020-12-28T15:15:28.35Z" }, ] [[package]] name = "pure-eval" version = "0.2.3" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/cd/05/0a34433a064256a578f1783a10da6df098ceaa4a57bbeaa96a6c0352786b/pure_eval-0.2.3.tar.gz", hash = "sha256:5f4e983f40564c576c7c8635ae88db5956bb2229d7e9237d03b3c0b0190eaf42", size = 19752 } +sdist = { url = "https://files.pythonhosted.org/packages/cd/05/0a34433a064256a578f1783a10da6df098ceaa4a57bbeaa96a6c0352786b/pure_eval-0.2.3.tar.gz", hash = "sha256:5f4e983f40564c576c7c8635ae88db5956bb2229d7e9237d03b3c0b0190eaf42", size = 19752, upload-time = "2024-07-21T12:58:21.801Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/8e/37/efad0257dc6e593a18957422533ff0f87ede7c9c6ea010a2177d738fb82f/pure_eval-0.2.3-py3-none-any.whl", hash = "sha256:1db8e35b67b3d218d818ae653e27f06c3aa420901fa7b081ca98cbedc874e0d0", size = 11842 }, + { url = "https://files.pythonhosted.org/packages/8e/37/efad0257dc6e593a18957422533ff0f87ede7c9c6ea010a2177d738fb82f/pure_eval-0.2.3-py3-none-any.whl", hash = "sha256:1db8e35b67b3d218d818ae653e27f06c3aa420901fa7b081ca98cbedc874e0d0", size = 11842, upload-time = "2024-07-21T12:58:20.04Z" }, ] [[package]] name = "py-cpuinfo" version = "9.0.0" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/37/a8/d832f7293ebb21690860d2e01d8115e5ff6f2ae8bbdc953f0eb0fa4bd2c7/py-cpuinfo-9.0.0.tar.gz", hash = "sha256:3cdbbf3fac90dc6f118bfd64384f309edeadd902d7c8fb17f02ffa1fc3f49690", size = 104716 } +sdist = { url = "https://files.pythonhosted.org/packages/37/a8/d832f7293ebb21690860d2e01d8115e5ff6f2ae8bbdc953f0eb0fa4bd2c7/py-cpuinfo-9.0.0.tar.gz", hash = "sha256:3cdbbf3fac90dc6f118bfd64384f309edeadd902d7c8fb17f02ffa1fc3f49690", size = 104716, upload-time = "2022-10-25T20:38:06.303Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/e0/a9/023730ba63db1e494a271cb018dcd361bd2c917ba7004c3e49d5daf795a2/py_cpuinfo-9.0.0-py3-none-any.whl", hash = "sha256:859625bc251f64e21f077d099d4162689c762b5d6a4c3c97553d56241c9674d5", size = 22335 }, + { url = "https://files.pythonhosted.org/packages/e0/a9/023730ba63db1e494a271cb018dcd361bd2c917ba7004c3e49d5daf795a2/py_cpuinfo-9.0.0-py3-none-any.whl", hash = "sha256:859625bc251f64e21f077d099d4162689c762b5d6a4c3c97553d56241c9674d5", size = 22335, upload-time = "2022-10-25T20:38:27.636Z" }, ] [[package]] name = "pyasn1" version = "0.6.1" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/ba/e9/01f1a64245b89f039897cb0130016d79f77d52669aae6ee7b159a6c4c018/pyasn1-0.6.1.tar.gz", hash = "sha256:6f580d2bdd84365380830acf45550f2511469f673cb4a5ae3857a3170128b034", size = 145322 } +sdist = { url = "https://files.pythonhosted.org/packages/ba/e9/01f1a64245b89f039897cb0130016d79f77d52669aae6ee7b159a6c4c018/pyasn1-0.6.1.tar.gz", hash = "sha256:6f580d2bdd84365380830acf45550f2511469f673cb4a5ae3857a3170128b034", size = 145322, upload-time = "2024-09-10T22:41:42.55Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/c8/f1/d6a797abb14f6283c0ddff96bbdd46937f64122b8c925cab503dd37f8214/pyasn1-0.6.1-py3-none-any.whl", hash = "sha256:0d632f46f2ba09143da3a8afe9e33fb6f92fa2320ab7e886e2d0f7672af84629", size = 83135 }, + { url = "https://files.pythonhosted.org/packages/c8/f1/d6a797abb14f6283c0ddff96bbdd46937f64122b8c925cab503dd37f8214/pyasn1-0.6.1-py3-none-any.whl", hash = "sha256:0d632f46f2ba09143da3a8afe9e33fb6f92fa2320ab7e886e2d0f7672af84629", size = 83135, upload-time = "2024-09-11T16:00:36.122Z" }, ] [[package]] @@ -1535,53 +1561,53 @@ source = { registry = "https://pypi.org/simple" } dependencies = [ { name = "pyasn1" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/e9/e6/78ebbb10a8c8e4b61a59249394a4a594c1a7af95593dc933a349c8d00964/pyasn1_modules-0.4.2.tar.gz", hash = "sha256:677091de870a80aae844b1ca6134f54652fa2c8c5a52aa396440ac3106e941e6", size = 307892 } +sdist = { url = "https://files.pythonhosted.org/packages/e9/e6/78ebbb10a8c8e4b61a59249394a4a594c1a7af95593dc933a349c8d00964/pyasn1_modules-0.4.2.tar.gz", hash = "sha256:677091de870a80aae844b1ca6134f54652fa2c8c5a52aa396440ac3106e941e6", size = 307892, upload-time = "2025-03-28T02:41:22.17Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/47/8d/d529b5d697919ba8c11ad626e835d4039be708a35b0d22de83a269a6682c/pyasn1_modules-0.4.2-py3-none-any.whl", hash = "sha256:29253a9207ce32b64c3ac6600edc75368f98473906e8fd1043bd6b5b1de2c14a", size = 181259 }, + { url = "https://files.pythonhosted.org/packages/47/8d/d529b5d697919ba8c11ad626e835d4039be708a35b0d22de83a269a6682c/pyasn1_modules-0.4.2-py3-none-any.whl", hash = "sha256:29253a9207ce32b64c3ac6600edc75368f98473906e8fd1043bd6b5b1de2c14a", size = 181259, upload-time = "2025-03-28T02:41:19.028Z" }, ] [[package]] name = "pycparser" version = "2.22" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/1d/b2/31537cf4b1ca988837256c910a668b553fceb8f069bedc4b1c826024b52c/pycparser-2.22.tar.gz", hash = "sha256:491c8be9c040f5390f5bf44a5b07752bd07f56edf992381b05c701439eec10f6", size = 172736 } +sdist = { url = "https://files.pythonhosted.org/packages/1d/b2/31537cf4b1ca988837256c910a668b553fceb8f069bedc4b1c826024b52c/pycparser-2.22.tar.gz", hash = "sha256:491c8be9c040f5390f5bf44a5b07752bd07f56edf992381b05c701439eec10f6", size = 172736, upload-time = "2024-03-30T13:22:22.564Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/13/a3/a812df4e2dd5696d1f351d58b8fe16a405b234ad2886a0dab9183fb78109/pycparser-2.22-py3-none-any.whl", hash = "sha256:c3702b6d3dd8c7abc1afa565d7e63d53a1d0bd86cdc24edd75470f4de499cfcc", size = 117552 }, + { url = "https://files.pythonhosted.org/packages/13/a3/a812df4e2dd5696d1f351d58b8fe16a405b234ad2886a0dab9183fb78109/pycparser-2.22-py3-none-any.whl", hash = "sha256:c3702b6d3dd8c7abc1afa565d7e63d53a1d0bd86cdc24edd75470f4de499cfcc", size = 117552, upload-time = "2024-03-30T13:22:20.476Z" }, ] [[package]] name = "pycryptodome" version = "3.23.0" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/8e/a6/8452177684d5e906854776276ddd34eca30d1b1e15aa1ee9cefc289a33f5/pycryptodome-3.23.0.tar.gz", hash = "sha256:447700a657182d60338bab09fdb27518f8856aecd80ae4c6bdddb67ff5da44ef", size = 4921276 } -wheels = [ - { url = "https://files.pythonhosted.org/packages/04/5d/bdb09489b63cd34a976cc9e2a8d938114f7a53a74d3dd4f125ffa49dce82/pycryptodome-3.23.0-cp313-cp313t-macosx_10_13_universal2.whl", hash = "sha256:0011f7f00cdb74879142011f95133274741778abba114ceca229adbf8e62c3e4", size = 2495152 }, - { url = "https://files.pythonhosted.org/packages/a7/ce/7840250ed4cc0039c433cd41715536f926d6e86ce84e904068eb3244b6a6/pycryptodome-3.23.0-cp313-cp313t-macosx_10_13_x86_64.whl", hash = "sha256:90460fc9e088ce095f9ee8356722d4f10f86e5be06e2354230a9880b9c549aae", size = 1639348 }, - { url = "https://files.pythonhosted.org/packages/ee/f0/991da24c55c1f688d6a3b5a11940567353f74590734ee4a64294834ae472/pycryptodome-3.23.0-cp313-cp313t-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:4764e64b269fc83b00f682c47443c2e6e85b18273712b98aa43bcb77f8570477", size = 2184033 }, - { url = "https://files.pythonhosted.org/packages/54/16/0e11882deddf00f68b68dd4e8e442ddc30641f31afeb2bc25588124ac8de/pycryptodome-3.23.0-cp313-cp313t-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:eb8f24adb74984aa0e5d07a2368ad95276cf38051fe2dc6605cbcf482e04f2a7", size = 2270142 }, - { url = "https://files.pythonhosted.org/packages/d5/fc/4347fea23a3f95ffb931f383ff28b3f7b1fe868739182cb76718c0da86a1/pycryptodome-3.23.0-cp313-cp313t-manylinux_2_5_i686.manylinux1_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:d97618c9c6684a97ef7637ba43bdf6663a2e2e77efe0f863cce97a76af396446", size = 2309384 }, - { url = "https://files.pythonhosted.org/packages/6e/d9/c5261780b69ce66d8cfab25d2797bd6e82ba0241804694cd48be41add5eb/pycryptodome-3.23.0-cp313-cp313t-musllinux_1_2_aarch64.whl", hash = "sha256:9a53a4fe5cb075075d515797d6ce2f56772ea7e6a1e5e4b96cf78a14bac3d265", size = 2183237 }, - { url = "https://files.pythonhosted.org/packages/5a/6f/3af2ffedd5cfa08c631f89452c6648c4d779e7772dfc388c77c920ca6bbf/pycryptodome-3.23.0-cp313-cp313t-musllinux_1_2_i686.whl", hash = "sha256:763d1d74f56f031788e5d307029caef067febf890cd1f8bf61183ae142f1a77b", size = 2343898 }, - { url = "https://files.pythonhosted.org/packages/9a/dc/9060d807039ee5de6e2f260f72f3d70ac213993a804f5e67e0a73a56dd2f/pycryptodome-3.23.0-cp313-cp313t-musllinux_1_2_x86_64.whl", hash = "sha256:954af0e2bd7cea83ce72243b14e4fb518b18f0c1649b576d114973e2073b273d", size = 2269197 }, - { url = "https://files.pythonhosted.org/packages/f9/34/e6c8ca177cb29dcc4967fef73f5de445912f93bd0343c9c33c8e5bf8cde8/pycryptodome-3.23.0-cp313-cp313t-win32.whl", hash = "sha256:257bb3572c63ad8ba40b89f6fc9d63a2a628e9f9708d31ee26560925ebe0210a", size = 1768600 }, - { url = "https://files.pythonhosted.org/packages/e4/1d/89756b8d7ff623ad0160f4539da571d1f594d21ee6d68be130a6eccb39a4/pycryptodome-3.23.0-cp313-cp313t-win_amd64.whl", hash = "sha256:6501790c5b62a29fcb227bd6b62012181d886a767ce9ed03b303d1f22eb5c625", size = 1799740 }, - { url = "https://files.pythonhosted.org/packages/5d/61/35a64f0feaea9fd07f0d91209e7be91726eb48c0f1bfc6720647194071e4/pycryptodome-3.23.0-cp313-cp313t-win_arm64.whl", hash = "sha256:9a77627a330ab23ca43b48b130e202582e91cc69619947840ea4d2d1be21eb39", size = 1703685 }, - { url = "https://files.pythonhosted.org/packages/db/6c/a1f71542c969912bb0e106f64f60a56cc1f0fabecf9396f45accbe63fa68/pycryptodome-3.23.0-cp37-abi3-macosx_10_9_universal2.whl", hash = "sha256:187058ab80b3281b1de11c2e6842a357a1f71b42cb1e15bce373f3d238135c27", size = 2495627 }, - { url = "https://files.pythonhosted.org/packages/6e/4e/a066527e079fc5002390c8acdd3aca431e6ea0a50ffd7201551175b47323/pycryptodome-3.23.0-cp37-abi3-macosx_10_9_x86_64.whl", hash = "sha256:cfb5cd445280c5b0a4e6187a7ce8de5a07b5f3f897f235caa11f1f435f182843", size = 1640362 }, - { url = "https://files.pythonhosted.org/packages/50/52/adaf4c8c100a8c49d2bd058e5b551f73dfd8cb89eb4911e25a0c469b6b4e/pycryptodome-3.23.0-cp37-abi3-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:67bd81fcbe34f43ad9422ee8fd4843c8e7198dd88dd3d40e6de42ee65fbe1490", size = 2182625 }, - { url = "https://files.pythonhosted.org/packages/5f/e9/a09476d436d0ff1402ac3867d933c61805ec2326c6ea557aeeac3825604e/pycryptodome-3.23.0-cp37-abi3-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:c8987bd3307a39bc03df5c8e0e3d8be0c4c3518b7f044b0f4c15d1aa78f52575", size = 2268954 }, - { url = "https://files.pythonhosted.org/packages/f9/c5/ffe6474e0c551d54cab931918127c46d70cab8f114e0c2b5a3c071c2f484/pycryptodome-3.23.0-cp37-abi3-manylinux_2_5_i686.manylinux1_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:aa0698f65e5b570426fc31b8162ed4603b0c2841cbb9088e2b01641e3065915b", size = 2308534 }, - { url = "https://files.pythonhosted.org/packages/18/28/e199677fc15ecf43010f2463fde4c1a53015d1fe95fb03bca2890836603a/pycryptodome-3.23.0-cp37-abi3-musllinux_1_2_aarch64.whl", hash = "sha256:53ecbafc2b55353edcebd64bf5da94a2a2cdf5090a6915bcca6eca6cc452585a", size = 2181853 }, - { url = "https://files.pythonhosted.org/packages/ce/ea/4fdb09f2165ce1365c9eaefef36625583371ee514db58dc9b65d3a255c4c/pycryptodome-3.23.0-cp37-abi3-musllinux_1_2_i686.whl", hash = "sha256:156df9667ad9f2ad26255926524e1c136d6664b741547deb0a86a9acf5ea631f", size = 2342465 }, - { url = "https://files.pythonhosted.org/packages/22/82/6edc3fc42fe9284aead511394bac167693fb2b0e0395b28b8bedaa07ef04/pycryptodome-3.23.0-cp37-abi3-musllinux_1_2_x86_64.whl", hash = "sha256:dea827b4d55ee390dc89b2afe5927d4308a8b538ae91d9c6f7a5090f397af1aa", size = 2267414 }, - { url = "https://files.pythonhosted.org/packages/59/fe/aae679b64363eb78326c7fdc9d06ec3de18bac68be4b612fc1fe8902693c/pycryptodome-3.23.0-cp37-abi3-win32.whl", hash = "sha256:507dbead45474b62b2bbe318eb1c4c8ee641077532067fec9c1aa82c31f84886", size = 1768484 }, - { url = "https://files.pythonhosted.org/packages/54/2f/e97a1b8294db0daaa87012c24a7bb714147c7ade7656973fd6c736b484ff/pycryptodome-3.23.0-cp37-abi3-win_amd64.whl", hash = "sha256:c75b52aacc6c0c260f204cbdd834f76edc9fb0d8e0da9fbf8352ef58202564e2", size = 1799636 }, - { url = "https://files.pythonhosted.org/packages/18/3d/f9441a0d798bf2b1e645adc3265e55706aead1255ccdad3856dbdcffec14/pycryptodome-3.23.0-cp37-abi3-win_arm64.whl", hash = "sha256:11eeeb6917903876f134b56ba11abe95c0b0fd5e3330def218083c7d98bbcb3c", size = 1703675 }, - { url = "https://files.pythonhosted.org/packages/d9/12/e33935a0709c07de084d7d58d330ec3f4daf7910a18e77937affdb728452/pycryptodome-3.23.0-pp310-pypy310_pp73-macosx_10_15_x86_64.whl", hash = "sha256:ddb95b49df036ddd264a0ad246d1be5b672000f12d6961ea2c267083a5e19379", size = 1623886 }, - { url = "https://files.pythonhosted.org/packages/22/0b/aa8f9419f25870889bebf0b26b223c6986652bdf071f000623df11212c90/pycryptodome-3.23.0-pp310-pypy310_pp73-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:d8e95564beb8782abfd9e431c974e14563a794a4944c29d6d3b7b5ea042110b4", size = 1672151 }, - { url = "https://files.pythonhosted.org/packages/d4/5e/63f5cbde2342b7f70a39e591dbe75d9809d6338ce0b07c10406f1a140cdc/pycryptodome-3.23.0-pp310-pypy310_pp73-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:14e15c081e912c4b0d75632acd8382dfce45b258667aa3c67caf7a4d4c13f630", size = 1664461 }, - { url = "https://files.pythonhosted.org/packages/d6/92/608fbdad566ebe499297a86aae5f2a5263818ceeecd16733006f1600403c/pycryptodome-3.23.0-pp310-pypy310_pp73-manylinux_2_5_i686.manylinux1_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:a7fc76bf273353dc7e5207d172b83f569540fc9a28d63171061c42e361d22353", size = 1702440 }, - { url = "https://files.pythonhosted.org/packages/d1/92/2eadd1341abd2989cce2e2740b4423608ee2014acb8110438244ee97d7ff/pycryptodome-3.23.0-pp310-pypy310_pp73-win_amd64.whl", hash = "sha256:45c69ad715ca1a94f778215a11e66b7ff989d792a4d63b68dc586a1da1392ff5", size = 1803005 }, +sdist = { url = "https://files.pythonhosted.org/packages/8e/a6/8452177684d5e906854776276ddd34eca30d1b1e15aa1ee9cefc289a33f5/pycryptodome-3.23.0.tar.gz", hash = "sha256:447700a657182d60338bab09fdb27518f8856aecd80ae4c6bdddb67ff5da44ef", size = 4921276, upload-time = "2025-05-17T17:21:45.242Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/04/5d/bdb09489b63cd34a976cc9e2a8d938114f7a53a74d3dd4f125ffa49dce82/pycryptodome-3.23.0-cp313-cp313t-macosx_10_13_universal2.whl", hash = "sha256:0011f7f00cdb74879142011f95133274741778abba114ceca229adbf8e62c3e4", size = 2495152, upload-time = "2025-05-17T17:20:20.833Z" }, + { url = "https://files.pythonhosted.org/packages/a7/ce/7840250ed4cc0039c433cd41715536f926d6e86ce84e904068eb3244b6a6/pycryptodome-3.23.0-cp313-cp313t-macosx_10_13_x86_64.whl", hash = "sha256:90460fc9e088ce095f9ee8356722d4f10f86e5be06e2354230a9880b9c549aae", size = 1639348, upload-time = "2025-05-17T17:20:23.171Z" }, + { url = "https://files.pythonhosted.org/packages/ee/f0/991da24c55c1f688d6a3b5a11940567353f74590734ee4a64294834ae472/pycryptodome-3.23.0-cp313-cp313t-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:4764e64b269fc83b00f682c47443c2e6e85b18273712b98aa43bcb77f8570477", size = 2184033, upload-time = "2025-05-17T17:20:25.424Z" }, + { url = "https://files.pythonhosted.org/packages/54/16/0e11882deddf00f68b68dd4e8e442ddc30641f31afeb2bc25588124ac8de/pycryptodome-3.23.0-cp313-cp313t-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:eb8f24adb74984aa0e5d07a2368ad95276cf38051fe2dc6605cbcf482e04f2a7", size = 2270142, upload-time = "2025-05-17T17:20:27.808Z" }, + { url = "https://files.pythonhosted.org/packages/d5/fc/4347fea23a3f95ffb931f383ff28b3f7b1fe868739182cb76718c0da86a1/pycryptodome-3.23.0-cp313-cp313t-manylinux_2_5_i686.manylinux1_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:d97618c9c6684a97ef7637ba43bdf6663a2e2e77efe0f863cce97a76af396446", size = 2309384, upload-time = "2025-05-17T17:20:30.765Z" }, + { url = "https://files.pythonhosted.org/packages/6e/d9/c5261780b69ce66d8cfab25d2797bd6e82ba0241804694cd48be41add5eb/pycryptodome-3.23.0-cp313-cp313t-musllinux_1_2_aarch64.whl", hash = "sha256:9a53a4fe5cb075075d515797d6ce2f56772ea7e6a1e5e4b96cf78a14bac3d265", size = 2183237, upload-time = "2025-05-17T17:20:33.736Z" }, + { url = "https://files.pythonhosted.org/packages/5a/6f/3af2ffedd5cfa08c631f89452c6648c4d779e7772dfc388c77c920ca6bbf/pycryptodome-3.23.0-cp313-cp313t-musllinux_1_2_i686.whl", hash = "sha256:763d1d74f56f031788e5d307029caef067febf890cd1f8bf61183ae142f1a77b", size = 2343898, upload-time = "2025-05-17T17:20:36.086Z" }, + { url = "https://files.pythonhosted.org/packages/9a/dc/9060d807039ee5de6e2f260f72f3d70ac213993a804f5e67e0a73a56dd2f/pycryptodome-3.23.0-cp313-cp313t-musllinux_1_2_x86_64.whl", hash = "sha256:954af0e2bd7cea83ce72243b14e4fb518b18f0c1649b576d114973e2073b273d", size = 2269197, upload-time = "2025-05-17T17:20:38.414Z" }, + { url = "https://files.pythonhosted.org/packages/f9/34/e6c8ca177cb29dcc4967fef73f5de445912f93bd0343c9c33c8e5bf8cde8/pycryptodome-3.23.0-cp313-cp313t-win32.whl", hash = "sha256:257bb3572c63ad8ba40b89f6fc9d63a2a628e9f9708d31ee26560925ebe0210a", size = 1768600, upload-time = "2025-05-17T17:20:40.688Z" }, + { url = "https://files.pythonhosted.org/packages/e4/1d/89756b8d7ff623ad0160f4539da571d1f594d21ee6d68be130a6eccb39a4/pycryptodome-3.23.0-cp313-cp313t-win_amd64.whl", hash = "sha256:6501790c5b62a29fcb227bd6b62012181d886a767ce9ed03b303d1f22eb5c625", size = 1799740, upload-time = "2025-05-17T17:20:42.413Z" }, + { url = "https://files.pythonhosted.org/packages/5d/61/35a64f0feaea9fd07f0d91209e7be91726eb48c0f1bfc6720647194071e4/pycryptodome-3.23.0-cp313-cp313t-win_arm64.whl", hash = "sha256:9a77627a330ab23ca43b48b130e202582e91cc69619947840ea4d2d1be21eb39", size = 1703685, upload-time = "2025-05-17T17:20:44.388Z" }, + { url = "https://files.pythonhosted.org/packages/db/6c/a1f71542c969912bb0e106f64f60a56cc1f0fabecf9396f45accbe63fa68/pycryptodome-3.23.0-cp37-abi3-macosx_10_9_universal2.whl", hash = "sha256:187058ab80b3281b1de11c2e6842a357a1f71b42cb1e15bce373f3d238135c27", size = 2495627, upload-time = "2025-05-17T17:20:47.139Z" }, + { url = "https://files.pythonhosted.org/packages/6e/4e/a066527e079fc5002390c8acdd3aca431e6ea0a50ffd7201551175b47323/pycryptodome-3.23.0-cp37-abi3-macosx_10_9_x86_64.whl", hash = "sha256:cfb5cd445280c5b0a4e6187a7ce8de5a07b5f3f897f235caa11f1f435f182843", size = 1640362, upload-time = "2025-05-17T17:20:50.392Z" }, + { url = "https://files.pythonhosted.org/packages/50/52/adaf4c8c100a8c49d2bd058e5b551f73dfd8cb89eb4911e25a0c469b6b4e/pycryptodome-3.23.0-cp37-abi3-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:67bd81fcbe34f43ad9422ee8fd4843c8e7198dd88dd3d40e6de42ee65fbe1490", size = 2182625, upload-time = "2025-05-17T17:20:52.866Z" }, + { url = "https://files.pythonhosted.org/packages/5f/e9/a09476d436d0ff1402ac3867d933c61805ec2326c6ea557aeeac3825604e/pycryptodome-3.23.0-cp37-abi3-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:c8987bd3307a39bc03df5c8e0e3d8be0c4c3518b7f044b0f4c15d1aa78f52575", size = 2268954, upload-time = "2025-05-17T17:20:55.027Z" }, + { url = "https://files.pythonhosted.org/packages/f9/c5/ffe6474e0c551d54cab931918127c46d70cab8f114e0c2b5a3c071c2f484/pycryptodome-3.23.0-cp37-abi3-manylinux_2_5_i686.manylinux1_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:aa0698f65e5b570426fc31b8162ed4603b0c2841cbb9088e2b01641e3065915b", size = 2308534, upload-time = "2025-05-17T17:20:57.279Z" }, + { url = "https://files.pythonhosted.org/packages/18/28/e199677fc15ecf43010f2463fde4c1a53015d1fe95fb03bca2890836603a/pycryptodome-3.23.0-cp37-abi3-musllinux_1_2_aarch64.whl", hash = "sha256:53ecbafc2b55353edcebd64bf5da94a2a2cdf5090a6915bcca6eca6cc452585a", size = 2181853, upload-time = "2025-05-17T17:20:59.322Z" }, + { url = "https://files.pythonhosted.org/packages/ce/ea/4fdb09f2165ce1365c9eaefef36625583371ee514db58dc9b65d3a255c4c/pycryptodome-3.23.0-cp37-abi3-musllinux_1_2_i686.whl", hash = "sha256:156df9667ad9f2ad26255926524e1c136d6664b741547deb0a86a9acf5ea631f", size = 2342465, upload-time = "2025-05-17T17:21:03.83Z" }, + { url = "https://files.pythonhosted.org/packages/22/82/6edc3fc42fe9284aead511394bac167693fb2b0e0395b28b8bedaa07ef04/pycryptodome-3.23.0-cp37-abi3-musllinux_1_2_x86_64.whl", hash = "sha256:dea827b4d55ee390dc89b2afe5927d4308a8b538ae91d9c6f7a5090f397af1aa", size = 2267414, upload-time = "2025-05-17T17:21:06.72Z" }, + { url = "https://files.pythonhosted.org/packages/59/fe/aae679b64363eb78326c7fdc9d06ec3de18bac68be4b612fc1fe8902693c/pycryptodome-3.23.0-cp37-abi3-win32.whl", hash = "sha256:507dbead45474b62b2bbe318eb1c4c8ee641077532067fec9c1aa82c31f84886", size = 1768484, upload-time = "2025-05-17T17:21:08.535Z" }, + { url = "https://files.pythonhosted.org/packages/54/2f/e97a1b8294db0daaa87012c24a7bb714147c7ade7656973fd6c736b484ff/pycryptodome-3.23.0-cp37-abi3-win_amd64.whl", hash = "sha256:c75b52aacc6c0c260f204cbdd834f76edc9fb0d8e0da9fbf8352ef58202564e2", size = 1799636, upload-time = "2025-05-17T17:21:10.393Z" }, + { url = "https://files.pythonhosted.org/packages/18/3d/f9441a0d798bf2b1e645adc3265e55706aead1255ccdad3856dbdcffec14/pycryptodome-3.23.0-cp37-abi3-win_arm64.whl", hash = "sha256:11eeeb6917903876f134b56ba11abe95c0b0fd5e3330def218083c7d98bbcb3c", size = 1703675, upload-time = "2025-05-17T17:21:13.146Z" }, + { url = "https://files.pythonhosted.org/packages/d9/12/e33935a0709c07de084d7d58d330ec3f4daf7910a18e77937affdb728452/pycryptodome-3.23.0-pp310-pypy310_pp73-macosx_10_15_x86_64.whl", hash = "sha256:ddb95b49df036ddd264a0ad246d1be5b672000f12d6961ea2c267083a5e19379", size = 1623886, upload-time = "2025-05-17T17:21:20.614Z" }, + { url = "https://files.pythonhosted.org/packages/22/0b/aa8f9419f25870889bebf0b26b223c6986652bdf071f000623df11212c90/pycryptodome-3.23.0-pp310-pypy310_pp73-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:d8e95564beb8782abfd9e431c974e14563a794a4944c29d6d3b7b5ea042110b4", size = 1672151, upload-time = "2025-05-17T17:21:22.666Z" }, + { url = "https://files.pythonhosted.org/packages/d4/5e/63f5cbde2342b7f70a39e591dbe75d9809d6338ce0b07c10406f1a140cdc/pycryptodome-3.23.0-pp310-pypy310_pp73-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:14e15c081e912c4b0d75632acd8382dfce45b258667aa3c67caf7a4d4c13f630", size = 1664461, upload-time = "2025-05-17T17:21:25.225Z" }, + { url = "https://files.pythonhosted.org/packages/d6/92/608fbdad566ebe499297a86aae5f2a5263818ceeecd16733006f1600403c/pycryptodome-3.23.0-pp310-pypy310_pp73-manylinux_2_5_i686.manylinux1_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:a7fc76bf273353dc7e5207d172b83f569540fc9a28d63171061c42e361d22353", size = 1702440, upload-time = "2025-05-17T17:21:27.991Z" }, + { url = "https://files.pythonhosted.org/packages/d1/92/2eadd1341abd2989cce2e2740b4423608ee2014acb8110438244ee97d7ff/pycryptodome-3.23.0-pp310-pypy310_pp73-win_amd64.whl", hash = "sha256:45c69ad715ca1a94f778215a11e66b7ff989d792a4d63b68dc586a1da1392ff5", size = 1803005, upload-time = "2025-05-17T17:21:31.37Z" }, ] [[package]] @@ -1594,9 +1620,9 @@ dependencies = [ { name = "typing-extensions" }, { name = "typing-inspection" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/f0/86/8ce9040065e8f924d642c58e4a344e33163a07f6b57f836d0d734e0ad3fb/pydantic-2.11.5.tar.gz", hash = "sha256:7f853db3d0ce78ce8bbb148c401c2cdd6431b3473c0cdff2755c7690952a7b7a", size = 787102 } +sdist = { url = "https://files.pythonhosted.org/packages/f0/86/8ce9040065e8f924d642c58e4a344e33163a07f6b57f836d0d734e0ad3fb/pydantic-2.11.5.tar.gz", hash = "sha256:7f853db3d0ce78ce8bbb148c401c2cdd6431b3473c0cdff2755c7690952a7b7a", size = 787102, upload-time = "2025-05-22T21:18:08.761Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/b5/69/831ed22b38ff9b4b64b66569f0e5b7b97cf3638346eb95a2147fdb49ad5f/pydantic-2.11.5-py3-none-any.whl", hash = "sha256:f9c26ba06f9747749ca1e5c94d6a85cb84254577553c8785576fd38fa64dc0f7", size = 444229 }, + { url = "https://files.pythonhosted.org/packages/b5/69/831ed22b38ff9b4b64b66569f0e5b7b97cf3638346eb95a2147fdb49ad5f/pydantic-2.11.5-py3-none-any.whl", hash = "sha256:f9c26ba06f9747749ca1e5c94d6a85cb84254577553c8785576fd38fa64dc0f7", size = 444229, upload-time = "2025-05-22T21:18:06.329Z" }, ] [[package]] @@ -1606,93 +1632,93 @@ source = { registry = "https://pypi.org/simple" } dependencies = [ { name = "typing-extensions" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/ad/88/5f2260bdfae97aabf98f1778d43f69574390ad787afb646292a638c923d4/pydantic_core-2.33.2.tar.gz", hash = "sha256:7cb8bc3605c29176e1b105350d2e6474142d7c1bd1d9327c4a9bdb46bf827acc", size = 435195 } -wheels = [ - { url = "https://files.pythonhosted.org/packages/e5/92/b31726561b5dae176c2d2c2dc43a9c5bfba5d32f96f8b4c0a600dd492447/pydantic_core-2.33.2-cp310-cp310-macosx_10_12_x86_64.whl", hash = "sha256:2b3d326aaef0c0399d9afffeb6367d5e26ddc24d351dbc9c636840ac355dc5d8", size = 2028817 }, - { url = "https://files.pythonhosted.org/packages/a3/44/3f0b95fafdaca04a483c4e685fe437c6891001bf3ce8b2fded82b9ea3aa1/pydantic_core-2.33.2-cp310-cp310-macosx_11_0_arm64.whl", hash = "sha256:0e5b2671f05ba48b94cb90ce55d8bdcaaedb8ba00cc5359f6810fc918713983d", size = 1861357 }, - { url = "https://files.pythonhosted.org/packages/30/97/e8f13b55766234caae05372826e8e4b3b96e7b248be3157f53237682e43c/pydantic_core-2.33.2-cp310-cp310-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:0069c9acc3f3981b9ff4cdfaf088e98d83440a4c7ea1bc07460af3d4dc22e72d", size = 1898011 }, - { url = "https://files.pythonhosted.org/packages/9b/a3/99c48cf7bafc991cc3ee66fd544c0aae8dc907b752f1dad2d79b1b5a471f/pydantic_core-2.33.2-cp310-cp310-manylinux_2_17_armv7l.manylinux2014_armv7l.whl", hash = "sha256:d53b22f2032c42eaaf025f7c40c2e3b94568ae077a606f006d206a463bc69572", size = 1982730 }, - { url = "https://files.pythonhosted.org/packages/de/8e/a5b882ec4307010a840fb8b58bd9bf65d1840c92eae7534c7441709bf54b/pydantic_core-2.33.2-cp310-cp310-manylinux_2_17_ppc64le.manylinux2014_ppc64le.whl", hash = "sha256:0405262705a123b7ce9f0b92f123334d67b70fd1f20a9372b907ce1080c7ba02", size = 2136178 }, - { url = "https://files.pythonhosted.org/packages/e4/bb/71e35fc3ed05af6834e890edb75968e2802fe98778971ab5cba20a162315/pydantic_core-2.33.2-cp310-cp310-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:4b25d91e288e2c4e0662b8038a28c6a07eaac3e196cfc4ff69de4ea3db992a1b", size = 2736462 }, - { url = "https://files.pythonhosted.org/packages/31/0d/c8f7593e6bc7066289bbc366f2235701dcbebcd1ff0ef8e64f6f239fb47d/pydantic_core-2.33.2-cp310-cp310-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:6bdfe4b3789761f3bcb4b1ddf33355a71079858958e3a552f16d5af19768fef2", size = 2005652 }, - { url = "https://files.pythonhosted.org/packages/d2/7a/996d8bd75f3eda405e3dd219ff5ff0a283cd8e34add39d8ef9157e722867/pydantic_core-2.33.2-cp310-cp310-manylinux_2_5_i686.manylinux1_i686.whl", hash = "sha256:efec8db3266b76ef9607c2c4c419bdb06bf335ae433b80816089ea7585816f6a", size = 2113306 }, - { url = "https://files.pythonhosted.org/packages/ff/84/daf2a6fb2db40ffda6578a7e8c5a6e9c8affb251a05c233ae37098118788/pydantic_core-2.33.2-cp310-cp310-musllinux_1_1_aarch64.whl", hash = "sha256:031c57d67ca86902726e0fae2214ce6770bbe2f710dc33063187a68744a5ecac", size = 2073720 }, - { url = "https://files.pythonhosted.org/packages/77/fb/2258da019f4825128445ae79456a5499c032b55849dbd5bed78c95ccf163/pydantic_core-2.33.2-cp310-cp310-musllinux_1_1_armv7l.whl", hash = "sha256:f8de619080e944347f5f20de29a975c2d815d9ddd8be9b9b7268e2e3ef68605a", size = 2244915 }, - { url = "https://files.pythonhosted.org/packages/d8/7a/925ff73756031289468326e355b6fa8316960d0d65f8b5d6b3a3e7866de7/pydantic_core-2.33.2-cp310-cp310-musllinux_1_1_x86_64.whl", hash = "sha256:73662edf539e72a9440129f231ed3757faab89630d291b784ca99237fb94db2b", size = 2241884 }, - { url = "https://files.pythonhosted.org/packages/0b/b0/249ee6d2646f1cdadcb813805fe76265745c4010cf20a8eba7b0e639d9b2/pydantic_core-2.33.2-cp310-cp310-win32.whl", hash = "sha256:0a39979dcbb70998b0e505fb1556a1d550a0781463ce84ebf915ba293ccb7e22", size = 1910496 }, - { url = "https://files.pythonhosted.org/packages/66/ff/172ba8f12a42d4b552917aa65d1f2328990d3ccfc01d5b7c943ec084299f/pydantic_core-2.33.2-cp310-cp310-win_amd64.whl", hash = "sha256:b0379a2b24882fef529ec3b4987cb5d003b9cda32256024e6fe1586ac45fc640", size = 1955019 }, - { url = "https://files.pythonhosted.org/packages/3f/8d/71db63483d518cbbf290261a1fc2839d17ff89fce7089e08cad07ccfce67/pydantic_core-2.33.2-cp311-cp311-macosx_10_12_x86_64.whl", hash = "sha256:4c5b0a576fb381edd6d27f0a85915c6daf2f8138dc5c267a57c08a62900758c7", size = 2028584 }, - { url = "https://files.pythonhosted.org/packages/24/2f/3cfa7244ae292dd850989f328722d2aef313f74ffc471184dc509e1e4e5a/pydantic_core-2.33.2-cp311-cp311-macosx_11_0_arm64.whl", hash = "sha256:e799c050df38a639db758c617ec771fd8fb7a5f8eaaa4b27b101f266b216a246", size = 1855071 }, - { url = "https://files.pythonhosted.org/packages/b3/d3/4ae42d33f5e3f50dd467761304be2fa0a9417fbf09735bc2cce003480f2a/pydantic_core-2.33.2-cp311-cp311-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:dc46a01bf8d62f227d5ecee74178ffc448ff4e5197c756331f71efcc66dc980f", size = 1897823 }, - { url = "https://files.pythonhosted.org/packages/f4/f3/aa5976e8352b7695ff808599794b1fba2a9ae2ee954a3426855935799488/pydantic_core-2.33.2-cp311-cp311-manylinux_2_17_armv7l.manylinux2014_armv7l.whl", hash = "sha256:a144d4f717285c6d9234a66778059f33a89096dfb9b39117663fd8413d582dcc", size = 1983792 }, - { url = "https://files.pythonhosted.org/packages/d5/7a/cda9b5a23c552037717f2b2a5257e9b2bfe45e687386df9591eff7b46d28/pydantic_core-2.33.2-cp311-cp311-manylinux_2_17_ppc64le.manylinux2014_ppc64le.whl", hash = "sha256:73cf6373c21bc80b2e0dc88444f41ae60b2f070ed02095754eb5a01df12256de", size = 2136338 }, - { url = "https://files.pythonhosted.org/packages/2b/9f/b8f9ec8dd1417eb9da784e91e1667d58a2a4a7b7b34cf4af765ef663a7e5/pydantic_core-2.33.2-cp311-cp311-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:3dc625f4aa79713512d1976fe9f0bc99f706a9dee21dfd1810b4bbbf228d0e8a", size = 2730998 }, - { url = "https://files.pythonhosted.org/packages/47/bc/cd720e078576bdb8255d5032c5d63ee5c0bf4b7173dd955185a1d658c456/pydantic_core-2.33.2-cp311-cp311-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:881b21b5549499972441da4758d662aeea93f1923f953e9cbaff14b8b9565aef", size = 2003200 }, - { url = "https://files.pythonhosted.org/packages/ca/22/3602b895ee2cd29d11a2b349372446ae9727c32e78a94b3d588a40fdf187/pydantic_core-2.33.2-cp311-cp311-manylinux_2_5_i686.manylinux1_i686.whl", hash = "sha256:bdc25f3681f7b78572699569514036afe3c243bc3059d3942624e936ec93450e", size = 2113890 }, - { url = "https://files.pythonhosted.org/packages/ff/e6/e3c5908c03cf00d629eb38393a98fccc38ee0ce8ecce32f69fc7d7b558a7/pydantic_core-2.33.2-cp311-cp311-musllinux_1_1_aarch64.whl", hash = "sha256:fe5b32187cbc0c862ee201ad66c30cf218e5ed468ec8dc1cf49dec66e160cc4d", size = 2073359 }, - { url = "https://files.pythonhosted.org/packages/12/e7/6a36a07c59ebefc8777d1ffdaf5ae71b06b21952582e4b07eba88a421c79/pydantic_core-2.33.2-cp311-cp311-musllinux_1_1_armv7l.whl", hash = "sha256:bc7aee6f634a6f4a95676fcb5d6559a2c2a390330098dba5e5a5f28a2e4ada30", size = 2245883 }, - { url = "https://files.pythonhosted.org/packages/16/3f/59b3187aaa6cc0c1e6616e8045b284de2b6a87b027cce2ffcea073adf1d2/pydantic_core-2.33.2-cp311-cp311-musllinux_1_1_x86_64.whl", hash = "sha256:235f45e5dbcccf6bd99f9f472858849f73d11120d76ea8707115415f8e5ebebf", size = 2241074 }, - { url = "https://files.pythonhosted.org/packages/e0/ed/55532bb88f674d5d8f67ab121a2a13c385df382de2a1677f30ad385f7438/pydantic_core-2.33.2-cp311-cp311-win32.whl", hash = "sha256:6368900c2d3ef09b69cb0b913f9f8263b03786e5b2a387706c5afb66800efd51", size = 1910538 }, - { url = "https://files.pythonhosted.org/packages/fe/1b/25b7cccd4519c0b23c2dd636ad39d381abf113085ce4f7bec2b0dc755eb1/pydantic_core-2.33.2-cp311-cp311-win_amd64.whl", hash = "sha256:1e063337ef9e9820c77acc768546325ebe04ee38b08703244c1309cccc4f1bab", size = 1952909 }, - { url = "https://files.pythonhosted.org/packages/49/a9/d809358e49126438055884c4366a1f6227f0f84f635a9014e2deb9b9de54/pydantic_core-2.33.2-cp311-cp311-win_arm64.whl", hash = "sha256:6b99022f1d19bc32a4c2a0d544fc9a76e3be90f0b3f4af413f87d38749300e65", size = 1897786 }, - { url = "https://files.pythonhosted.org/packages/18/8a/2b41c97f554ec8c71f2a8a5f85cb56a8b0956addfe8b0efb5b3d77e8bdc3/pydantic_core-2.33.2-cp312-cp312-macosx_10_12_x86_64.whl", hash = "sha256:a7ec89dc587667f22b6a0b6579c249fca9026ce7c333fc142ba42411fa243cdc", size = 2009000 }, - { url = "https://files.pythonhosted.org/packages/a1/02/6224312aacb3c8ecbaa959897af57181fb6cf3a3d7917fd44d0f2917e6f2/pydantic_core-2.33.2-cp312-cp312-macosx_11_0_arm64.whl", hash = "sha256:3c6db6e52c6d70aa0d00d45cdb9b40f0433b96380071ea80b09277dba021ddf7", size = 1847996 }, - { url = "https://files.pythonhosted.org/packages/d6/46/6dcdf084a523dbe0a0be59d054734b86a981726f221f4562aed313dbcb49/pydantic_core-2.33.2-cp312-cp312-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:4e61206137cbc65e6d5256e1166f88331d3b6238e082d9f74613b9b765fb9025", size = 1880957 }, - { url = "https://files.pythonhosted.org/packages/ec/6b/1ec2c03837ac00886ba8160ce041ce4e325b41d06a034adbef11339ae422/pydantic_core-2.33.2-cp312-cp312-manylinux_2_17_armv7l.manylinux2014_armv7l.whl", hash = "sha256:eb8c529b2819c37140eb51b914153063d27ed88e3bdc31b71198a198e921e011", size = 1964199 }, - { url = "https://files.pythonhosted.org/packages/2d/1d/6bf34d6adb9debd9136bd197ca72642203ce9aaaa85cfcbfcf20f9696e83/pydantic_core-2.33.2-cp312-cp312-manylinux_2_17_ppc64le.manylinux2014_ppc64le.whl", hash = "sha256:c52b02ad8b4e2cf14ca7b3d918f3eb0ee91e63b3167c32591e57c4317e134f8f", size = 2120296 }, - { url = "https://files.pythonhosted.org/packages/e0/94/2bd0aaf5a591e974b32a9f7123f16637776c304471a0ab33cf263cf5591a/pydantic_core-2.33.2-cp312-cp312-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:96081f1605125ba0855dfda83f6f3df5ec90c61195421ba72223de35ccfb2f88", size = 2676109 }, - { url = "https://files.pythonhosted.org/packages/f9/41/4b043778cf9c4285d59742281a769eac371b9e47e35f98ad321349cc5d61/pydantic_core-2.33.2-cp312-cp312-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:8f57a69461af2a5fa6e6bbd7a5f60d3b7e6cebb687f55106933188e79ad155c1", size = 2002028 }, - { url = "https://files.pythonhosted.org/packages/cb/d5/7bb781bf2748ce3d03af04d5c969fa1308880e1dca35a9bd94e1a96a922e/pydantic_core-2.33.2-cp312-cp312-manylinux_2_5_i686.manylinux1_i686.whl", hash = "sha256:572c7e6c8bb4774d2ac88929e3d1f12bc45714ae5ee6d9a788a9fb35e60bb04b", size = 2100044 }, - { url = "https://files.pythonhosted.org/packages/fe/36/def5e53e1eb0ad896785702a5bbfd25eed546cdcf4087ad285021a90ed53/pydantic_core-2.33.2-cp312-cp312-musllinux_1_1_aarch64.whl", hash = "sha256:db4b41f9bd95fbe5acd76d89920336ba96f03e149097365afe1cb092fceb89a1", size = 2058881 }, - { url = "https://files.pythonhosted.org/packages/01/6c/57f8d70b2ee57fc3dc8b9610315949837fa8c11d86927b9bb044f8705419/pydantic_core-2.33.2-cp312-cp312-musllinux_1_1_armv7l.whl", hash = "sha256:fa854f5cf7e33842a892e5c73f45327760bc7bc516339fda888c75ae60edaeb6", size = 2227034 }, - { url = "https://files.pythonhosted.org/packages/27/b9/9c17f0396a82b3d5cbea4c24d742083422639e7bb1d5bf600e12cb176a13/pydantic_core-2.33.2-cp312-cp312-musllinux_1_1_x86_64.whl", hash = "sha256:5f483cfb75ff703095c59e365360cb73e00185e01aaea067cd19acffd2ab20ea", size = 2234187 }, - { url = "https://files.pythonhosted.org/packages/b0/6a/adf5734ffd52bf86d865093ad70b2ce543415e0e356f6cacabbc0d9ad910/pydantic_core-2.33.2-cp312-cp312-win32.whl", hash = "sha256:9cb1da0f5a471435a7bc7e439b8a728e8b61e59784b2af70d7c169f8dd8ae290", size = 1892628 }, - { url = "https://files.pythonhosted.org/packages/43/e4/5479fecb3606c1368d496a825d8411e126133c41224c1e7238be58b87d7e/pydantic_core-2.33.2-cp312-cp312-win_amd64.whl", hash = "sha256:f941635f2a3d96b2973e867144fde513665c87f13fe0e193c158ac51bfaaa7b2", size = 1955866 }, - { url = "https://files.pythonhosted.org/packages/0d/24/8b11e8b3e2be9dd82df4b11408a67c61bb4dc4f8e11b5b0fc888b38118b5/pydantic_core-2.33.2-cp312-cp312-win_arm64.whl", hash = "sha256:cca3868ddfaccfbc4bfb1d608e2ccaaebe0ae628e1416aeb9c4d88c001bb45ab", size = 1888894 }, - { url = "https://files.pythonhosted.org/packages/46/8c/99040727b41f56616573a28771b1bfa08a3d3fe74d3d513f01251f79f172/pydantic_core-2.33.2-cp313-cp313-macosx_10_12_x86_64.whl", hash = "sha256:1082dd3e2d7109ad8b7da48e1d4710c8d06c253cbc4a27c1cff4fbcaa97a9e3f", size = 2015688 }, - { url = "https://files.pythonhosted.org/packages/3a/cc/5999d1eb705a6cefc31f0b4a90e9f7fc400539b1a1030529700cc1b51838/pydantic_core-2.33.2-cp313-cp313-macosx_11_0_arm64.whl", hash = "sha256:f517ca031dfc037a9c07e748cefd8d96235088b83b4f4ba8939105d20fa1dcd6", size = 1844808 }, - { url = "https://files.pythonhosted.org/packages/6f/5e/a0a7b8885c98889a18b6e376f344da1ef323d270b44edf8174d6bce4d622/pydantic_core-2.33.2-cp313-cp313-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:0a9f2c9dd19656823cb8250b0724ee9c60a82f3cdf68a080979d13092a3b0fef", size = 1885580 }, - { url = "https://files.pythonhosted.org/packages/3b/2a/953581f343c7d11a304581156618c3f592435523dd9d79865903272c256a/pydantic_core-2.33.2-cp313-cp313-manylinux_2_17_armv7l.manylinux2014_armv7l.whl", hash = "sha256:2b0a451c263b01acebe51895bfb0e1cc842a5c666efe06cdf13846c7418caa9a", size = 1973859 }, - { url = "https://files.pythonhosted.org/packages/e6/55/f1a813904771c03a3f97f676c62cca0c0a4138654107c1b61f19c644868b/pydantic_core-2.33.2-cp313-cp313-manylinux_2_17_ppc64le.manylinux2014_ppc64le.whl", hash = "sha256:1ea40a64d23faa25e62a70ad163571c0b342b8bf66d5fa612ac0dec4f069d916", size = 2120810 }, - { url = "https://files.pythonhosted.org/packages/aa/c3/053389835a996e18853ba107a63caae0b9deb4a276c6b472931ea9ae6e48/pydantic_core-2.33.2-cp313-cp313-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:0fb2d542b4d66f9470e8065c5469ec676978d625a8b7a363f07d9a501a9cb36a", size = 2676498 }, - { url = "https://files.pythonhosted.org/packages/eb/3c/f4abd740877a35abade05e437245b192f9d0ffb48bbbbd708df33d3cda37/pydantic_core-2.33.2-cp313-cp313-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:9fdac5d6ffa1b5a83bca06ffe7583f5576555e6c8b3a91fbd25ea7780f825f7d", size = 2000611 }, - { url = "https://files.pythonhosted.org/packages/59/a7/63ef2fed1837d1121a894d0ce88439fe3e3b3e48c7543b2a4479eb99c2bd/pydantic_core-2.33.2-cp313-cp313-manylinux_2_5_i686.manylinux1_i686.whl", hash = "sha256:04a1a413977ab517154eebb2d326da71638271477d6ad87a769102f7c2488c56", size = 2107924 }, - { url = "https://files.pythonhosted.org/packages/04/8f/2551964ef045669801675f1cfc3b0d74147f4901c3ffa42be2ddb1f0efc4/pydantic_core-2.33.2-cp313-cp313-musllinux_1_1_aarch64.whl", hash = "sha256:c8e7af2f4e0194c22b5b37205bfb293d166a7344a5b0d0eaccebc376546d77d5", size = 2063196 }, - { url = "https://files.pythonhosted.org/packages/26/bd/d9602777e77fc6dbb0c7db9ad356e9a985825547dce5ad1d30ee04903918/pydantic_core-2.33.2-cp313-cp313-musllinux_1_1_armv7l.whl", hash = "sha256:5c92edd15cd58b3c2d34873597a1e20f13094f59cf88068adb18947df5455b4e", size = 2236389 }, - { url = "https://files.pythonhosted.org/packages/42/db/0e950daa7e2230423ab342ae918a794964b053bec24ba8af013fc7c94846/pydantic_core-2.33.2-cp313-cp313-musllinux_1_1_x86_64.whl", hash = "sha256:65132b7b4a1c0beded5e057324b7e16e10910c106d43675d9bd87d4f38dde162", size = 2239223 }, - { url = "https://files.pythonhosted.org/packages/58/4d/4f937099c545a8a17eb52cb67fe0447fd9a373b348ccfa9a87f141eeb00f/pydantic_core-2.33.2-cp313-cp313-win32.whl", hash = "sha256:52fb90784e0a242bb96ec53f42196a17278855b0f31ac7c3cc6f5c1ec4811849", size = 1900473 }, - { url = "https://files.pythonhosted.org/packages/a0/75/4a0a9bac998d78d889def5e4ef2b065acba8cae8c93696906c3a91f310ca/pydantic_core-2.33.2-cp313-cp313-win_amd64.whl", hash = "sha256:c083a3bdd5a93dfe480f1125926afcdbf2917ae714bdb80b36d34318b2bec5d9", size = 1955269 }, - { url = "https://files.pythonhosted.org/packages/f9/86/1beda0576969592f1497b4ce8e7bc8cbdf614c352426271b1b10d5f0aa64/pydantic_core-2.33.2-cp313-cp313-win_arm64.whl", hash = "sha256:e80b087132752f6b3d714f041ccf74403799d3b23a72722ea2e6ba2e892555b9", size = 1893921 }, - { url = "https://files.pythonhosted.org/packages/a4/7d/e09391c2eebeab681df2b74bfe6c43422fffede8dc74187b2b0bf6fd7571/pydantic_core-2.33.2-cp313-cp313t-macosx_11_0_arm64.whl", hash = "sha256:61c18fba8e5e9db3ab908620af374db0ac1baa69f0f32df4f61ae23f15e586ac", size = 1806162 }, - { url = "https://files.pythonhosted.org/packages/f1/3d/847b6b1fed9f8ed3bb95a9ad04fbd0b212e832d4f0f50ff4d9ee5a9f15cf/pydantic_core-2.33.2-cp313-cp313t-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:95237e53bb015f67b63c91af7518a62a8660376a6a0db19b89acc77a4d6199f5", size = 1981560 }, - { url = "https://files.pythonhosted.org/packages/6f/9a/e73262f6c6656262b5fdd723ad90f518f579b7bc8622e43a942eec53c938/pydantic_core-2.33.2-cp313-cp313t-win_amd64.whl", hash = "sha256:c2fc0a768ef76c15ab9238afa6da7f69895bb5d1ee83aeea2e3509af4472d0b9", size = 1935777 }, - { url = "https://files.pythonhosted.org/packages/30/68/373d55e58b7e83ce371691f6eaa7175e3a24b956c44628eb25d7da007917/pydantic_core-2.33.2-pp310-pypy310_pp73-macosx_10_12_x86_64.whl", hash = "sha256:5c4aa4e82353f65e548c476b37e64189783aa5384903bfea4f41580f255fddfa", size = 2023982 }, - { url = "https://files.pythonhosted.org/packages/a4/16/145f54ac08c96a63d8ed6442f9dec17b2773d19920b627b18d4f10a061ea/pydantic_core-2.33.2-pp310-pypy310_pp73-macosx_11_0_arm64.whl", hash = "sha256:d946c8bf0d5c24bf4fe333af284c59a19358aa3ec18cb3dc4370080da1e8ad29", size = 1858412 }, - { url = "https://files.pythonhosted.org/packages/41/b1/c6dc6c3e2de4516c0bb2c46f6a373b91b5660312342a0cf5826e38ad82fa/pydantic_core-2.33.2-pp310-pypy310_pp73-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:87b31b6846e361ef83fedb187bb5b4372d0da3f7e28d85415efa92d6125d6e6d", size = 1892749 }, - { url = "https://files.pythonhosted.org/packages/12/73/8cd57e20afba760b21b742106f9dbdfa6697f1570b189c7457a1af4cd8a0/pydantic_core-2.33.2-pp310-pypy310_pp73-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:aa9d91b338f2df0508606f7009fde642391425189bba6d8c653afd80fd6bb64e", size = 2067527 }, - { url = "https://files.pythonhosted.org/packages/e3/d5/0bb5d988cc019b3cba4a78f2d4b3854427fc47ee8ec8e9eaabf787da239c/pydantic_core-2.33.2-pp310-pypy310_pp73-manylinux_2_5_i686.manylinux1_i686.whl", hash = "sha256:2058a32994f1fde4ca0480ab9d1e75a0e8c87c22b53a3ae66554f9af78f2fe8c", size = 2108225 }, - { url = "https://files.pythonhosted.org/packages/f1/c5/00c02d1571913d496aabf146106ad8239dc132485ee22efe08085084ff7c/pydantic_core-2.33.2-pp310-pypy310_pp73-musllinux_1_1_aarch64.whl", hash = "sha256:0e03262ab796d986f978f79c943fc5f620381be7287148b8010b4097f79a39ec", size = 2069490 }, - { url = "https://files.pythonhosted.org/packages/22/a8/dccc38768274d3ed3a59b5d06f59ccb845778687652daa71df0cab4040d7/pydantic_core-2.33.2-pp310-pypy310_pp73-musllinux_1_1_armv7l.whl", hash = "sha256:1a8695a8d00c73e50bff9dfda4d540b7dee29ff9b8053e38380426a85ef10052", size = 2237525 }, - { url = "https://files.pythonhosted.org/packages/d4/e7/4f98c0b125dda7cf7ccd14ba936218397b44f50a56dd8c16a3091df116c3/pydantic_core-2.33.2-pp310-pypy310_pp73-musllinux_1_1_x86_64.whl", hash = "sha256:fa754d1850735a0b0e03bcffd9d4b4343eb417e47196e4485d9cca326073a42c", size = 2238446 }, - { url = "https://files.pythonhosted.org/packages/ce/91/2ec36480fdb0b783cd9ef6795753c1dea13882f2e68e73bce76ae8c21e6a/pydantic_core-2.33.2-pp310-pypy310_pp73-win_amd64.whl", hash = "sha256:a11c8d26a50bfab49002947d3d237abe4d9e4b5bdc8846a63537b6488e197808", size = 2066678 }, - { url = "https://files.pythonhosted.org/packages/7b/27/d4ae6487d73948d6f20dddcd94be4ea43e74349b56eba82e9bdee2d7494c/pydantic_core-2.33.2-pp311-pypy311_pp73-macosx_10_12_x86_64.whl", hash = "sha256:dd14041875d09cc0f9308e37a6f8b65f5585cf2598a53aa0123df8b129d481f8", size = 2025200 }, - { url = "https://files.pythonhosted.org/packages/f1/b8/b3cb95375f05d33801024079b9392a5ab45267a63400bf1866e7ce0f0de4/pydantic_core-2.33.2-pp311-pypy311_pp73-macosx_11_0_arm64.whl", hash = "sha256:d87c561733f66531dced0da6e864f44ebf89a8fba55f31407b00c2f7f9449593", size = 1859123 }, - { url = "https://files.pythonhosted.org/packages/05/bc/0d0b5adeda59a261cd30a1235a445bf55c7e46ae44aea28f7bd6ed46e091/pydantic_core-2.33.2-pp311-pypy311_pp73-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:2f82865531efd18d6e07a04a17331af02cb7a651583c418df8266f17a63c6612", size = 1892852 }, - { url = "https://files.pythonhosted.org/packages/3e/11/d37bdebbda2e449cb3f519f6ce950927b56d62f0b84fd9cb9e372a26a3d5/pydantic_core-2.33.2-pp311-pypy311_pp73-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:2bfb5112df54209d820d7bf9317c7a6c9025ea52e49f46b6a2060104bba37de7", size = 2067484 }, - { url = "https://files.pythonhosted.org/packages/8c/55/1f95f0a05ce72ecb02a8a8a1c3be0579bbc29b1d5ab68f1378b7bebc5057/pydantic_core-2.33.2-pp311-pypy311_pp73-manylinux_2_5_i686.manylinux1_i686.whl", hash = "sha256:64632ff9d614e5eecfb495796ad51b0ed98c453e447a76bcbeeb69615079fc7e", size = 2108896 }, - { url = "https://files.pythonhosted.org/packages/53/89/2b2de6c81fa131f423246a9109d7b2a375e83968ad0800d6e57d0574629b/pydantic_core-2.33.2-pp311-pypy311_pp73-musllinux_1_1_aarch64.whl", hash = "sha256:f889f7a40498cc077332c7ab6b4608d296d852182211787d4f3ee377aaae66e8", size = 2069475 }, - { url = "https://files.pythonhosted.org/packages/b8/e9/1f7efbe20d0b2b10f6718944b5d8ece9152390904f29a78e68d4e7961159/pydantic_core-2.33.2-pp311-pypy311_pp73-musllinux_1_1_armv7l.whl", hash = "sha256:de4b83bb311557e439b9e186f733f6c645b9417c84e2eb8203f3f820a4b988bf", size = 2239013 }, - { url = "https://files.pythonhosted.org/packages/3c/b2/5309c905a93811524a49b4e031e9851a6b00ff0fb668794472ea7746b448/pydantic_core-2.33.2-pp311-pypy311_pp73-musllinux_1_1_x86_64.whl", hash = "sha256:82f68293f055f51b51ea42fafc74b6aad03e70e191799430b90c13d643059ebb", size = 2238715 }, - { url = "https://files.pythonhosted.org/packages/32/56/8a7ca5d2cd2cda1d245d34b1c9a942920a718082ae8e54e5f3e5a58b7add/pydantic_core-2.33.2-pp311-pypy311_pp73-win_amd64.whl", hash = "sha256:329467cecfb529c925cf2bbd4d60d2c509bc2fb52a20c1045bf09bb70971a9c1", size = 2066757 }, +sdist = { url = "https://files.pythonhosted.org/packages/ad/88/5f2260bdfae97aabf98f1778d43f69574390ad787afb646292a638c923d4/pydantic_core-2.33.2.tar.gz", hash = "sha256:7cb8bc3605c29176e1b105350d2e6474142d7c1bd1d9327c4a9bdb46bf827acc", size = 435195, upload-time = "2025-04-23T18:33:52.104Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/e5/92/b31726561b5dae176c2d2c2dc43a9c5bfba5d32f96f8b4c0a600dd492447/pydantic_core-2.33.2-cp310-cp310-macosx_10_12_x86_64.whl", hash = "sha256:2b3d326aaef0c0399d9afffeb6367d5e26ddc24d351dbc9c636840ac355dc5d8", size = 2028817, upload-time = "2025-04-23T18:30:43.919Z" }, + { url = "https://files.pythonhosted.org/packages/a3/44/3f0b95fafdaca04a483c4e685fe437c6891001bf3ce8b2fded82b9ea3aa1/pydantic_core-2.33.2-cp310-cp310-macosx_11_0_arm64.whl", hash = "sha256:0e5b2671f05ba48b94cb90ce55d8bdcaaedb8ba00cc5359f6810fc918713983d", size = 1861357, upload-time = "2025-04-23T18:30:46.372Z" }, + { url = "https://files.pythonhosted.org/packages/30/97/e8f13b55766234caae05372826e8e4b3b96e7b248be3157f53237682e43c/pydantic_core-2.33.2-cp310-cp310-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:0069c9acc3f3981b9ff4cdfaf088e98d83440a4c7ea1bc07460af3d4dc22e72d", size = 1898011, upload-time = "2025-04-23T18:30:47.591Z" }, + { url = "https://files.pythonhosted.org/packages/9b/a3/99c48cf7bafc991cc3ee66fd544c0aae8dc907b752f1dad2d79b1b5a471f/pydantic_core-2.33.2-cp310-cp310-manylinux_2_17_armv7l.manylinux2014_armv7l.whl", hash = "sha256:d53b22f2032c42eaaf025f7c40c2e3b94568ae077a606f006d206a463bc69572", size = 1982730, upload-time = "2025-04-23T18:30:49.328Z" }, + { url = "https://files.pythonhosted.org/packages/de/8e/a5b882ec4307010a840fb8b58bd9bf65d1840c92eae7534c7441709bf54b/pydantic_core-2.33.2-cp310-cp310-manylinux_2_17_ppc64le.manylinux2014_ppc64le.whl", hash = "sha256:0405262705a123b7ce9f0b92f123334d67b70fd1f20a9372b907ce1080c7ba02", size = 2136178, upload-time = "2025-04-23T18:30:50.907Z" }, + { url = "https://files.pythonhosted.org/packages/e4/bb/71e35fc3ed05af6834e890edb75968e2802fe98778971ab5cba20a162315/pydantic_core-2.33.2-cp310-cp310-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:4b25d91e288e2c4e0662b8038a28c6a07eaac3e196cfc4ff69de4ea3db992a1b", size = 2736462, upload-time = "2025-04-23T18:30:52.083Z" }, + { url = "https://files.pythonhosted.org/packages/31/0d/c8f7593e6bc7066289bbc366f2235701dcbebcd1ff0ef8e64f6f239fb47d/pydantic_core-2.33.2-cp310-cp310-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:6bdfe4b3789761f3bcb4b1ddf33355a71079858958e3a552f16d5af19768fef2", size = 2005652, upload-time = "2025-04-23T18:30:53.389Z" }, + { url = "https://files.pythonhosted.org/packages/d2/7a/996d8bd75f3eda405e3dd219ff5ff0a283cd8e34add39d8ef9157e722867/pydantic_core-2.33.2-cp310-cp310-manylinux_2_5_i686.manylinux1_i686.whl", hash = "sha256:efec8db3266b76ef9607c2c4c419bdb06bf335ae433b80816089ea7585816f6a", size = 2113306, upload-time = "2025-04-23T18:30:54.661Z" }, + { url = "https://files.pythonhosted.org/packages/ff/84/daf2a6fb2db40ffda6578a7e8c5a6e9c8affb251a05c233ae37098118788/pydantic_core-2.33.2-cp310-cp310-musllinux_1_1_aarch64.whl", hash = "sha256:031c57d67ca86902726e0fae2214ce6770bbe2f710dc33063187a68744a5ecac", size = 2073720, upload-time = "2025-04-23T18:30:56.11Z" }, + { url = "https://files.pythonhosted.org/packages/77/fb/2258da019f4825128445ae79456a5499c032b55849dbd5bed78c95ccf163/pydantic_core-2.33.2-cp310-cp310-musllinux_1_1_armv7l.whl", hash = "sha256:f8de619080e944347f5f20de29a975c2d815d9ddd8be9b9b7268e2e3ef68605a", size = 2244915, upload-time = "2025-04-23T18:30:57.501Z" }, + { url = "https://files.pythonhosted.org/packages/d8/7a/925ff73756031289468326e355b6fa8316960d0d65f8b5d6b3a3e7866de7/pydantic_core-2.33.2-cp310-cp310-musllinux_1_1_x86_64.whl", hash = "sha256:73662edf539e72a9440129f231ed3757faab89630d291b784ca99237fb94db2b", size = 2241884, upload-time = "2025-04-23T18:30:58.867Z" }, + { url = "https://files.pythonhosted.org/packages/0b/b0/249ee6d2646f1cdadcb813805fe76265745c4010cf20a8eba7b0e639d9b2/pydantic_core-2.33.2-cp310-cp310-win32.whl", hash = "sha256:0a39979dcbb70998b0e505fb1556a1d550a0781463ce84ebf915ba293ccb7e22", size = 1910496, upload-time = "2025-04-23T18:31:00.078Z" }, + { url = "https://files.pythonhosted.org/packages/66/ff/172ba8f12a42d4b552917aa65d1f2328990d3ccfc01d5b7c943ec084299f/pydantic_core-2.33.2-cp310-cp310-win_amd64.whl", hash = "sha256:b0379a2b24882fef529ec3b4987cb5d003b9cda32256024e6fe1586ac45fc640", size = 1955019, upload-time = "2025-04-23T18:31:01.335Z" }, + { url = "https://files.pythonhosted.org/packages/3f/8d/71db63483d518cbbf290261a1fc2839d17ff89fce7089e08cad07ccfce67/pydantic_core-2.33.2-cp311-cp311-macosx_10_12_x86_64.whl", hash = "sha256:4c5b0a576fb381edd6d27f0a85915c6daf2f8138dc5c267a57c08a62900758c7", size = 2028584, upload-time = "2025-04-23T18:31:03.106Z" }, + { url = "https://files.pythonhosted.org/packages/24/2f/3cfa7244ae292dd850989f328722d2aef313f74ffc471184dc509e1e4e5a/pydantic_core-2.33.2-cp311-cp311-macosx_11_0_arm64.whl", hash = "sha256:e799c050df38a639db758c617ec771fd8fb7a5f8eaaa4b27b101f266b216a246", size = 1855071, upload-time = "2025-04-23T18:31:04.621Z" }, + { url = "https://files.pythonhosted.org/packages/b3/d3/4ae42d33f5e3f50dd467761304be2fa0a9417fbf09735bc2cce003480f2a/pydantic_core-2.33.2-cp311-cp311-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:dc46a01bf8d62f227d5ecee74178ffc448ff4e5197c756331f71efcc66dc980f", size = 1897823, upload-time = "2025-04-23T18:31:06.377Z" }, + { url = "https://files.pythonhosted.org/packages/f4/f3/aa5976e8352b7695ff808599794b1fba2a9ae2ee954a3426855935799488/pydantic_core-2.33.2-cp311-cp311-manylinux_2_17_armv7l.manylinux2014_armv7l.whl", hash = "sha256:a144d4f717285c6d9234a66778059f33a89096dfb9b39117663fd8413d582dcc", size = 1983792, upload-time = "2025-04-23T18:31:07.93Z" }, + { url = "https://files.pythonhosted.org/packages/d5/7a/cda9b5a23c552037717f2b2a5257e9b2bfe45e687386df9591eff7b46d28/pydantic_core-2.33.2-cp311-cp311-manylinux_2_17_ppc64le.manylinux2014_ppc64le.whl", hash = "sha256:73cf6373c21bc80b2e0dc88444f41ae60b2f070ed02095754eb5a01df12256de", size = 2136338, upload-time = "2025-04-23T18:31:09.283Z" }, + { url = "https://files.pythonhosted.org/packages/2b/9f/b8f9ec8dd1417eb9da784e91e1667d58a2a4a7b7b34cf4af765ef663a7e5/pydantic_core-2.33.2-cp311-cp311-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:3dc625f4aa79713512d1976fe9f0bc99f706a9dee21dfd1810b4bbbf228d0e8a", size = 2730998, upload-time = "2025-04-23T18:31:11.7Z" }, + { url = "https://files.pythonhosted.org/packages/47/bc/cd720e078576bdb8255d5032c5d63ee5c0bf4b7173dd955185a1d658c456/pydantic_core-2.33.2-cp311-cp311-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:881b21b5549499972441da4758d662aeea93f1923f953e9cbaff14b8b9565aef", size = 2003200, upload-time = "2025-04-23T18:31:13.536Z" }, + { url = "https://files.pythonhosted.org/packages/ca/22/3602b895ee2cd29d11a2b349372446ae9727c32e78a94b3d588a40fdf187/pydantic_core-2.33.2-cp311-cp311-manylinux_2_5_i686.manylinux1_i686.whl", hash = "sha256:bdc25f3681f7b78572699569514036afe3c243bc3059d3942624e936ec93450e", size = 2113890, upload-time = "2025-04-23T18:31:15.011Z" }, + { url = "https://files.pythonhosted.org/packages/ff/e6/e3c5908c03cf00d629eb38393a98fccc38ee0ce8ecce32f69fc7d7b558a7/pydantic_core-2.33.2-cp311-cp311-musllinux_1_1_aarch64.whl", hash = "sha256:fe5b32187cbc0c862ee201ad66c30cf218e5ed468ec8dc1cf49dec66e160cc4d", size = 2073359, upload-time = "2025-04-23T18:31:16.393Z" }, + { url = "https://files.pythonhosted.org/packages/12/e7/6a36a07c59ebefc8777d1ffdaf5ae71b06b21952582e4b07eba88a421c79/pydantic_core-2.33.2-cp311-cp311-musllinux_1_1_armv7l.whl", hash = "sha256:bc7aee6f634a6f4a95676fcb5d6559a2c2a390330098dba5e5a5f28a2e4ada30", size = 2245883, upload-time = "2025-04-23T18:31:17.892Z" }, + { url = "https://files.pythonhosted.org/packages/16/3f/59b3187aaa6cc0c1e6616e8045b284de2b6a87b027cce2ffcea073adf1d2/pydantic_core-2.33.2-cp311-cp311-musllinux_1_1_x86_64.whl", hash = "sha256:235f45e5dbcccf6bd99f9f472858849f73d11120d76ea8707115415f8e5ebebf", size = 2241074, upload-time = "2025-04-23T18:31:19.205Z" }, + { url = "https://files.pythonhosted.org/packages/e0/ed/55532bb88f674d5d8f67ab121a2a13c385df382de2a1677f30ad385f7438/pydantic_core-2.33.2-cp311-cp311-win32.whl", hash = "sha256:6368900c2d3ef09b69cb0b913f9f8263b03786e5b2a387706c5afb66800efd51", size = 1910538, upload-time = "2025-04-23T18:31:20.541Z" }, + { url = "https://files.pythonhosted.org/packages/fe/1b/25b7cccd4519c0b23c2dd636ad39d381abf113085ce4f7bec2b0dc755eb1/pydantic_core-2.33.2-cp311-cp311-win_amd64.whl", hash = "sha256:1e063337ef9e9820c77acc768546325ebe04ee38b08703244c1309cccc4f1bab", size = 1952909, upload-time = "2025-04-23T18:31:22.371Z" }, + { url = "https://files.pythonhosted.org/packages/49/a9/d809358e49126438055884c4366a1f6227f0f84f635a9014e2deb9b9de54/pydantic_core-2.33.2-cp311-cp311-win_arm64.whl", hash = "sha256:6b99022f1d19bc32a4c2a0d544fc9a76e3be90f0b3f4af413f87d38749300e65", size = 1897786, upload-time = "2025-04-23T18:31:24.161Z" }, + { url = "https://files.pythonhosted.org/packages/18/8a/2b41c97f554ec8c71f2a8a5f85cb56a8b0956addfe8b0efb5b3d77e8bdc3/pydantic_core-2.33.2-cp312-cp312-macosx_10_12_x86_64.whl", hash = "sha256:a7ec89dc587667f22b6a0b6579c249fca9026ce7c333fc142ba42411fa243cdc", size = 2009000, upload-time = "2025-04-23T18:31:25.863Z" }, + { url = "https://files.pythonhosted.org/packages/a1/02/6224312aacb3c8ecbaa959897af57181fb6cf3a3d7917fd44d0f2917e6f2/pydantic_core-2.33.2-cp312-cp312-macosx_11_0_arm64.whl", hash = "sha256:3c6db6e52c6d70aa0d00d45cdb9b40f0433b96380071ea80b09277dba021ddf7", size = 1847996, upload-time = "2025-04-23T18:31:27.341Z" }, + { url = "https://files.pythonhosted.org/packages/d6/46/6dcdf084a523dbe0a0be59d054734b86a981726f221f4562aed313dbcb49/pydantic_core-2.33.2-cp312-cp312-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:4e61206137cbc65e6d5256e1166f88331d3b6238e082d9f74613b9b765fb9025", size = 1880957, upload-time = "2025-04-23T18:31:28.956Z" }, + { url = "https://files.pythonhosted.org/packages/ec/6b/1ec2c03837ac00886ba8160ce041ce4e325b41d06a034adbef11339ae422/pydantic_core-2.33.2-cp312-cp312-manylinux_2_17_armv7l.manylinux2014_armv7l.whl", hash = "sha256:eb8c529b2819c37140eb51b914153063d27ed88e3bdc31b71198a198e921e011", size = 1964199, upload-time = "2025-04-23T18:31:31.025Z" }, + { url = "https://files.pythonhosted.org/packages/2d/1d/6bf34d6adb9debd9136bd197ca72642203ce9aaaa85cfcbfcf20f9696e83/pydantic_core-2.33.2-cp312-cp312-manylinux_2_17_ppc64le.manylinux2014_ppc64le.whl", hash = "sha256:c52b02ad8b4e2cf14ca7b3d918f3eb0ee91e63b3167c32591e57c4317e134f8f", size = 2120296, upload-time = "2025-04-23T18:31:32.514Z" }, + { url = "https://files.pythonhosted.org/packages/e0/94/2bd0aaf5a591e974b32a9f7123f16637776c304471a0ab33cf263cf5591a/pydantic_core-2.33.2-cp312-cp312-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:96081f1605125ba0855dfda83f6f3df5ec90c61195421ba72223de35ccfb2f88", size = 2676109, upload-time = "2025-04-23T18:31:33.958Z" }, + { url = "https://files.pythonhosted.org/packages/f9/41/4b043778cf9c4285d59742281a769eac371b9e47e35f98ad321349cc5d61/pydantic_core-2.33.2-cp312-cp312-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:8f57a69461af2a5fa6e6bbd7a5f60d3b7e6cebb687f55106933188e79ad155c1", size = 2002028, upload-time = "2025-04-23T18:31:39.095Z" }, + { url = "https://files.pythonhosted.org/packages/cb/d5/7bb781bf2748ce3d03af04d5c969fa1308880e1dca35a9bd94e1a96a922e/pydantic_core-2.33.2-cp312-cp312-manylinux_2_5_i686.manylinux1_i686.whl", hash = "sha256:572c7e6c8bb4774d2ac88929e3d1f12bc45714ae5ee6d9a788a9fb35e60bb04b", size = 2100044, upload-time = "2025-04-23T18:31:41.034Z" }, + { url = "https://files.pythonhosted.org/packages/fe/36/def5e53e1eb0ad896785702a5bbfd25eed546cdcf4087ad285021a90ed53/pydantic_core-2.33.2-cp312-cp312-musllinux_1_1_aarch64.whl", hash = "sha256:db4b41f9bd95fbe5acd76d89920336ba96f03e149097365afe1cb092fceb89a1", size = 2058881, upload-time = "2025-04-23T18:31:42.757Z" }, + { url = "https://files.pythonhosted.org/packages/01/6c/57f8d70b2ee57fc3dc8b9610315949837fa8c11d86927b9bb044f8705419/pydantic_core-2.33.2-cp312-cp312-musllinux_1_1_armv7l.whl", hash = "sha256:fa854f5cf7e33842a892e5c73f45327760bc7bc516339fda888c75ae60edaeb6", size = 2227034, upload-time = "2025-04-23T18:31:44.304Z" }, + { url = "https://files.pythonhosted.org/packages/27/b9/9c17f0396a82b3d5cbea4c24d742083422639e7bb1d5bf600e12cb176a13/pydantic_core-2.33.2-cp312-cp312-musllinux_1_1_x86_64.whl", hash = "sha256:5f483cfb75ff703095c59e365360cb73e00185e01aaea067cd19acffd2ab20ea", size = 2234187, upload-time = "2025-04-23T18:31:45.891Z" }, + { url = "https://files.pythonhosted.org/packages/b0/6a/adf5734ffd52bf86d865093ad70b2ce543415e0e356f6cacabbc0d9ad910/pydantic_core-2.33.2-cp312-cp312-win32.whl", hash = "sha256:9cb1da0f5a471435a7bc7e439b8a728e8b61e59784b2af70d7c169f8dd8ae290", size = 1892628, upload-time = "2025-04-23T18:31:47.819Z" }, + { url = "https://files.pythonhosted.org/packages/43/e4/5479fecb3606c1368d496a825d8411e126133c41224c1e7238be58b87d7e/pydantic_core-2.33.2-cp312-cp312-win_amd64.whl", hash = "sha256:f941635f2a3d96b2973e867144fde513665c87f13fe0e193c158ac51bfaaa7b2", size = 1955866, upload-time = "2025-04-23T18:31:49.635Z" }, + { url = "https://files.pythonhosted.org/packages/0d/24/8b11e8b3e2be9dd82df4b11408a67c61bb4dc4f8e11b5b0fc888b38118b5/pydantic_core-2.33.2-cp312-cp312-win_arm64.whl", hash = "sha256:cca3868ddfaccfbc4bfb1d608e2ccaaebe0ae628e1416aeb9c4d88c001bb45ab", size = 1888894, upload-time = "2025-04-23T18:31:51.609Z" }, + { url = "https://files.pythonhosted.org/packages/46/8c/99040727b41f56616573a28771b1bfa08a3d3fe74d3d513f01251f79f172/pydantic_core-2.33.2-cp313-cp313-macosx_10_12_x86_64.whl", hash = "sha256:1082dd3e2d7109ad8b7da48e1d4710c8d06c253cbc4a27c1cff4fbcaa97a9e3f", size = 2015688, upload-time = "2025-04-23T18:31:53.175Z" }, + { url = "https://files.pythonhosted.org/packages/3a/cc/5999d1eb705a6cefc31f0b4a90e9f7fc400539b1a1030529700cc1b51838/pydantic_core-2.33.2-cp313-cp313-macosx_11_0_arm64.whl", hash = "sha256:f517ca031dfc037a9c07e748cefd8d96235088b83b4f4ba8939105d20fa1dcd6", size = 1844808, upload-time = "2025-04-23T18:31:54.79Z" }, + { url = "https://files.pythonhosted.org/packages/6f/5e/a0a7b8885c98889a18b6e376f344da1ef323d270b44edf8174d6bce4d622/pydantic_core-2.33.2-cp313-cp313-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:0a9f2c9dd19656823cb8250b0724ee9c60a82f3cdf68a080979d13092a3b0fef", size = 1885580, upload-time = "2025-04-23T18:31:57.393Z" }, + { url = "https://files.pythonhosted.org/packages/3b/2a/953581f343c7d11a304581156618c3f592435523dd9d79865903272c256a/pydantic_core-2.33.2-cp313-cp313-manylinux_2_17_armv7l.manylinux2014_armv7l.whl", hash = "sha256:2b0a451c263b01acebe51895bfb0e1cc842a5c666efe06cdf13846c7418caa9a", size = 1973859, upload-time = "2025-04-23T18:31:59.065Z" }, + { url = "https://files.pythonhosted.org/packages/e6/55/f1a813904771c03a3f97f676c62cca0c0a4138654107c1b61f19c644868b/pydantic_core-2.33.2-cp313-cp313-manylinux_2_17_ppc64le.manylinux2014_ppc64le.whl", hash = "sha256:1ea40a64d23faa25e62a70ad163571c0b342b8bf66d5fa612ac0dec4f069d916", size = 2120810, upload-time = "2025-04-23T18:32:00.78Z" }, + { url = "https://files.pythonhosted.org/packages/aa/c3/053389835a996e18853ba107a63caae0b9deb4a276c6b472931ea9ae6e48/pydantic_core-2.33.2-cp313-cp313-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:0fb2d542b4d66f9470e8065c5469ec676978d625a8b7a363f07d9a501a9cb36a", size = 2676498, upload-time = "2025-04-23T18:32:02.418Z" }, + { url = "https://files.pythonhosted.org/packages/eb/3c/f4abd740877a35abade05e437245b192f9d0ffb48bbbbd708df33d3cda37/pydantic_core-2.33.2-cp313-cp313-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:9fdac5d6ffa1b5a83bca06ffe7583f5576555e6c8b3a91fbd25ea7780f825f7d", size = 2000611, upload-time = "2025-04-23T18:32:04.152Z" }, + { url = "https://files.pythonhosted.org/packages/59/a7/63ef2fed1837d1121a894d0ce88439fe3e3b3e48c7543b2a4479eb99c2bd/pydantic_core-2.33.2-cp313-cp313-manylinux_2_5_i686.manylinux1_i686.whl", hash = "sha256:04a1a413977ab517154eebb2d326da71638271477d6ad87a769102f7c2488c56", size = 2107924, upload-time = "2025-04-23T18:32:06.129Z" }, + { url = "https://files.pythonhosted.org/packages/04/8f/2551964ef045669801675f1cfc3b0d74147f4901c3ffa42be2ddb1f0efc4/pydantic_core-2.33.2-cp313-cp313-musllinux_1_1_aarch64.whl", hash = "sha256:c8e7af2f4e0194c22b5b37205bfb293d166a7344a5b0d0eaccebc376546d77d5", size = 2063196, upload-time = "2025-04-23T18:32:08.178Z" }, + { url = "https://files.pythonhosted.org/packages/26/bd/d9602777e77fc6dbb0c7db9ad356e9a985825547dce5ad1d30ee04903918/pydantic_core-2.33.2-cp313-cp313-musllinux_1_1_armv7l.whl", hash = "sha256:5c92edd15cd58b3c2d34873597a1e20f13094f59cf88068adb18947df5455b4e", size = 2236389, upload-time = "2025-04-23T18:32:10.242Z" }, + { url = "https://files.pythonhosted.org/packages/42/db/0e950daa7e2230423ab342ae918a794964b053bec24ba8af013fc7c94846/pydantic_core-2.33.2-cp313-cp313-musllinux_1_1_x86_64.whl", hash = "sha256:65132b7b4a1c0beded5e057324b7e16e10910c106d43675d9bd87d4f38dde162", size = 2239223, upload-time = "2025-04-23T18:32:12.382Z" }, + { url = "https://files.pythonhosted.org/packages/58/4d/4f937099c545a8a17eb52cb67fe0447fd9a373b348ccfa9a87f141eeb00f/pydantic_core-2.33.2-cp313-cp313-win32.whl", hash = "sha256:52fb90784e0a242bb96ec53f42196a17278855b0f31ac7c3cc6f5c1ec4811849", size = 1900473, upload-time = "2025-04-23T18:32:14.034Z" }, + { url = "https://files.pythonhosted.org/packages/a0/75/4a0a9bac998d78d889def5e4ef2b065acba8cae8c93696906c3a91f310ca/pydantic_core-2.33.2-cp313-cp313-win_amd64.whl", hash = "sha256:c083a3bdd5a93dfe480f1125926afcdbf2917ae714bdb80b36d34318b2bec5d9", size = 1955269, upload-time = "2025-04-23T18:32:15.783Z" }, + { url = "https://files.pythonhosted.org/packages/f9/86/1beda0576969592f1497b4ce8e7bc8cbdf614c352426271b1b10d5f0aa64/pydantic_core-2.33.2-cp313-cp313-win_arm64.whl", hash = "sha256:e80b087132752f6b3d714f041ccf74403799d3b23a72722ea2e6ba2e892555b9", size = 1893921, upload-time = "2025-04-23T18:32:18.473Z" }, + { url = "https://files.pythonhosted.org/packages/a4/7d/e09391c2eebeab681df2b74bfe6c43422fffede8dc74187b2b0bf6fd7571/pydantic_core-2.33.2-cp313-cp313t-macosx_11_0_arm64.whl", hash = "sha256:61c18fba8e5e9db3ab908620af374db0ac1baa69f0f32df4f61ae23f15e586ac", size = 1806162, upload-time = "2025-04-23T18:32:20.188Z" }, + { url = "https://files.pythonhosted.org/packages/f1/3d/847b6b1fed9f8ed3bb95a9ad04fbd0b212e832d4f0f50ff4d9ee5a9f15cf/pydantic_core-2.33.2-cp313-cp313t-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:95237e53bb015f67b63c91af7518a62a8660376a6a0db19b89acc77a4d6199f5", size = 1981560, upload-time = "2025-04-23T18:32:22.354Z" }, + { url = "https://files.pythonhosted.org/packages/6f/9a/e73262f6c6656262b5fdd723ad90f518f579b7bc8622e43a942eec53c938/pydantic_core-2.33.2-cp313-cp313t-win_amd64.whl", hash = "sha256:c2fc0a768ef76c15ab9238afa6da7f69895bb5d1ee83aeea2e3509af4472d0b9", size = 1935777, upload-time = "2025-04-23T18:32:25.088Z" }, + { url = "https://files.pythonhosted.org/packages/30/68/373d55e58b7e83ce371691f6eaa7175e3a24b956c44628eb25d7da007917/pydantic_core-2.33.2-pp310-pypy310_pp73-macosx_10_12_x86_64.whl", hash = "sha256:5c4aa4e82353f65e548c476b37e64189783aa5384903bfea4f41580f255fddfa", size = 2023982, upload-time = "2025-04-23T18:32:53.14Z" }, + { url = "https://files.pythonhosted.org/packages/a4/16/145f54ac08c96a63d8ed6442f9dec17b2773d19920b627b18d4f10a061ea/pydantic_core-2.33.2-pp310-pypy310_pp73-macosx_11_0_arm64.whl", hash = "sha256:d946c8bf0d5c24bf4fe333af284c59a19358aa3ec18cb3dc4370080da1e8ad29", size = 1858412, upload-time = "2025-04-23T18:32:55.52Z" }, + { url = "https://files.pythonhosted.org/packages/41/b1/c6dc6c3e2de4516c0bb2c46f6a373b91b5660312342a0cf5826e38ad82fa/pydantic_core-2.33.2-pp310-pypy310_pp73-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:87b31b6846e361ef83fedb187bb5b4372d0da3f7e28d85415efa92d6125d6e6d", size = 1892749, upload-time = "2025-04-23T18:32:57.546Z" }, + { url = "https://files.pythonhosted.org/packages/12/73/8cd57e20afba760b21b742106f9dbdfa6697f1570b189c7457a1af4cd8a0/pydantic_core-2.33.2-pp310-pypy310_pp73-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:aa9d91b338f2df0508606f7009fde642391425189bba6d8c653afd80fd6bb64e", size = 2067527, upload-time = "2025-04-23T18:32:59.771Z" }, + { url = "https://files.pythonhosted.org/packages/e3/d5/0bb5d988cc019b3cba4a78f2d4b3854427fc47ee8ec8e9eaabf787da239c/pydantic_core-2.33.2-pp310-pypy310_pp73-manylinux_2_5_i686.manylinux1_i686.whl", hash = "sha256:2058a32994f1fde4ca0480ab9d1e75a0e8c87c22b53a3ae66554f9af78f2fe8c", size = 2108225, upload-time = "2025-04-23T18:33:04.51Z" }, + { url = "https://files.pythonhosted.org/packages/f1/c5/00c02d1571913d496aabf146106ad8239dc132485ee22efe08085084ff7c/pydantic_core-2.33.2-pp310-pypy310_pp73-musllinux_1_1_aarch64.whl", hash = "sha256:0e03262ab796d986f978f79c943fc5f620381be7287148b8010b4097f79a39ec", size = 2069490, upload-time = "2025-04-23T18:33:06.391Z" }, + { url = "https://files.pythonhosted.org/packages/22/a8/dccc38768274d3ed3a59b5d06f59ccb845778687652daa71df0cab4040d7/pydantic_core-2.33.2-pp310-pypy310_pp73-musllinux_1_1_armv7l.whl", hash = "sha256:1a8695a8d00c73e50bff9dfda4d540b7dee29ff9b8053e38380426a85ef10052", size = 2237525, upload-time = "2025-04-23T18:33:08.44Z" }, + { url = "https://files.pythonhosted.org/packages/d4/e7/4f98c0b125dda7cf7ccd14ba936218397b44f50a56dd8c16a3091df116c3/pydantic_core-2.33.2-pp310-pypy310_pp73-musllinux_1_1_x86_64.whl", hash = "sha256:fa754d1850735a0b0e03bcffd9d4b4343eb417e47196e4485d9cca326073a42c", size = 2238446, upload-time = "2025-04-23T18:33:10.313Z" }, + { url = "https://files.pythonhosted.org/packages/ce/91/2ec36480fdb0b783cd9ef6795753c1dea13882f2e68e73bce76ae8c21e6a/pydantic_core-2.33.2-pp310-pypy310_pp73-win_amd64.whl", hash = "sha256:a11c8d26a50bfab49002947d3d237abe4d9e4b5bdc8846a63537b6488e197808", size = 2066678, upload-time = "2025-04-23T18:33:12.224Z" }, + { url = "https://files.pythonhosted.org/packages/7b/27/d4ae6487d73948d6f20dddcd94be4ea43e74349b56eba82e9bdee2d7494c/pydantic_core-2.33.2-pp311-pypy311_pp73-macosx_10_12_x86_64.whl", hash = "sha256:dd14041875d09cc0f9308e37a6f8b65f5585cf2598a53aa0123df8b129d481f8", size = 2025200, upload-time = "2025-04-23T18:33:14.199Z" }, + { url = "https://files.pythonhosted.org/packages/f1/b8/b3cb95375f05d33801024079b9392a5ab45267a63400bf1866e7ce0f0de4/pydantic_core-2.33.2-pp311-pypy311_pp73-macosx_11_0_arm64.whl", hash = "sha256:d87c561733f66531dced0da6e864f44ebf89a8fba55f31407b00c2f7f9449593", size = 1859123, upload-time = "2025-04-23T18:33:16.555Z" }, + { url = "https://files.pythonhosted.org/packages/05/bc/0d0b5adeda59a261cd30a1235a445bf55c7e46ae44aea28f7bd6ed46e091/pydantic_core-2.33.2-pp311-pypy311_pp73-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:2f82865531efd18d6e07a04a17331af02cb7a651583c418df8266f17a63c6612", size = 1892852, upload-time = "2025-04-23T18:33:18.513Z" }, + { url = "https://files.pythonhosted.org/packages/3e/11/d37bdebbda2e449cb3f519f6ce950927b56d62f0b84fd9cb9e372a26a3d5/pydantic_core-2.33.2-pp311-pypy311_pp73-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:2bfb5112df54209d820d7bf9317c7a6c9025ea52e49f46b6a2060104bba37de7", size = 2067484, upload-time = "2025-04-23T18:33:20.475Z" }, + { url = "https://files.pythonhosted.org/packages/8c/55/1f95f0a05ce72ecb02a8a8a1c3be0579bbc29b1d5ab68f1378b7bebc5057/pydantic_core-2.33.2-pp311-pypy311_pp73-manylinux_2_5_i686.manylinux1_i686.whl", hash = "sha256:64632ff9d614e5eecfb495796ad51b0ed98c453e447a76bcbeeb69615079fc7e", size = 2108896, upload-time = "2025-04-23T18:33:22.501Z" }, + { url = "https://files.pythonhosted.org/packages/53/89/2b2de6c81fa131f423246a9109d7b2a375e83968ad0800d6e57d0574629b/pydantic_core-2.33.2-pp311-pypy311_pp73-musllinux_1_1_aarch64.whl", hash = "sha256:f889f7a40498cc077332c7ab6b4608d296d852182211787d4f3ee377aaae66e8", size = 2069475, upload-time = "2025-04-23T18:33:24.528Z" }, + { url = "https://files.pythonhosted.org/packages/b8/e9/1f7efbe20d0b2b10f6718944b5d8ece9152390904f29a78e68d4e7961159/pydantic_core-2.33.2-pp311-pypy311_pp73-musllinux_1_1_armv7l.whl", hash = "sha256:de4b83bb311557e439b9e186f733f6c645b9417c84e2eb8203f3f820a4b988bf", size = 2239013, upload-time = "2025-04-23T18:33:26.621Z" }, + { url = "https://files.pythonhosted.org/packages/3c/b2/5309c905a93811524a49b4e031e9851a6b00ff0fb668794472ea7746b448/pydantic_core-2.33.2-pp311-pypy311_pp73-musllinux_1_1_x86_64.whl", hash = "sha256:82f68293f055f51b51ea42fafc74b6aad03e70e191799430b90c13d643059ebb", size = 2238715, upload-time = "2025-04-23T18:33:28.656Z" }, + { url = "https://files.pythonhosted.org/packages/32/56/8a7ca5d2cd2cda1d245d34b1c9a942920a718082ae8e54e5f3e5a58b7add/pydantic_core-2.33.2-pp311-pypy311_pp73-win_amd64.whl", hash = "sha256:329467cecfb529c925cf2bbd4d60d2c509bc2fb52a20c1045bf09bb70971a9c1", size = 2066757, upload-time = "2025-04-23T18:33:30.645Z" }, ] [[package]] name = "pygments" version = "2.19.1" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/7c/2d/c3338d48ea6cc0feb8446d8e6937e1408088a72a39937982cc6111d17f84/pygments-2.19.1.tar.gz", hash = "sha256:61c16d2a8576dc0649d9f39e089b5f02bcd27fba10d8fb4dcc28173f7a45151f", size = 4968581 } +sdist = { url = "https://files.pythonhosted.org/packages/7c/2d/c3338d48ea6cc0feb8446d8e6937e1408088a72a39937982cc6111d17f84/pygments-2.19.1.tar.gz", hash = "sha256:61c16d2a8576dc0649d9f39e089b5f02bcd27fba10d8fb4dcc28173f7a45151f", size = 4968581, upload-time = "2025-01-06T17:26:30.443Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/8a/0b/9fcc47d19c48b59121088dd6da2488a49d5f72dacf8262e2790a1d2c7d15/pygments-2.19.1-py3-none-any.whl", hash = "sha256:9ea1544ad55cecf4b8242fab6dd35a93bbce657034b0611ee383099054ab6d8c", size = 1225293 }, + { url = "https://files.pythonhosted.org/packages/8a/0b/9fcc47d19c48b59121088dd6da2488a49d5f72dacf8262e2790a1d2c7d15/pygments-2.19.1-py3-none-any.whl", hash = "sha256:9ea1544ad55cecf4b8242fab6dd35a93bbce657034b0611ee383099054ab6d8c", size = 1225293, upload-time = "2025-01-06T17:26:25.553Z" }, ] [[package]] @@ -1703,9 +1729,9 @@ dependencies = [ { name = "pynacl" }, { name = "six" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/37/b4/52ff00b59e91c4817ca60210c33caf11e85a7f68f7b361748ca2eb50923e/pymacaroons-0.13.0.tar.gz", hash = "sha256:1e6bba42a5f66c245adf38a5a4006a99dcc06a0703786ea636098667d42903b8", size = 21083 } +sdist = { url = "https://files.pythonhosted.org/packages/37/b4/52ff00b59e91c4817ca60210c33caf11e85a7f68f7b361748ca2eb50923e/pymacaroons-0.13.0.tar.gz", hash = "sha256:1e6bba42a5f66c245adf38a5a4006a99dcc06a0703786ea636098667d42903b8", size = 21083, upload-time = "2018-02-21T18:07:49.045Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/d8/87/fd9b54258216e3f19671f6e9dd76da1ebc49e93ea0107c986b1071dd3068/pymacaroons-0.13.0-py2.py3-none-any.whl", hash = "sha256:3e14dff6a262fdbf1a15e769ce635a8aea72e6f8f91e408f9a97166c53b91907", size = 19463 }, + { url = "https://files.pythonhosted.org/packages/d8/87/fd9b54258216e3f19671f6e9dd76da1ebc49e93ea0107c986b1071dd3068/pymacaroons-0.13.0-py2.py3-none-any.whl", hash = "sha256:3e14dff6a262fdbf1a15e769ce635a8aea72e6f8f91e408f9a97166c53b91907", size = 19463, upload-time = "2018-02-21T18:07:47.085Z" }, ] [[package]] @@ -1715,26 +1741,26 @@ source = { registry = "https://pypi.org/simple" } dependencies = [ { name = "cffi" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/a7/22/27582568be639dfe22ddb3902225f91f2f17ceff88ce80e4db396c8986da/PyNaCl-1.5.0.tar.gz", hash = "sha256:8ac7448f09ab85811607bdd21ec2464495ac8b7c66d146bf545b0f08fb9220ba", size = 3392854 } +sdist = { url = "https://files.pythonhosted.org/packages/a7/22/27582568be639dfe22ddb3902225f91f2f17ceff88ce80e4db396c8986da/PyNaCl-1.5.0.tar.gz", hash = "sha256:8ac7448f09ab85811607bdd21ec2464495ac8b7c66d146bf545b0f08fb9220ba", size = 3392854, upload-time = "2022-01-07T22:05:41.134Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/ce/75/0b8ede18506041c0bf23ac4d8e2971b4161cd6ce630b177d0a08eb0d8857/PyNaCl-1.5.0-cp36-abi3-macosx_10_10_universal2.whl", hash = "sha256:401002a4aaa07c9414132aaed7f6836ff98f59277a234704ff66878c2ee4a0d1", size = 349920 }, - { url = "https://files.pythonhosted.org/packages/59/bb/fddf10acd09637327a97ef89d2a9d621328850a72f1fdc8c08bdf72e385f/PyNaCl-1.5.0-cp36-abi3-manylinux_2_17_aarch64.manylinux2014_aarch64.manylinux_2_24_aarch64.whl", hash = "sha256:52cb72a79269189d4e0dc537556f4740f7f0a9ec41c1322598799b0bdad4ef92", size = 601722 }, - { url = "https://files.pythonhosted.org/packages/5d/70/87a065c37cca41a75f2ce113a5a2c2aa7533be648b184ade58971b5f7ccc/PyNaCl-1.5.0-cp36-abi3-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:a36d4a9dda1f19ce6e03c9a784a2921a4b726b02e1c736600ca9c22029474394", size = 680087 }, - { url = "https://files.pythonhosted.org/packages/ee/87/f1bb6a595f14a327e8285b9eb54d41fef76c585a0edef0a45f6fc95de125/PyNaCl-1.5.0-cp36-abi3-manylinux_2_17_x86_64.manylinux2014_x86_64.manylinux_2_24_x86_64.whl", hash = "sha256:0c84947a22519e013607c9be43706dd42513f9e6ae5d39d3613ca1e142fba44d", size = 856678 }, - { url = "https://files.pythonhosted.org/packages/66/28/ca86676b69bf9f90e710571b67450508484388bfce09acf8a46f0b8c785f/PyNaCl-1.5.0-cp36-abi3-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:06b8f6fa7f5de8d5d2f7573fe8c863c051225a27b61e6860fd047b1775807858", size = 1133660 }, - { url = "https://files.pythonhosted.org/packages/3d/85/c262db650e86812585e2bc59e497a8f59948a005325a11bbbc9ecd3fe26b/PyNaCl-1.5.0-cp36-abi3-musllinux_1_1_aarch64.whl", hash = "sha256:a422368fc821589c228f4c49438a368831cb5bbc0eab5ebe1d7fac9dded6567b", size = 663824 }, - { url = "https://files.pythonhosted.org/packages/fd/1a/cc308a884bd299b651f1633acb978e8596c71c33ca85e9dc9fa33a5399b9/PyNaCl-1.5.0-cp36-abi3-musllinux_1_1_x86_64.whl", hash = "sha256:61f642bf2378713e2c2e1de73444a3778e5f0a38be6fee0fe532fe30060282ff", size = 1117912 }, - { url = "https://files.pythonhosted.org/packages/25/2d/b7df6ddb0c2a33afdb358f8af6ea3b8c4d1196ca45497dd37a56f0c122be/PyNaCl-1.5.0-cp36-abi3-win32.whl", hash = "sha256:e46dae94e34b085175f8abb3b0aaa7da40767865ac82c928eeb9e57e1ea8a543", size = 204624 }, - { url = "https://files.pythonhosted.org/packages/5e/22/d3db169895faaf3e2eda892f005f433a62db2decbcfbc2f61e6517adfa87/PyNaCl-1.5.0-cp36-abi3-win_amd64.whl", hash = "sha256:20f42270d27e1b6a29f54032090b972d97f0a1b0948cc52392041ef7831fee93", size = 212141 }, + { url = "https://files.pythonhosted.org/packages/ce/75/0b8ede18506041c0bf23ac4d8e2971b4161cd6ce630b177d0a08eb0d8857/PyNaCl-1.5.0-cp36-abi3-macosx_10_10_universal2.whl", hash = "sha256:401002a4aaa07c9414132aaed7f6836ff98f59277a234704ff66878c2ee4a0d1", size = 349920, upload-time = "2022-01-07T22:05:49.156Z" }, + { url = "https://files.pythonhosted.org/packages/59/bb/fddf10acd09637327a97ef89d2a9d621328850a72f1fdc8c08bdf72e385f/PyNaCl-1.5.0-cp36-abi3-manylinux_2_17_aarch64.manylinux2014_aarch64.manylinux_2_24_aarch64.whl", hash = "sha256:52cb72a79269189d4e0dc537556f4740f7f0a9ec41c1322598799b0bdad4ef92", size = 601722, upload-time = "2022-01-07T22:05:50.989Z" }, + { url = "https://files.pythonhosted.org/packages/5d/70/87a065c37cca41a75f2ce113a5a2c2aa7533be648b184ade58971b5f7ccc/PyNaCl-1.5.0-cp36-abi3-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:a36d4a9dda1f19ce6e03c9a784a2921a4b726b02e1c736600ca9c22029474394", size = 680087, upload-time = "2022-01-07T22:05:52.539Z" }, + { url = "https://files.pythonhosted.org/packages/ee/87/f1bb6a595f14a327e8285b9eb54d41fef76c585a0edef0a45f6fc95de125/PyNaCl-1.5.0-cp36-abi3-manylinux_2_17_x86_64.manylinux2014_x86_64.manylinux_2_24_x86_64.whl", hash = "sha256:0c84947a22519e013607c9be43706dd42513f9e6ae5d39d3613ca1e142fba44d", size = 856678, upload-time = "2022-01-07T22:05:54.251Z" }, + { url = "https://files.pythonhosted.org/packages/66/28/ca86676b69bf9f90e710571b67450508484388bfce09acf8a46f0b8c785f/PyNaCl-1.5.0-cp36-abi3-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:06b8f6fa7f5de8d5d2f7573fe8c863c051225a27b61e6860fd047b1775807858", size = 1133660, upload-time = "2022-01-07T22:05:56.056Z" }, + { url = "https://files.pythonhosted.org/packages/3d/85/c262db650e86812585e2bc59e497a8f59948a005325a11bbbc9ecd3fe26b/PyNaCl-1.5.0-cp36-abi3-musllinux_1_1_aarch64.whl", hash = "sha256:a422368fc821589c228f4c49438a368831cb5bbc0eab5ebe1d7fac9dded6567b", size = 663824, upload-time = "2022-01-07T22:05:57.434Z" }, + { url = "https://files.pythonhosted.org/packages/fd/1a/cc308a884bd299b651f1633acb978e8596c71c33ca85e9dc9fa33a5399b9/PyNaCl-1.5.0-cp36-abi3-musllinux_1_1_x86_64.whl", hash = "sha256:61f642bf2378713e2c2e1de73444a3778e5f0a38be6fee0fe532fe30060282ff", size = 1117912, upload-time = "2022-01-07T22:05:58.665Z" }, + { url = "https://files.pythonhosted.org/packages/25/2d/b7df6ddb0c2a33afdb358f8af6ea3b8c4d1196ca45497dd37a56f0c122be/PyNaCl-1.5.0-cp36-abi3-win32.whl", hash = "sha256:e46dae94e34b085175f8abb3b0aaa7da40767865ac82c928eeb9e57e1ea8a543", size = 204624, upload-time = "2022-01-07T22:06:00.085Z" }, + { url = "https://files.pythonhosted.org/packages/5e/22/d3db169895faaf3e2eda892f005f433a62db2decbcfbc2f61e6517adfa87/PyNaCl-1.5.0-cp36-abi3-win_amd64.whl", hash = "sha256:20f42270d27e1b6a29f54032090b972d97f0a1b0948cc52392041ef7831fee93", size = 212141, upload-time = "2022-01-07T22:06:01.861Z" }, ] [[package]] name = "pyproject-hooks" version = "1.2.0" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/e7/82/28175b2414effca1cdac8dc99f76d660e7a4fb0ceefa4b4ab8f5f6742925/pyproject_hooks-1.2.0.tar.gz", hash = "sha256:1e859bd5c40fae9448642dd871adf459e5e2084186e8d2c2a79a824c970da1f8", size = 19228 } +sdist = { url = "https://files.pythonhosted.org/packages/e7/82/28175b2414effca1cdac8dc99f76d660e7a4fb0ceefa4b4ab8f5f6742925/pyproject_hooks-1.2.0.tar.gz", hash = "sha256:1e859bd5c40fae9448642dd871adf459e5e2084186e8d2c2a79a824c970da1f8", size = 19228, upload-time = "2024-09-29T09:24:13.293Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/bd/24/12818598c362d7f300f18e74db45963dbcb85150324092410c8b49405e42/pyproject_hooks-1.2.0-py3-none-any.whl", hash = "sha256:9e5c6bfa8dcc30091c74b0cf803c81fdd29d94f01992a7707bc97babb1141913", size = 10216 }, + { url = "https://files.pythonhosted.org/packages/bd/24/12818598c362d7f300f18e74db45963dbcb85150324092410c8b49405e42/pyproject_hooks-1.2.0-py3-none-any.whl", hash = "sha256:9e5c6bfa8dcc30091c74b0cf803c81fdd29d94f01992a7707bc97babb1141913", size = 10216, upload-time = "2024-09-29T09:24:11.978Z" }, ] [[package]] @@ -1744,9 +1770,9 @@ source = { registry = "https://pypi.org/simple" } dependencies = [ { name = "pytz" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/00/52/75ea0ae249ba885c9429e421b4f94bc154df68484847f1ac164287d978d7/pyRFC3339-1.1.tar.gz", hash = "sha256:81b8cbe1519cdb79bed04910dd6fa4e181faf8c88dff1e1b987b5f7ab23a5b1a", size = 5290 } +sdist = { url = "https://files.pythonhosted.org/packages/00/52/75ea0ae249ba885c9429e421b4f94bc154df68484847f1ac164287d978d7/pyRFC3339-1.1.tar.gz", hash = "sha256:81b8cbe1519cdb79bed04910dd6fa4e181faf8c88dff1e1b987b5f7ab23a5b1a", size = 5290, upload-time = "2018-06-11T00:26:31Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/c1/7a/725f5c16756ec6211b1e7eeac09f469084595513917ea069bc023c40a5e2/pyRFC3339-1.1-py2.py3-none-any.whl", hash = "sha256:67196cb83b470709c580bb4738b83165e67c6cc60e1f2e4f286cfcb402a926f4", size = 5669 }, + { url = "https://files.pythonhosted.org/packages/c1/7a/725f5c16756ec6211b1e7eeac09f469084595513917ea069bc023c40a5e2/pyRFC3339-1.1-py2.py3-none-any.whl", hash = "sha256:67196cb83b470709c580bb4738b83165e67c6cc60e1f2e4f286cfcb402a926f4", size = 5669, upload-time = "2018-06-11T00:22:40.934Z" }, ] [[package]] @@ -1757,9 +1783,9 @@ dependencies = [ { name = "nodeenv" }, { name = "typing-extensions" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/29/ca/3238db97766ecfd6b2758fb50727a0b433e7b1bb6be0de090ed08b291fff/pyright-1.1.385.tar.gz", hash = "sha256:1bf042b8f080441534aa02101dea30f8fc2efa8f7b6f1ab05197c21317f5bfa7", size = 21971 } +sdist = { url = "https://files.pythonhosted.org/packages/29/ca/3238db97766ecfd6b2758fb50727a0b433e7b1bb6be0de090ed08b291fff/pyright-1.1.385.tar.gz", hash = "sha256:1bf042b8f080441534aa02101dea30f8fc2efa8f7b6f1ab05197c21317f5bfa7", size = 21971, upload-time = "2024-10-16T09:00:56.771Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/e3/39/877484412a1079003a7645375b487bd7c422692f4e5b7c2030dea3e83043/pyright-1.1.385-py3-none-any.whl", hash = "sha256:e5b9a1b8d492e13004d822af94d07d235f2c7c158457293b51ab2214c8c5b375", size = 18579 }, + { url = "https://files.pythonhosted.org/packages/e3/39/877484412a1079003a7645375b487bd7c422692f4e5b7c2030dea3e83043/pyright-1.1.385-py3-none-any.whl", hash = "sha256:e5b9a1b8d492e13004d822af94d07d235f2c7c158457293b51ab2214c8c5b375", size = 18579, upload-time = "2024-10-16T09:00:55.545Z" }, ] [[package]] @@ -1775,9 +1801,9 @@ dependencies = [ { name = "soupsieve" }, { name = "wcmatch" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/12/07/168a857755a29b7e41550a28cd8f527025bc62fcb36a951d8f3f2eedcdf7/pyspelling-2.10.tar.gz", hash = "sha256:acd67133c1b7cecd410e3d4489e61f2e4b1f0b6acf1ae6c48c240fbb21729c37", size = 148239 } +sdist = { url = "https://files.pythonhosted.org/packages/12/07/168a857755a29b7e41550a28cd8f527025bc62fcb36a951d8f3f2eedcdf7/pyspelling-2.10.tar.gz", hash = "sha256:acd67133c1b7cecd410e3d4489e61f2e4b1f0b6acf1ae6c48c240fbb21729c37", size = 148239, upload-time = "2024-01-13T06:08:26.1Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/9f/16/242558b5c5cb73efd52490f1e6bfb03eae63b2585770b9cae78bd491ef0b/pyspelling-2.10-py3-none-any.whl", hash = "sha256:9b079dd238bd0616a49f9ac5df32799beb851dddc5ed7634f551e7df1aeee943", size = 45035 }, + { url = "https://files.pythonhosted.org/packages/9f/16/242558b5c5cb73efd52490f1e6bfb03eae63b2585770b9cae78bd491ef0b/pyspelling-2.10-py3-none-any.whl", hash = "sha256:9b079dd238bd0616a49f9ac5df32799beb851dddc5ed7634f551e7df1aeee943", size = 45035, upload-time = "2024-01-13T06:08:23.641Z" }, ] [[package]] @@ -1793,9 +1819,9 @@ dependencies = [ { name = "pygments" }, { name = "tomli", marker = "python_full_version < '3.11'" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/08/ba/45911d754e8eba3d5a841a5ce61a65a685ff1798421ac054f85aa8747dfb/pytest-8.4.1.tar.gz", hash = "sha256:7c67fd69174877359ed9371ec3af8a3d2b04741818c51e5e99cc1742251fa93c", size = 1517714 } +sdist = { url = "https://files.pythonhosted.org/packages/08/ba/45911d754e8eba3d5a841a5ce61a65a685ff1798421ac054f85aa8747dfb/pytest-8.4.1.tar.gz", hash = "sha256:7c67fd69174877359ed9371ec3af8a3d2b04741818c51e5e99cc1742251fa93c", size = 1517714, upload-time = "2025-06-18T05:48:06.109Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/29/16/c8a903f4c4dffe7a12843191437d7cd8e32751d5de349d45d3fe69544e87/pytest-8.4.1-py3-none-any.whl", hash = "sha256:539c70ba6fcead8e78eebbf1115e8b589e7565830d7d006a8723f19ac8a0afb7", size = 365474 }, + { url = "https://files.pythonhosted.org/packages/29/16/c8a903f4c4dffe7a12843191437d7cd8e32751d5de349d45d3fe69544e87/pytest-8.4.1-py3-none-any.whl", hash = "sha256:539c70ba6fcead8e78eebbf1115e8b589e7565830d7d006a8723f19ac8a0afb7", size = 365474, upload-time = "2025-06-18T05:48:03.955Z" }, ] [[package]] @@ -1805,9 +1831,9 @@ source = { registry = "https://pypi.org/simple" } dependencies = [ { name = "pytest" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/ae/53/57663d99acaac2fcdafdc697e52a9b1b7d6fcf36616281ff9768a44e7ff3/pytest_asyncio-0.21.2.tar.gz", hash = "sha256:d67738fc232b94b326b9d060750beb16e0074210b98dd8b58a5239fa2a154f45", size = 30656 } +sdist = { url = "https://files.pythonhosted.org/packages/ae/53/57663d99acaac2fcdafdc697e52a9b1b7d6fcf36616281ff9768a44e7ff3/pytest_asyncio-0.21.2.tar.gz", hash = "sha256:d67738fc232b94b326b9d060750beb16e0074210b98dd8b58a5239fa2a154f45", size = 30656, upload-time = "2024-04-29T13:23:24.738Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/9c/ce/1e4b53c213dce25d6e8b163697fbce2d43799d76fa08eea6ad270451c370/pytest_asyncio-0.21.2-py3-none-any.whl", hash = "sha256:ab664c88bb7998f711d8039cacd4884da6430886ae8bbd4eded552ed2004f16b", size = 13368 }, + { url = "https://files.pythonhosted.org/packages/9c/ce/1e4b53c213dce25d6e8b163697fbce2d43799d76fa08eea6ad270451c370/pytest_asyncio-0.21.2-py3-none-any.whl", hash = "sha256:ab664c88bb7998f711d8039cacd4884da6430886ae8bbd4eded552ed2004f16b", size = 13368, upload-time = "2024-04-29T13:23:23.126Z" }, ] [[package]] @@ -1818,9 +1844,9 @@ dependencies = [ { name = "py-cpuinfo" }, { name = "pytest" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/39/d0/a8bd08d641b393db3be3819b03e2d9bb8760ca8479080a26a5f6e540e99c/pytest-benchmark-5.1.0.tar.gz", hash = "sha256:9ea661cdc292e8231f7cd4c10b0319e56a2118e2c09d9f50e1b3d150d2aca105", size = 337810 } +sdist = { url = "https://files.pythonhosted.org/packages/39/d0/a8bd08d641b393db3be3819b03e2d9bb8760ca8479080a26a5f6e540e99c/pytest-benchmark-5.1.0.tar.gz", hash = "sha256:9ea661cdc292e8231f7cd4c10b0319e56a2118e2c09d9f50e1b3d150d2aca105", size = 337810, upload-time = "2024-10-30T11:51:48.521Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/9e/d6/b41653199ea09d5969d4e385df9bbfd9a100f28ca7e824ce7c0a016e3053/pytest_benchmark-5.1.0-py3-none-any.whl", hash = "sha256:922de2dfa3033c227c96da942d1878191afa135a29485fb942e85dff1c592c89", size = 44259 }, + { url = "https://files.pythonhosted.org/packages/9e/d6/b41653199ea09d5969d4e385df9bbfd9a100f28ca7e824ce7c0a016e3053/pytest_benchmark-5.1.0-py3-none-any.whl", hash = "sha256:922de2dfa3033c227c96da942d1878191afa135a29485fb942e85dff1c592c89", size = 44259, upload-time = "2024-10-30T11:51:45.94Z" }, ] [[package]] @@ -1835,9 +1861,9 @@ dependencies = [ { name = "pytest-asyncio" }, { name = "pyyaml" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/0c/6c/1942c882fa035b300ec61653d64f2614c2cdb6113ce819176fa57a677753/pytest_operator-0.42.0.tar.gz", hash = "sha256:389afb648dab91eb8f0e224cbe58f05598e850aafc46e589fce1705577309c69", size = 46479 } +sdist = { url = "https://files.pythonhosted.org/packages/0c/6c/1942c882fa035b300ec61653d64f2614c2cdb6113ce819176fa57a677753/pytest_operator-0.42.0.tar.gz", hash = "sha256:389afb648dab91eb8f0e224cbe58f05598e850aafc46e589fce1705577309c69", size = 46479, upload-time = "2025-04-17T18:45:09.388Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/26/89/96ec3e0c3fe863b609ef4bea87a7cce4a185571c62d59d4d4862a5eb5fd9/pytest_operator-0.42.0-py3-none-any.whl", hash = "sha256:29ee3df46b5a47b435f63f7efa2e1433807ba723ac3890f86b88033f79b3e48c", size = 25628 }, + { url = "https://files.pythonhosted.org/packages/26/89/96ec3e0c3fe863b609ef4bea87a7cce4a185571c62d59d4d4862a5eb5fd9/pytest_operator-0.42.0-py3-none-any.whl", hash = "sha256:29ee3df46b5a47b435f63f7efa2e1433807ba723ac3890f86b88033f79b3e48c", size = 25628, upload-time = "2025-04-17T18:45:07.862Z" }, ] [[package]] @@ -1848,9 +1874,9 @@ dependencies = [ { name = "execnet" }, { name = "pytest" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/49/dc/865845cfe987b21658e871d16e0a24e871e00884c545f246dd8f6f69edda/pytest_xdist-3.7.0.tar.gz", hash = "sha256:f9248c99a7c15b7d2f90715df93610353a485827bc06eefb6566d23f6400f126", size = 87550 } +sdist = { url = "https://files.pythonhosted.org/packages/49/dc/865845cfe987b21658e871d16e0a24e871e00884c545f246dd8f6f69edda/pytest_xdist-3.7.0.tar.gz", hash = "sha256:f9248c99a7c15b7d2f90715df93610353a485827bc06eefb6566d23f6400f126", size = 87550, upload-time = "2025-05-26T21:18:20.251Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/0d/b2/0e802fde6f1c5b2f7ae7e9ad42b83fd4ecebac18a8a8c2f2f14e39dce6e1/pytest_xdist-3.7.0-py3-none-any.whl", hash = "sha256:7d3fbd255998265052435eb9daa4e99b62e6fb9cfb6efd1f858d4d8c0c7f0ca0", size = 46142 }, + { url = "https://files.pythonhosted.org/packages/0d/b2/0e802fde6f1c5b2f7ae7e9ad42b83fd4ecebac18a8a8c2f2f14e39dce6e1/pytest_xdist-3.7.0-py3-none-any.whl", hash = "sha256:7d3fbd255998265052435eb9daa4e99b62e6fb9cfb6efd1f858d4d8c0c7f0ca0", size = 46142, upload-time = "2025-05-26T21:18:18.759Z" }, ] [[package]] @@ -1860,62 +1886,62 @@ source = { registry = "https://pypi.org/simple" } dependencies = [ { name = "six" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/66/c0/0c8b6ad9f17a802ee498c46e004a0eb49bc148f2fd230864601a86dcf6db/python-dateutil-2.9.0.post0.tar.gz", hash = "sha256:37dd54208da7e1cd875388217d5e00ebd4179249f90fb72437e91a35459a0ad3", size = 342432 } +sdist = { url = "https://files.pythonhosted.org/packages/66/c0/0c8b6ad9f17a802ee498c46e004a0eb49bc148f2fd230864601a86dcf6db/python-dateutil-2.9.0.post0.tar.gz", hash = "sha256:37dd54208da7e1cd875388217d5e00ebd4179249f90fb72437e91a35459a0ad3", size = 342432, upload-time = "2024-03-01T18:36:20.211Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/ec/57/56b9bcc3c9c6a792fcbaf139543cee77261f3651ca9da0c93f5c1221264b/python_dateutil-2.9.0.post0-py2.py3-none-any.whl", hash = "sha256:a8b2bc7bffae282281c8140a97d3aa9c14da0b136dfe83f850eea9a5f7470427", size = 229892 }, + { url = "https://files.pythonhosted.org/packages/ec/57/56b9bcc3c9c6a792fcbaf139543cee77261f3651ca9da0c93f5c1221264b/python_dateutil-2.9.0.post0-py2.py3-none-any.whl", hash = "sha256:a8b2bc7bffae282281c8140a97d3aa9c14da0b136dfe83f850eea9a5f7470427", size = 229892, upload-time = "2024-03-01T18:36:18.57Z" }, ] [[package]] name = "pytz" version = "2025.2" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/f8/bf/abbd3cdfb8fbc7fb3d4d38d320f2441b1e7cbe29be4f23797b4a2b5d8aac/pytz-2025.2.tar.gz", hash = "sha256:360b9e3dbb49a209c21ad61809c7fb453643e048b38924c765813546746e81c3", size = 320884 } +sdist = { url = "https://files.pythonhosted.org/packages/f8/bf/abbd3cdfb8fbc7fb3d4d38d320f2441b1e7cbe29be4f23797b4a2b5d8aac/pytz-2025.2.tar.gz", hash = "sha256:360b9e3dbb49a209c21ad61809c7fb453643e048b38924c765813546746e81c3", size = 320884, upload-time = "2025-03-25T02:25:00.538Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/81/c4/34e93fe5f5429d7570ec1fa436f1986fb1f00c3e0f43a589fe2bbcd22c3f/pytz-2025.2-py2.py3-none-any.whl", hash = "sha256:5ddf76296dd8c44c26eb8f4b6f35488f3ccbf6fbbd7adee0b7262d43f0ec2f00", size = 509225 }, + { url = "https://files.pythonhosted.org/packages/81/c4/34e93fe5f5429d7570ec1fa436f1986fb1f00c3e0f43a589fe2bbcd22c3f/pytz-2025.2-py2.py3-none-any.whl", hash = "sha256:5ddf76296dd8c44c26eb8f4b6f35488f3ccbf6fbbd7adee0b7262d43f0ec2f00", size = 509225, upload-time = "2025-03-25T02:24:58.468Z" }, ] [[package]] name = "pyyaml" version = "6.0.2" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/54/ed/79a089b6be93607fa5cdaedf301d7dfb23af5f25c398d5ead2525b063e17/pyyaml-6.0.2.tar.gz", hash = "sha256:d584d9ec91ad65861cc08d42e834324ef890a082e591037abe114850ff7bbc3e", size = 130631 } -wheels = [ - { url = "https://files.pythonhosted.org/packages/9b/95/a3fac87cb7158e231b5a6012e438c647e1a87f09f8e0d123acec8ab8bf71/PyYAML-6.0.2-cp310-cp310-macosx_10_9_x86_64.whl", hash = "sha256:0a9a2848a5b7feac301353437eb7d5957887edbf81d56e903999a75a3d743086", size = 184199 }, - { url = "https://files.pythonhosted.org/packages/c7/7a/68bd47624dab8fd4afbfd3c48e3b79efe09098ae941de5b58abcbadff5cb/PyYAML-6.0.2-cp310-cp310-macosx_11_0_arm64.whl", hash = "sha256:29717114e51c84ddfba879543fb232a6ed60086602313ca38cce623c1d62cfbf", size = 171758 }, - { url = "https://files.pythonhosted.org/packages/49/ee/14c54df452143b9ee9f0f29074d7ca5516a36edb0b4cc40c3f280131656f/PyYAML-6.0.2-cp310-cp310-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:8824b5a04a04a047e72eea5cec3bc266db09e35de6bdfe34c9436ac5ee27d237", size = 718463 }, - { url = "https://files.pythonhosted.org/packages/4d/61/de363a97476e766574650d742205be468921a7b532aa2499fcd886b62530/PyYAML-6.0.2-cp310-cp310-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:7c36280e6fb8385e520936c3cb3b8042851904eba0e58d277dca80a5cfed590b", size = 719280 }, - { url = "https://files.pythonhosted.org/packages/6b/4e/1523cb902fd98355e2e9ea5e5eb237cbc5f3ad5f3075fa65087aa0ecb669/PyYAML-6.0.2-cp310-cp310-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:ec031d5d2feb36d1d1a24380e4db6d43695f3748343d99434e6f5f9156aaa2ed", size = 751239 }, - { url = "https://files.pythonhosted.org/packages/b7/33/5504b3a9a4464893c32f118a9cc045190a91637b119a9c881da1cf6b7a72/PyYAML-6.0.2-cp310-cp310-musllinux_1_1_aarch64.whl", hash = "sha256:936d68689298c36b53b29f23c6dbb74de12b4ac12ca6cfe0e047bedceea56180", size = 695802 }, - { url = "https://files.pythonhosted.org/packages/5c/20/8347dcabd41ef3a3cdc4f7b7a2aff3d06598c8779faa189cdbf878b626a4/PyYAML-6.0.2-cp310-cp310-musllinux_1_1_x86_64.whl", hash = "sha256:23502f431948090f597378482b4812b0caae32c22213aecf3b55325e049a6c68", size = 720527 }, - { url = "https://files.pythonhosted.org/packages/be/aa/5afe99233fb360d0ff37377145a949ae258aaab831bde4792b32650a4378/PyYAML-6.0.2-cp310-cp310-win32.whl", hash = "sha256:2e99c6826ffa974fe6e27cdb5ed0021786b03fc98e5ee3c5bfe1fd5015f42b99", size = 144052 }, - { url = "https://files.pythonhosted.org/packages/b5/84/0fa4b06f6d6c958d207620fc60005e241ecedceee58931bb20138e1e5776/PyYAML-6.0.2-cp310-cp310-win_amd64.whl", hash = "sha256:a4d3091415f010369ae4ed1fc6b79def9416358877534caf6a0fdd2146c87a3e", size = 161774 }, - { url = "https://files.pythonhosted.org/packages/f8/aa/7af4e81f7acba21a4c6be026da38fd2b872ca46226673c89a758ebdc4fd2/PyYAML-6.0.2-cp311-cp311-macosx_10_9_x86_64.whl", hash = "sha256:cc1c1159b3d456576af7a3e4d1ba7e6924cb39de8f67111c735f6fc832082774", size = 184612 }, - { url = "https://files.pythonhosted.org/packages/8b/62/b9faa998fd185f65c1371643678e4d58254add437edb764a08c5a98fb986/PyYAML-6.0.2-cp311-cp311-macosx_11_0_arm64.whl", hash = "sha256:1e2120ef853f59c7419231f3bf4e7021f1b936f6ebd222406c3b60212205d2ee", size = 172040 }, - { url = "https://files.pythonhosted.org/packages/ad/0c/c804f5f922a9a6563bab712d8dcc70251e8af811fce4524d57c2c0fd49a4/PyYAML-6.0.2-cp311-cp311-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:5d225db5a45f21e78dd9358e58a98702a0302f2659a3c6cd320564b75b86f47c", size = 736829 }, - { url = "https://files.pythonhosted.org/packages/51/16/6af8d6a6b210c8e54f1406a6b9481febf9c64a3109c541567e35a49aa2e7/PyYAML-6.0.2-cp311-cp311-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:5ac9328ec4831237bec75defaf839f7d4564be1e6b25ac710bd1a96321cc8317", size = 764167 }, - { url = "https://files.pythonhosted.org/packages/75/e4/2c27590dfc9992f73aabbeb9241ae20220bd9452df27483b6e56d3975cc5/PyYAML-6.0.2-cp311-cp311-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:3ad2a3decf9aaba3d29c8f537ac4b243e36bef957511b4766cb0057d32b0be85", size = 762952 }, - { url = "https://files.pythonhosted.org/packages/9b/97/ecc1abf4a823f5ac61941a9c00fe501b02ac3ab0e373c3857f7d4b83e2b6/PyYAML-6.0.2-cp311-cp311-musllinux_1_1_aarch64.whl", hash = "sha256:ff3824dc5261f50c9b0dfb3be22b4567a6f938ccce4587b38952d85fd9e9afe4", size = 735301 }, - { url = "https://files.pythonhosted.org/packages/45/73/0f49dacd6e82c9430e46f4a027baa4ca205e8b0a9dce1397f44edc23559d/PyYAML-6.0.2-cp311-cp311-musllinux_1_1_x86_64.whl", hash = "sha256:797b4f722ffa07cc8d62053e4cff1486fa6dc094105d13fea7b1de7d8bf71c9e", size = 756638 }, - { url = "https://files.pythonhosted.org/packages/22/5f/956f0f9fc65223a58fbc14459bf34b4cc48dec52e00535c79b8db361aabd/PyYAML-6.0.2-cp311-cp311-win32.whl", hash = "sha256:11d8f3dd2b9c1207dcaf2ee0bbbfd5991f571186ec9cc78427ba5bd32afae4b5", size = 143850 }, - { url = "https://files.pythonhosted.org/packages/ed/23/8da0bbe2ab9dcdd11f4f4557ccaf95c10b9811b13ecced089d43ce59c3c8/PyYAML-6.0.2-cp311-cp311-win_amd64.whl", hash = "sha256:e10ce637b18caea04431ce14fabcf5c64a1c61ec9c56b071a4b7ca131ca52d44", size = 161980 }, - { url = "https://files.pythonhosted.org/packages/86/0c/c581167fc46d6d6d7ddcfb8c843a4de25bdd27e4466938109ca68492292c/PyYAML-6.0.2-cp312-cp312-macosx_10_9_x86_64.whl", hash = "sha256:c70c95198c015b85feafc136515252a261a84561b7b1d51e3384e0655ddf25ab", size = 183873 }, - { url = "https://files.pythonhosted.org/packages/a8/0c/38374f5bb272c051e2a69281d71cba6fdb983413e6758b84482905e29a5d/PyYAML-6.0.2-cp312-cp312-macosx_11_0_arm64.whl", hash = "sha256:ce826d6ef20b1bc864f0a68340c8b3287705cae2f8b4b1d932177dcc76721725", size = 173302 }, - { url = "https://files.pythonhosted.org/packages/c3/93/9916574aa8c00aa06bbac729972eb1071d002b8e158bd0e83a3b9a20a1f7/PyYAML-6.0.2-cp312-cp312-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:1f71ea527786de97d1a0cc0eacd1defc0985dcf6b3f17bb77dcfc8c34bec4dc5", size = 739154 }, - { url = "https://files.pythonhosted.org/packages/95/0f/b8938f1cbd09739c6da569d172531567dbcc9789e0029aa070856f123984/PyYAML-6.0.2-cp312-cp312-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:9b22676e8097e9e22e36d6b7bda33190d0d400f345f23d4065d48f4ca7ae0425", size = 766223 }, - { url = "https://files.pythonhosted.org/packages/b9/2b/614b4752f2e127db5cc206abc23a8c19678e92b23c3db30fc86ab731d3bd/PyYAML-6.0.2-cp312-cp312-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:80bab7bfc629882493af4aa31a4cfa43a4c57c83813253626916b8c7ada83476", size = 767542 }, - { url = "https://files.pythonhosted.org/packages/d4/00/dd137d5bcc7efea1836d6264f049359861cf548469d18da90cd8216cf05f/PyYAML-6.0.2-cp312-cp312-musllinux_1_1_aarch64.whl", hash = "sha256:0833f8694549e586547b576dcfaba4a6b55b9e96098b36cdc7ebefe667dfed48", size = 731164 }, - { url = "https://files.pythonhosted.org/packages/c9/1f/4f998c900485e5c0ef43838363ba4a9723ac0ad73a9dc42068b12aaba4e4/PyYAML-6.0.2-cp312-cp312-musllinux_1_1_x86_64.whl", hash = "sha256:8b9c7197f7cb2738065c481a0461e50ad02f18c78cd75775628afb4d7137fb3b", size = 756611 }, - { url = "https://files.pythonhosted.org/packages/df/d1/f5a275fdb252768b7a11ec63585bc38d0e87c9e05668a139fea92b80634c/PyYAML-6.0.2-cp312-cp312-win32.whl", hash = "sha256:ef6107725bd54b262d6dedcc2af448a266975032bc85ef0172c5f059da6325b4", size = 140591 }, - { url = "https://files.pythonhosted.org/packages/0c/e8/4f648c598b17c3d06e8753d7d13d57542b30d56e6c2dedf9c331ae56312e/PyYAML-6.0.2-cp312-cp312-win_amd64.whl", hash = "sha256:7e7401d0de89a9a855c839bc697c079a4af81cf878373abd7dc625847d25cbd8", size = 156338 }, - { url = "https://files.pythonhosted.org/packages/ef/e3/3af305b830494fa85d95f6d95ef7fa73f2ee1cc8ef5b495c7c3269fb835f/PyYAML-6.0.2-cp313-cp313-macosx_10_13_x86_64.whl", hash = "sha256:efdca5630322a10774e8e98e1af481aad470dd62c3170801852d752aa7a783ba", size = 181309 }, - { url = "https://files.pythonhosted.org/packages/45/9f/3b1c20a0b7a3200524eb0076cc027a970d320bd3a6592873c85c92a08731/PyYAML-6.0.2-cp313-cp313-macosx_11_0_arm64.whl", hash = "sha256:50187695423ffe49e2deacb8cd10510bc361faac997de9efef88badc3bb9e2d1", size = 171679 }, - { url = "https://files.pythonhosted.org/packages/7c/9a/337322f27005c33bcb656c655fa78325b730324c78620e8328ae28b64d0c/PyYAML-6.0.2-cp313-cp313-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:0ffe8360bab4910ef1b9e87fb812d8bc0a308b0d0eef8c8f44e0254ab3b07133", size = 733428 }, - { url = "https://files.pythonhosted.org/packages/a3/69/864fbe19e6c18ea3cc196cbe5d392175b4cf3d5d0ac1403ec3f2d237ebb5/PyYAML-6.0.2-cp313-cp313-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:17e311b6c678207928d649faa7cb0d7b4c26a0ba73d41e99c4fff6b6c3276484", size = 763361 }, - { url = "https://files.pythonhosted.org/packages/04/24/b7721e4845c2f162d26f50521b825fb061bc0a5afcf9a386840f23ea19fa/PyYAML-6.0.2-cp313-cp313-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:70b189594dbe54f75ab3a1acec5f1e3faa7e8cf2f1e08d9b561cb41b845f69d5", size = 759523 }, - { url = "https://files.pythonhosted.org/packages/2b/b2/e3234f59ba06559c6ff63c4e10baea10e5e7df868092bf9ab40e5b9c56b6/PyYAML-6.0.2-cp313-cp313-musllinux_1_1_aarch64.whl", hash = "sha256:41e4e3953a79407c794916fa277a82531dd93aad34e29c2a514c2c0c5fe971cc", size = 726660 }, - { url = "https://files.pythonhosted.org/packages/fe/0f/25911a9f080464c59fab9027482f822b86bf0608957a5fcc6eaac85aa515/PyYAML-6.0.2-cp313-cp313-musllinux_1_1_x86_64.whl", hash = "sha256:68ccc6023a3400877818152ad9a1033e3db8625d899c72eacb5a668902e4d652", size = 751597 }, - { url = "https://files.pythonhosted.org/packages/14/0d/e2c3b43bbce3cf6bd97c840b46088a3031085179e596d4929729d8d68270/PyYAML-6.0.2-cp313-cp313-win32.whl", hash = "sha256:bc2fa7c6b47d6bc618dd7fb02ef6fdedb1090ec036abab80d4681424b84c1183", size = 140527 }, - { url = "https://files.pythonhosted.org/packages/fa/de/02b54f42487e3d3c6efb3f89428677074ca7bf43aae402517bc7cca949f3/PyYAML-6.0.2-cp313-cp313-win_amd64.whl", hash = "sha256:8388ee1976c416731879ac16da0aff3f63b286ffdd57cdeb95f3f2e085687563", size = 156446 }, +sdist = { url = "https://files.pythonhosted.org/packages/54/ed/79a089b6be93607fa5cdaedf301d7dfb23af5f25c398d5ead2525b063e17/pyyaml-6.0.2.tar.gz", hash = "sha256:d584d9ec91ad65861cc08d42e834324ef890a082e591037abe114850ff7bbc3e", size = 130631, upload-time = "2024-08-06T20:33:50.674Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/9b/95/a3fac87cb7158e231b5a6012e438c647e1a87f09f8e0d123acec8ab8bf71/PyYAML-6.0.2-cp310-cp310-macosx_10_9_x86_64.whl", hash = "sha256:0a9a2848a5b7feac301353437eb7d5957887edbf81d56e903999a75a3d743086", size = 184199, upload-time = "2024-08-06T20:31:40.178Z" }, + { url = "https://files.pythonhosted.org/packages/c7/7a/68bd47624dab8fd4afbfd3c48e3b79efe09098ae941de5b58abcbadff5cb/PyYAML-6.0.2-cp310-cp310-macosx_11_0_arm64.whl", hash = "sha256:29717114e51c84ddfba879543fb232a6ed60086602313ca38cce623c1d62cfbf", size = 171758, upload-time = "2024-08-06T20:31:42.173Z" }, + { url = "https://files.pythonhosted.org/packages/49/ee/14c54df452143b9ee9f0f29074d7ca5516a36edb0b4cc40c3f280131656f/PyYAML-6.0.2-cp310-cp310-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:8824b5a04a04a047e72eea5cec3bc266db09e35de6bdfe34c9436ac5ee27d237", size = 718463, upload-time = "2024-08-06T20:31:44.263Z" }, + { url = "https://files.pythonhosted.org/packages/4d/61/de363a97476e766574650d742205be468921a7b532aa2499fcd886b62530/PyYAML-6.0.2-cp310-cp310-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:7c36280e6fb8385e520936c3cb3b8042851904eba0e58d277dca80a5cfed590b", size = 719280, upload-time = "2024-08-06T20:31:50.199Z" }, + { url = "https://files.pythonhosted.org/packages/6b/4e/1523cb902fd98355e2e9ea5e5eb237cbc5f3ad5f3075fa65087aa0ecb669/PyYAML-6.0.2-cp310-cp310-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:ec031d5d2feb36d1d1a24380e4db6d43695f3748343d99434e6f5f9156aaa2ed", size = 751239, upload-time = "2024-08-06T20:31:52.292Z" }, + { url = "https://files.pythonhosted.org/packages/b7/33/5504b3a9a4464893c32f118a9cc045190a91637b119a9c881da1cf6b7a72/PyYAML-6.0.2-cp310-cp310-musllinux_1_1_aarch64.whl", hash = "sha256:936d68689298c36b53b29f23c6dbb74de12b4ac12ca6cfe0e047bedceea56180", size = 695802, upload-time = "2024-08-06T20:31:53.836Z" }, + { url = "https://files.pythonhosted.org/packages/5c/20/8347dcabd41ef3a3cdc4f7b7a2aff3d06598c8779faa189cdbf878b626a4/PyYAML-6.0.2-cp310-cp310-musllinux_1_1_x86_64.whl", hash = "sha256:23502f431948090f597378482b4812b0caae32c22213aecf3b55325e049a6c68", size = 720527, upload-time = "2024-08-06T20:31:55.565Z" }, + { url = "https://files.pythonhosted.org/packages/be/aa/5afe99233fb360d0ff37377145a949ae258aaab831bde4792b32650a4378/PyYAML-6.0.2-cp310-cp310-win32.whl", hash = "sha256:2e99c6826ffa974fe6e27cdb5ed0021786b03fc98e5ee3c5bfe1fd5015f42b99", size = 144052, upload-time = "2024-08-06T20:31:56.914Z" }, + { url = "https://files.pythonhosted.org/packages/b5/84/0fa4b06f6d6c958d207620fc60005e241ecedceee58931bb20138e1e5776/PyYAML-6.0.2-cp310-cp310-win_amd64.whl", hash = "sha256:a4d3091415f010369ae4ed1fc6b79def9416358877534caf6a0fdd2146c87a3e", size = 161774, upload-time = "2024-08-06T20:31:58.304Z" }, + { url = "https://files.pythonhosted.org/packages/f8/aa/7af4e81f7acba21a4c6be026da38fd2b872ca46226673c89a758ebdc4fd2/PyYAML-6.0.2-cp311-cp311-macosx_10_9_x86_64.whl", hash = "sha256:cc1c1159b3d456576af7a3e4d1ba7e6924cb39de8f67111c735f6fc832082774", size = 184612, upload-time = "2024-08-06T20:32:03.408Z" }, + { url = "https://files.pythonhosted.org/packages/8b/62/b9faa998fd185f65c1371643678e4d58254add437edb764a08c5a98fb986/PyYAML-6.0.2-cp311-cp311-macosx_11_0_arm64.whl", hash = "sha256:1e2120ef853f59c7419231f3bf4e7021f1b936f6ebd222406c3b60212205d2ee", size = 172040, upload-time = "2024-08-06T20:32:04.926Z" }, + { url = "https://files.pythonhosted.org/packages/ad/0c/c804f5f922a9a6563bab712d8dcc70251e8af811fce4524d57c2c0fd49a4/PyYAML-6.0.2-cp311-cp311-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:5d225db5a45f21e78dd9358e58a98702a0302f2659a3c6cd320564b75b86f47c", size = 736829, upload-time = "2024-08-06T20:32:06.459Z" }, + { url = "https://files.pythonhosted.org/packages/51/16/6af8d6a6b210c8e54f1406a6b9481febf9c64a3109c541567e35a49aa2e7/PyYAML-6.0.2-cp311-cp311-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:5ac9328ec4831237bec75defaf839f7d4564be1e6b25ac710bd1a96321cc8317", size = 764167, upload-time = "2024-08-06T20:32:08.338Z" }, + { url = "https://files.pythonhosted.org/packages/75/e4/2c27590dfc9992f73aabbeb9241ae20220bd9452df27483b6e56d3975cc5/PyYAML-6.0.2-cp311-cp311-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:3ad2a3decf9aaba3d29c8f537ac4b243e36bef957511b4766cb0057d32b0be85", size = 762952, upload-time = "2024-08-06T20:32:14.124Z" }, + { url = "https://files.pythonhosted.org/packages/9b/97/ecc1abf4a823f5ac61941a9c00fe501b02ac3ab0e373c3857f7d4b83e2b6/PyYAML-6.0.2-cp311-cp311-musllinux_1_1_aarch64.whl", hash = "sha256:ff3824dc5261f50c9b0dfb3be22b4567a6f938ccce4587b38952d85fd9e9afe4", size = 735301, upload-time = "2024-08-06T20:32:16.17Z" }, + { url = "https://files.pythonhosted.org/packages/45/73/0f49dacd6e82c9430e46f4a027baa4ca205e8b0a9dce1397f44edc23559d/PyYAML-6.0.2-cp311-cp311-musllinux_1_1_x86_64.whl", hash = "sha256:797b4f722ffa07cc8d62053e4cff1486fa6dc094105d13fea7b1de7d8bf71c9e", size = 756638, upload-time = "2024-08-06T20:32:18.555Z" }, + { url = "https://files.pythonhosted.org/packages/22/5f/956f0f9fc65223a58fbc14459bf34b4cc48dec52e00535c79b8db361aabd/PyYAML-6.0.2-cp311-cp311-win32.whl", hash = "sha256:11d8f3dd2b9c1207dcaf2ee0bbbfd5991f571186ec9cc78427ba5bd32afae4b5", size = 143850, upload-time = "2024-08-06T20:32:19.889Z" }, + { url = "https://files.pythonhosted.org/packages/ed/23/8da0bbe2ab9dcdd11f4f4557ccaf95c10b9811b13ecced089d43ce59c3c8/PyYAML-6.0.2-cp311-cp311-win_amd64.whl", hash = "sha256:e10ce637b18caea04431ce14fabcf5c64a1c61ec9c56b071a4b7ca131ca52d44", size = 161980, upload-time = "2024-08-06T20:32:21.273Z" }, + { url = "https://files.pythonhosted.org/packages/86/0c/c581167fc46d6d6d7ddcfb8c843a4de25bdd27e4466938109ca68492292c/PyYAML-6.0.2-cp312-cp312-macosx_10_9_x86_64.whl", hash = "sha256:c70c95198c015b85feafc136515252a261a84561b7b1d51e3384e0655ddf25ab", size = 183873, upload-time = "2024-08-06T20:32:25.131Z" }, + { url = "https://files.pythonhosted.org/packages/a8/0c/38374f5bb272c051e2a69281d71cba6fdb983413e6758b84482905e29a5d/PyYAML-6.0.2-cp312-cp312-macosx_11_0_arm64.whl", hash = "sha256:ce826d6ef20b1bc864f0a68340c8b3287705cae2f8b4b1d932177dcc76721725", size = 173302, upload-time = "2024-08-06T20:32:26.511Z" }, + { url = "https://files.pythonhosted.org/packages/c3/93/9916574aa8c00aa06bbac729972eb1071d002b8e158bd0e83a3b9a20a1f7/PyYAML-6.0.2-cp312-cp312-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:1f71ea527786de97d1a0cc0eacd1defc0985dcf6b3f17bb77dcfc8c34bec4dc5", size = 739154, upload-time = "2024-08-06T20:32:28.363Z" }, + { url = "https://files.pythonhosted.org/packages/95/0f/b8938f1cbd09739c6da569d172531567dbcc9789e0029aa070856f123984/PyYAML-6.0.2-cp312-cp312-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:9b22676e8097e9e22e36d6b7bda33190d0d400f345f23d4065d48f4ca7ae0425", size = 766223, upload-time = "2024-08-06T20:32:30.058Z" }, + { url = "https://files.pythonhosted.org/packages/b9/2b/614b4752f2e127db5cc206abc23a8c19678e92b23c3db30fc86ab731d3bd/PyYAML-6.0.2-cp312-cp312-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:80bab7bfc629882493af4aa31a4cfa43a4c57c83813253626916b8c7ada83476", size = 767542, upload-time = "2024-08-06T20:32:31.881Z" }, + { url = "https://files.pythonhosted.org/packages/d4/00/dd137d5bcc7efea1836d6264f049359861cf548469d18da90cd8216cf05f/PyYAML-6.0.2-cp312-cp312-musllinux_1_1_aarch64.whl", hash = "sha256:0833f8694549e586547b576dcfaba4a6b55b9e96098b36cdc7ebefe667dfed48", size = 731164, upload-time = "2024-08-06T20:32:37.083Z" }, + { url = "https://files.pythonhosted.org/packages/c9/1f/4f998c900485e5c0ef43838363ba4a9723ac0ad73a9dc42068b12aaba4e4/PyYAML-6.0.2-cp312-cp312-musllinux_1_1_x86_64.whl", hash = "sha256:8b9c7197f7cb2738065c481a0461e50ad02f18c78cd75775628afb4d7137fb3b", size = 756611, upload-time = "2024-08-06T20:32:38.898Z" }, + { url = "https://files.pythonhosted.org/packages/df/d1/f5a275fdb252768b7a11ec63585bc38d0e87c9e05668a139fea92b80634c/PyYAML-6.0.2-cp312-cp312-win32.whl", hash = "sha256:ef6107725bd54b262d6dedcc2af448a266975032bc85ef0172c5f059da6325b4", size = 140591, upload-time = "2024-08-06T20:32:40.241Z" }, + { url = "https://files.pythonhosted.org/packages/0c/e8/4f648c598b17c3d06e8753d7d13d57542b30d56e6c2dedf9c331ae56312e/PyYAML-6.0.2-cp312-cp312-win_amd64.whl", hash = "sha256:7e7401d0de89a9a855c839bc697c079a4af81cf878373abd7dc625847d25cbd8", size = 156338, upload-time = "2024-08-06T20:32:41.93Z" }, + { url = "https://files.pythonhosted.org/packages/ef/e3/3af305b830494fa85d95f6d95ef7fa73f2ee1cc8ef5b495c7c3269fb835f/PyYAML-6.0.2-cp313-cp313-macosx_10_13_x86_64.whl", hash = "sha256:efdca5630322a10774e8e98e1af481aad470dd62c3170801852d752aa7a783ba", size = 181309, upload-time = "2024-08-06T20:32:43.4Z" }, + { url = "https://files.pythonhosted.org/packages/45/9f/3b1c20a0b7a3200524eb0076cc027a970d320bd3a6592873c85c92a08731/PyYAML-6.0.2-cp313-cp313-macosx_11_0_arm64.whl", hash = "sha256:50187695423ffe49e2deacb8cd10510bc361faac997de9efef88badc3bb9e2d1", size = 171679, upload-time = "2024-08-06T20:32:44.801Z" }, + { url = "https://files.pythonhosted.org/packages/7c/9a/337322f27005c33bcb656c655fa78325b730324c78620e8328ae28b64d0c/PyYAML-6.0.2-cp313-cp313-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:0ffe8360bab4910ef1b9e87fb812d8bc0a308b0d0eef8c8f44e0254ab3b07133", size = 733428, upload-time = "2024-08-06T20:32:46.432Z" }, + { url = "https://files.pythonhosted.org/packages/a3/69/864fbe19e6c18ea3cc196cbe5d392175b4cf3d5d0ac1403ec3f2d237ebb5/PyYAML-6.0.2-cp313-cp313-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:17e311b6c678207928d649faa7cb0d7b4c26a0ba73d41e99c4fff6b6c3276484", size = 763361, upload-time = "2024-08-06T20:32:51.188Z" }, + { url = "https://files.pythonhosted.org/packages/04/24/b7721e4845c2f162d26f50521b825fb061bc0a5afcf9a386840f23ea19fa/PyYAML-6.0.2-cp313-cp313-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:70b189594dbe54f75ab3a1acec5f1e3faa7e8cf2f1e08d9b561cb41b845f69d5", size = 759523, upload-time = "2024-08-06T20:32:53.019Z" }, + { url = "https://files.pythonhosted.org/packages/2b/b2/e3234f59ba06559c6ff63c4e10baea10e5e7df868092bf9ab40e5b9c56b6/PyYAML-6.0.2-cp313-cp313-musllinux_1_1_aarch64.whl", hash = "sha256:41e4e3953a79407c794916fa277a82531dd93aad34e29c2a514c2c0c5fe971cc", size = 726660, upload-time = "2024-08-06T20:32:54.708Z" }, + { url = "https://files.pythonhosted.org/packages/fe/0f/25911a9f080464c59fab9027482f822b86bf0608957a5fcc6eaac85aa515/PyYAML-6.0.2-cp313-cp313-musllinux_1_1_x86_64.whl", hash = "sha256:68ccc6023a3400877818152ad9a1033e3db8625d899c72eacb5a668902e4d652", size = 751597, upload-time = "2024-08-06T20:32:56.985Z" }, + { url = "https://files.pythonhosted.org/packages/14/0d/e2c3b43bbce3cf6bd97c840b46088a3031085179e596d4929729d8d68270/PyYAML-6.0.2-cp313-cp313-win32.whl", hash = "sha256:bc2fa7c6b47d6bc618dd7fb02ef6fdedb1090ec036abab80d4681424b84c1183", size = 140527, upload-time = "2024-08-06T20:33:03.001Z" }, + { url = "https://files.pythonhosted.org/packages/fa/de/02b54f42487e3d3c6efb3f89428677074ca7bf43aae402517bc7cca949f3/PyYAML-6.0.2-cp313-cp313-win_amd64.whl", hash = "sha256:8388ee1976c416731879ac16da0aff3f63b286ffdd57cdeb95f3f2e085687563", size = 156446, upload-time = "2024-08-06T20:33:04.33Z" }, ] [[package]] @@ -1928,9 +1954,9 @@ dependencies = [ { name = "idna" }, { name = "urllib3" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/e1/0a/929373653770d8a0d7ea76c37de6e41f11eb07559b103b1c02cafb3f7cf8/requests-2.32.4.tar.gz", hash = "sha256:27d0316682c8a29834d3264820024b62a36942083d52caf2f14c0591336d3422", size = 135258 } +sdist = { url = "https://files.pythonhosted.org/packages/e1/0a/929373653770d8a0d7ea76c37de6e41f11eb07559b103b1c02cafb3f7cf8/requests-2.32.4.tar.gz", hash = "sha256:27d0316682c8a29834d3264820024b62a36942083d52caf2f14c0591336d3422", size = 135258, upload-time = "2025-06-09T16:43:07.34Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/7c/e4/56027c4a6b4ae70ca9de302488c5ca95ad4a39e190093d6c1a8ace08341b/requests-2.32.4-py3-none-any.whl", hash = "sha256:27babd3cda2a6d50b30443204ee89830707d396671944c998b5975b031ac2b2c", size = 64847 }, + { url = "https://files.pythonhosted.org/packages/7c/e4/56027c4a6b4ae70ca9de302488c5ca95ad4a39e190093d6c1a8ace08341b/requests-2.32.4-py3-none-any.whl", hash = "sha256:27babd3cda2a6d50b30443204ee89830707d396671944c998b5975b031ac2b2c", size = 64847, upload-time = "2025-06-09T16:43:05.728Z" }, ] [[package]] @@ -1941,9 +1967,9 @@ dependencies = [ { name = "oauthlib" }, { name = "requests" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/42/f2/05f29bc3913aea15eb670be136045bf5c5bbf4b99ecb839da9b422bb2c85/requests-oauthlib-2.0.0.tar.gz", hash = "sha256:b3dffaebd884d8cd778494369603a9e7b58d29111bf6b41bdc2dcd87203af4e9", size = 55650 } +sdist = { url = "https://files.pythonhosted.org/packages/42/f2/05f29bc3913aea15eb670be136045bf5c5bbf4b99ecb839da9b422bb2c85/requests-oauthlib-2.0.0.tar.gz", hash = "sha256:b3dffaebd884d8cd778494369603a9e7b58d29111bf6b41bdc2dcd87203af4e9", size = 55650, upload-time = "2024-03-22T20:32:29.939Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/3b/5d/63d4ae3b9daea098d5d6f5da83984853c1bbacd5dc826764b249fe119d24/requests_oauthlib-2.0.0-py2.py3-none-any.whl", hash = "sha256:7dd8a5c40426b779b0868c404bdef9768deccf22749cde15852df527e6269b36", size = 24179 }, + { url = "https://files.pythonhosted.org/packages/3b/5d/63d4ae3b9daea098d5d6f5da83984853c1bbacd5dc826764b249fe119d24/requests_oauthlib-2.0.0-py2.py3-none-any.whl", hash = "sha256:7dd8a5c40426b779b0868c404bdef9768deccf22749cde15852df527e6269b36", size = 24179, upload-time = "2024-03-22T20:32:28.055Z" }, ] [[package]] @@ -1953,79 +1979,79 @@ source = { registry = "https://pypi.org/simple" } dependencies = [ { name = "pyasn1" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/da/8a/22b7beea3ee0d44b1916c0c1cb0ee3af23b700b6da9f04991899d0c555d4/rsa-4.9.1.tar.gz", hash = "sha256:e7bdbfdb5497da4c07dfd35530e1a902659db6ff241e39d9953cad06ebd0ae75", size = 29034 } +sdist = { url = "https://files.pythonhosted.org/packages/da/8a/22b7beea3ee0d44b1916c0c1cb0ee3af23b700b6da9f04991899d0c555d4/rsa-4.9.1.tar.gz", hash = "sha256:e7bdbfdb5497da4c07dfd35530e1a902659db6ff241e39d9953cad06ebd0ae75", size = 29034, upload-time = "2025-04-16T09:51:18.218Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/64/8d/0133e4eb4beed9e425d9a98ed6e081a55d195481b7632472be1af08d2f6b/rsa-4.9.1-py3-none-any.whl", hash = "sha256:68635866661c6836b8d39430f97a996acbd61bfa49406748ea243539fe239762", size = 34696 }, + { url = "https://files.pythonhosted.org/packages/64/8d/0133e4eb4beed9e425d9a98ed6e081a55d195481b7632472be1af08d2f6b/rsa-4.9.1-py3-none-any.whl", hash = "sha256:68635866661c6836b8d39430f97a996acbd61bfa49406748ea243539fe239762", size = 34696, upload-time = "2025-04-16T09:51:17.142Z" }, ] [[package]] name = "ruff" version = "0.11.2" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/90/61/fb87430f040e4e577e784e325351186976516faef17d6fcd921fe28edfd7/ruff-0.11.2.tar.gz", hash = "sha256:ec47591497d5a1050175bdf4e1a4e6272cddff7da88a2ad595e1e326041d8d94", size = 3857511 } +sdist = { url = "https://files.pythonhosted.org/packages/90/61/fb87430f040e4e577e784e325351186976516faef17d6fcd921fe28edfd7/ruff-0.11.2.tar.gz", hash = "sha256:ec47591497d5a1050175bdf4e1a4e6272cddff7da88a2ad595e1e326041d8d94", size = 3857511, upload-time = "2025-03-21T13:31:17.419Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/62/99/102578506f0f5fa29fd7e0df0a273864f79af044757aef73d1cae0afe6ad/ruff-0.11.2-py3-none-linux_armv6l.whl", hash = "sha256:c69e20ea49e973f3afec2c06376eb56045709f0212615c1adb0eda35e8a4e477", size = 10113146 }, - { url = "https://files.pythonhosted.org/packages/74/ad/5cd4ba58ab602a579997a8494b96f10f316e874d7c435bcc1a92e6da1b12/ruff-0.11.2-py3-none-macosx_10_12_x86_64.whl", hash = "sha256:2c5424cc1c4eb1d8ecabe6d4f1b70470b4f24a0c0171356290b1953ad8f0e272", size = 10867092 }, - { url = "https://files.pythonhosted.org/packages/fc/3e/d3f13619e1d152c7b600a38c1a035e833e794c6625c9a6cea6f63dbf3af4/ruff-0.11.2-py3-none-macosx_11_0_arm64.whl", hash = "sha256:ecf20854cc73f42171eedb66f006a43d0a21bfb98a2523a809931cda569552d9", size = 10224082 }, - { url = "https://files.pythonhosted.org/packages/90/06/f77b3d790d24a93f38e3806216f263974909888fd1e826717c3ec956bbcd/ruff-0.11.2-py3-none-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:0c543bf65d5d27240321604cee0633a70c6c25c9a2f2492efa9f6d4b8e4199bb", size = 10394818 }, - { url = "https://files.pythonhosted.org/packages/99/7f/78aa431d3ddebfc2418cd95b786642557ba8b3cb578c075239da9ce97ff9/ruff-0.11.2-py3-none-manylinux_2_17_armv7l.manylinux2014_armv7l.whl", hash = "sha256:20967168cc21195db5830b9224be0e964cc9c8ecf3b5a9e3ce19876e8d3a96e3", size = 9952251 }, - { url = "https://files.pythonhosted.org/packages/30/3e/f11186d1ddfaca438c3bbff73c6a2fdb5b60e6450cc466129c694b0ab7a2/ruff-0.11.2-py3-none-manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:955a9ce63483999d9f0b8f0b4a3ad669e53484232853054cc8b9d51ab4c5de74", size = 11563566 }, - { url = "https://files.pythonhosted.org/packages/22/6c/6ca91befbc0a6539ee133d9a9ce60b1a354db12c3c5d11cfdbf77140f851/ruff-0.11.2-py3-none-manylinux_2_17_ppc64.manylinux2014_ppc64.whl", hash = "sha256:86b3a27c38b8fce73bcd262b0de32e9a6801b76d52cdb3ae4c914515f0cef608", size = 12208721 }, - { url = "https://files.pythonhosted.org/packages/19/b0/24516a3b850d55b17c03fc399b681c6a549d06ce665915721dc5d6458a5c/ruff-0.11.2-py3-none-manylinux_2_17_ppc64le.manylinux2014_ppc64le.whl", hash = "sha256:a3b66a03b248c9fcd9d64d445bafdf1589326bee6fc5c8e92d7562e58883e30f", size = 11662274 }, - { url = "https://files.pythonhosted.org/packages/d7/65/76be06d28ecb7c6070280cef2bcb20c98fbf99ff60b1c57d2fb9b8771348/ruff-0.11.2-py3-none-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:0397c2672db015be5aa3d4dac54c69aa012429097ff219392c018e21f5085147", size = 13792284 }, - { url = "https://files.pythonhosted.org/packages/ce/d2/4ceed7147e05852876f3b5f3fdc23f878ce2b7e0b90dd6e698bda3d20787/ruff-0.11.2-py3-none-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:869bcf3f9abf6457fbe39b5a37333aa4eecc52a3b99c98827ccc371a8e5b6f1b", size = 11327861 }, - { url = "https://files.pythonhosted.org/packages/c4/78/4935ecba13706fd60ebe0e3dc50371f2bdc3d9bc80e68adc32ff93914534/ruff-0.11.2-py3-none-musllinux_1_2_aarch64.whl", hash = "sha256:2a2b50ca35457ba785cd8c93ebbe529467594087b527a08d487cf0ee7b3087e9", size = 10276560 }, - { url = "https://files.pythonhosted.org/packages/81/7f/1b2435c3f5245d410bb5dc80f13ec796454c21fbda12b77d7588d5cf4e29/ruff-0.11.2-py3-none-musllinux_1_2_armv7l.whl", hash = "sha256:7c69c74bf53ddcfbc22e6eb2f31211df7f65054bfc1f72288fc71e5f82db3eab", size = 9945091 }, - { url = "https://files.pythonhosted.org/packages/39/c4/692284c07e6bf2b31d82bb8c32f8840f9d0627d92983edaac991a2b66c0a/ruff-0.11.2-py3-none-musllinux_1_2_i686.whl", hash = "sha256:6e8fb75e14560f7cf53b15bbc55baf5ecbe373dd5f3aab96ff7aa7777edd7630", size = 10977133 }, - { url = "https://files.pythonhosted.org/packages/94/cf/8ab81cb7dd7a3b0a3960c2769825038f3adcd75faf46dd6376086df8b128/ruff-0.11.2-py3-none-musllinux_1_2_x86_64.whl", hash = "sha256:842a472d7b4d6f5924e9297aa38149e5dcb1e628773b70e6387ae2c97a63c58f", size = 11378514 }, - { url = "https://files.pythonhosted.org/packages/d9/3a/a647fa4f316482dacf2fd68e8a386327a33d6eabd8eb2f9a0c3d291ec549/ruff-0.11.2-py3-none-win32.whl", hash = "sha256:aca01ccd0eb5eb7156b324cfaa088586f06a86d9e5314b0eb330cb48415097cc", size = 10319835 }, - { url = "https://files.pythonhosted.org/packages/86/54/3c12d3af58012a5e2cd7ebdbe9983f4834af3f8cbea0e8a8c74fa1e23b2b/ruff-0.11.2-py3-none-win_amd64.whl", hash = "sha256:3170150172a8f994136c0c66f494edf199a0bbea7a409f649e4bc8f4d7084080", size = 11373713 }, - { url = "https://files.pythonhosted.org/packages/d6/d4/dd813703af8a1e2ac33bf3feb27e8a5ad514c9f219df80c64d69807e7f71/ruff-0.11.2-py3-none-win_arm64.whl", hash = "sha256:52933095158ff328f4c77af3d74f0379e34fd52f175144cefc1b192e7ccd32b4", size = 10441990 }, + { url = "https://files.pythonhosted.org/packages/62/99/102578506f0f5fa29fd7e0df0a273864f79af044757aef73d1cae0afe6ad/ruff-0.11.2-py3-none-linux_armv6l.whl", hash = "sha256:c69e20ea49e973f3afec2c06376eb56045709f0212615c1adb0eda35e8a4e477", size = 10113146, upload-time = "2025-03-21T13:30:26.68Z" }, + { url = "https://files.pythonhosted.org/packages/74/ad/5cd4ba58ab602a579997a8494b96f10f316e874d7c435bcc1a92e6da1b12/ruff-0.11.2-py3-none-macosx_10_12_x86_64.whl", hash = "sha256:2c5424cc1c4eb1d8ecabe6d4f1b70470b4f24a0c0171356290b1953ad8f0e272", size = 10867092, upload-time = "2025-03-21T13:30:37.949Z" }, + { url = "https://files.pythonhosted.org/packages/fc/3e/d3f13619e1d152c7b600a38c1a035e833e794c6625c9a6cea6f63dbf3af4/ruff-0.11.2-py3-none-macosx_11_0_arm64.whl", hash = "sha256:ecf20854cc73f42171eedb66f006a43d0a21bfb98a2523a809931cda569552d9", size = 10224082, upload-time = "2025-03-21T13:30:39.962Z" }, + { url = "https://files.pythonhosted.org/packages/90/06/f77b3d790d24a93f38e3806216f263974909888fd1e826717c3ec956bbcd/ruff-0.11.2-py3-none-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:0c543bf65d5d27240321604cee0633a70c6c25c9a2f2492efa9f6d4b8e4199bb", size = 10394818, upload-time = "2025-03-21T13:30:42.551Z" }, + { url = "https://files.pythonhosted.org/packages/99/7f/78aa431d3ddebfc2418cd95b786642557ba8b3cb578c075239da9ce97ff9/ruff-0.11.2-py3-none-manylinux_2_17_armv7l.manylinux2014_armv7l.whl", hash = "sha256:20967168cc21195db5830b9224be0e964cc9c8ecf3b5a9e3ce19876e8d3a96e3", size = 9952251, upload-time = "2025-03-21T13:30:45.196Z" }, + { url = "https://files.pythonhosted.org/packages/30/3e/f11186d1ddfaca438c3bbff73c6a2fdb5b60e6450cc466129c694b0ab7a2/ruff-0.11.2-py3-none-manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:955a9ce63483999d9f0b8f0b4a3ad669e53484232853054cc8b9d51ab4c5de74", size = 11563566, upload-time = "2025-03-21T13:30:47.516Z" }, + { url = "https://files.pythonhosted.org/packages/22/6c/6ca91befbc0a6539ee133d9a9ce60b1a354db12c3c5d11cfdbf77140f851/ruff-0.11.2-py3-none-manylinux_2_17_ppc64.manylinux2014_ppc64.whl", hash = "sha256:86b3a27c38b8fce73bcd262b0de32e9a6801b76d52cdb3ae4c914515f0cef608", size = 12208721, upload-time = "2025-03-21T13:30:49.56Z" }, + { url = "https://files.pythonhosted.org/packages/19/b0/24516a3b850d55b17c03fc399b681c6a549d06ce665915721dc5d6458a5c/ruff-0.11.2-py3-none-manylinux_2_17_ppc64le.manylinux2014_ppc64le.whl", hash = "sha256:a3b66a03b248c9fcd9d64d445bafdf1589326bee6fc5c8e92d7562e58883e30f", size = 11662274, upload-time = "2025-03-21T13:30:52.055Z" }, + { url = "https://files.pythonhosted.org/packages/d7/65/76be06d28ecb7c6070280cef2bcb20c98fbf99ff60b1c57d2fb9b8771348/ruff-0.11.2-py3-none-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:0397c2672db015be5aa3d4dac54c69aa012429097ff219392c018e21f5085147", size = 13792284, upload-time = "2025-03-21T13:30:54.24Z" }, + { url = "https://files.pythonhosted.org/packages/ce/d2/4ceed7147e05852876f3b5f3fdc23f878ce2b7e0b90dd6e698bda3d20787/ruff-0.11.2-py3-none-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:869bcf3f9abf6457fbe39b5a37333aa4eecc52a3b99c98827ccc371a8e5b6f1b", size = 11327861, upload-time = "2025-03-21T13:30:56.757Z" }, + { url = "https://files.pythonhosted.org/packages/c4/78/4935ecba13706fd60ebe0e3dc50371f2bdc3d9bc80e68adc32ff93914534/ruff-0.11.2-py3-none-musllinux_1_2_aarch64.whl", hash = "sha256:2a2b50ca35457ba785cd8c93ebbe529467594087b527a08d487cf0ee7b3087e9", size = 10276560, upload-time = "2025-03-21T13:30:58.881Z" }, + { url = "https://files.pythonhosted.org/packages/81/7f/1b2435c3f5245d410bb5dc80f13ec796454c21fbda12b77d7588d5cf4e29/ruff-0.11.2-py3-none-musllinux_1_2_armv7l.whl", hash = "sha256:7c69c74bf53ddcfbc22e6eb2f31211df7f65054bfc1f72288fc71e5f82db3eab", size = 9945091, upload-time = "2025-03-21T13:31:01.45Z" }, + { url = "https://files.pythonhosted.org/packages/39/c4/692284c07e6bf2b31d82bb8c32f8840f9d0627d92983edaac991a2b66c0a/ruff-0.11.2-py3-none-musllinux_1_2_i686.whl", hash = "sha256:6e8fb75e14560f7cf53b15bbc55baf5ecbe373dd5f3aab96ff7aa7777edd7630", size = 10977133, upload-time = "2025-03-21T13:31:04.013Z" }, + { url = "https://files.pythonhosted.org/packages/94/cf/8ab81cb7dd7a3b0a3960c2769825038f3adcd75faf46dd6376086df8b128/ruff-0.11.2-py3-none-musllinux_1_2_x86_64.whl", hash = "sha256:842a472d7b4d6f5924e9297aa38149e5dcb1e628773b70e6387ae2c97a63c58f", size = 11378514, upload-time = "2025-03-21T13:31:06.166Z" }, + { url = "https://files.pythonhosted.org/packages/d9/3a/a647fa4f316482dacf2fd68e8a386327a33d6eabd8eb2f9a0c3d291ec549/ruff-0.11.2-py3-none-win32.whl", hash = "sha256:aca01ccd0eb5eb7156b324cfaa088586f06a86d9e5314b0eb330cb48415097cc", size = 10319835, upload-time = "2025-03-21T13:31:10.7Z" }, + { url = "https://files.pythonhosted.org/packages/86/54/3c12d3af58012a5e2cd7ebdbe9983f4834af3f8cbea0e8a8c74fa1e23b2b/ruff-0.11.2-py3-none-win_amd64.whl", hash = "sha256:3170150172a8f994136c0c66f494edf199a0bbea7a409f649e4bc8f4d7084080", size = 11373713, upload-time = "2025-03-21T13:31:13.148Z" }, + { url = "https://files.pythonhosted.org/packages/d6/d4/dd813703af8a1e2ac33bf3feb27e8a5ad514c9f219df80c64d69807e7f71/ruff-0.11.2-py3-none-win_arm64.whl", hash = "sha256:52933095158ff328f4c77af3d74f0379e34fd52f175144cefc1b192e7ccd32b4", size = 10441990, upload-time = "2025-03-21T13:31:15.206Z" }, ] [[package]] name = "six" version = "1.17.0" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/94/e7/b2c673351809dca68a0e064b6af791aa332cf192da575fd474ed7d6f16a2/six-1.17.0.tar.gz", hash = "sha256:ff70335d468e7eb6ec65b95b99d3a2836546063f63acc5171de367e834932a81", size = 34031 } +sdist = { url = "https://files.pythonhosted.org/packages/94/e7/b2c673351809dca68a0e064b6af791aa332cf192da575fd474ed7d6f16a2/six-1.17.0.tar.gz", hash = "sha256:ff70335d468e7eb6ec65b95b99d3a2836546063f63acc5171de367e834932a81", size = 34031, upload-time = "2024-12-04T17:35:28.174Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/b7/ce/149a00dd41f10bc29e5921b496af8b574d8413afcd5e30dfa0ed46c2cc5e/six-1.17.0-py2.py3-none-any.whl", hash = "sha256:4721f391ed90541fddacab5acf947aa0d3dc7d27b2e1e8eda2be8970586c3274", size = 11050 }, + { url = "https://files.pythonhosted.org/packages/b7/ce/149a00dd41f10bc29e5921b496af8b574d8413afcd5e30dfa0ed46c2cc5e/six-1.17.0-py2.py3-none-any.whl", hash = "sha256:4721f391ed90541fddacab5acf947aa0d3dc7d27b2e1e8eda2be8970586c3274", size = 11050, upload-time = "2024-12-04T17:35:26.475Z" }, ] [[package]] name = "smmap" version = "5.0.2" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/44/cd/a040c4b3119bbe532e5b0732286f805445375489fceaec1f48306068ee3b/smmap-5.0.2.tar.gz", hash = "sha256:26ea65a03958fa0c8a1c7e8c7a58fdc77221b8910f6be2131affade476898ad5", size = 22329 } +sdist = { url = "https://files.pythonhosted.org/packages/44/cd/a040c4b3119bbe532e5b0732286f805445375489fceaec1f48306068ee3b/smmap-5.0.2.tar.gz", hash = "sha256:26ea65a03958fa0c8a1c7e8c7a58fdc77221b8910f6be2131affade476898ad5", size = 22329, upload-time = "2025-01-02T07:14:40.909Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/04/be/d09147ad1ec7934636ad912901c5fd7667e1c858e19d355237db0d0cd5e4/smmap-5.0.2-py3-none-any.whl", hash = "sha256:b30115f0def7d7531d22a0fb6502488d879e75b260a9db4d0819cfb25403af5e", size = 24303 }, + { url = "https://files.pythonhosted.org/packages/04/be/d09147ad1ec7934636ad912901c5fd7667e1c858e19d355237db0d0cd5e4/smmap-5.0.2-py3-none-any.whl", hash = "sha256:b30115f0def7d7531d22a0fb6502488d879e75b260a9db4d0819cfb25403af5e", size = 24303, upload-time = "2025-01-02T07:14:38.724Z" }, ] [[package]] name = "sniffio" version = "1.3.1" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/a2/87/a6771e1546d97e7e041b6ae58d80074f81b7d5121207425c964ddf5cfdbd/sniffio-1.3.1.tar.gz", hash = "sha256:f4324edc670a0f49750a81b895f35c3adb843cca46f0530f79fc1babb23789dc", size = 20372 } +sdist = { url = "https://files.pythonhosted.org/packages/a2/87/a6771e1546d97e7e041b6ae58d80074f81b7d5121207425c964ddf5cfdbd/sniffio-1.3.1.tar.gz", hash = "sha256:f4324edc670a0f49750a81b895f35c3adb843cca46f0530f79fc1babb23789dc", size = 20372, upload-time = "2024-02-25T23:20:04.057Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/e9/44/75a9c9421471a6c4805dbf2356f7c181a29c1879239abab1ea2cc8f38b40/sniffio-1.3.1-py3-none-any.whl", hash = "sha256:2f6da418d1f1e0fddd844478f41680e794e6051915791a034ff65e5f100525a2", size = 10235 }, + { url = "https://files.pythonhosted.org/packages/e9/44/75a9c9421471a6c4805dbf2356f7c181a29c1879239abab1ea2cc8f38b40/sniffio-1.3.1-py3-none-any.whl", hash = "sha256:2f6da418d1f1e0fddd844478f41680e794e6051915791a034ff65e5f100525a2", size = 10235, upload-time = "2024-02-25T23:20:01.196Z" }, ] [[package]] name = "snowballstemmer" version = "3.0.1" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/75/a7/9810d872919697c9d01295633f5d574fb416d47e535f258272ca1f01f447/snowballstemmer-3.0.1.tar.gz", hash = "sha256:6d5eeeec8e9f84d4d56b847692bacf79bc2c8e90c7f80ca4444ff8b6f2e52895", size = 105575 } +sdist = { url = "https://files.pythonhosted.org/packages/75/a7/9810d872919697c9d01295633f5d574fb416d47e535f258272ca1f01f447/snowballstemmer-3.0.1.tar.gz", hash = "sha256:6d5eeeec8e9f84d4d56b847692bacf79bc2c8e90c7f80ca4444ff8b6f2e52895", size = 105575, upload-time = "2025-05-09T16:34:51.843Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/c8/78/3565d011c61f5a43488987ee32b6f3f656e7f107ac2782dd57bdd7d91d9a/snowballstemmer-3.0.1-py3-none-any.whl", hash = "sha256:6cd7b3897da8d6c9ffb968a6781fa6532dce9c3618a4b127d920dab764a19064", size = 103274 }, + { url = "https://files.pythonhosted.org/packages/c8/78/3565d011c61f5a43488987ee32b6f3f656e7f107ac2782dd57bdd7d91d9a/snowballstemmer-3.0.1-py3-none-any.whl", hash = "sha256:6cd7b3897da8d6c9ffb968a6781fa6532dce9c3618a4b127d920dab764a19064", size = 103274, upload-time = "2025-05-09T16:34:50.371Z" }, ] [[package]] name = "soupsieve" version = "2.7" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/3f/f4/4a80cd6ef364b2e8b65b15816a843c0980f7a5a2b4dc701fc574952aa19f/soupsieve-2.7.tar.gz", hash = "sha256:ad282f9b6926286d2ead4750552c8a6142bc4c783fd66b0293547c8fe6ae126a", size = 103418 } +sdist = { url = "https://files.pythonhosted.org/packages/3f/f4/4a80cd6ef364b2e8b65b15816a843c0980f7a5a2b4dc701fc574952aa19f/soupsieve-2.7.tar.gz", hash = "sha256:ad282f9b6926286d2ead4750552c8a6142bc4c783fd66b0293547c8fe6ae126a", size = 103418, upload-time = "2025-04-20T18:50:08.518Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/e7/9c/0e6afc12c269578be5c0c1c9f4b49a8d32770a080260c333ac04cc1c832d/soupsieve-2.7-py3-none-any.whl", hash = "sha256:6e60cc5c1ffaf1cebcc12e8188320b72071e922c2e897f737cadce79ad5d30c4", size = 36677 }, + { url = "https://files.pythonhosted.org/packages/e7/9c/0e6afc12c269578be5c0c1c9f4b49a8d32770a080260c333ac04cc1c832d/soupsieve-2.7-py3-none-any.whl", hash = "sha256:6e60cc5c1ffaf1cebcc12e8188320b72071e922c2e897f737cadce79ad5d30c4", size = 36677, upload-time = "2025-04-20T18:50:07.196Z" }, ] [[package]] @@ -2051,9 +2077,9 @@ dependencies = [ { name = "sphinxcontrib-serializinghtml" }, { name = "tomli", marker = "python_full_version < '3.11'" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/25/a7/3cc3d6dcad70aba2e32a3ae8de5a90026a0a2fdaaa0756925e3a120249b6/sphinx-8.0.2.tar.gz", hash = "sha256:0cce1ddcc4fd3532cf1dd283bc7d886758362c5c1de6598696579ce96d8ffa5b", size = 8189041 } +sdist = { url = "https://files.pythonhosted.org/packages/25/a7/3cc3d6dcad70aba2e32a3ae8de5a90026a0a2fdaaa0756925e3a120249b6/sphinx-8.0.2.tar.gz", hash = "sha256:0cce1ddcc4fd3532cf1dd283bc7d886758362c5c1de6598696579ce96d8ffa5b", size = 8189041, upload-time = "2024-07-30T01:39:14.711Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/4d/61/2ad169c6ff1226b46e50da0e44671592dbc6d840a52034a0193a99b28579/sphinx-8.0.2-py3-none-any.whl", hash = "sha256:56173572ae6c1b9a38911786e206a110c9749116745873feae4f9ce88e59391d", size = 3498950 }, + { url = "https://files.pythonhosted.org/packages/4d/61/2ad169c6ff1226b46e50da0e44671592dbc6d840a52034a0193a99b28579/sphinx-8.0.2-py3-none-any.whl", hash = "sha256:56173572ae6c1b9a38911786e206a110c9749116745873feae4f9ce88e59391d", size = 3498950, upload-time = "2024-07-30T01:39:11.116Z" }, ] [[package]] @@ -2068,9 +2094,9 @@ dependencies = [ { name = "watchfiles" }, { name = "websockets" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/a5/2c/155e1de2c1ba96a72e5dba152c509a8b41e047ee5c2def9e9f0d812f8be7/sphinx_autobuild-2024.10.3.tar.gz", hash = "sha256:248150f8f333e825107b6d4b86113ab28fa51750e5f9ae63b59dc339be951fb1", size = 14023 } +sdist = { url = "https://files.pythonhosted.org/packages/a5/2c/155e1de2c1ba96a72e5dba152c509a8b41e047ee5c2def9e9f0d812f8be7/sphinx_autobuild-2024.10.3.tar.gz", hash = "sha256:248150f8f333e825107b6d4b86113ab28fa51750e5f9ae63b59dc339be951fb1", size = 14023, upload-time = "2024-10-02T23:15:30.172Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/18/c0/eba125db38c84d3c74717008fd3cb5000b68cd7e2cbafd1349c6a38c3d3b/sphinx_autobuild-2024.10.3-py3-none-any.whl", hash = "sha256:158e16c36f9d633e613c9aaf81c19b0fc458ca78b112533b20dafcda430d60fa", size = 11908 }, + { url = "https://files.pythonhosted.org/packages/18/c0/eba125db38c84d3c74717008fd3cb5000b68cd7e2cbafd1349c6a38c3d3b/sphinx_autobuild-2024.10.3-py3-none-any.whl", hash = "sha256:158e16c36f9d633e613c9aaf81c19b0fc458ca78b112533b20dafcda430d60fa", size = 11908, upload-time = "2024-10-02T23:15:28.739Z" }, ] [[package]] @@ -2080,9 +2106,9 @@ source = { registry = "https://pypi.org/simple" } dependencies = [ { name = "sphinx" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/98/0b/a866924ded68efec7a1759587a4e478aec7559d8165fac8b2ad1c0e774d6/sphinx_basic_ng-1.0.0b2.tar.gz", hash = "sha256:9ec55a47c90c8c002b5960c57492ec3021f5193cb26cebc2dc4ea226848651c9", size = 20736 } +sdist = { url = "https://files.pythonhosted.org/packages/98/0b/a866924ded68efec7a1759587a4e478aec7559d8165fac8b2ad1c0e774d6/sphinx_basic_ng-1.0.0b2.tar.gz", hash = "sha256:9ec55a47c90c8c002b5960c57492ec3021f5193cb26cebc2dc4ea226848651c9", size = 20736, upload-time = "2023-07-08T18:40:54.166Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/3c/dd/018ce05c532a22007ac58d4f45232514cd9d6dd0ee1dc374e309db830983/sphinx_basic_ng-1.0.0b2-py3-none-any.whl", hash = "sha256:eb09aedbabfb650607e9b4b68c9d240b90b1e1be221d6ad71d61c52e29f7932b", size = 22496 }, + { url = "https://files.pythonhosted.org/packages/3c/dd/018ce05c532a22007ac58d4f45232514cd9d6dd0ee1dc374e309db830983/sphinx_basic_ng-1.0.0b2-py3-none-any.whl", hash = "sha256:eb09aedbabfb650607e9b4b68c9d240b90b1e1be221d6ad71d61c52e29f7932b", size = 22496, upload-time = "2023-07-08T18:40:52.659Z" }, ] [[package]] @@ -2092,9 +2118,9 @@ source = { registry = "https://pypi.org/simple" } dependencies = [ { name = "sphinx" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/fc/2b/a964715e7f5295f77509e59309959f4125122d648f86b4fe7d70ca1d882c/sphinx-copybutton-0.5.2.tar.gz", hash = "sha256:4cf17c82fb9646d1bc9ca92ac280813a3b605d8c421225fd9913154103ee1fbd", size = 23039 } +sdist = { url = "https://files.pythonhosted.org/packages/fc/2b/a964715e7f5295f77509e59309959f4125122d648f86b4fe7d70ca1d882c/sphinx-copybutton-0.5.2.tar.gz", hash = "sha256:4cf17c82fb9646d1bc9ca92ac280813a3b605d8c421225fd9913154103ee1fbd", size = 23039, upload-time = "2023-04-14T08:10:22.998Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/9e/48/1ea60e74949eecb12cdd6ac43987f9fd331156388dcc2319b45e2ebb81bf/sphinx_copybutton-0.5.2-py3-none-any.whl", hash = "sha256:fb543fd386d917746c9a2c50360c7905b605726b9355cd26e9974857afeae06e", size = 13343 }, + { url = "https://files.pythonhosted.org/packages/9e/48/1ea60e74949eecb12cdd6ac43987f9fd331156388dcc2319b45e2ebb81bf/sphinx_copybutton-0.5.2-py3-none-any.whl", hash = "sha256:fb543fd386d917746c9a2c50360c7905b605726b9355cd26e9974857afeae06e", size = 13343, upload-time = "2023-04-14T08:10:20.844Z" }, ] [[package]] @@ -2104,9 +2130,9 @@ source = { registry = "https://pypi.org/simple" } dependencies = [ { name = "sphinx" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/2b/69/b34e0cb5336f09c6866d53b4a19d76c227cdec1bbc7ac4de63ca7d58c9c7/sphinx_design-0.6.1.tar.gz", hash = "sha256:b44eea3719386d04d765c1a8257caca2b3e6f8421d7b3a5e742c0fd45f84e632", size = 2193689 } +sdist = { url = "https://files.pythonhosted.org/packages/2b/69/b34e0cb5336f09c6866d53b4a19d76c227cdec1bbc7ac4de63ca7d58c9c7/sphinx_design-0.6.1.tar.gz", hash = "sha256:b44eea3719386d04d765c1a8257caca2b3e6f8421d7b3a5e742c0fd45f84e632", size = 2193689, upload-time = "2024-08-02T13:48:44.277Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/c6/43/65c0acbd8cc6f50195a3a1fc195c404988b15c67090e73c7a41a9f57d6bd/sphinx_design-0.6.1-py3-none-any.whl", hash = "sha256:b11f37db1a802a183d61b159d9a202314d4d2fe29c163437001324fe2f19549c", size = 2215338 }, + { url = "https://files.pythonhosted.org/packages/c6/43/65c0acbd8cc6f50195a3a1fc195c404988b15c67090e73c7a41a9f57d6bd/sphinx_design-0.6.1-py3-none-any.whl", hash = "sha256:b11f37db1a802a183d61b159d9a202314d4d2fe29c163437001324fe2f19549c", size = 2215338, upload-time = "2024-08-02T13:48:42.106Z" }, ] [[package]] @@ -2116,9 +2142,9 @@ source = { registry = "https://pypi.org/simple" } dependencies = [ { name = "sphinx" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/6a/b2/67603444a8ee97b4a8ea71b0a9d6bab1727ed65e362c87e02f818ee57b8a/sphinx_notfound_page-1.1.0.tar.gz", hash = "sha256:913e1754370bb3db201d9300d458a8b8b5fb22e9246a816643a819a9ea2b8067", size = 7392 } +sdist = { url = "https://files.pythonhosted.org/packages/6a/b2/67603444a8ee97b4a8ea71b0a9d6bab1727ed65e362c87e02f818ee57b8a/sphinx_notfound_page-1.1.0.tar.gz", hash = "sha256:913e1754370bb3db201d9300d458a8b8b5fb22e9246a816643a819a9ea2b8067", size = 7392, upload-time = "2025-01-28T18:45:02.871Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/cd/d4/019fe439c840a7966012bbb95ccbdd81c5c10271749706793b43beb05145/sphinx_notfound_page-1.1.0-py3-none-any.whl", hash = "sha256:835dc76ff7914577a1f58d80a2c8418fb6138c0932c8da8adce4d9096fbcd389", size = 8167 }, + { url = "https://files.pythonhosted.org/packages/cd/d4/019fe439c840a7966012bbb95ccbdd81c5c10271749706793b43beb05145/sphinx_notfound_page-1.1.0-py3-none-any.whl", hash = "sha256:835dc76ff7914577a1f58d80a2c8418fb6138c0932c8da8adce4d9096fbcd389", size = 8167, upload-time = "2025-01-28T18:45:00.465Z" }, ] [[package]] @@ -2130,36 +2156,36 @@ dependencies = [ { name = "pygments" }, { name = "sphinx" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/6a/53/a9a91995cb365e589f413b77fc75f1c0e9b4ac61bfa8da52a779ad855cc0/sphinx-tabs-3.4.7.tar.gz", hash = "sha256:991ad4a424ff54119799ba1491701aa8130dd43509474aef45a81c42d889784d", size = 15891 } +sdist = { url = "https://files.pythonhosted.org/packages/6a/53/a9a91995cb365e589f413b77fc75f1c0e9b4ac61bfa8da52a779ad855cc0/sphinx-tabs-3.4.7.tar.gz", hash = "sha256:991ad4a424ff54119799ba1491701aa8130dd43509474aef45a81c42d889784d", size = 15891, upload-time = "2024-10-08T13:37:27.887Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/6b/c6/f47505b564b918a3ba60c1e99232d4942c4a7e44ecaae603e829e3d05dae/sphinx_tabs-3.4.7-py3-none-any.whl", hash = "sha256:c12d7a36fd413b369e9e9967a0a4015781b71a9c393575419834f19204bd1915", size = 9727 }, + { url = "https://files.pythonhosted.org/packages/6b/c6/f47505b564b918a3ba60c1e99232d4942c4a7e44ecaae603e829e3d05dae/sphinx_tabs-3.4.7-py3-none-any.whl", hash = "sha256:c12d7a36fd413b369e9e9967a0a4015781b71a9c393575419834f19204bd1915", size = 9727, upload-time = "2024-10-08T13:37:26.192Z" }, ] [[package]] name = "sphinxcontrib-applehelp" version = "2.0.0" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/ba/6e/b837e84a1a704953c62ef8776d45c3e8d759876b4a84fe14eba2859106fe/sphinxcontrib_applehelp-2.0.0.tar.gz", hash = "sha256:2f29ef331735ce958efa4734873f084941970894c6090408b079c61b2e1c06d1", size = 20053 } +sdist = { url = "https://files.pythonhosted.org/packages/ba/6e/b837e84a1a704953c62ef8776d45c3e8d759876b4a84fe14eba2859106fe/sphinxcontrib_applehelp-2.0.0.tar.gz", hash = "sha256:2f29ef331735ce958efa4734873f084941970894c6090408b079c61b2e1c06d1", size = 20053, upload-time = "2024-07-29T01:09:00.465Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/5d/85/9ebeae2f76e9e77b952f4b274c27238156eae7979c5421fba91a28f4970d/sphinxcontrib_applehelp-2.0.0-py3-none-any.whl", hash = "sha256:4cd3f0ec4ac5dd9c17ec65e9ab272c9b867ea77425228e68ecf08d6b28ddbdb5", size = 119300 }, + { url = "https://files.pythonhosted.org/packages/5d/85/9ebeae2f76e9e77b952f4b274c27238156eae7979c5421fba91a28f4970d/sphinxcontrib_applehelp-2.0.0-py3-none-any.whl", hash = "sha256:4cd3f0ec4ac5dd9c17ec65e9ab272c9b867ea77425228e68ecf08d6b28ddbdb5", size = 119300, upload-time = "2024-07-29T01:08:58.99Z" }, ] [[package]] name = "sphinxcontrib-devhelp" version = "2.0.0" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/f6/d2/5beee64d3e4e747f316bae86b55943f51e82bb86ecd325883ef65741e7da/sphinxcontrib_devhelp-2.0.0.tar.gz", hash = "sha256:411f5d96d445d1d73bb5d52133377b4248ec79db5c793ce7dbe59e074b4dd1ad", size = 12967 } +sdist = { url = "https://files.pythonhosted.org/packages/f6/d2/5beee64d3e4e747f316bae86b55943f51e82bb86ecd325883ef65741e7da/sphinxcontrib_devhelp-2.0.0.tar.gz", hash = "sha256:411f5d96d445d1d73bb5d52133377b4248ec79db5c793ce7dbe59e074b4dd1ad", size = 12967, upload-time = "2024-07-29T01:09:23.417Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/35/7a/987e583882f985fe4d7323774889ec58049171828b58c2217e7f79cdf44e/sphinxcontrib_devhelp-2.0.0-py3-none-any.whl", hash = "sha256:aefb8b83854e4b0998877524d1029fd3e6879210422ee3780459e28a1f03a8a2", size = 82530 }, + { url = "https://files.pythonhosted.org/packages/35/7a/987e583882f985fe4d7323774889ec58049171828b58c2217e7f79cdf44e/sphinxcontrib_devhelp-2.0.0-py3-none-any.whl", hash = "sha256:aefb8b83854e4b0998877524d1029fd3e6879210422ee3780459e28a1f03a8a2", size = 82530, upload-time = "2024-07-29T01:09:21.945Z" }, ] [[package]] name = "sphinxcontrib-htmlhelp" version = "2.1.0" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/43/93/983afd9aa001e5201eab16b5a444ed5b9b0a7a010541e0ddfbbfd0b2470c/sphinxcontrib_htmlhelp-2.1.0.tar.gz", hash = "sha256:c9e2916ace8aad64cc13a0d233ee22317f2b9025b9cf3295249fa985cc7082e9", size = 22617 } +sdist = { url = "https://files.pythonhosted.org/packages/43/93/983afd9aa001e5201eab16b5a444ed5b9b0a7a010541e0ddfbbfd0b2470c/sphinxcontrib_htmlhelp-2.1.0.tar.gz", hash = "sha256:c9e2916ace8aad64cc13a0d233ee22317f2b9025b9cf3295249fa985cc7082e9", size = 22617, upload-time = "2024-07-29T01:09:37.889Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/0a/7b/18a8c0bcec9182c05a0b3ec2a776bba4ead82750a55ff798e8d406dae604/sphinxcontrib_htmlhelp-2.1.0-py3-none-any.whl", hash = "sha256:166759820b47002d22914d64a075ce08f4c46818e17cfc9470a9786b759b19f8", size = 98705 }, + { url = "https://files.pythonhosted.org/packages/0a/7b/18a8c0bcec9182c05a0b3ec2a776bba4ead82750a55ff798e8d406dae604/sphinxcontrib_htmlhelp-2.1.0-py3-none-any.whl", hash = "sha256:166759820b47002d22914d64a075ce08f4c46818e17cfc9470a9786b759b19f8", size = 98705, upload-time = "2024-07-29T01:09:36.407Z" }, ] [[package]] @@ -2169,36 +2195,36 @@ source = { registry = "https://pypi.org/simple" } dependencies = [ { name = "sphinx" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/de/f3/aa67467e051df70a6330fe7770894b3e4f09436dea6881ae0b4f3d87cad8/sphinxcontrib-jquery-4.1.tar.gz", hash = "sha256:1620739f04e36a2c779f1a131a2dfd49b2fd07351bf1968ced074365933abc7a", size = 122331 } +sdist = { url = "https://files.pythonhosted.org/packages/de/f3/aa67467e051df70a6330fe7770894b3e4f09436dea6881ae0b4f3d87cad8/sphinxcontrib-jquery-4.1.tar.gz", hash = "sha256:1620739f04e36a2c779f1a131a2dfd49b2fd07351bf1968ced074365933abc7a", size = 122331, upload-time = "2023-03-14T15:01:01.944Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/76/85/749bd22d1a68db7291c89e2ebca53f4306c3f205853cf31e9de279034c3c/sphinxcontrib_jquery-4.1-py2.py3-none-any.whl", hash = "sha256:f936030d7d0147dd026a4f2b5a57343d233f1fc7b363f68b3d4f1cb0993878ae", size = 121104 }, + { url = "https://files.pythonhosted.org/packages/76/85/749bd22d1a68db7291c89e2ebca53f4306c3f205853cf31e9de279034c3c/sphinxcontrib_jquery-4.1-py2.py3-none-any.whl", hash = "sha256:f936030d7d0147dd026a4f2b5a57343d233f1fc7b363f68b3d4f1cb0993878ae", size = 121104, upload-time = "2023-03-14T15:01:00.356Z" }, ] [[package]] name = "sphinxcontrib-jsmath" version = "1.0.1" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/b2/e8/9ed3830aeed71f17c026a07a5097edcf44b692850ef215b161b8ad875729/sphinxcontrib-jsmath-1.0.1.tar.gz", hash = "sha256:a9925e4a4587247ed2191a22df5f6970656cb8ca2bd6284309578f2153e0c4b8", size = 5787 } +sdist = { url = "https://files.pythonhosted.org/packages/b2/e8/9ed3830aeed71f17c026a07a5097edcf44b692850ef215b161b8ad875729/sphinxcontrib-jsmath-1.0.1.tar.gz", hash = "sha256:a9925e4a4587247ed2191a22df5f6970656cb8ca2bd6284309578f2153e0c4b8", size = 5787, upload-time = "2019-01-21T16:10:16.347Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/c2/42/4c8646762ee83602e3fb3fbe774c2fac12f317deb0b5dbeeedd2d3ba4b77/sphinxcontrib_jsmath-1.0.1-py2.py3-none-any.whl", hash = "sha256:2ec2eaebfb78f3f2078e73666b1415417a116cc848b72e5172e596c871103178", size = 5071 }, + { url = "https://files.pythonhosted.org/packages/c2/42/4c8646762ee83602e3fb3fbe774c2fac12f317deb0b5dbeeedd2d3ba4b77/sphinxcontrib_jsmath-1.0.1-py2.py3-none-any.whl", hash = "sha256:2ec2eaebfb78f3f2078e73666b1415417a116cc848b72e5172e596c871103178", size = 5071, upload-time = "2019-01-21T16:10:14.333Z" }, ] [[package]] name = "sphinxcontrib-qthelp" version = "2.0.0" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/68/bc/9104308fc285eb3e0b31b67688235db556cd5b0ef31d96f30e45f2e51cae/sphinxcontrib_qthelp-2.0.0.tar.gz", hash = "sha256:4fe7d0ac8fc171045be623aba3e2a8f613f8682731f9153bb2e40ece16b9bbab", size = 17165 } +sdist = { url = "https://files.pythonhosted.org/packages/68/bc/9104308fc285eb3e0b31b67688235db556cd5b0ef31d96f30e45f2e51cae/sphinxcontrib_qthelp-2.0.0.tar.gz", hash = "sha256:4fe7d0ac8fc171045be623aba3e2a8f613f8682731f9153bb2e40ece16b9bbab", size = 17165, upload-time = "2024-07-29T01:09:56.435Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/27/83/859ecdd180cacc13b1f7e857abf8582a64552ea7a061057a6c716e790fce/sphinxcontrib_qthelp-2.0.0-py3-none-any.whl", hash = "sha256:b18a828cdba941ccd6ee8445dbe72ffa3ef8cbe7505d8cd1fa0d42d3f2d5f3eb", size = 88743 }, + { url = "https://files.pythonhosted.org/packages/27/83/859ecdd180cacc13b1f7e857abf8582a64552ea7a061057a6c716e790fce/sphinxcontrib_qthelp-2.0.0-py3-none-any.whl", hash = "sha256:b18a828cdba941ccd6ee8445dbe72ffa3ef8cbe7505d8cd1fa0d42d3f2d5f3eb", size = 88743, upload-time = "2024-07-29T01:09:54.885Z" }, ] [[package]] name = "sphinxcontrib-serializinghtml" version = "2.0.0" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/3b/44/6716b257b0aa6bfd51a1b31665d1c205fb12cb5ad56de752dfa15657de2f/sphinxcontrib_serializinghtml-2.0.0.tar.gz", hash = "sha256:e9d912827f872c029017a53f0ef2180b327c3f7fd23c87229f7a8e8b70031d4d", size = 16080 } +sdist = { url = "https://files.pythonhosted.org/packages/3b/44/6716b257b0aa6bfd51a1b31665d1c205fb12cb5ad56de752dfa15657de2f/sphinxcontrib_serializinghtml-2.0.0.tar.gz", hash = "sha256:e9d912827f872c029017a53f0ef2180b327c3f7fd23c87229f7a8e8b70031d4d", size = 16080, upload-time = "2024-07-29T01:10:09.332Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/52/a7/d2782e4e3f77c8450f727ba74a8f12756d5ba823d81b941f1b04da9d033a/sphinxcontrib_serializinghtml-2.0.0-py3-none-any.whl", hash = "sha256:6e2cb0eef194e10c27ec0023bfeb25badbbb5868244cf5bc5bdc04e4464bf331", size = 92072 }, + { url = "https://files.pythonhosted.org/packages/52/a7/d2782e4e3f77c8450f727ba74a8f12756d5ba823d81b941f1b04da9d033a/sphinxcontrib_serializinghtml-2.0.0-py3-none-any.whl", hash = "sha256:6e2cb0eef194e10c27ec0023bfeb25badbbb5868244cf5bc5bdc04e4464bf331", size = 92072, upload-time = "2024-07-29T01:10:08.203Z" }, ] [[package]] @@ -2208,9 +2234,9 @@ source = { registry = "https://pypi.org/simple" } dependencies = [ { name = "sphinx" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/2c/27/d8e269030e1f063494ee2b8110256de8fa05b1ef532c76e6807b5c42c8b1/sphinxext_opengraph-0.10.0.tar.gz", hash = "sha256:5781149c1dfc306c3701661acdd02c512c2e6f21d2253487bf0b39639017fc24", size = 1027562 } +sdist = { url = "https://files.pythonhosted.org/packages/2c/27/d8e269030e1f063494ee2b8110256de8fa05b1ef532c76e6807b5c42c8b1/sphinxext_opengraph-0.10.0.tar.gz", hash = "sha256:5781149c1dfc306c3701661acdd02c512c2e6f21d2253487bf0b39639017fc24", size = 1027562, upload-time = "2025-04-04T21:35:19.646Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/47/3f/bb8bbee4d26aa2abd46e76025697040708e1b0d37c9f198877cebf0e3ba0/sphinxext_opengraph-0.10.0-py3-none-any.whl", hash = "sha256:8afd33f96a02d9506d9dc8f284840888ca8948482ac93015a68d88493df43712", size = 1004031 }, + { url = "https://files.pythonhosted.org/packages/47/3f/bb8bbee4d26aa2abd46e76025697040708e1b0d37c9f198877cebf0e3ba0/sphinxext_opengraph-0.10.0-py3-none-any.whl", hash = "sha256:8afd33f96a02d9506d9dc8f284840888ca8948482ac93015a68d88493df43712", size = 1004031, upload-time = "2025-04-04T21:35:17.637Z" }, ] [[package]] @@ -2222,9 +2248,9 @@ dependencies = [ { name = "executing" }, { name = "pure-eval" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/28/e3/55dcc2cfbc3ca9c29519eb6884dd1415ecb53b0e934862d3559ddcb7e20b/stack_data-0.6.3.tar.gz", hash = "sha256:836a778de4fec4dcd1dcd89ed8abff8a221f58308462e1c4aa2a3cf30148f0b9", size = 44707 } +sdist = { url = "https://files.pythonhosted.org/packages/28/e3/55dcc2cfbc3ca9c29519eb6884dd1415ecb53b0e934862d3559ddcb7e20b/stack_data-0.6.3.tar.gz", hash = "sha256:836a778de4fec4dcd1dcd89ed8abff8a221f58308462e1c4aa2a3cf30148f0b9", size = 44707, upload-time = "2023-09-30T13:58:05.479Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/f1/7b/ce1eafaf1a76852e2ec9b22edecf1daa58175c090266e9f6c64afcd81d91/stack_data-0.6.3-py3-none-any.whl", hash = "sha256:d5558e0c25a4cb0853cddad3d77da9891a08cb85dd9f9f91b9f8cd66e511e695", size = 24521 }, + { url = "https://files.pythonhosted.org/packages/f1/7b/ce1eafaf1a76852e2ec9b22edecf1daa58175c090266e9f6c64afcd81d91/stack_data-0.6.3-py3-none-any.whl", hash = "sha256:d5558e0c25a4cb0853cddad3d77da9891a08cb85dd9f9f91b9f8cd66e511e695", size = 24521, upload-time = "2023-09-30T13:58:03.53Z" }, ] [[package]] @@ -2234,75 +2260,75 @@ source = { registry = "https://pypi.org/simple" } dependencies = [ { name = "anyio" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/8b/d0/0332bd8a25779a0e2082b0e179805ad39afad642938b371ae0882e7f880d/starlette-0.47.0.tar.gz", hash = "sha256:1f64887e94a447fed5f23309fb6890ef23349b7e478faa7b24a851cd4eb844af", size = 2582856 } +sdist = { url = "https://files.pythonhosted.org/packages/8b/d0/0332bd8a25779a0e2082b0e179805ad39afad642938b371ae0882e7f880d/starlette-0.47.0.tar.gz", hash = "sha256:1f64887e94a447fed5f23309fb6890ef23349b7e478faa7b24a851cd4eb844af", size = 2582856, upload-time = "2025-05-29T15:45:27.628Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/e3/81/c60b35fe9674f63b38a8feafc414fca0da378a9dbd5fa1e0b8d23fcc7a9b/starlette-0.47.0-py3-none-any.whl", hash = "sha256:9d052d4933683af40ffd47c7465433570b4949dc937e20ad1d73b34e72f10c37", size = 72796 }, + { url = "https://files.pythonhosted.org/packages/e3/81/c60b35fe9674f63b38a8feafc414fca0da378a9dbd5fa1e0b8d23fcc7a9b/starlette-0.47.0-py3-none-any.whl", hash = "sha256:9d052d4933683af40ffd47c7465433570b4949dc937e20ad1d73b34e72f10c37", size = 72796, upload-time = "2025-05-29T15:45:26.305Z" }, ] [[package]] name = "tomli" version = "2.2.1" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/18/87/302344fed471e44a87289cf4967697d07e532f2421fdaf868a303cbae4ff/tomli-2.2.1.tar.gz", hash = "sha256:cd45e1dc79c835ce60f7404ec8119f2eb06d38b1deba146f07ced3bbc44505ff", size = 17175 } -wheels = [ - { url = "https://files.pythonhosted.org/packages/43/ca/75707e6efa2b37c77dadb324ae7d9571cb424e61ea73fad7c56c2d14527f/tomli-2.2.1-cp311-cp311-macosx_10_9_x86_64.whl", hash = "sha256:678e4fa69e4575eb77d103de3df8a895e1591b48e740211bd1067378c69e8249", size = 131077 }, - { url = "https://files.pythonhosted.org/packages/c7/16/51ae563a8615d472fdbffc43a3f3d46588c264ac4f024f63f01283becfbb/tomli-2.2.1-cp311-cp311-macosx_11_0_arm64.whl", hash = "sha256:023aa114dd824ade0100497eb2318602af309e5a55595f76b626d6d9f3b7b0a6", size = 123429 }, - { url = "https://files.pythonhosted.org/packages/f1/dd/4f6cd1e7b160041db83c694abc78e100473c15d54620083dbd5aae7b990e/tomli-2.2.1-cp311-cp311-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:ece47d672db52ac607a3d9599a9d48dcb2f2f735c6c2d1f34130085bb12b112a", size = 226067 }, - { url = "https://files.pythonhosted.org/packages/a9/6b/c54ede5dc70d648cc6361eaf429304b02f2871a345bbdd51e993d6cdf550/tomli-2.2.1-cp311-cp311-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:6972ca9c9cc9f0acaa56a8ca1ff51e7af152a9f87fb64623e31d5c83700080ee", size = 236030 }, - { url = "https://files.pythonhosted.org/packages/1f/47/999514fa49cfaf7a92c805a86c3c43f4215621855d151b61c602abb38091/tomli-2.2.1-cp311-cp311-manylinux_2_5_i686.manylinux1_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:c954d2250168d28797dd4e3ac5cf812a406cd5a92674ee4c8f123c889786aa8e", size = 240898 }, - { url = "https://files.pythonhosted.org/packages/73/41/0a01279a7ae09ee1573b423318e7934674ce06eb33f50936655071d81a24/tomli-2.2.1-cp311-cp311-musllinux_1_2_aarch64.whl", hash = "sha256:8dd28b3e155b80f4d54beb40a441d366adcfe740969820caf156c019fb5c7ec4", size = 229894 }, - { url = "https://files.pythonhosted.org/packages/55/18/5d8bc5b0a0362311ce4d18830a5d28943667599a60d20118074ea1b01bb7/tomli-2.2.1-cp311-cp311-musllinux_1_2_i686.whl", hash = "sha256:e59e304978767a54663af13c07b3d1af22ddee3bb2fb0618ca1593e4f593a106", size = 245319 }, - { url = "https://files.pythonhosted.org/packages/92/a3/7ade0576d17f3cdf5ff44d61390d4b3febb8a9fc2b480c75c47ea048c646/tomli-2.2.1-cp311-cp311-musllinux_1_2_x86_64.whl", hash = "sha256:33580bccab0338d00994d7f16f4c4ec25b776af3ffaac1ed74e0b3fc95e885a8", size = 238273 }, - { url = "https://files.pythonhosted.org/packages/72/6f/fa64ef058ac1446a1e51110c375339b3ec6be245af9d14c87c4a6412dd32/tomli-2.2.1-cp311-cp311-win32.whl", hash = "sha256:465af0e0875402f1d226519c9904f37254b3045fc5084697cefb9bdde1ff99ff", size = 98310 }, - { url = "https://files.pythonhosted.org/packages/6a/1c/4a2dcde4a51b81be3530565e92eda625d94dafb46dbeb15069df4caffc34/tomli-2.2.1-cp311-cp311-win_amd64.whl", hash = "sha256:2d0f2fdd22b02c6d81637a3c95f8cd77f995846af7414c5c4b8d0545afa1bc4b", size = 108309 }, - { url = "https://files.pythonhosted.org/packages/52/e1/f8af4c2fcde17500422858155aeb0d7e93477a0d59a98e56cbfe75070fd0/tomli-2.2.1-cp312-cp312-macosx_10_13_x86_64.whl", hash = "sha256:4a8f6e44de52d5e6c657c9fe83b562f5f4256d8ebbfe4ff922c495620a7f6cea", size = 132762 }, - { url = "https://files.pythonhosted.org/packages/03/b8/152c68bb84fc00396b83e7bbddd5ec0bd3dd409db4195e2a9b3e398ad2e3/tomli-2.2.1-cp312-cp312-macosx_11_0_arm64.whl", hash = "sha256:8d57ca8095a641b8237d5b079147646153d22552f1c637fd3ba7f4b0b29167a8", size = 123453 }, - { url = "https://files.pythonhosted.org/packages/c8/d6/fc9267af9166f79ac528ff7e8c55c8181ded34eb4b0e93daa767b8841573/tomli-2.2.1-cp312-cp312-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:4e340144ad7ae1533cb897d406382b4b6fede8890a03738ff1683af800d54192", size = 233486 }, - { url = "https://files.pythonhosted.org/packages/5c/51/51c3f2884d7bab89af25f678447ea7d297b53b5a3b5730a7cb2ef6069f07/tomli-2.2.1-cp312-cp312-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:db2b95f9de79181805df90bedc5a5ab4c165e6ec3fe99f970d0e302f384ad222", size = 242349 }, - { url = "https://files.pythonhosted.org/packages/ab/df/bfa89627d13a5cc22402e441e8a931ef2108403db390ff3345c05253935e/tomli-2.2.1-cp312-cp312-manylinux_2_5_i686.manylinux1_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:40741994320b232529c802f8bc86da4e1aa9f413db394617b9a256ae0f9a7f77", size = 252159 }, - { url = "https://files.pythonhosted.org/packages/9e/6e/fa2b916dced65763a5168c6ccb91066f7639bdc88b48adda990db10c8c0b/tomli-2.2.1-cp312-cp312-musllinux_1_2_aarch64.whl", hash = "sha256:400e720fe168c0f8521520190686ef8ef033fb19fc493da09779e592861b78c6", size = 237243 }, - { url = "https://files.pythonhosted.org/packages/b4/04/885d3b1f650e1153cbb93a6a9782c58a972b94ea4483ae4ac5cedd5e4a09/tomli-2.2.1-cp312-cp312-musllinux_1_2_i686.whl", hash = "sha256:02abe224de6ae62c19f090f68da4e27b10af2b93213d36cf44e6e1c5abd19fdd", size = 259645 }, - { url = "https://files.pythonhosted.org/packages/9c/de/6b432d66e986e501586da298e28ebeefd3edc2c780f3ad73d22566034239/tomli-2.2.1-cp312-cp312-musllinux_1_2_x86_64.whl", hash = "sha256:b82ebccc8c8a36f2094e969560a1b836758481f3dc360ce9a3277c65f374285e", size = 244584 }, - { url = "https://files.pythonhosted.org/packages/1c/9a/47c0449b98e6e7d1be6cbac02f93dd79003234ddc4aaab6ba07a9a7482e2/tomli-2.2.1-cp312-cp312-win32.whl", hash = "sha256:889f80ef92701b9dbb224e49ec87c645ce5df3fa2cc548664eb8a25e03127a98", size = 98875 }, - { url = "https://files.pythonhosted.org/packages/ef/60/9b9638f081c6f1261e2688bd487625cd1e660d0a85bd469e91d8db969734/tomli-2.2.1-cp312-cp312-win_amd64.whl", hash = "sha256:7fc04e92e1d624a4a63c76474610238576942d6b8950a2d7f908a340494e67e4", size = 109418 }, - { url = "https://files.pythonhosted.org/packages/04/90/2ee5f2e0362cb8a0b6499dc44f4d7d48f8fff06d28ba46e6f1eaa61a1388/tomli-2.2.1-cp313-cp313-macosx_10_13_x86_64.whl", hash = "sha256:f4039b9cbc3048b2416cc57ab3bda989a6fcf9b36cf8937f01a6e731b64f80d7", size = 132708 }, - { url = "https://files.pythonhosted.org/packages/c0/ec/46b4108816de6b385141f082ba99e315501ccd0a2ea23db4a100dd3990ea/tomli-2.2.1-cp313-cp313-macosx_11_0_arm64.whl", hash = "sha256:286f0ca2ffeeb5b9bd4fcc8d6c330534323ec51b2f52da063b11c502da16f30c", size = 123582 }, - { url = "https://files.pythonhosted.org/packages/a0/bd/b470466d0137b37b68d24556c38a0cc819e8febe392d5b199dcd7f578365/tomli-2.2.1-cp313-cp313-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:a92ef1a44547e894e2a17d24e7557a5e85a9e1d0048b0b5e7541f76c5032cb13", size = 232543 }, - { url = "https://files.pythonhosted.org/packages/d9/e5/82e80ff3b751373f7cead2815bcbe2d51c895b3c990686741a8e56ec42ab/tomli-2.2.1-cp313-cp313-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:9316dc65bed1684c9a98ee68759ceaed29d229e985297003e494aa825ebb0281", size = 241691 }, - { url = "https://files.pythonhosted.org/packages/05/7e/2a110bc2713557d6a1bfb06af23dd01e7dde52b6ee7dadc589868f9abfac/tomli-2.2.1-cp313-cp313-manylinux_2_5_i686.manylinux1_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:e85e99945e688e32d5a35c1ff38ed0b3f41f43fad8df0bdf79f72b2ba7bc5272", size = 251170 }, - { url = "https://files.pythonhosted.org/packages/64/7b/22d713946efe00e0adbcdfd6d1aa119ae03fd0b60ebed51ebb3fa9f5a2e5/tomli-2.2.1-cp313-cp313-musllinux_1_2_aarch64.whl", hash = "sha256:ac065718db92ca818f8d6141b5f66369833d4a80a9d74435a268c52bdfa73140", size = 236530 }, - { url = "https://files.pythonhosted.org/packages/38/31/3a76f67da4b0cf37b742ca76beaf819dca0ebef26d78fc794a576e08accf/tomli-2.2.1-cp313-cp313-musllinux_1_2_i686.whl", hash = "sha256:d920f33822747519673ee656a4b6ac33e382eca9d331c87770faa3eef562aeb2", size = 258666 }, - { url = "https://files.pythonhosted.org/packages/07/10/5af1293da642aded87e8a988753945d0cf7e00a9452d3911dd3bb354c9e2/tomli-2.2.1-cp313-cp313-musllinux_1_2_x86_64.whl", hash = "sha256:a198f10c4d1b1375d7687bc25294306e551bf1abfa4eace6650070a5c1ae2744", size = 243954 }, - { url = "https://files.pythonhosted.org/packages/5b/b9/1ed31d167be802da0fc95020d04cd27b7d7065cc6fbefdd2f9186f60d7bd/tomli-2.2.1-cp313-cp313-win32.whl", hash = "sha256:d3f5614314d758649ab2ab3a62d4f2004c825922f9e370b29416484086b264ec", size = 98724 }, - { url = "https://files.pythonhosted.org/packages/c7/32/b0963458706accd9afcfeb867c0f9175a741bf7b19cd424230714d722198/tomli-2.2.1-cp313-cp313-win_amd64.whl", hash = "sha256:a38aa0308e754b0e3c67e344754dff64999ff9b513e691d0e786265c93583c69", size = 109383 }, - { url = "https://files.pythonhosted.org/packages/6e/c2/61d3e0f47e2b74ef40a68b9e6ad5984f6241a942f7cd3bbfbdbd03861ea9/tomli-2.2.1-py3-none-any.whl", hash = "sha256:cb55c73c5f4408779d0cf3eef9f762b9c9f147a77de7b258bef0a5628adc85cc", size = 14257 }, +sdist = { url = "https://files.pythonhosted.org/packages/18/87/302344fed471e44a87289cf4967697d07e532f2421fdaf868a303cbae4ff/tomli-2.2.1.tar.gz", hash = "sha256:cd45e1dc79c835ce60f7404ec8119f2eb06d38b1deba146f07ced3bbc44505ff", size = 17175, upload-time = "2024-11-27T22:38:36.873Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/43/ca/75707e6efa2b37c77dadb324ae7d9571cb424e61ea73fad7c56c2d14527f/tomli-2.2.1-cp311-cp311-macosx_10_9_x86_64.whl", hash = "sha256:678e4fa69e4575eb77d103de3df8a895e1591b48e740211bd1067378c69e8249", size = 131077, upload-time = "2024-11-27T22:37:54.956Z" }, + { url = "https://files.pythonhosted.org/packages/c7/16/51ae563a8615d472fdbffc43a3f3d46588c264ac4f024f63f01283becfbb/tomli-2.2.1-cp311-cp311-macosx_11_0_arm64.whl", hash = "sha256:023aa114dd824ade0100497eb2318602af309e5a55595f76b626d6d9f3b7b0a6", size = 123429, upload-time = "2024-11-27T22:37:56.698Z" }, + { url = "https://files.pythonhosted.org/packages/f1/dd/4f6cd1e7b160041db83c694abc78e100473c15d54620083dbd5aae7b990e/tomli-2.2.1-cp311-cp311-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:ece47d672db52ac607a3d9599a9d48dcb2f2f735c6c2d1f34130085bb12b112a", size = 226067, upload-time = "2024-11-27T22:37:57.63Z" }, + { url = "https://files.pythonhosted.org/packages/a9/6b/c54ede5dc70d648cc6361eaf429304b02f2871a345bbdd51e993d6cdf550/tomli-2.2.1-cp311-cp311-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:6972ca9c9cc9f0acaa56a8ca1ff51e7af152a9f87fb64623e31d5c83700080ee", size = 236030, upload-time = "2024-11-27T22:37:59.344Z" }, + { url = "https://files.pythonhosted.org/packages/1f/47/999514fa49cfaf7a92c805a86c3c43f4215621855d151b61c602abb38091/tomli-2.2.1-cp311-cp311-manylinux_2_5_i686.manylinux1_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:c954d2250168d28797dd4e3ac5cf812a406cd5a92674ee4c8f123c889786aa8e", size = 240898, upload-time = "2024-11-27T22:38:00.429Z" }, + { url = "https://files.pythonhosted.org/packages/73/41/0a01279a7ae09ee1573b423318e7934674ce06eb33f50936655071d81a24/tomli-2.2.1-cp311-cp311-musllinux_1_2_aarch64.whl", hash = "sha256:8dd28b3e155b80f4d54beb40a441d366adcfe740969820caf156c019fb5c7ec4", size = 229894, upload-time = "2024-11-27T22:38:02.094Z" }, + { url = "https://files.pythonhosted.org/packages/55/18/5d8bc5b0a0362311ce4d18830a5d28943667599a60d20118074ea1b01bb7/tomli-2.2.1-cp311-cp311-musllinux_1_2_i686.whl", hash = "sha256:e59e304978767a54663af13c07b3d1af22ddee3bb2fb0618ca1593e4f593a106", size = 245319, upload-time = "2024-11-27T22:38:03.206Z" }, + { url = "https://files.pythonhosted.org/packages/92/a3/7ade0576d17f3cdf5ff44d61390d4b3febb8a9fc2b480c75c47ea048c646/tomli-2.2.1-cp311-cp311-musllinux_1_2_x86_64.whl", hash = "sha256:33580bccab0338d00994d7f16f4c4ec25b776af3ffaac1ed74e0b3fc95e885a8", size = 238273, upload-time = "2024-11-27T22:38:04.217Z" }, + { url = "https://files.pythonhosted.org/packages/72/6f/fa64ef058ac1446a1e51110c375339b3ec6be245af9d14c87c4a6412dd32/tomli-2.2.1-cp311-cp311-win32.whl", hash = "sha256:465af0e0875402f1d226519c9904f37254b3045fc5084697cefb9bdde1ff99ff", size = 98310, upload-time = "2024-11-27T22:38:05.908Z" }, + { url = "https://files.pythonhosted.org/packages/6a/1c/4a2dcde4a51b81be3530565e92eda625d94dafb46dbeb15069df4caffc34/tomli-2.2.1-cp311-cp311-win_amd64.whl", hash = "sha256:2d0f2fdd22b02c6d81637a3c95f8cd77f995846af7414c5c4b8d0545afa1bc4b", size = 108309, upload-time = "2024-11-27T22:38:06.812Z" }, + { url = "https://files.pythonhosted.org/packages/52/e1/f8af4c2fcde17500422858155aeb0d7e93477a0d59a98e56cbfe75070fd0/tomli-2.2.1-cp312-cp312-macosx_10_13_x86_64.whl", hash = "sha256:4a8f6e44de52d5e6c657c9fe83b562f5f4256d8ebbfe4ff922c495620a7f6cea", size = 132762, upload-time = "2024-11-27T22:38:07.731Z" }, + { url = "https://files.pythonhosted.org/packages/03/b8/152c68bb84fc00396b83e7bbddd5ec0bd3dd409db4195e2a9b3e398ad2e3/tomli-2.2.1-cp312-cp312-macosx_11_0_arm64.whl", hash = "sha256:8d57ca8095a641b8237d5b079147646153d22552f1c637fd3ba7f4b0b29167a8", size = 123453, upload-time = "2024-11-27T22:38:09.384Z" }, + { url = "https://files.pythonhosted.org/packages/c8/d6/fc9267af9166f79ac528ff7e8c55c8181ded34eb4b0e93daa767b8841573/tomli-2.2.1-cp312-cp312-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:4e340144ad7ae1533cb897d406382b4b6fede8890a03738ff1683af800d54192", size = 233486, upload-time = "2024-11-27T22:38:10.329Z" }, + { url = "https://files.pythonhosted.org/packages/5c/51/51c3f2884d7bab89af25f678447ea7d297b53b5a3b5730a7cb2ef6069f07/tomli-2.2.1-cp312-cp312-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:db2b95f9de79181805df90bedc5a5ab4c165e6ec3fe99f970d0e302f384ad222", size = 242349, upload-time = "2024-11-27T22:38:11.443Z" }, + { url = "https://files.pythonhosted.org/packages/ab/df/bfa89627d13a5cc22402e441e8a931ef2108403db390ff3345c05253935e/tomli-2.2.1-cp312-cp312-manylinux_2_5_i686.manylinux1_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:40741994320b232529c802f8bc86da4e1aa9f413db394617b9a256ae0f9a7f77", size = 252159, upload-time = "2024-11-27T22:38:13.099Z" }, + { url = "https://files.pythonhosted.org/packages/9e/6e/fa2b916dced65763a5168c6ccb91066f7639bdc88b48adda990db10c8c0b/tomli-2.2.1-cp312-cp312-musllinux_1_2_aarch64.whl", hash = "sha256:400e720fe168c0f8521520190686ef8ef033fb19fc493da09779e592861b78c6", size = 237243, upload-time = "2024-11-27T22:38:14.766Z" }, + { url = "https://files.pythonhosted.org/packages/b4/04/885d3b1f650e1153cbb93a6a9782c58a972b94ea4483ae4ac5cedd5e4a09/tomli-2.2.1-cp312-cp312-musllinux_1_2_i686.whl", hash = "sha256:02abe224de6ae62c19f090f68da4e27b10af2b93213d36cf44e6e1c5abd19fdd", size = 259645, upload-time = "2024-11-27T22:38:15.843Z" }, + { url = "https://files.pythonhosted.org/packages/9c/de/6b432d66e986e501586da298e28ebeefd3edc2c780f3ad73d22566034239/tomli-2.2.1-cp312-cp312-musllinux_1_2_x86_64.whl", hash = "sha256:b82ebccc8c8a36f2094e969560a1b836758481f3dc360ce9a3277c65f374285e", size = 244584, upload-time = "2024-11-27T22:38:17.645Z" }, + { url = "https://files.pythonhosted.org/packages/1c/9a/47c0449b98e6e7d1be6cbac02f93dd79003234ddc4aaab6ba07a9a7482e2/tomli-2.2.1-cp312-cp312-win32.whl", hash = "sha256:889f80ef92701b9dbb224e49ec87c645ce5df3fa2cc548664eb8a25e03127a98", size = 98875, upload-time = "2024-11-27T22:38:19.159Z" }, + { url = "https://files.pythonhosted.org/packages/ef/60/9b9638f081c6f1261e2688bd487625cd1e660d0a85bd469e91d8db969734/tomli-2.2.1-cp312-cp312-win_amd64.whl", hash = "sha256:7fc04e92e1d624a4a63c76474610238576942d6b8950a2d7f908a340494e67e4", size = 109418, upload-time = "2024-11-27T22:38:20.064Z" }, + { url = "https://files.pythonhosted.org/packages/04/90/2ee5f2e0362cb8a0b6499dc44f4d7d48f8fff06d28ba46e6f1eaa61a1388/tomli-2.2.1-cp313-cp313-macosx_10_13_x86_64.whl", hash = "sha256:f4039b9cbc3048b2416cc57ab3bda989a6fcf9b36cf8937f01a6e731b64f80d7", size = 132708, upload-time = "2024-11-27T22:38:21.659Z" }, + { url = "https://files.pythonhosted.org/packages/c0/ec/46b4108816de6b385141f082ba99e315501ccd0a2ea23db4a100dd3990ea/tomli-2.2.1-cp313-cp313-macosx_11_0_arm64.whl", hash = "sha256:286f0ca2ffeeb5b9bd4fcc8d6c330534323ec51b2f52da063b11c502da16f30c", size = 123582, upload-time = "2024-11-27T22:38:22.693Z" }, + { url = "https://files.pythonhosted.org/packages/a0/bd/b470466d0137b37b68d24556c38a0cc819e8febe392d5b199dcd7f578365/tomli-2.2.1-cp313-cp313-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:a92ef1a44547e894e2a17d24e7557a5e85a9e1d0048b0b5e7541f76c5032cb13", size = 232543, upload-time = "2024-11-27T22:38:24.367Z" }, + { url = "https://files.pythonhosted.org/packages/d9/e5/82e80ff3b751373f7cead2815bcbe2d51c895b3c990686741a8e56ec42ab/tomli-2.2.1-cp313-cp313-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:9316dc65bed1684c9a98ee68759ceaed29d229e985297003e494aa825ebb0281", size = 241691, upload-time = "2024-11-27T22:38:26.081Z" }, + { url = "https://files.pythonhosted.org/packages/05/7e/2a110bc2713557d6a1bfb06af23dd01e7dde52b6ee7dadc589868f9abfac/tomli-2.2.1-cp313-cp313-manylinux_2_5_i686.manylinux1_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:e85e99945e688e32d5a35c1ff38ed0b3f41f43fad8df0bdf79f72b2ba7bc5272", size = 251170, upload-time = "2024-11-27T22:38:27.921Z" }, + { url = "https://files.pythonhosted.org/packages/64/7b/22d713946efe00e0adbcdfd6d1aa119ae03fd0b60ebed51ebb3fa9f5a2e5/tomli-2.2.1-cp313-cp313-musllinux_1_2_aarch64.whl", hash = "sha256:ac065718db92ca818f8d6141b5f66369833d4a80a9d74435a268c52bdfa73140", size = 236530, upload-time = "2024-11-27T22:38:29.591Z" }, + { url = "https://files.pythonhosted.org/packages/38/31/3a76f67da4b0cf37b742ca76beaf819dca0ebef26d78fc794a576e08accf/tomli-2.2.1-cp313-cp313-musllinux_1_2_i686.whl", hash = "sha256:d920f33822747519673ee656a4b6ac33e382eca9d331c87770faa3eef562aeb2", size = 258666, upload-time = "2024-11-27T22:38:30.639Z" }, + { url = "https://files.pythonhosted.org/packages/07/10/5af1293da642aded87e8a988753945d0cf7e00a9452d3911dd3bb354c9e2/tomli-2.2.1-cp313-cp313-musllinux_1_2_x86_64.whl", hash = "sha256:a198f10c4d1b1375d7687bc25294306e551bf1abfa4eace6650070a5c1ae2744", size = 243954, upload-time = "2024-11-27T22:38:31.702Z" }, + { url = "https://files.pythonhosted.org/packages/5b/b9/1ed31d167be802da0fc95020d04cd27b7d7065cc6fbefdd2f9186f60d7bd/tomli-2.2.1-cp313-cp313-win32.whl", hash = "sha256:d3f5614314d758649ab2ab3a62d4f2004c825922f9e370b29416484086b264ec", size = 98724, upload-time = "2024-11-27T22:38:32.837Z" }, + { url = "https://files.pythonhosted.org/packages/c7/32/b0963458706accd9afcfeb867c0f9175a741bf7b19cd424230714d722198/tomli-2.2.1-cp313-cp313-win_amd64.whl", hash = "sha256:a38aa0308e754b0e3c67e344754dff64999ff9b513e691d0e786265c93583c69", size = 109383, upload-time = "2024-11-27T22:38:34.455Z" }, + { url = "https://files.pythonhosted.org/packages/6e/c2/61d3e0f47e2b74ef40a68b9e6ad5984f6241a942f7cd3bbfbdbd03861ea9/tomli-2.2.1-py3-none-any.whl", hash = "sha256:cb55c73c5f4408779d0cf3eef9f762b9c9f147a77de7b258bef0a5628adc85cc", size = 14257, upload-time = "2024-11-27T22:38:35.385Z" }, ] [[package]] name = "toposort" version = "1.10" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/69/19/8e955d90985ecbd3b9adb2a759753a6840da2dff3c569d412b2c9217678b/toposort-1.10.tar.gz", hash = "sha256:bfbb479c53d0a696ea7402601f4e693c97b0367837c8898bc6471adfca37a6bd", size = 11132 } +sdist = { url = "https://files.pythonhosted.org/packages/69/19/8e955d90985ecbd3b9adb2a759753a6840da2dff3c569d412b2c9217678b/toposort-1.10.tar.gz", hash = "sha256:bfbb479c53d0a696ea7402601f4e693c97b0367837c8898bc6471adfca37a6bd", size = 11132, upload-time = "2023-02-27T13:59:51.834Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/f6/17/57b444fd314d5e1593350b9a31d000e7411ba8e17ce12dc7ad54ca76b810/toposort-1.10-py3-none-any.whl", hash = "sha256:cbdbc0d0bee4d2695ab2ceec97fe0679e9c10eab4b2a87a9372b929e70563a87", size = 8500 }, + { url = "https://files.pythonhosted.org/packages/f6/17/57b444fd314d5e1593350b9a31d000e7411ba8e17ce12dc7ad54ca76b810/toposort-1.10-py3-none-any.whl", hash = "sha256:cbdbc0d0bee4d2695ab2ceec97fe0679e9c10eab4b2a87a9372b929e70563a87", size = 8500, upload-time = "2023-02-25T20:07:06.538Z" }, ] [[package]] name = "traitlets" version = "5.14.3" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/eb/79/72064e6a701c2183016abbbfedaba506d81e30e232a68c9f0d6f6fcd1574/traitlets-5.14.3.tar.gz", hash = "sha256:9ed0579d3502c94b4b3732ac120375cda96f923114522847de4b3bb98b96b6b7", size = 161621 } +sdist = { url = "https://files.pythonhosted.org/packages/eb/79/72064e6a701c2183016abbbfedaba506d81e30e232a68c9f0d6f6fcd1574/traitlets-5.14.3.tar.gz", hash = "sha256:9ed0579d3502c94b4b3732ac120375cda96f923114522847de4b3bb98b96b6b7", size = 161621, upload-time = "2024-04-19T11:11:49.746Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/00/c0/8f5d070730d7836adc9c9b6408dec68c6ced86b304a9b26a14df072a6e8c/traitlets-5.14.3-py3-none-any.whl", hash = "sha256:b74e89e397b1ed28cc831db7aea759ba6640cb3de13090ca145426688ff1ac4f", size = 85359 }, + { url = "https://files.pythonhosted.org/packages/00/c0/8f5d070730d7836adc9c9b6408dec68c6ced86b304a9b26a14df072a6e8c/traitlets-5.14.3-py3-none-any.whl", hash = "sha256:b74e89e397b1ed28cc831db7aea759ba6640cb3de13090ca145426688ff1ac4f", size = 85359, upload-time = "2024-04-19T11:11:46.763Z" }, ] [[package]] name = "typing-extensions" version = "4.14.0" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/d1/bc/51647cd02527e87d05cb083ccc402f93e441606ff1f01739a62c8ad09ba5/typing_extensions-4.14.0.tar.gz", hash = "sha256:8676b788e32f02ab42d9e7c61324048ae4c6d844a399eebace3d4979d75ceef4", size = 107423 } +sdist = { url = "https://files.pythonhosted.org/packages/d1/bc/51647cd02527e87d05cb083ccc402f93e441606ff1f01739a62c8ad09ba5/typing_extensions-4.14.0.tar.gz", hash = "sha256:8676b788e32f02ab42d9e7c61324048ae4c6d844a399eebace3d4979d75ceef4", size = 107423, upload-time = "2025-06-02T14:52:11.399Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/69/e0/552843e0d356fbb5256d21449fa957fa4eff3bbc135a74a691ee70c7c5da/typing_extensions-4.14.0-py3-none-any.whl", hash = "sha256:a1514509136dd0b477638fc68d6a91497af5076466ad0fa6c338e44e359944af", size = 43839 }, + { url = "https://files.pythonhosted.org/packages/69/e0/552843e0d356fbb5256d21449fa957fa4eff3bbc135a74a691ee70c7c5da/typing_extensions-4.14.0-py3-none-any.whl", hash = "sha256:a1514509136dd0b477638fc68d6a91497af5076466ad0fa6c338e44e359944af", size = 43839, upload-time = "2025-06-02T14:52:10.026Z" }, ] [[package]] @@ -2313,9 +2339,9 @@ dependencies = [ { name = "mypy-extensions" }, { name = "typing-extensions" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/dc/74/1789779d91f1961fa9438e9a8710cdae6bd138c80d7303996933d117264a/typing_inspect-0.9.0.tar.gz", hash = "sha256:b23fc42ff6f6ef6954e4852c1fb512cdd18dbea03134f91f856a95ccc9461f78", size = 13825 } +sdist = { url = "https://files.pythonhosted.org/packages/dc/74/1789779d91f1961fa9438e9a8710cdae6bd138c80d7303996933d117264a/typing_inspect-0.9.0.tar.gz", hash = "sha256:b23fc42ff6f6ef6954e4852c1fb512cdd18dbea03134f91f856a95ccc9461f78", size = 13825, upload-time = "2023-05-24T20:25:47.612Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/65/f3/107a22063bf27bdccf2024833d3445f4eea42b2e598abfbd46f6a63b6cb0/typing_inspect-0.9.0-py3-none-any.whl", hash = "sha256:9ee6fc59062311ef8547596ab6b955e1b8aa46242d854bfc78f4f6b0eff35f9f", size = 8827 }, + { url = "https://files.pythonhosted.org/packages/65/f3/107a22063bf27bdccf2024833d3445f4eea42b2e598abfbd46f6a63b6cb0/typing_inspect-0.9.0-py3-none-any.whl", hash = "sha256:9ee6fc59062311ef8547596ab6b955e1b8aa46242d854bfc78f4f6b0eff35f9f", size = 8827, upload-time = "2023-05-24T20:25:45.287Z" }, ] [[package]] @@ -2325,27 +2351,27 @@ source = { registry = "https://pypi.org/simple" } dependencies = [ { name = "typing-extensions" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/f8/b1/0c11f5058406b3af7609f121aaa6b609744687f1d158b3c3a5bf4cc94238/typing_inspection-0.4.1.tar.gz", hash = "sha256:6ae134cc0203c33377d43188d4064e9b357dba58cff3185f22924610e70a9d28", size = 75726 } +sdist = { url = "https://files.pythonhosted.org/packages/f8/b1/0c11f5058406b3af7609f121aaa6b609744687f1d158b3c3a5bf4cc94238/typing_inspection-0.4.1.tar.gz", hash = "sha256:6ae134cc0203c33377d43188d4064e9b357dba58cff3185f22924610e70a9d28", size = 75726, upload-time = "2025-05-21T18:55:23.885Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/17/69/cd203477f944c353c31bade965f880aa1061fd6bf05ded0726ca845b6ff7/typing_inspection-0.4.1-py3-none-any.whl", hash = "sha256:389055682238f53b04f7badcb49b989835495a96700ced5dab2d8feae4b26f51", size = 14552 }, + { url = "https://files.pythonhosted.org/packages/17/69/cd203477f944c353c31bade965f880aa1061fd6bf05ded0726ca845b6ff7/typing_inspection-0.4.1-py3-none-any.whl", hash = "sha256:389055682238f53b04f7badcb49b989835495a96700ced5dab2d8feae4b26f51", size = 14552, upload-time = "2025-05-21T18:55:22.152Z" }, ] [[package]] name = "uc-micro-py" version = "1.0.3" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/91/7a/146a99696aee0609e3712f2b44c6274566bc368dfe8375191278045186b8/uc-micro-py-1.0.3.tar.gz", hash = "sha256:d321b92cff673ec58027c04015fcaa8bb1e005478643ff4a500882eaab88c48a", size = 6043 } +sdist = { url = "https://files.pythonhosted.org/packages/91/7a/146a99696aee0609e3712f2b44c6274566bc368dfe8375191278045186b8/uc-micro-py-1.0.3.tar.gz", hash = "sha256:d321b92cff673ec58027c04015fcaa8bb1e005478643ff4a500882eaab88c48a", size = 6043, upload-time = "2024-02-09T16:52:01.654Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/37/87/1f677586e8ac487e29672e4b17455758fce261de06a0d086167bb760361a/uc_micro_py-1.0.3-py3-none-any.whl", hash = "sha256:db1dffff340817673d7b466ec86114a9dc0e9d4d9b5ba229d9d60e5c12600cd5", size = 6229 }, + { url = "https://files.pythonhosted.org/packages/37/87/1f677586e8ac487e29672e4b17455758fce261de06a0d086167bb760361a/uc_micro_py-1.0.3-py3-none-any.whl", hash = "sha256:db1dffff340817673d7b466ec86114a9dc0e9d4d9b5ba229d9d60e5c12600cd5", size = 6229, upload-time = "2024-02-09T16:52:00.371Z" }, ] [[package]] name = "urllib3" version = "2.4.0" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/8a/78/16493d9c386d8e60e442a35feac5e00f0913c0f4b7c217c11e8ec2ff53e0/urllib3-2.4.0.tar.gz", hash = "sha256:414bc6535b787febd7567804cc015fee39daab8ad86268f1310a9250697de466", size = 390672 } +sdist = { url = "https://files.pythonhosted.org/packages/8a/78/16493d9c386d8e60e442a35feac5e00f0913c0f4b7c217c11e8ec2ff53e0/urllib3-2.4.0.tar.gz", hash = "sha256:414bc6535b787febd7567804cc015fee39daab8ad86268f1310a9250697de466", size = 390672, upload-time = "2025-04-10T15:23:39.232Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/6b/11/cc635220681e93a0183390e26485430ca2c7b5f9d33b15c74c2861cb8091/urllib3-2.4.0-py3-none-any.whl", hash = "sha256:4e16665048960a0900c702d4a66415956a584919c03361cac9f1df5c5dd7e813", size = 128680 }, + { url = "https://files.pythonhosted.org/packages/6b/11/cc635220681e93a0183390e26485430ca2c7b5f9d33b15c74c2861cb8091/urllib3-2.4.0-py3-none-any.whl", hash = "sha256:4e16665048960a0900c702d4a66415956a584919c03361cac9f1df5c5dd7e813", size = 128680, upload-time = "2025-04-10T15:23:37.377Z" }, ] [[package]] @@ -2357,9 +2383,9 @@ dependencies = [ { name = "h11" }, { name = "typing-extensions", marker = "python_full_version < '3.11'" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/de/ad/713be230bcda622eaa35c28f0d328c3675c371238470abdea52417f17a8e/uvicorn-0.34.3.tar.gz", hash = "sha256:35919a9a979d7a59334b6b10e05d77c1d0d574c50e0fc98b8b1a0f165708b55a", size = 76631 } +sdist = { url = "https://files.pythonhosted.org/packages/de/ad/713be230bcda622eaa35c28f0d328c3675c371238470abdea52417f17a8e/uvicorn-0.34.3.tar.gz", hash = "sha256:35919a9a979d7a59334b6b10e05d77c1d0d574c50e0fc98b8b1a0f165708b55a", size = 76631, upload-time = "2025-06-01T07:48:17.531Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/6d/0d/8adfeaa62945f90d19ddc461c55f4a50c258af7662d34b6a3d5d1f8646f6/uvicorn-0.34.3-py3-none-any.whl", hash = "sha256:16246631db62bdfbf069b0645177d6e8a77ba950cfedbfd093acef9444e4d885", size = 62431 }, + { url = "https://files.pythonhosted.org/packages/6d/0d/8adfeaa62945f90d19ddc461c55f4a50c258af7662d34b6a3d5d1f8646f6/uvicorn-0.34.3-py3-none-any.whl", hash = "sha256:16246631db62bdfbf069b0645177d6e8a77ba950cfedbfd093acef9444e4d885", size = 62431, upload-time = "2025-06-01T07:48:15.664Z" }, ] [[package]] @@ -2369,62 +2395,62 @@ source = { registry = "https://pypi.org/simple" } dependencies = [ { name = "anyio" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/03/e2/8ed598c42057de7aa5d97c472254af4906ff0a59a66699d426fc9ef795d7/watchfiles-1.0.5.tar.gz", hash = "sha256:b7529b5dcc114679d43827d8c35a07c493ad6f083633d573d81c660abc5979e9", size = 94537 } -wheels = [ - { url = "https://files.pythonhosted.org/packages/af/4d/d02e6ea147bb7fff5fd109c694a95109612f419abed46548a930e7f7afa3/watchfiles-1.0.5-cp310-cp310-macosx_10_12_x86_64.whl", hash = "sha256:5c40fe7dd9e5f81e0847b1ea64e1f5dd79dd61afbedb57759df06767ac719b40", size = 405632 }, - { url = "https://files.pythonhosted.org/packages/60/31/9ee50e29129d53a9a92ccf1d3992751dc56fc3c8f6ee721be1c7b9c81763/watchfiles-1.0.5-cp310-cp310-macosx_11_0_arm64.whl", hash = "sha256:8c0db396e6003d99bb2d7232c957b5f0b5634bbd1b24e381a5afcc880f7373fb", size = 395734 }, - { url = "https://files.pythonhosted.org/packages/ad/8c/759176c97195306f028024f878e7f1c776bda66ccc5c68fa51e699cf8f1d/watchfiles-1.0.5-cp310-cp310-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:b551d4fb482fc57d852b4541f911ba28957d051c8776e79c3b4a51eb5e2a1b11", size = 455008 }, - { url = "https://files.pythonhosted.org/packages/55/1a/5e977250c795ee79a0229e3b7f5e3a1b664e4e450756a22da84d2f4979fe/watchfiles-1.0.5-cp310-cp310-manylinux_2_17_armv7l.manylinux2014_armv7l.whl", hash = "sha256:830aa432ba5c491d52a15b51526c29e4a4b92bf4f92253787f9726fe01519487", size = 459029 }, - { url = "https://files.pythonhosted.org/packages/e6/17/884cf039333605c1d6e296cf5be35fad0836953c3dfd2adb71b72f9dbcd0/watchfiles-1.0.5-cp310-cp310-manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:a16512051a822a416b0d477d5f8c0e67b67c1a20d9acecb0aafa3aa4d6e7d256", size = 488916 }, - { url = "https://files.pythonhosted.org/packages/ef/e0/bcb6e64b45837056c0a40f3a2db3ef51c2ced19fda38484fa7508e00632c/watchfiles-1.0.5-cp310-cp310-manylinux_2_17_ppc64le.manylinux2014_ppc64le.whl", hash = "sha256:bfe0cbc787770e52a96c6fda6726ace75be7f840cb327e1b08d7d54eadc3bc85", size = 523763 }, - { url = "https://files.pythonhosted.org/packages/24/e9/f67e9199f3bb35c1837447ecf07e9830ec00ff5d35a61e08c2cd67217949/watchfiles-1.0.5-cp310-cp310-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:d363152c5e16b29d66cbde8fa614f9e313e6f94a8204eaab268db52231fe5358", size = 502891 }, - { url = "https://files.pythonhosted.org/packages/23/ed/a6cf815f215632f5c8065e9c41fe872025ffea35aa1f80499f86eae922db/watchfiles-1.0.5-cp310-cp310-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:7ee32c9a9bee4d0b7bd7cbeb53cb185cf0b622ac761efaa2eba84006c3b3a614", size = 454921 }, - { url = "https://files.pythonhosted.org/packages/92/4c/e14978599b80cde8486ab5a77a821e8a982ae8e2fcb22af7b0886a033ec8/watchfiles-1.0.5-cp310-cp310-musllinux_1_1_aarch64.whl", hash = "sha256:29c7fd632ccaf5517c16a5188e36f6612d6472ccf55382db6c7fe3fcccb7f59f", size = 631422 }, - { url = "https://files.pythonhosted.org/packages/b2/1a/9263e34c3458f7614b657f974f4ee61fd72f58adce8b436e16450e054efd/watchfiles-1.0.5-cp310-cp310-musllinux_1_1_x86_64.whl", hash = "sha256:8e637810586e6fe380c8bc1b3910accd7f1d3a9a7262c8a78d4c8fb3ba6a2b3d", size = 625675 }, - { url = "https://files.pythonhosted.org/packages/96/1f/1803a18bd6ab04a0766386a19bcfe64641381a04939efdaa95f0e3b0eb58/watchfiles-1.0.5-cp310-cp310-win32.whl", hash = "sha256:cd47d063fbeabd4c6cae1d4bcaa38f0902f8dc5ed168072874ea11d0c7afc1ff", size = 277921 }, - { url = "https://files.pythonhosted.org/packages/c2/3b/29a89de074a7d6e8b4dc67c26e03d73313e4ecf0d6e97e942a65fa7c195e/watchfiles-1.0.5-cp310-cp310-win_amd64.whl", hash = "sha256:86c0df05b47a79d80351cd179893f2f9c1b1cae49d96e8b3290c7f4bd0ca0a92", size = 291526 }, - { url = "https://files.pythonhosted.org/packages/39/f4/41b591f59021786ef517e1cdc3b510383551846703e03f204827854a96f8/watchfiles-1.0.5-cp311-cp311-macosx_10_12_x86_64.whl", hash = "sha256:237f9be419e977a0f8f6b2e7b0475ababe78ff1ab06822df95d914a945eac827", size = 405336 }, - { url = "https://files.pythonhosted.org/packages/ae/06/93789c135be4d6d0e4f63e96eea56dc54050b243eacc28439a26482b5235/watchfiles-1.0.5-cp311-cp311-macosx_11_0_arm64.whl", hash = "sha256:e0da39ff917af8b27a4bdc5a97ac577552a38aac0d260a859c1517ea3dc1a7c4", size = 395977 }, - { url = "https://files.pythonhosted.org/packages/d2/db/1cd89bd83728ca37054512d4d35ab69b5f12b8aa2ac9be3b0276b3bf06cc/watchfiles-1.0.5-cp311-cp311-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:2cfcb3952350e95603f232a7a15f6c5f86c5375e46f0bd4ae70d43e3e063c13d", size = 455232 }, - { url = "https://files.pythonhosted.org/packages/40/90/d8a4d44ffe960517e487c9c04f77b06b8abf05eb680bed71c82b5f2cad62/watchfiles-1.0.5-cp311-cp311-manylinux_2_17_armv7l.manylinux2014_armv7l.whl", hash = "sha256:68b2dddba7a4e6151384e252a5632efcaa9bc5d1c4b567f3cb621306b2ca9f63", size = 459151 }, - { url = "https://files.pythonhosted.org/packages/6c/da/267a1546f26465dead1719caaba3ce660657f83c9d9c052ba98fb8856e13/watchfiles-1.0.5-cp311-cp311-manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:95cf944fcfc394c5f9de794ce581914900f82ff1f855326f25ebcf24d5397418", size = 489054 }, - { url = "https://files.pythonhosted.org/packages/b1/31/33850dfd5c6efb6f27d2465cc4c6b27c5a6f5ed53c6fa63b7263cf5f60f6/watchfiles-1.0.5-cp311-cp311-manylinux_2_17_ppc64le.manylinux2014_ppc64le.whl", hash = "sha256:ecf6cd9f83d7c023b1aba15d13f705ca7b7d38675c121f3cc4a6e25bd0857ee9", size = 523955 }, - { url = "https://files.pythonhosted.org/packages/09/84/b7d7b67856efb183a421f1416b44ca975cb2ea6c4544827955dfb01f7dc2/watchfiles-1.0.5-cp311-cp311-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:852de68acd6212cd6d33edf21e6f9e56e5d98c6add46f48244bd479d97c967c6", size = 502234 }, - { url = "https://files.pythonhosted.org/packages/71/87/6dc5ec6882a2254cfdd8b0718b684504e737273903b65d7338efaba08b52/watchfiles-1.0.5-cp311-cp311-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:d5730f3aa35e646103b53389d5bc77edfbf578ab6dab2e005142b5b80a35ef25", size = 454750 }, - { url = "https://files.pythonhosted.org/packages/3d/6c/3786c50213451a0ad15170d091570d4a6554976cf0df19878002fc96075a/watchfiles-1.0.5-cp311-cp311-musllinux_1_1_aarch64.whl", hash = "sha256:18b3bd29954bc4abeeb4e9d9cf0b30227f0f206c86657674f544cb032296acd5", size = 631591 }, - { url = "https://files.pythonhosted.org/packages/1b/b3/1427425ade4e359a0deacce01a47a26024b2ccdb53098f9d64d497f6684c/watchfiles-1.0.5-cp311-cp311-musllinux_1_1_x86_64.whl", hash = "sha256:ba5552a1b07c8edbf197055bc9d518b8f0d98a1c6a73a293bc0726dce068ed01", size = 625370 }, - { url = "https://files.pythonhosted.org/packages/15/ba/f60e053b0b5b8145d682672024aa91370a29c5c921a88977eb565de34086/watchfiles-1.0.5-cp311-cp311-win32.whl", hash = "sha256:2f1fefb2e90e89959447bc0420fddd1e76f625784340d64a2f7d5983ef9ad246", size = 277791 }, - { url = "https://files.pythonhosted.org/packages/50/ed/7603c4e164225c12c0d4e8700b64bb00e01a6c4eeea372292a3856be33a4/watchfiles-1.0.5-cp311-cp311-win_amd64.whl", hash = "sha256:b6e76ceb1dd18c8e29c73f47d41866972e891fc4cc7ba014f487def72c1cf096", size = 291622 }, - { url = "https://files.pythonhosted.org/packages/a2/c2/99bb7c96b4450e36877fde33690ded286ff555b5a5c1d925855d556968a1/watchfiles-1.0.5-cp311-cp311-win_arm64.whl", hash = "sha256:266710eb6fddc1f5e51843c70e3bebfb0f5e77cf4f27129278c70554104d19ed", size = 283699 }, - { url = "https://files.pythonhosted.org/packages/2a/8c/4f0b9bdb75a1bfbd9c78fad7d8854369283f74fe7cf03eb16be77054536d/watchfiles-1.0.5-cp312-cp312-macosx_10_12_x86_64.whl", hash = "sha256:b5eb568c2aa6018e26da9e6c86f3ec3fd958cee7f0311b35c2630fa4217d17f2", size = 401511 }, - { url = "https://files.pythonhosted.org/packages/dc/4e/7e15825def77f8bd359b6d3f379f0c9dac4eb09dd4ddd58fd7d14127179c/watchfiles-1.0.5-cp312-cp312-macosx_11_0_arm64.whl", hash = "sha256:0a04059f4923ce4e856b4b4e5e783a70f49d9663d22a4c3b3298165996d1377f", size = 392715 }, - { url = "https://files.pythonhosted.org/packages/58/65/b72fb817518728e08de5840d5d38571466c1b4a3f724d190cec909ee6f3f/watchfiles-1.0.5-cp312-cp312-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:3e380c89983ce6e6fe2dd1e1921b9952fb4e6da882931abd1824c092ed495dec", size = 454138 }, - { url = "https://files.pythonhosted.org/packages/3e/a4/86833fd2ea2e50ae28989f5950b5c3f91022d67092bfec08f8300d8b347b/watchfiles-1.0.5-cp312-cp312-manylinux_2_17_armv7l.manylinux2014_armv7l.whl", hash = "sha256:fe43139b2c0fdc4a14d4f8d5b5d967f7a2777fd3d38ecf5b1ec669b0d7e43c21", size = 458592 }, - { url = "https://files.pythonhosted.org/packages/38/7e/42cb8df8be9a37e50dd3a818816501cf7a20d635d76d6bd65aae3dbbff68/watchfiles-1.0.5-cp312-cp312-manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:ee0822ce1b8a14fe5a066f93edd20aada932acfe348bede8aa2149f1a4489512", size = 487532 }, - { url = "https://files.pythonhosted.org/packages/fc/fd/13d26721c85d7f3df6169d8b495fcac8ab0dc8f0945ebea8845de4681dab/watchfiles-1.0.5-cp312-cp312-manylinux_2_17_ppc64le.manylinux2014_ppc64le.whl", hash = "sha256:a0dbcb1c2d8f2ab6e0a81c6699b236932bd264d4cef1ac475858d16c403de74d", size = 522865 }, - { url = "https://files.pythonhosted.org/packages/a1/0d/7f9ae243c04e96c5455d111e21b09087d0eeaf9a1369e13a01c7d3d82478/watchfiles-1.0.5-cp312-cp312-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:a2014a2b18ad3ca53b1f6c23f8cd94a18ce930c1837bd891262c182640eb40a6", size = 499887 }, - { url = "https://files.pythonhosted.org/packages/8e/0f/a257766998e26aca4b3acf2ae97dff04b57071e991a510857d3799247c67/watchfiles-1.0.5-cp312-cp312-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:10f6ae86d5cb647bf58f9f655fcf577f713915a5d69057a0371bc257e2553234", size = 454498 }, - { url = "https://files.pythonhosted.org/packages/81/79/8bf142575a03e0af9c3d5f8bcae911ee6683ae93a625d349d4ecf4c8f7df/watchfiles-1.0.5-cp312-cp312-musllinux_1_1_aarch64.whl", hash = "sha256:1a7bac2bde1d661fb31f4d4e8e539e178774b76db3c2c17c4bb3e960a5de07a2", size = 630663 }, - { url = "https://files.pythonhosted.org/packages/f1/80/abe2e79f610e45c63a70d271caea90c49bbf93eb00fa947fa9b803a1d51f/watchfiles-1.0.5-cp312-cp312-musllinux_1_1_x86_64.whl", hash = "sha256:4ab626da2fc1ac277bbf752446470b367f84b50295264d2d313e28dc4405d663", size = 625410 }, - { url = "https://files.pythonhosted.org/packages/91/6f/bc7fbecb84a41a9069c2c6eb6319f7f7df113adf113e358c57fc1aff7ff5/watchfiles-1.0.5-cp312-cp312-win32.whl", hash = "sha256:9f4571a783914feda92018ef3901dab8caf5b029325b5fe4558c074582815249", size = 277965 }, - { url = "https://files.pythonhosted.org/packages/99/a5/bf1c297ea6649ec59e935ab311f63d8af5faa8f0b86993e3282b984263e3/watchfiles-1.0.5-cp312-cp312-win_amd64.whl", hash = "sha256:360a398c3a19672cf93527f7e8d8b60d8275119c5d900f2e184d32483117a705", size = 291693 }, - { url = "https://files.pythonhosted.org/packages/7f/7b/fd01087cc21db5c47e5beae507b87965db341cce8a86f9eb12bf5219d4e0/watchfiles-1.0.5-cp312-cp312-win_arm64.whl", hash = "sha256:1a2902ede862969077b97523987c38db28abbe09fb19866e711485d9fbf0d417", size = 283287 }, - { url = "https://files.pythonhosted.org/packages/c7/62/435766874b704f39b2fecd8395a29042db2b5ec4005bd34523415e9bd2e0/watchfiles-1.0.5-cp313-cp313-macosx_10_12_x86_64.whl", hash = "sha256:0b289572c33a0deae62daa57e44a25b99b783e5f7aed81b314232b3d3c81a11d", size = 401531 }, - { url = "https://files.pythonhosted.org/packages/6e/a6/e52a02c05411b9cb02823e6797ef9bbba0bfaf1bb627da1634d44d8af833/watchfiles-1.0.5-cp313-cp313-macosx_11_0_arm64.whl", hash = "sha256:a056c2f692d65bf1e99c41045e3bdcaea3cb9e6b5a53dcaf60a5f3bd95fc9763", size = 392417 }, - { url = "https://files.pythonhosted.org/packages/3f/53/c4af6819770455932144e0109d4854437769672d7ad897e76e8e1673435d/watchfiles-1.0.5-cp313-cp313-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:b9dca99744991fc9850d18015c4f0438865414e50069670f5f7eee08340d8b40", size = 453423 }, - { url = "https://files.pythonhosted.org/packages/cb/d1/8e88df58bbbf819b8bc5cfbacd3c79e01b40261cad0fc84d1e1ebd778a07/watchfiles-1.0.5-cp313-cp313-manylinux_2_17_armv7l.manylinux2014_armv7l.whl", hash = "sha256:894342d61d355446d02cd3988a7326af344143eb33a2fd5d38482a92072d9563", size = 458185 }, - { url = "https://files.pythonhosted.org/packages/ff/70/fffaa11962dd5429e47e478a18736d4e42bec42404f5ee3b92ef1b87ad60/watchfiles-1.0.5-cp313-cp313-manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:ab44e1580924d1ffd7b3938e02716d5ad190441965138b4aa1d1f31ea0877f04", size = 486696 }, - { url = "https://files.pythonhosted.org/packages/39/db/723c0328e8b3692d53eb273797d9a08be6ffb1d16f1c0ba2bdbdc2a3852c/watchfiles-1.0.5-cp313-cp313-manylinux_2_17_ppc64le.manylinux2014_ppc64le.whl", hash = "sha256:d6f9367b132078b2ceb8d066ff6c93a970a18c3029cea37bfd7b2d3dd2e5db8f", size = 522327 }, - { url = "https://files.pythonhosted.org/packages/cd/05/9fccc43c50c39a76b68343484b9da7b12d42d0859c37c61aec018c967a32/watchfiles-1.0.5-cp313-cp313-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:f2e55a9b162e06e3f862fb61e399fe9f05d908d019d87bf5b496a04ef18a970a", size = 499741 }, - { url = "https://files.pythonhosted.org/packages/23/14/499e90c37fa518976782b10a18b18db9f55ea73ca14641615056f8194bb3/watchfiles-1.0.5-cp313-cp313-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:0125f91f70e0732a9f8ee01e49515c35d38ba48db507a50c5bdcad9503af5827", size = 453995 }, - { url = "https://files.pythonhosted.org/packages/61/d9/f75d6840059320df5adecd2c687fbc18960a7f97b55c300d20f207d48aef/watchfiles-1.0.5-cp313-cp313-musllinux_1_1_aarch64.whl", hash = "sha256:13bb21f8ba3248386337c9fa51c528868e6c34a707f729ab041c846d52a0c69a", size = 629693 }, - { url = "https://files.pythonhosted.org/packages/fc/17/180ca383f5061b61406477218c55d66ec118e6c0c51f02d8142895fcf0a9/watchfiles-1.0.5-cp313-cp313-musllinux_1_1_x86_64.whl", hash = "sha256:839ebd0df4a18c5b3c1b890145b5a3f5f64063c2a0d02b13c76d78fe5de34936", size = 624677 }, - { url = "https://files.pythonhosted.org/packages/bf/15/714d6ef307f803f236d69ee9d421763707899d6298d9f3183e55e366d9af/watchfiles-1.0.5-cp313-cp313-win32.whl", hash = "sha256:4a8ec1e4e16e2d5bafc9ba82f7aaecfeec990ca7cd27e84fb6f191804ed2fcfc", size = 277804 }, - { url = "https://files.pythonhosted.org/packages/a8/b4/c57b99518fadf431f3ef47a610839e46e5f8abf9814f969859d1c65c02c7/watchfiles-1.0.5-cp313-cp313-win_amd64.whl", hash = "sha256:f436601594f15bf406518af922a89dcaab416568edb6f65c4e5bbbad1ea45c11", size = 291087 }, - { url = "https://files.pythonhosted.org/packages/1a/03/81f9fcc3963b3fc415cd4b0b2b39ee8cc136c42fb10a36acf38745e9d283/watchfiles-1.0.5-pp310-pypy310_pp73-macosx_10_12_x86_64.whl", hash = "sha256:f59b870db1f1ae5a9ac28245707d955c8721dd6565e7f411024fa374b5362d1d", size = 405947 }, - { url = "https://files.pythonhosted.org/packages/54/97/8c4213a852feb64807ec1d380f42d4fc8bfaef896bdbd94318f8fd7f3e4e/watchfiles-1.0.5-pp310-pypy310_pp73-macosx_11_0_arm64.whl", hash = "sha256:9475b0093767e1475095f2aeb1d219fb9664081d403d1dff81342df8cd707034", size = 397276 }, - { url = "https://files.pythonhosted.org/packages/78/12/d4464d19860cb9672efa45eec1b08f8472c478ed67dcd30647c51ada7aef/watchfiles-1.0.5-pp310-pypy310_pp73-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:fc533aa50664ebd6c628b2f30591956519462f5d27f951ed03d6c82b2dfd9965", size = 455550 }, - { url = "https://files.pythonhosted.org/packages/90/fb/b07bcdf1034d8edeaef4c22f3e9e3157d37c5071b5f9492ffdfa4ad4bed7/watchfiles-1.0.5-pp310-pypy310_pp73-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:fed1cd825158dcaae36acce7b2db33dcbfd12b30c34317a88b8ed80f0541cc57", size = 455542 }, +sdist = { url = "https://files.pythonhosted.org/packages/03/e2/8ed598c42057de7aa5d97c472254af4906ff0a59a66699d426fc9ef795d7/watchfiles-1.0.5.tar.gz", hash = "sha256:b7529b5dcc114679d43827d8c35a07c493ad6f083633d573d81c660abc5979e9", size = 94537, upload-time = "2025-04-08T10:36:26.722Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/af/4d/d02e6ea147bb7fff5fd109c694a95109612f419abed46548a930e7f7afa3/watchfiles-1.0.5-cp310-cp310-macosx_10_12_x86_64.whl", hash = "sha256:5c40fe7dd9e5f81e0847b1ea64e1f5dd79dd61afbedb57759df06767ac719b40", size = 405632, upload-time = "2025-04-08T10:34:41.832Z" }, + { url = "https://files.pythonhosted.org/packages/60/31/9ee50e29129d53a9a92ccf1d3992751dc56fc3c8f6ee721be1c7b9c81763/watchfiles-1.0.5-cp310-cp310-macosx_11_0_arm64.whl", hash = "sha256:8c0db396e6003d99bb2d7232c957b5f0b5634bbd1b24e381a5afcc880f7373fb", size = 395734, upload-time = "2025-04-08T10:34:44.236Z" }, + { url = "https://files.pythonhosted.org/packages/ad/8c/759176c97195306f028024f878e7f1c776bda66ccc5c68fa51e699cf8f1d/watchfiles-1.0.5-cp310-cp310-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:b551d4fb482fc57d852b4541f911ba28957d051c8776e79c3b4a51eb5e2a1b11", size = 455008, upload-time = "2025-04-08T10:34:45.617Z" }, + { url = "https://files.pythonhosted.org/packages/55/1a/5e977250c795ee79a0229e3b7f5e3a1b664e4e450756a22da84d2f4979fe/watchfiles-1.0.5-cp310-cp310-manylinux_2_17_armv7l.manylinux2014_armv7l.whl", hash = "sha256:830aa432ba5c491d52a15b51526c29e4a4b92bf4f92253787f9726fe01519487", size = 459029, upload-time = "2025-04-08T10:34:46.814Z" }, + { url = "https://files.pythonhosted.org/packages/e6/17/884cf039333605c1d6e296cf5be35fad0836953c3dfd2adb71b72f9dbcd0/watchfiles-1.0.5-cp310-cp310-manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:a16512051a822a416b0d477d5f8c0e67b67c1a20d9acecb0aafa3aa4d6e7d256", size = 488916, upload-time = "2025-04-08T10:34:48.571Z" }, + { url = "https://files.pythonhosted.org/packages/ef/e0/bcb6e64b45837056c0a40f3a2db3ef51c2ced19fda38484fa7508e00632c/watchfiles-1.0.5-cp310-cp310-manylinux_2_17_ppc64le.manylinux2014_ppc64le.whl", hash = "sha256:bfe0cbc787770e52a96c6fda6726ace75be7f840cb327e1b08d7d54eadc3bc85", size = 523763, upload-time = "2025-04-08T10:34:50.268Z" }, + { url = "https://files.pythonhosted.org/packages/24/e9/f67e9199f3bb35c1837447ecf07e9830ec00ff5d35a61e08c2cd67217949/watchfiles-1.0.5-cp310-cp310-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:d363152c5e16b29d66cbde8fa614f9e313e6f94a8204eaab268db52231fe5358", size = 502891, upload-time = "2025-04-08T10:34:51.419Z" }, + { url = "https://files.pythonhosted.org/packages/23/ed/a6cf815f215632f5c8065e9c41fe872025ffea35aa1f80499f86eae922db/watchfiles-1.0.5-cp310-cp310-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:7ee32c9a9bee4d0b7bd7cbeb53cb185cf0b622ac761efaa2eba84006c3b3a614", size = 454921, upload-time = "2025-04-08T10:34:52.67Z" }, + { url = "https://files.pythonhosted.org/packages/92/4c/e14978599b80cde8486ab5a77a821e8a982ae8e2fcb22af7b0886a033ec8/watchfiles-1.0.5-cp310-cp310-musllinux_1_1_aarch64.whl", hash = "sha256:29c7fd632ccaf5517c16a5188e36f6612d6472ccf55382db6c7fe3fcccb7f59f", size = 631422, upload-time = "2025-04-08T10:34:53.985Z" }, + { url = "https://files.pythonhosted.org/packages/b2/1a/9263e34c3458f7614b657f974f4ee61fd72f58adce8b436e16450e054efd/watchfiles-1.0.5-cp310-cp310-musllinux_1_1_x86_64.whl", hash = "sha256:8e637810586e6fe380c8bc1b3910accd7f1d3a9a7262c8a78d4c8fb3ba6a2b3d", size = 625675, upload-time = "2025-04-08T10:34:55.173Z" }, + { url = "https://files.pythonhosted.org/packages/96/1f/1803a18bd6ab04a0766386a19bcfe64641381a04939efdaa95f0e3b0eb58/watchfiles-1.0.5-cp310-cp310-win32.whl", hash = "sha256:cd47d063fbeabd4c6cae1d4bcaa38f0902f8dc5ed168072874ea11d0c7afc1ff", size = 277921, upload-time = "2025-04-08T10:34:56.318Z" }, + { url = "https://files.pythonhosted.org/packages/c2/3b/29a89de074a7d6e8b4dc67c26e03d73313e4ecf0d6e97e942a65fa7c195e/watchfiles-1.0.5-cp310-cp310-win_amd64.whl", hash = "sha256:86c0df05b47a79d80351cd179893f2f9c1b1cae49d96e8b3290c7f4bd0ca0a92", size = 291526, upload-time = "2025-04-08T10:34:57.95Z" }, + { url = "https://files.pythonhosted.org/packages/39/f4/41b591f59021786ef517e1cdc3b510383551846703e03f204827854a96f8/watchfiles-1.0.5-cp311-cp311-macosx_10_12_x86_64.whl", hash = "sha256:237f9be419e977a0f8f6b2e7b0475ababe78ff1ab06822df95d914a945eac827", size = 405336, upload-time = "2025-04-08T10:34:59.359Z" }, + { url = "https://files.pythonhosted.org/packages/ae/06/93789c135be4d6d0e4f63e96eea56dc54050b243eacc28439a26482b5235/watchfiles-1.0.5-cp311-cp311-macosx_11_0_arm64.whl", hash = "sha256:e0da39ff917af8b27a4bdc5a97ac577552a38aac0d260a859c1517ea3dc1a7c4", size = 395977, upload-time = "2025-04-08T10:35:00.522Z" }, + { url = "https://files.pythonhosted.org/packages/d2/db/1cd89bd83728ca37054512d4d35ab69b5f12b8aa2ac9be3b0276b3bf06cc/watchfiles-1.0.5-cp311-cp311-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:2cfcb3952350e95603f232a7a15f6c5f86c5375e46f0bd4ae70d43e3e063c13d", size = 455232, upload-time = "2025-04-08T10:35:01.698Z" }, + { url = "https://files.pythonhosted.org/packages/40/90/d8a4d44ffe960517e487c9c04f77b06b8abf05eb680bed71c82b5f2cad62/watchfiles-1.0.5-cp311-cp311-manylinux_2_17_armv7l.manylinux2014_armv7l.whl", hash = "sha256:68b2dddba7a4e6151384e252a5632efcaa9bc5d1c4b567f3cb621306b2ca9f63", size = 459151, upload-time = "2025-04-08T10:35:03.358Z" }, + { url = "https://files.pythonhosted.org/packages/6c/da/267a1546f26465dead1719caaba3ce660657f83c9d9c052ba98fb8856e13/watchfiles-1.0.5-cp311-cp311-manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:95cf944fcfc394c5f9de794ce581914900f82ff1f855326f25ebcf24d5397418", size = 489054, upload-time = "2025-04-08T10:35:04.561Z" }, + { url = "https://files.pythonhosted.org/packages/b1/31/33850dfd5c6efb6f27d2465cc4c6b27c5a6f5ed53c6fa63b7263cf5f60f6/watchfiles-1.0.5-cp311-cp311-manylinux_2_17_ppc64le.manylinux2014_ppc64le.whl", hash = "sha256:ecf6cd9f83d7c023b1aba15d13f705ca7b7d38675c121f3cc4a6e25bd0857ee9", size = 523955, upload-time = "2025-04-08T10:35:05.786Z" }, + { url = "https://files.pythonhosted.org/packages/09/84/b7d7b67856efb183a421f1416b44ca975cb2ea6c4544827955dfb01f7dc2/watchfiles-1.0.5-cp311-cp311-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:852de68acd6212cd6d33edf21e6f9e56e5d98c6add46f48244bd479d97c967c6", size = 502234, upload-time = "2025-04-08T10:35:07.187Z" }, + { url = "https://files.pythonhosted.org/packages/71/87/6dc5ec6882a2254cfdd8b0718b684504e737273903b65d7338efaba08b52/watchfiles-1.0.5-cp311-cp311-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:d5730f3aa35e646103b53389d5bc77edfbf578ab6dab2e005142b5b80a35ef25", size = 454750, upload-time = "2025-04-08T10:35:08.859Z" }, + { url = "https://files.pythonhosted.org/packages/3d/6c/3786c50213451a0ad15170d091570d4a6554976cf0df19878002fc96075a/watchfiles-1.0.5-cp311-cp311-musllinux_1_1_aarch64.whl", hash = "sha256:18b3bd29954bc4abeeb4e9d9cf0b30227f0f206c86657674f544cb032296acd5", size = 631591, upload-time = "2025-04-08T10:35:10.64Z" }, + { url = "https://files.pythonhosted.org/packages/1b/b3/1427425ade4e359a0deacce01a47a26024b2ccdb53098f9d64d497f6684c/watchfiles-1.0.5-cp311-cp311-musllinux_1_1_x86_64.whl", hash = "sha256:ba5552a1b07c8edbf197055bc9d518b8f0d98a1c6a73a293bc0726dce068ed01", size = 625370, upload-time = "2025-04-08T10:35:12.412Z" }, + { url = "https://files.pythonhosted.org/packages/15/ba/f60e053b0b5b8145d682672024aa91370a29c5c921a88977eb565de34086/watchfiles-1.0.5-cp311-cp311-win32.whl", hash = "sha256:2f1fefb2e90e89959447bc0420fddd1e76f625784340d64a2f7d5983ef9ad246", size = 277791, upload-time = "2025-04-08T10:35:13.719Z" }, + { url = "https://files.pythonhosted.org/packages/50/ed/7603c4e164225c12c0d4e8700b64bb00e01a6c4eeea372292a3856be33a4/watchfiles-1.0.5-cp311-cp311-win_amd64.whl", hash = "sha256:b6e76ceb1dd18c8e29c73f47d41866972e891fc4cc7ba014f487def72c1cf096", size = 291622, upload-time = "2025-04-08T10:35:15.071Z" }, + { url = "https://files.pythonhosted.org/packages/a2/c2/99bb7c96b4450e36877fde33690ded286ff555b5a5c1d925855d556968a1/watchfiles-1.0.5-cp311-cp311-win_arm64.whl", hash = "sha256:266710eb6fddc1f5e51843c70e3bebfb0f5e77cf4f27129278c70554104d19ed", size = 283699, upload-time = "2025-04-08T10:35:16.732Z" }, + { url = "https://files.pythonhosted.org/packages/2a/8c/4f0b9bdb75a1bfbd9c78fad7d8854369283f74fe7cf03eb16be77054536d/watchfiles-1.0.5-cp312-cp312-macosx_10_12_x86_64.whl", hash = "sha256:b5eb568c2aa6018e26da9e6c86f3ec3fd958cee7f0311b35c2630fa4217d17f2", size = 401511, upload-time = "2025-04-08T10:35:17.956Z" }, + { url = "https://files.pythonhosted.org/packages/dc/4e/7e15825def77f8bd359b6d3f379f0c9dac4eb09dd4ddd58fd7d14127179c/watchfiles-1.0.5-cp312-cp312-macosx_11_0_arm64.whl", hash = "sha256:0a04059f4923ce4e856b4b4e5e783a70f49d9663d22a4c3b3298165996d1377f", size = 392715, upload-time = "2025-04-08T10:35:19.202Z" }, + { url = "https://files.pythonhosted.org/packages/58/65/b72fb817518728e08de5840d5d38571466c1b4a3f724d190cec909ee6f3f/watchfiles-1.0.5-cp312-cp312-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:3e380c89983ce6e6fe2dd1e1921b9952fb4e6da882931abd1824c092ed495dec", size = 454138, upload-time = "2025-04-08T10:35:20.586Z" }, + { url = "https://files.pythonhosted.org/packages/3e/a4/86833fd2ea2e50ae28989f5950b5c3f91022d67092bfec08f8300d8b347b/watchfiles-1.0.5-cp312-cp312-manylinux_2_17_armv7l.manylinux2014_armv7l.whl", hash = "sha256:fe43139b2c0fdc4a14d4f8d5b5d967f7a2777fd3d38ecf5b1ec669b0d7e43c21", size = 458592, upload-time = "2025-04-08T10:35:21.87Z" }, + { url = "https://files.pythonhosted.org/packages/38/7e/42cb8df8be9a37e50dd3a818816501cf7a20d635d76d6bd65aae3dbbff68/watchfiles-1.0.5-cp312-cp312-manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:ee0822ce1b8a14fe5a066f93edd20aada932acfe348bede8aa2149f1a4489512", size = 487532, upload-time = "2025-04-08T10:35:23.143Z" }, + { url = "https://files.pythonhosted.org/packages/fc/fd/13d26721c85d7f3df6169d8b495fcac8ab0dc8f0945ebea8845de4681dab/watchfiles-1.0.5-cp312-cp312-manylinux_2_17_ppc64le.manylinux2014_ppc64le.whl", hash = "sha256:a0dbcb1c2d8f2ab6e0a81c6699b236932bd264d4cef1ac475858d16c403de74d", size = 522865, upload-time = "2025-04-08T10:35:24.702Z" }, + { url = "https://files.pythonhosted.org/packages/a1/0d/7f9ae243c04e96c5455d111e21b09087d0eeaf9a1369e13a01c7d3d82478/watchfiles-1.0.5-cp312-cp312-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:a2014a2b18ad3ca53b1f6c23f8cd94a18ce930c1837bd891262c182640eb40a6", size = 499887, upload-time = "2025-04-08T10:35:25.969Z" }, + { url = "https://files.pythonhosted.org/packages/8e/0f/a257766998e26aca4b3acf2ae97dff04b57071e991a510857d3799247c67/watchfiles-1.0.5-cp312-cp312-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:10f6ae86d5cb647bf58f9f655fcf577f713915a5d69057a0371bc257e2553234", size = 454498, upload-time = "2025-04-08T10:35:27.353Z" }, + { url = "https://files.pythonhosted.org/packages/81/79/8bf142575a03e0af9c3d5f8bcae911ee6683ae93a625d349d4ecf4c8f7df/watchfiles-1.0.5-cp312-cp312-musllinux_1_1_aarch64.whl", hash = "sha256:1a7bac2bde1d661fb31f4d4e8e539e178774b76db3c2c17c4bb3e960a5de07a2", size = 630663, upload-time = "2025-04-08T10:35:28.685Z" }, + { url = "https://files.pythonhosted.org/packages/f1/80/abe2e79f610e45c63a70d271caea90c49bbf93eb00fa947fa9b803a1d51f/watchfiles-1.0.5-cp312-cp312-musllinux_1_1_x86_64.whl", hash = "sha256:4ab626da2fc1ac277bbf752446470b367f84b50295264d2d313e28dc4405d663", size = 625410, upload-time = "2025-04-08T10:35:30.42Z" }, + { url = "https://files.pythonhosted.org/packages/91/6f/bc7fbecb84a41a9069c2c6eb6319f7f7df113adf113e358c57fc1aff7ff5/watchfiles-1.0.5-cp312-cp312-win32.whl", hash = "sha256:9f4571a783914feda92018ef3901dab8caf5b029325b5fe4558c074582815249", size = 277965, upload-time = "2025-04-08T10:35:32.023Z" }, + { url = "https://files.pythonhosted.org/packages/99/a5/bf1c297ea6649ec59e935ab311f63d8af5faa8f0b86993e3282b984263e3/watchfiles-1.0.5-cp312-cp312-win_amd64.whl", hash = "sha256:360a398c3a19672cf93527f7e8d8b60d8275119c5d900f2e184d32483117a705", size = 291693, upload-time = "2025-04-08T10:35:33.225Z" }, + { url = "https://files.pythonhosted.org/packages/7f/7b/fd01087cc21db5c47e5beae507b87965db341cce8a86f9eb12bf5219d4e0/watchfiles-1.0.5-cp312-cp312-win_arm64.whl", hash = "sha256:1a2902ede862969077b97523987c38db28abbe09fb19866e711485d9fbf0d417", size = 283287, upload-time = "2025-04-08T10:35:34.568Z" }, + { url = "https://files.pythonhosted.org/packages/c7/62/435766874b704f39b2fecd8395a29042db2b5ec4005bd34523415e9bd2e0/watchfiles-1.0.5-cp313-cp313-macosx_10_12_x86_64.whl", hash = "sha256:0b289572c33a0deae62daa57e44a25b99b783e5f7aed81b314232b3d3c81a11d", size = 401531, upload-time = "2025-04-08T10:35:35.792Z" }, + { url = "https://files.pythonhosted.org/packages/6e/a6/e52a02c05411b9cb02823e6797ef9bbba0bfaf1bb627da1634d44d8af833/watchfiles-1.0.5-cp313-cp313-macosx_11_0_arm64.whl", hash = "sha256:a056c2f692d65bf1e99c41045e3bdcaea3cb9e6b5a53dcaf60a5f3bd95fc9763", size = 392417, upload-time = "2025-04-08T10:35:37.048Z" }, + { url = "https://files.pythonhosted.org/packages/3f/53/c4af6819770455932144e0109d4854437769672d7ad897e76e8e1673435d/watchfiles-1.0.5-cp313-cp313-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:b9dca99744991fc9850d18015c4f0438865414e50069670f5f7eee08340d8b40", size = 453423, upload-time = "2025-04-08T10:35:38.357Z" }, + { url = "https://files.pythonhosted.org/packages/cb/d1/8e88df58bbbf819b8bc5cfbacd3c79e01b40261cad0fc84d1e1ebd778a07/watchfiles-1.0.5-cp313-cp313-manylinux_2_17_armv7l.manylinux2014_armv7l.whl", hash = "sha256:894342d61d355446d02cd3988a7326af344143eb33a2fd5d38482a92072d9563", size = 458185, upload-time = "2025-04-08T10:35:39.708Z" }, + { url = "https://files.pythonhosted.org/packages/ff/70/fffaa11962dd5429e47e478a18736d4e42bec42404f5ee3b92ef1b87ad60/watchfiles-1.0.5-cp313-cp313-manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:ab44e1580924d1ffd7b3938e02716d5ad190441965138b4aa1d1f31ea0877f04", size = 486696, upload-time = "2025-04-08T10:35:41.469Z" }, + { url = "https://files.pythonhosted.org/packages/39/db/723c0328e8b3692d53eb273797d9a08be6ffb1d16f1c0ba2bdbdc2a3852c/watchfiles-1.0.5-cp313-cp313-manylinux_2_17_ppc64le.manylinux2014_ppc64le.whl", hash = "sha256:d6f9367b132078b2ceb8d066ff6c93a970a18c3029cea37bfd7b2d3dd2e5db8f", size = 522327, upload-time = "2025-04-08T10:35:43.289Z" }, + { url = "https://files.pythonhosted.org/packages/cd/05/9fccc43c50c39a76b68343484b9da7b12d42d0859c37c61aec018c967a32/watchfiles-1.0.5-cp313-cp313-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:f2e55a9b162e06e3f862fb61e399fe9f05d908d019d87bf5b496a04ef18a970a", size = 499741, upload-time = "2025-04-08T10:35:44.574Z" }, + { url = "https://files.pythonhosted.org/packages/23/14/499e90c37fa518976782b10a18b18db9f55ea73ca14641615056f8194bb3/watchfiles-1.0.5-cp313-cp313-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:0125f91f70e0732a9f8ee01e49515c35d38ba48db507a50c5bdcad9503af5827", size = 453995, upload-time = "2025-04-08T10:35:46.336Z" }, + { url = "https://files.pythonhosted.org/packages/61/d9/f75d6840059320df5adecd2c687fbc18960a7f97b55c300d20f207d48aef/watchfiles-1.0.5-cp313-cp313-musllinux_1_1_aarch64.whl", hash = "sha256:13bb21f8ba3248386337c9fa51c528868e6c34a707f729ab041c846d52a0c69a", size = 629693, upload-time = "2025-04-08T10:35:48.161Z" }, + { url = "https://files.pythonhosted.org/packages/fc/17/180ca383f5061b61406477218c55d66ec118e6c0c51f02d8142895fcf0a9/watchfiles-1.0.5-cp313-cp313-musllinux_1_1_x86_64.whl", hash = "sha256:839ebd0df4a18c5b3c1b890145b5a3f5f64063c2a0d02b13c76d78fe5de34936", size = 624677, upload-time = "2025-04-08T10:35:49.65Z" }, + { url = "https://files.pythonhosted.org/packages/bf/15/714d6ef307f803f236d69ee9d421763707899d6298d9f3183e55e366d9af/watchfiles-1.0.5-cp313-cp313-win32.whl", hash = "sha256:4a8ec1e4e16e2d5bafc9ba82f7aaecfeec990ca7cd27e84fb6f191804ed2fcfc", size = 277804, upload-time = "2025-04-08T10:35:51.093Z" }, + { url = "https://files.pythonhosted.org/packages/a8/b4/c57b99518fadf431f3ef47a610839e46e5f8abf9814f969859d1c65c02c7/watchfiles-1.0.5-cp313-cp313-win_amd64.whl", hash = "sha256:f436601594f15bf406518af922a89dcaab416568edb6f65c4e5bbbad1ea45c11", size = 291087, upload-time = "2025-04-08T10:35:52.458Z" }, + { url = "https://files.pythonhosted.org/packages/1a/03/81f9fcc3963b3fc415cd4b0b2b39ee8cc136c42fb10a36acf38745e9d283/watchfiles-1.0.5-pp310-pypy310_pp73-macosx_10_12_x86_64.whl", hash = "sha256:f59b870db1f1ae5a9ac28245707d955c8721dd6565e7f411024fa374b5362d1d", size = 405947, upload-time = "2025-04-08T10:36:13.721Z" }, + { url = "https://files.pythonhosted.org/packages/54/97/8c4213a852feb64807ec1d380f42d4fc8bfaef896bdbd94318f8fd7f3e4e/watchfiles-1.0.5-pp310-pypy310_pp73-macosx_11_0_arm64.whl", hash = "sha256:9475b0093767e1475095f2aeb1d219fb9664081d403d1dff81342df8cd707034", size = 397276, upload-time = "2025-04-08T10:36:15.131Z" }, + { url = "https://files.pythonhosted.org/packages/78/12/d4464d19860cb9672efa45eec1b08f8472c478ed67dcd30647c51ada7aef/watchfiles-1.0.5-pp310-pypy310_pp73-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:fc533aa50664ebd6c628b2f30591956519462f5d27f951ed03d6c82b2dfd9965", size = 455550, upload-time = "2025-04-08T10:36:16.635Z" }, + { url = "https://files.pythonhosted.org/packages/90/fb/b07bcdf1034d8edeaef4c22f3e9e3157d37c5071b5f9492ffdfa4ad4bed7/watchfiles-1.0.5-pp310-pypy310_pp73-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:fed1cd825158dcaae36acce7b2db33dcbfd12b30c34317a88b8ed80f0541cc57", size = 455542, upload-time = "2025-04-08T10:36:18.655Z" }, ] [[package]] @@ -2434,102 +2460,102 @@ source = { registry = "https://pypi.org/simple" } dependencies = [ { name = "bracex" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/41/ab/b3a52228538ccb983653c446c1656eddf1d5303b9cb8b9aef6a91299f862/wcmatch-10.0.tar.gz", hash = "sha256:e72f0de09bba6a04e0de70937b0cf06e55f36f37b3deb422dfaf854b867b840a", size = 115578 } +sdist = { url = "https://files.pythonhosted.org/packages/41/ab/b3a52228538ccb983653c446c1656eddf1d5303b9cb8b9aef6a91299f862/wcmatch-10.0.tar.gz", hash = "sha256:e72f0de09bba6a04e0de70937b0cf06e55f36f37b3deb422dfaf854b867b840a", size = 115578, upload-time = "2024-09-26T18:39:52.505Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/ab/df/4ee467ab39cc1de4b852c212c1ed3becfec2e486a51ac1ce0091f85f38d7/wcmatch-10.0-py3-none-any.whl", hash = "sha256:0dd927072d03c0a6527a20d2e6ad5ba8d0380e60870c383bc533b71744df7b7a", size = 39347 }, + { url = "https://files.pythonhosted.org/packages/ab/df/4ee467ab39cc1de4b852c212c1ed3becfec2e486a51ac1ce0091f85f38d7/wcmatch-10.0-py3-none-any.whl", hash = "sha256:0dd927072d03c0a6527a20d2e6ad5ba8d0380e60870c383bc533b71744df7b7a", size = 39347, upload-time = "2024-09-26T18:39:51.002Z" }, ] [[package]] name = "wcwidth" version = "0.2.13" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/6c/63/53559446a878410fc5a5974feb13d31d78d752eb18aeba59c7fef1af7598/wcwidth-0.2.13.tar.gz", hash = "sha256:72ea0c06399eb286d978fdedb6923a9eb47e1c486ce63e9b4e64fc18303972b5", size = 101301 } +sdist = { url = "https://files.pythonhosted.org/packages/6c/63/53559446a878410fc5a5974feb13d31d78d752eb18aeba59c7fef1af7598/wcwidth-0.2.13.tar.gz", hash = "sha256:72ea0c06399eb286d978fdedb6923a9eb47e1c486ce63e9b4e64fc18303972b5", size = 101301, upload-time = "2024-01-06T02:10:57.829Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/fd/84/fd2ba7aafacbad3c4201d395674fc6348826569da3c0937e75505ead3528/wcwidth-0.2.13-py2.py3-none-any.whl", hash = "sha256:3da69048e4540d84af32131829ff948f1e022c1c6bdb8d6102117aac784f6859", size = 34166 }, + { url = "https://files.pythonhosted.org/packages/fd/84/fd2ba7aafacbad3c4201d395674fc6348826569da3c0937e75505ead3528/wcwidth-0.2.13-py2.py3-none-any.whl", hash = "sha256:3da69048e4540d84af32131829ff948f1e022c1c6bdb8d6102117aac784f6859", size = 34166, upload-time = "2024-01-06T02:10:55.763Z" }, ] [[package]] name = "webencodings" version = "0.5.1" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/0b/02/ae6ceac1baeda530866a85075641cec12989bd8d31af6d5ab4a3e8c92f47/webencodings-0.5.1.tar.gz", hash = "sha256:b36a1c245f2d304965eb4e0a82848379241dc04b865afcc4aab16748587e1923", size = 9721 } +sdist = { url = "https://files.pythonhosted.org/packages/0b/02/ae6ceac1baeda530866a85075641cec12989bd8d31af6d5ab4a3e8c92f47/webencodings-0.5.1.tar.gz", hash = "sha256:b36a1c245f2d304965eb4e0a82848379241dc04b865afcc4aab16748587e1923", size = 9721, upload-time = "2017-04-05T20:21:34.189Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/f4/24/2a3e3df732393fed8b3ebf2ec078f05546de641fe1b667ee316ec1dcf3b7/webencodings-0.5.1-py2.py3-none-any.whl", hash = "sha256:a0af1213f3c2226497a97e2b3aa01a7e4bee4f403f95be16fc9acd2947514a78", size = 11774 }, + { url = "https://files.pythonhosted.org/packages/f4/24/2a3e3df732393fed8b3ebf2ec078f05546de641fe1b667ee316ec1dcf3b7/webencodings-0.5.1-py2.py3-none-any.whl", hash = "sha256:a0af1213f3c2226497a97e2b3aa01a7e4bee4f403f95be16fc9acd2947514a78", size = 11774, upload-time = "2017-04-05T20:21:32.581Z" }, ] [[package]] name = "websocket-client" version = "1.8.0" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/e6/30/fba0d96b4b5fbf5948ed3f4681f7da2f9f64512e1d303f94b4cc174c24a5/websocket_client-1.8.0.tar.gz", hash = "sha256:3239df9f44da632f96012472805d40a23281a991027ce11d2f45a6f24ac4c3da", size = 54648 } +sdist = { url = "https://files.pythonhosted.org/packages/e6/30/fba0d96b4b5fbf5948ed3f4681f7da2f9f64512e1d303f94b4cc174c24a5/websocket_client-1.8.0.tar.gz", hash = "sha256:3239df9f44da632f96012472805d40a23281a991027ce11d2f45a6f24ac4c3da", size = 54648, upload-time = "2024-04-23T22:16:16.976Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/5a/84/44687a29792a70e111c5c477230a72c4b957d88d16141199bf9acb7537a3/websocket_client-1.8.0-py3-none-any.whl", hash = "sha256:17b44cc997f5c498e809b22cdf2d9c7a9e71c02c8cc2b6c56e7c2d1239bfa526", size = 58826 }, + { url = "https://files.pythonhosted.org/packages/5a/84/44687a29792a70e111c5c477230a72c4b957d88d16141199bf9acb7537a3/websocket_client-1.8.0-py3-none-any.whl", hash = "sha256:17b44cc997f5c498e809b22cdf2d9c7a9e71c02c8cc2b6c56e7c2d1239bfa526", size = 58826, upload-time = "2024-04-23T22:16:14.422Z" }, ] [[package]] name = "websockets" version = "15.0.1" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/21/e6/26d09fab466b7ca9c7737474c52be4f76a40301b08362eb2dbc19dcc16c1/websockets-15.0.1.tar.gz", hash = "sha256:82544de02076bafba038ce055ee6412d68da13ab47f0c60cab827346de828dee", size = 177016 } -wheels = [ - { url = "https://files.pythonhosted.org/packages/1e/da/6462a9f510c0c49837bbc9345aca92d767a56c1fb2939e1579df1e1cdcf7/websockets-15.0.1-cp310-cp310-macosx_10_9_universal2.whl", hash = "sha256:d63efaa0cd96cf0c5fe4d581521d9fa87744540d4bc999ae6e08595a1014b45b", size = 175423 }, - { url = "https://files.pythonhosted.org/packages/1c/9f/9d11c1a4eb046a9e106483b9ff69bce7ac880443f00e5ce64261b47b07e7/websockets-15.0.1-cp310-cp310-macosx_10_9_x86_64.whl", hash = "sha256:ac60e3b188ec7574cb761b08d50fcedf9d77f1530352db4eef1707fe9dee7205", size = 173080 }, - { url = "https://files.pythonhosted.org/packages/d5/4f/b462242432d93ea45f297b6179c7333dd0402b855a912a04e7fc61c0d71f/websockets-15.0.1-cp310-cp310-macosx_11_0_arm64.whl", hash = "sha256:5756779642579d902eed757b21b0164cd6fe338506a8083eb58af5c372e39d9a", size = 173329 }, - { url = "https://files.pythonhosted.org/packages/6e/0c/6afa1f4644d7ed50284ac59cc70ef8abd44ccf7d45850d989ea7310538d0/websockets-15.0.1-cp310-cp310-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:0fdfe3e2a29e4db3659dbd5bbf04560cea53dd9610273917799f1cde46aa725e", size = 182312 }, - { url = "https://files.pythonhosted.org/packages/dd/d4/ffc8bd1350b229ca7a4db2a3e1c482cf87cea1baccd0ef3e72bc720caeec/websockets-15.0.1-cp310-cp310-manylinux_2_5_i686.manylinux1_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:4c2529b320eb9e35af0fa3016c187dffb84a3ecc572bcee7c3ce302bfeba52bf", size = 181319 }, - { url = "https://files.pythonhosted.org/packages/97/3a/5323a6bb94917af13bbb34009fac01e55c51dfde354f63692bf2533ffbc2/websockets-15.0.1-cp310-cp310-manylinux_2_5_x86_64.manylinux1_x86_64.manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:ac1e5c9054fe23226fb11e05a6e630837f074174c4c2f0fe442996112a6de4fb", size = 181631 }, - { url = "https://files.pythonhosted.org/packages/a6/cc/1aeb0f7cee59ef065724041bb7ed667b6ab1eeffe5141696cccec2687b66/websockets-15.0.1-cp310-cp310-musllinux_1_2_aarch64.whl", hash = "sha256:5df592cd503496351d6dc14f7cdad49f268d8e618f80dce0cd5a36b93c3fc08d", size = 182016 }, - { url = "https://files.pythonhosted.org/packages/79/f9/c86f8f7af208e4161a7f7e02774e9d0a81c632ae76db2ff22549e1718a51/websockets-15.0.1-cp310-cp310-musllinux_1_2_i686.whl", hash = "sha256:0a34631031a8f05657e8e90903e656959234f3a04552259458aac0b0f9ae6fd9", size = 181426 }, - { url = "https://files.pythonhosted.org/packages/c7/b9/828b0bc6753db905b91df6ae477c0b14a141090df64fb17f8a9d7e3516cf/websockets-15.0.1-cp310-cp310-musllinux_1_2_x86_64.whl", hash = "sha256:3d00075aa65772e7ce9e990cab3ff1de702aa09be3940d1dc88d5abf1ab8a09c", size = 181360 }, - { url = "https://files.pythonhosted.org/packages/89/fb/250f5533ec468ba6327055b7d98b9df056fb1ce623b8b6aaafb30b55d02e/websockets-15.0.1-cp310-cp310-win32.whl", hash = "sha256:1234d4ef35db82f5446dca8e35a7da7964d02c127b095e172e54397fb6a6c256", size = 176388 }, - { url = "https://files.pythonhosted.org/packages/1c/46/aca7082012768bb98e5608f01658ff3ac8437e563eca41cf068bd5849a5e/websockets-15.0.1-cp310-cp310-win_amd64.whl", hash = "sha256:39c1fec2c11dc8d89bba6b2bf1556af381611a173ac2b511cf7231622058af41", size = 176830 }, - { url = "https://files.pythonhosted.org/packages/9f/32/18fcd5919c293a398db67443acd33fde142f283853076049824fc58e6f75/websockets-15.0.1-cp311-cp311-macosx_10_9_universal2.whl", hash = "sha256:823c248b690b2fd9303ba00c4f66cd5e2d8c3ba4aa968b2779be9532a4dad431", size = 175423 }, - { url = "https://files.pythonhosted.org/packages/76/70/ba1ad96b07869275ef42e2ce21f07a5b0148936688c2baf7e4a1f60d5058/websockets-15.0.1-cp311-cp311-macosx_10_9_x86_64.whl", hash = "sha256:678999709e68425ae2593acf2e3ebcbcf2e69885a5ee78f9eb80e6e371f1bf57", size = 173082 }, - { url = "https://files.pythonhosted.org/packages/86/f2/10b55821dd40eb696ce4704a87d57774696f9451108cff0d2824c97e0f97/websockets-15.0.1-cp311-cp311-macosx_11_0_arm64.whl", hash = "sha256:d50fd1ee42388dcfb2b3676132c78116490976f1300da28eb629272d5d93e905", size = 173330 }, - { url = "https://files.pythonhosted.org/packages/a5/90/1c37ae8b8a113d3daf1065222b6af61cc44102da95388ac0018fcb7d93d9/websockets-15.0.1-cp311-cp311-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:d99e5546bf73dbad5bf3547174cd6cb8ba7273062a23808ffea025ecb1cf8562", size = 182878 }, - { url = "https://files.pythonhosted.org/packages/8e/8d/96e8e288b2a41dffafb78e8904ea7367ee4f891dafc2ab8d87e2124cb3d3/websockets-15.0.1-cp311-cp311-manylinux_2_5_i686.manylinux1_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:66dd88c918e3287efc22409d426c8f729688d89a0c587c88971a0faa2c2f3792", size = 181883 }, - { url = "https://files.pythonhosted.org/packages/93/1f/5d6dbf551766308f6f50f8baf8e9860be6182911e8106da7a7f73785f4c4/websockets-15.0.1-cp311-cp311-manylinux_2_5_x86_64.manylinux1_x86_64.manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:8dd8327c795b3e3f219760fa603dcae1dcc148172290a8ab15158cf85a953413", size = 182252 }, - { url = "https://files.pythonhosted.org/packages/d4/78/2d4fed9123e6620cbf1706c0de8a1632e1a28e7774d94346d7de1bba2ca3/websockets-15.0.1-cp311-cp311-musllinux_1_2_aarch64.whl", hash = "sha256:8fdc51055e6ff4adeb88d58a11042ec9a5eae317a0a53d12c062c8a8865909e8", size = 182521 }, - { url = "https://files.pythonhosted.org/packages/e7/3b/66d4c1b444dd1a9823c4a81f50231b921bab54eee2f69e70319b4e21f1ca/websockets-15.0.1-cp311-cp311-musllinux_1_2_i686.whl", hash = "sha256:693f0192126df6c2327cce3baa7c06f2a117575e32ab2308f7f8216c29d9e2e3", size = 181958 }, - { url = "https://files.pythonhosted.org/packages/08/ff/e9eed2ee5fed6f76fdd6032ca5cd38c57ca9661430bb3d5fb2872dc8703c/websockets-15.0.1-cp311-cp311-musllinux_1_2_x86_64.whl", hash = "sha256:54479983bd5fb469c38f2f5c7e3a24f9a4e70594cd68cd1fa6b9340dadaff7cf", size = 181918 }, - { url = "https://files.pythonhosted.org/packages/d8/75/994634a49b7e12532be6a42103597b71098fd25900f7437d6055ed39930a/websockets-15.0.1-cp311-cp311-win32.whl", hash = "sha256:16b6c1b3e57799b9d38427dda63edcbe4926352c47cf88588c0be4ace18dac85", size = 176388 }, - { url = "https://files.pythonhosted.org/packages/98/93/e36c73f78400a65f5e236cd376713c34182e6663f6889cd45a4a04d8f203/websockets-15.0.1-cp311-cp311-win_amd64.whl", hash = "sha256:27ccee0071a0e75d22cb35849b1db43f2ecd3e161041ac1ee9d2352ddf72f065", size = 176828 }, - { url = "https://files.pythonhosted.org/packages/51/6b/4545a0d843594f5d0771e86463606a3988b5a09ca5123136f8a76580dd63/websockets-15.0.1-cp312-cp312-macosx_10_13_universal2.whl", hash = "sha256:3e90baa811a5d73f3ca0bcbf32064d663ed81318ab225ee4f427ad4e26e5aff3", size = 175437 }, - { url = "https://files.pythonhosted.org/packages/f4/71/809a0f5f6a06522af902e0f2ea2757f71ead94610010cf570ab5c98e99ed/websockets-15.0.1-cp312-cp312-macosx_10_13_x86_64.whl", hash = "sha256:592f1a9fe869c778694f0aa806ba0374e97648ab57936f092fd9d87f8bc03665", size = 173096 }, - { url = "https://files.pythonhosted.org/packages/3d/69/1a681dd6f02180916f116894181eab8b2e25b31e484c5d0eae637ec01f7c/websockets-15.0.1-cp312-cp312-macosx_11_0_arm64.whl", hash = "sha256:0701bc3cfcb9164d04a14b149fd74be7347a530ad3bbf15ab2c678a2cd3dd9a2", size = 173332 }, - { url = "https://files.pythonhosted.org/packages/a6/02/0073b3952f5bce97eafbb35757f8d0d54812b6174ed8dd952aa08429bcc3/websockets-15.0.1-cp312-cp312-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:e8b56bdcdb4505c8078cb6c7157d9811a85790f2f2b3632c7d1462ab5783d215", size = 183152 }, - { url = "https://files.pythonhosted.org/packages/74/45/c205c8480eafd114b428284840da0b1be9ffd0e4f87338dc95dc6ff961a1/websockets-15.0.1-cp312-cp312-manylinux_2_5_i686.manylinux1_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:0af68c55afbd5f07986df82831c7bff04846928ea8d1fd7f30052638788bc9b5", size = 182096 }, - { url = "https://files.pythonhosted.org/packages/14/8f/aa61f528fba38578ec553c145857a181384c72b98156f858ca5c8e82d9d3/websockets-15.0.1-cp312-cp312-manylinux_2_5_x86_64.manylinux1_x86_64.manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:64dee438fed052b52e4f98f76c5790513235efaa1ef7f3f2192c392cd7c91b65", size = 182523 }, - { url = "https://files.pythonhosted.org/packages/ec/6d/0267396610add5bc0d0d3e77f546d4cd287200804fe02323797de77dbce9/websockets-15.0.1-cp312-cp312-musllinux_1_2_aarch64.whl", hash = "sha256:d5f6b181bb38171a8ad1d6aa58a67a6aa9d4b38d0f8c5f496b9e42561dfc62fe", size = 182790 }, - { url = "https://files.pythonhosted.org/packages/02/05/c68c5adbf679cf610ae2f74a9b871ae84564462955d991178f95a1ddb7dd/websockets-15.0.1-cp312-cp312-musllinux_1_2_i686.whl", hash = "sha256:5d54b09eba2bada6011aea5375542a157637b91029687eb4fdb2dab11059c1b4", size = 182165 }, - { url = "https://files.pythonhosted.org/packages/29/93/bb672df7b2f5faac89761cb5fa34f5cec45a4026c383a4b5761c6cea5c16/websockets-15.0.1-cp312-cp312-musllinux_1_2_x86_64.whl", hash = "sha256:3be571a8b5afed347da347bfcf27ba12b069d9d7f42cb8c7028b5e98bbb12597", size = 182160 }, - { url = "https://files.pythonhosted.org/packages/ff/83/de1f7709376dc3ca9b7eeb4b9a07b4526b14876b6d372a4dc62312bebee0/websockets-15.0.1-cp312-cp312-win32.whl", hash = "sha256:c338ffa0520bdb12fbc527265235639fb76e7bc7faafbb93f6ba80d9c06578a9", size = 176395 }, - { url = "https://files.pythonhosted.org/packages/7d/71/abf2ebc3bbfa40f391ce1428c7168fb20582d0ff57019b69ea20fa698043/websockets-15.0.1-cp312-cp312-win_amd64.whl", hash = "sha256:fcd5cf9e305d7b8338754470cf69cf81f420459dbae8a3b40cee57417f4614a7", size = 176841 }, - { url = "https://files.pythonhosted.org/packages/cb/9f/51f0cf64471a9d2b4d0fc6c534f323b664e7095640c34562f5182e5a7195/websockets-15.0.1-cp313-cp313-macosx_10_13_universal2.whl", hash = "sha256:ee443ef070bb3b6ed74514f5efaa37a252af57c90eb33b956d35c8e9c10a1931", size = 175440 }, - { url = "https://files.pythonhosted.org/packages/8a/05/aa116ec9943c718905997412c5989f7ed671bc0188ee2ba89520e8765d7b/websockets-15.0.1-cp313-cp313-macosx_10_13_x86_64.whl", hash = "sha256:5a939de6b7b4e18ca683218320fc67ea886038265fd1ed30173f5ce3f8e85675", size = 173098 }, - { url = "https://files.pythonhosted.org/packages/ff/0b/33cef55ff24f2d92924923c99926dcce78e7bd922d649467f0eda8368923/websockets-15.0.1-cp313-cp313-macosx_11_0_arm64.whl", hash = "sha256:746ee8dba912cd6fc889a8147168991d50ed70447bf18bcda7039f7d2e3d9151", size = 173329 }, - { url = "https://files.pythonhosted.org/packages/31/1d/063b25dcc01faa8fada1469bdf769de3768b7044eac9d41f734fd7b6ad6d/websockets-15.0.1-cp313-cp313-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:595b6c3969023ecf9041b2936ac3827e4623bfa3ccf007575f04c5a6aa318c22", size = 183111 }, - { url = "https://files.pythonhosted.org/packages/93/53/9a87ee494a51bf63e4ec9241c1ccc4f7c2f45fff85d5bde2ff74fcb68b9e/websockets-15.0.1-cp313-cp313-manylinux_2_5_i686.manylinux1_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:3c714d2fc58b5ca3e285461a4cc0c9a66bd0e24c5da9911e30158286c9b5be7f", size = 182054 }, - { url = "https://files.pythonhosted.org/packages/ff/b2/83a6ddf56cdcbad4e3d841fcc55d6ba7d19aeb89c50f24dd7e859ec0805f/websockets-15.0.1-cp313-cp313-manylinux_2_5_x86_64.manylinux1_x86_64.manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:0f3c1e2ab208db911594ae5b4f79addeb3501604a165019dd221c0bdcabe4db8", size = 182496 }, - { url = "https://files.pythonhosted.org/packages/98/41/e7038944ed0abf34c45aa4635ba28136f06052e08fc2168520bb8b25149f/websockets-15.0.1-cp313-cp313-musllinux_1_2_aarch64.whl", hash = "sha256:229cf1d3ca6c1804400b0a9790dc66528e08a6a1feec0d5040e8b9eb14422375", size = 182829 }, - { url = "https://files.pythonhosted.org/packages/e0/17/de15b6158680c7623c6ef0db361da965ab25d813ae54fcfeae2e5b9ef910/websockets-15.0.1-cp313-cp313-musllinux_1_2_i686.whl", hash = "sha256:756c56e867a90fb00177d530dca4b097dd753cde348448a1012ed6c5131f8b7d", size = 182217 }, - { url = "https://files.pythonhosted.org/packages/33/2b/1f168cb6041853eef0362fb9554c3824367c5560cbdaad89ac40f8c2edfc/websockets-15.0.1-cp313-cp313-musllinux_1_2_x86_64.whl", hash = "sha256:558d023b3df0bffe50a04e710bc87742de35060580a293c2a984299ed83bc4e4", size = 182195 }, - { url = "https://files.pythonhosted.org/packages/86/eb/20b6cdf273913d0ad05a6a14aed4b9a85591c18a987a3d47f20fa13dcc47/websockets-15.0.1-cp313-cp313-win32.whl", hash = "sha256:ba9e56e8ceeeedb2e080147ba85ffcd5cd0711b89576b83784d8605a7df455fa", size = 176393 }, - { url = "https://files.pythonhosted.org/packages/1b/6c/c65773d6cab416a64d191d6ee8a8b1c68a09970ea6909d16965d26bfed1e/websockets-15.0.1-cp313-cp313-win_amd64.whl", hash = "sha256:e09473f095a819042ecb2ab9465aee615bd9c2028e4ef7d933600a8401c79561", size = 176837 }, - { url = "https://files.pythonhosted.org/packages/02/9e/d40f779fa16f74d3468357197af8d6ad07e7c5a27ea1ca74ceb38986f77a/websockets-15.0.1-pp310-pypy310_pp73-macosx_10_15_x86_64.whl", hash = "sha256:0c9e74d766f2818bb95f84c25be4dea09841ac0f734d1966f415e4edfc4ef1c3", size = 173109 }, - { url = "https://files.pythonhosted.org/packages/bc/cd/5b887b8585a593073fd92f7c23ecd3985cd2c3175025a91b0d69b0551372/websockets-15.0.1-pp310-pypy310_pp73-macosx_11_0_arm64.whl", hash = "sha256:1009ee0c7739c08a0cd59de430d6de452a55e42d6b522de7aa15e6f67db0b8e1", size = 173343 }, - { url = "https://files.pythonhosted.org/packages/fe/ae/d34f7556890341e900a95acf4886833646306269f899d58ad62f588bf410/websockets-15.0.1-pp310-pypy310_pp73-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:76d1f20b1c7a2fa82367e04982e708723ba0e7b8d43aa643d3dcd404d74f1475", size = 174599 }, - { url = "https://files.pythonhosted.org/packages/71/e6/5fd43993a87db364ec60fc1d608273a1a465c0caba69176dd160e197ce42/websockets-15.0.1-pp310-pypy310_pp73-manylinux_2_5_i686.manylinux1_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:f29d80eb9a9263b8d109135351caf568cc3f80b9928bccde535c235de55c22d9", size = 174207 }, - { url = "https://files.pythonhosted.org/packages/2b/fb/c492d6daa5ec067c2988ac80c61359ace5c4c674c532985ac5a123436cec/websockets-15.0.1-pp310-pypy310_pp73-manylinux_2_5_x86_64.manylinux1_x86_64.manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:b359ed09954d7c18bbc1680f380c7301f92c60bf924171629c5db97febb12f04", size = 174155 }, - { url = "https://files.pythonhosted.org/packages/68/a1/dcb68430b1d00b698ae7a7e0194433bce4f07ded185f0ee5fb21e2a2e91e/websockets-15.0.1-pp310-pypy310_pp73-win_amd64.whl", hash = "sha256:cad21560da69f4ce7658ca2cb83138fb4cf695a2ba3e475e0559e05991aa8122", size = 176884 }, - { url = "https://files.pythonhosted.org/packages/fa/a8/5b41e0da817d64113292ab1f8247140aac61cbf6cfd085d6a0fa77f4984f/websockets-15.0.1-py3-none-any.whl", hash = "sha256:f7a866fbc1e97b5c617ee4116daaa09b722101d4a3c170c787450ba409f9736f", size = 169743 }, +sdist = { url = "https://files.pythonhosted.org/packages/21/e6/26d09fab466b7ca9c7737474c52be4f76a40301b08362eb2dbc19dcc16c1/websockets-15.0.1.tar.gz", hash = "sha256:82544de02076bafba038ce055ee6412d68da13ab47f0c60cab827346de828dee", size = 177016, upload-time = "2025-03-05T20:03:41.606Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/1e/da/6462a9f510c0c49837bbc9345aca92d767a56c1fb2939e1579df1e1cdcf7/websockets-15.0.1-cp310-cp310-macosx_10_9_universal2.whl", hash = "sha256:d63efaa0cd96cf0c5fe4d581521d9fa87744540d4bc999ae6e08595a1014b45b", size = 175423, upload-time = "2025-03-05T20:01:35.363Z" }, + { url = "https://files.pythonhosted.org/packages/1c/9f/9d11c1a4eb046a9e106483b9ff69bce7ac880443f00e5ce64261b47b07e7/websockets-15.0.1-cp310-cp310-macosx_10_9_x86_64.whl", hash = "sha256:ac60e3b188ec7574cb761b08d50fcedf9d77f1530352db4eef1707fe9dee7205", size = 173080, upload-time = "2025-03-05T20:01:37.304Z" }, + { url = "https://files.pythonhosted.org/packages/d5/4f/b462242432d93ea45f297b6179c7333dd0402b855a912a04e7fc61c0d71f/websockets-15.0.1-cp310-cp310-macosx_11_0_arm64.whl", hash = "sha256:5756779642579d902eed757b21b0164cd6fe338506a8083eb58af5c372e39d9a", size = 173329, upload-time = "2025-03-05T20:01:39.668Z" }, + { url = "https://files.pythonhosted.org/packages/6e/0c/6afa1f4644d7ed50284ac59cc70ef8abd44ccf7d45850d989ea7310538d0/websockets-15.0.1-cp310-cp310-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:0fdfe3e2a29e4db3659dbd5bbf04560cea53dd9610273917799f1cde46aa725e", size = 182312, upload-time = "2025-03-05T20:01:41.815Z" }, + { url = "https://files.pythonhosted.org/packages/dd/d4/ffc8bd1350b229ca7a4db2a3e1c482cf87cea1baccd0ef3e72bc720caeec/websockets-15.0.1-cp310-cp310-manylinux_2_5_i686.manylinux1_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:4c2529b320eb9e35af0fa3016c187dffb84a3ecc572bcee7c3ce302bfeba52bf", size = 181319, upload-time = "2025-03-05T20:01:43.967Z" }, + { url = "https://files.pythonhosted.org/packages/97/3a/5323a6bb94917af13bbb34009fac01e55c51dfde354f63692bf2533ffbc2/websockets-15.0.1-cp310-cp310-manylinux_2_5_x86_64.manylinux1_x86_64.manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:ac1e5c9054fe23226fb11e05a6e630837f074174c4c2f0fe442996112a6de4fb", size = 181631, upload-time = "2025-03-05T20:01:46.104Z" }, + { url = "https://files.pythonhosted.org/packages/a6/cc/1aeb0f7cee59ef065724041bb7ed667b6ab1eeffe5141696cccec2687b66/websockets-15.0.1-cp310-cp310-musllinux_1_2_aarch64.whl", hash = "sha256:5df592cd503496351d6dc14f7cdad49f268d8e618f80dce0cd5a36b93c3fc08d", size = 182016, upload-time = "2025-03-05T20:01:47.603Z" }, + { url = "https://files.pythonhosted.org/packages/79/f9/c86f8f7af208e4161a7f7e02774e9d0a81c632ae76db2ff22549e1718a51/websockets-15.0.1-cp310-cp310-musllinux_1_2_i686.whl", hash = "sha256:0a34631031a8f05657e8e90903e656959234f3a04552259458aac0b0f9ae6fd9", size = 181426, upload-time = "2025-03-05T20:01:48.949Z" }, + { url = "https://files.pythonhosted.org/packages/c7/b9/828b0bc6753db905b91df6ae477c0b14a141090df64fb17f8a9d7e3516cf/websockets-15.0.1-cp310-cp310-musllinux_1_2_x86_64.whl", hash = "sha256:3d00075aa65772e7ce9e990cab3ff1de702aa09be3940d1dc88d5abf1ab8a09c", size = 181360, upload-time = "2025-03-05T20:01:50.938Z" }, + { url = "https://files.pythonhosted.org/packages/89/fb/250f5533ec468ba6327055b7d98b9df056fb1ce623b8b6aaafb30b55d02e/websockets-15.0.1-cp310-cp310-win32.whl", hash = "sha256:1234d4ef35db82f5446dca8e35a7da7964d02c127b095e172e54397fb6a6c256", size = 176388, upload-time = "2025-03-05T20:01:52.213Z" }, + { url = "https://files.pythonhosted.org/packages/1c/46/aca7082012768bb98e5608f01658ff3ac8437e563eca41cf068bd5849a5e/websockets-15.0.1-cp310-cp310-win_amd64.whl", hash = "sha256:39c1fec2c11dc8d89bba6b2bf1556af381611a173ac2b511cf7231622058af41", size = 176830, upload-time = "2025-03-05T20:01:53.922Z" }, + { url = "https://files.pythonhosted.org/packages/9f/32/18fcd5919c293a398db67443acd33fde142f283853076049824fc58e6f75/websockets-15.0.1-cp311-cp311-macosx_10_9_universal2.whl", hash = "sha256:823c248b690b2fd9303ba00c4f66cd5e2d8c3ba4aa968b2779be9532a4dad431", size = 175423, upload-time = "2025-03-05T20:01:56.276Z" }, + { url = "https://files.pythonhosted.org/packages/76/70/ba1ad96b07869275ef42e2ce21f07a5b0148936688c2baf7e4a1f60d5058/websockets-15.0.1-cp311-cp311-macosx_10_9_x86_64.whl", hash = "sha256:678999709e68425ae2593acf2e3ebcbcf2e69885a5ee78f9eb80e6e371f1bf57", size = 173082, upload-time = "2025-03-05T20:01:57.563Z" }, + { url = "https://files.pythonhosted.org/packages/86/f2/10b55821dd40eb696ce4704a87d57774696f9451108cff0d2824c97e0f97/websockets-15.0.1-cp311-cp311-macosx_11_0_arm64.whl", hash = "sha256:d50fd1ee42388dcfb2b3676132c78116490976f1300da28eb629272d5d93e905", size = 173330, upload-time = "2025-03-05T20:01:59.063Z" }, + { url = "https://files.pythonhosted.org/packages/a5/90/1c37ae8b8a113d3daf1065222b6af61cc44102da95388ac0018fcb7d93d9/websockets-15.0.1-cp311-cp311-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:d99e5546bf73dbad5bf3547174cd6cb8ba7273062a23808ffea025ecb1cf8562", size = 182878, upload-time = "2025-03-05T20:02:00.305Z" }, + { url = "https://files.pythonhosted.org/packages/8e/8d/96e8e288b2a41dffafb78e8904ea7367ee4f891dafc2ab8d87e2124cb3d3/websockets-15.0.1-cp311-cp311-manylinux_2_5_i686.manylinux1_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:66dd88c918e3287efc22409d426c8f729688d89a0c587c88971a0faa2c2f3792", size = 181883, upload-time = "2025-03-05T20:02:03.148Z" }, + { url = "https://files.pythonhosted.org/packages/93/1f/5d6dbf551766308f6f50f8baf8e9860be6182911e8106da7a7f73785f4c4/websockets-15.0.1-cp311-cp311-manylinux_2_5_x86_64.manylinux1_x86_64.manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:8dd8327c795b3e3f219760fa603dcae1dcc148172290a8ab15158cf85a953413", size = 182252, upload-time = "2025-03-05T20:02:05.29Z" }, + { url = "https://files.pythonhosted.org/packages/d4/78/2d4fed9123e6620cbf1706c0de8a1632e1a28e7774d94346d7de1bba2ca3/websockets-15.0.1-cp311-cp311-musllinux_1_2_aarch64.whl", hash = "sha256:8fdc51055e6ff4adeb88d58a11042ec9a5eae317a0a53d12c062c8a8865909e8", size = 182521, upload-time = "2025-03-05T20:02:07.458Z" }, + { url = "https://files.pythonhosted.org/packages/e7/3b/66d4c1b444dd1a9823c4a81f50231b921bab54eee2f69e70319b4e21f1ca/websockets-15.0.1-cp311-cp311-musllinux_1_2_i686.whl", hash = "sha256:693f0192126df6c2327cce3baa7c06f2a117575e32ab2308f7f8216c29d9e2e3", size = 181958, upload-time = "2025-03-05T20:02:09.842Z" }, + { url = "https://files.pythonhosted.org/packages/08/ff/e9eed2ee5fed6f76fdd6032ca5cd38c57ca9661430bb3d5fb2872dc8703c/websockets-15.0.1-cp311-cp311-musllinux_1_2_x86_64.whl", hash = "sha256:54479983bd5fb469c38f2f5c7e3a24f9a4e70594cd68cd1fa6b9340dadaff7cf", size = 181918, upload-time = "2025-03-05T20:02:11.968Z" }, + { url = "https://files.pythonhosted.org/packages/d8/75/994634a49b7e12532be6a42103597b71098fd25900f7437d6055ed39930a/websockets-15.0.1-cp311-cp311-win32.whl", hash = "sha256:16b6c1b3e57799b9d38427dda63edcbe4926352c47cf88588c0be4ace18dac85", size = 176388, upload-time = "2025-03-05T20:02:13.32Z" }, + { url = "https://files.pythonhosted.org/packages/98/93/e36c73f78400a65f5e236cd376713c34182e6663f6889cd45a4a04d8f203/websockets-15.0.1-cp311-cp311-win_amd64.whl", hash = "sha256:27ccee0071a0e75d22cb35849b1db43f2ecd3e161041ac1ee9d2352ddf72f065", size = 176828, upload-time = "2025-03-05T20:02:14.585Z" }, + { url = "https://files.pythonhosted.org/packages/51/6b/4545a0d843594f5d0771e86463606a3988b5a09ca5123136f8a76580dd63/websockets-15.0.1-cp312-cp312-macosx_10_13_universal2.whl", hash = "sha256:3e90baa811a5d73f3ca0bcbf32064d663ed81318ab225ee4f427ad4e26e5aff3", size = 175437, upload-time = "2025-03-05T20:02:16.706Z" }, + { url = "https://files.pythonhosted.org/packages/f4/71/809a0f5f6a06522af902e0f2ea2757f71ead94610010cf570ab5c98e99ed/websockets-15.0.1-cp312-cp312-macosx_10_13_x86_64.whl", hash = "sha256:592f1a9fe869c778694f0aa806ba0374e97648ab57936f092fd9d87f8bc03665", size = 173096, upload-time = "2025-03-05T20:02:18.832Z" }, + { url = "https://files.pythonhosted.org/packages/3d/69/1a681dd6f02180916f116894181eab8b2e25b31e484c5d0eae637ec01f7c/websockets-15.0.1-cp312-cp312-macosx_11_0_arm64.whl", hash = "sha256:0701bc3cfcb9164d04a14b149fd74be7347a530ad3bbf15ab2c678a2cd3dd9a2", size = 173332, upload-time = "2025-03-05T20:02:20.187Z" }, + { url = "https://files.pythonhosted.org/packages/a6/02/0073b3952f5bce97eafbb35757f8d0d54812b6174ed8dd952aa08429bcc3/websockets-15.0.1-cp312-cp312-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:e8b56bdcdb4505c8078cb6c7157d9811a85790f2f2b3632c7d1462ab5783d215", size = 183152, upload-time = "2025-03-05T20:02:22.286Z" }, + { url = "https://files.pythonhosted.org/packages/74/45/c205c8480eafd114b428284840da0b1be9ffd0e4f87338dc95dc6ff961a1/websockets-15.0.1-cp312-cp312-manylinux_2_5_i686.manylinux1_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:0af68c55afbd5f07986df82831c7bff04846928ea8d1fd7f30052638788bc9b5", size = 182096, upload-time = "2025-03-05T20:02:24.368Z" }, + { url = "https://files.pythonhosted.org/packages/14/8f/aa61f528fba38578ec553c145857a181384c72b98156f858ca5c8e82d9d3/websockets-15.0.1-cp312-cp312-manylinux_2_5_x86_64.manylinux1_x86_64.manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:64dee438fed052b52e4f98f76c5790513235efaa1ef7f3f2192c392cd7c91b65", size = 182523, upload-time = "2025-03-05T20:02:25.669Z" }, + { url = "https://files.pythonhosted.org/packages/ec/6d/0267396610add5bc0d0d3e77f546d4cd287200804fe02323797de77dbce9/websockets-15.0.1-cp312-cp312-musllinux_1_2_aarch64.whl", hash = "sha256:d5f6b181bb38171a8ad1d6aa58a67a6aa9d4b38d0f8c5f496b9e42561dfc62fe", size = 182790, upload-time = "2025-03-05T20:02:26.99Z" }, + { url = "https://files.pythonhosted.org/packages/02/05/c68c5adbf679cf610ae2f74a9b871ae84564462955d991178f95a1ddb7dd/websockets-15.0.1-cp312-cp312-musllinux_1_2_i686.whl", hash = "sha256:5d54b09eba2bada6011aea5375542a157637b91029687eb4fdb2dab11059c1b4", size = 182165, upload-time = "2025-03-05T20:02:30.291Z" }, + { url = "https://files.pythonhosted.org/packages/29/93/bb672df7b2f5faac89761cb5fa34f5cec45a4026c383a4b5761c6cea5c16/websockets-15.0.1-cp312-cp312-musllinux_1_2_x86_64.whl", hash = "sha256:3be571a8b5afed347da347bfcf27ba12b069d9d7f42cb8c7028b5e98bbb12597", size = 182160, upload-time = "2025-03-05T20:02:31.634Z" }, + { url = "https://files.pythonhosted.org/packages/ff/83/de1f7709376dc3ca9b7eeb4b9a07b4526b14876b6d372a4dc62312bebee0/websockets-15.0.1-cp312-cp312-win32.whl", hash = "sha256:c338ffa0520bdb12fbc527265235639fb76e7bc7faafbb93f6ba80d9c06578a9", size = 176395, upload-time = "2025-03-05T20:02:33.017Z" }, + { url = "https://files.pythonhosted.org/packages/7d/71/abf2ebc3bbfa40f391ce1428c7168fb20582d0ff57019b69ea20fa698043/websockets-15.0.1-cp312-cp312-win_amd64.whl", hash = "sha256:fcd5cf9e305d7b8338754470cf69cf81f420459dbae8a3b40cee57417f4614a7", size = 176841, upload-time = "2025-03-05T20:02:34.498Z" }, + { url = "https://files.pythonhosted.org/packages/cb/9f/51f0cf64471a9d2b4d0fc6c534f323b664e7095640c34562f5182e5a7195/websockets-15.0.1-cp313-cp313-macosx_10_13_universal2.whl", hash = "sha256:ee443ef070bb3b6ed74514f5efaa37a252af57c90eb33b956d35c8e9c10a1931", size = 175440, upload-time = "2025-03-05T20:02:36.695Z" }, + { url = "https://files.pythonhosted.org/packages/8a/05/aa116ec9943c718905997412c5989f7ed671bc0188ee2ba89520e8765d7b/websockets-15.0.1-cp313-cp313-macosx_10_13_x86_64.whl", hash = "sha256:5a939de6b7b4e18ca683218320fc67ea886038265fd1ed30173f5ce3f8e85675", size = 173098, upload-time = "2025-03-05T20:02:37.985Z" }, + { url = "https://files.pythonhosted.org/packages/ff/0b/33cef55ff24f2d92924923c99926dcce78e7bd922d649467f0eda8368923/websockets-15.0.1-cp313-cp313-macosx_11_0_arm64.whl", hash = "sha256:746ee8dba912cd6fc889a8147168991d50ed70447bf18bcda7039f7d2e3d9151", size = 173329, upload-time = "2025-03-05T20:02:39.298Z" }, + { url = "https://files.pythonhosted.org/packages/31/1d/063b25dcc01faa8fada1469bdf769de3768b7044eac9d41f734fd7b6ad6d/websockets-15.0.1-cp313-cp313-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:595b6c3969023ecf9041b2936ac3827e4623bfa3ccf007575f04c5a6aa318c22", size = 183111, upload-time = "2025-03-05T20:02:40.595Z" }, + { url = "https://files.pythonhosted.org/packages/93/53/9a87ee494a51bf63e4ec9241c1ccc4f7c2f45fff85d5bde2ff74fcb68b9e/websockets-15.0.1-cp313-cp313-manylinux_2_5_i686.manylinux1_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:3c714d2fc58b5ca3e285461a4cc0c9a66bd0e24c5da9911e30158286c9b5be7f", size = 182054, upload-time = "2025-03-05T20:02:41.926Z" }, + { url = "https://files.pythonhosted.org/packages/ff/b2/83a6ddf56cdcbad4e3d841fcc55d6ba7d19aeb89c50f24dd7e859ec0805f/websockets-15.0.1-cp313-cp313-manylinux_2_5_x86_64.manylinux1_x86_64.manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:0f3c1e2ab208db911594ae5b4f79addeb3501604a165019dd221c0bdcabe4db8", size = 182496, upload-time = "2025-03-05T20:02:43.304Z" }, + { url = "https://files.pythonhosted.org/packages/98/41/e7038944ed0abf34c45aa4635ba28136f06052e08fc2168520bb8b25149f/websockets-15.0.1-cp313-cp313-musllinux_1_2_aarch64.whl", hash = "sha256:229cf1d3ca6c1804400b0a9790dc66528e08a6a1feec0d5040e8b9eb14422375", size = 182829, upload-time = "2025-03-05T20:02:48.812Z" }, + { url = "https://files.pythonhosted.org/packages/e0/17/de15b6158680c7623c6ef0db361da965ab25d813ae54fcfeae2e5b9ef910/websockets-15.0.1-cp313-cp313-musllinux_1_2_i686.whl", hash = "sha256:756c56e867a90fb00177d530dca4b097dd753cde348448a1012ed6c5131f8b7d", size = 182217, upload-time = "2025-03-05T20:02:50.14Z" }, + { url = "https://files.pythonhosted.org/packages/33/2b/1f168cb6041853eef0362fb9554c3824367c5560cbdaad89ac40f8c2edfc/websockets-15.0.1-cp313-cp313-musllinux_1_2_x86_64.whl", hash = "sha256:558d023b3df0bffe50a04e710bc87742de35060580a293c2a984299ed83bc4e4", size = 182195, upload-time = "2025-03-05T20:02:51.561Z" }, + { url = "https://files.pythonhosted.org/packages/86/eb/20b6cdf273913d0ad05a6a14aed4b9a85591c18a987a3d47f20fa13dcc47/websockets-15.0.1-cp313-cp313-win32.whl", hash = "sha256:ba9e56e8ceeeedb2e080147ba85ffcd5cd0711b89576b83784d8605a7df455fa", size = 176393, upload-time = "2025-03-05T20:02:53.814Z" }, + { url = "https://files.pythonhosted.org/packages/1b/6c/c65773d6cab416a64d191d6ee8a8b1c68a09970ea6909d16965d26bfed1e/websockets-15.0.1-cp313-cp313-win_amd64.whl", hash = "sha256:e09473f095a819042ecb2ab9465aee615bd9c2028e4ef7d933600a8401c79561", size = 176837, upload-time = "2025-03-05T20:02:55.237Z" }, + { url = "https://files.pythonhosted.org/packages/02/9e/d40f779fa16f74d3468357197af8d6ad07e7c5a27ea1ca74ceb38986f77a/websockets-15.0.1-pp310-pypy310_pp73-macosx_10_15_x86_64.whl", hash = "sha256:0c9e74d766f2818bb95f84c25be4dea09841ac0f734d1966f415e4edfc4ef1c3", size = 173109, upload-time = "2025-03-05T20:03:17.769Z" }, + { url = "https://files.pythonhosted.org/packages/bc/cd/5b887b8585a593073fd92f7c23ecd3985cd2c3175025a91b0d69b0551372/websockets-15.0.1-pp310-pypy310_pp73-macosx_11_0_arm64.whl", hash = "sha256:1009ee0c7739c08a0cd59de430d6de452a55e42d6b522de7aa15e6f67db0b8e1", size = 173343, upload-time = "2025-03-05T20:03:19.094Z" }, + { url = "https://files.pythonhosted.org/packages/fe/ae/d34f7556890341e900a95acf4886833646306269f899d58ad62f588bf410/websockets-15.0.1-pp310-pypy310_pp73-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:76d1f20b1c7a2fa82367e04982e708723ba0e7b8d43aa643d3dcd404d74f1475", size = 174599, upload-time = "2025-03-05T20:03:21.1Z" }, + { url = "https://files.pythonhosted.org/packages/71/e6/5fd43993a87db364ec60fc1d608273a1a465c0caba69176dd160e197ce42/websockets-15.0.1-pp310-pypy310_pp73-manylinux_2_5_i686.manylinux1_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:f29d80eb9a9263b8d109135351caf568cc3f80b9928bccde535c235de55c22d9", size = 174207, upload-time = "2025-03-05T20:03:23.221Z" }, + { url = "https://files.pythonhosted.org/packages/2b/fb/c492d6daa5ec067c2988ac80c61359ace5c4c674c532985ac5a123436cec/websockets-15.0.1-pp310-pypy310_pp73-manylinux_2_5_x86_64.manylinux1_x86_64.manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:b359ed09954d7c18bbc1680f380c7301f92c60bf924171629c5db97febb12f04", size = 174155, upload-time = "2025-03-05T20:03:25.321Z" }, + { url = "https://files.pythonhosted.org/packages/68/a1/dcb68430b1d00b698ae7a7e0194433bce4f07ded185f0ee5fb21e2a2e91e/websockets-15.0.1-pp310-pypy310_pp73-win_amd64.whl", hash = "sha256:cad21560da69f4ce7658ca2cb83138fb4cf695a2ba3e475e0559e05991aa8122", size = 176884, upload-time = "2025-03-05T20:03:27.934Z" }, + { url = "https://files.pythonhosted.org/packages/fa/a8/5b41e0da817d64113292ab1f8247140aac61cbf6cfd085d6a0fa77f4984f/websockets-15.0.1-py3-none-any.whl", hash = "sha256:f7a866fbc1e97b5c617ee4116daaa09b722101d4a3c170c787450ba409f9736f", size = 169743, upload-time = "2025-03-05T20:03:39.41Z" }, ] [[package]] name = "zipp" version = "3.23.0" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/e3/02/0f2892c661036d50ede074e376733dca2ae7c6eb617489437771209d4180/zipp-3.23.0.tar.gz", hash = "sha256:a07157588a12518c9d4034df3fbbee09c814741a33ff63c05fa29d26a2404166", size = 25547 } +sdist = { url = "https://files.pythonhosted.org/packages/e3/02/0f2892c661036d50ede074e376733dca2ae7c6eb617489437771209d4180/zipp-3.23.0.tar.gz", hash = "sha256:a07157588a12518c9d4034df3fbbee09c814741a33ff63c05fa29d26a2404166", size = 25547, upload-time = "2025-06-08T17:06:39.4Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/2e/54/647ade08bf0db230bfea292f893923872fd20be6ac6f53b2b936ba839d75/zipp-3.23.0-py3-none-any.whl", hash = "sha256:071652d6115ed432f5ce1d34c336c0adfd6a884660d1e9712a256d3d3bd4b14e", size = 10276 }, + { url = "https://files.pythonhosted.org/packages/2e/54/647ade08bf0db230bfea292f893923872fd20be6ac6f53b2b936ba839d75/zipp-3.23.0-py3-none-any.whl", hash = "sha256:071652d6115ed432f5ce1d34c336c0adfd6a884660d1e9712a256d3d3bd4b14e", size = 10276, upload-time = "2025-06-08T17:06:38.034Z" }, ] From b8986d65d3bd5a09bdcf90654cc66b46f6300298 Mon Sep 17 00:00:00 2001 From: Tony Meyer Date: Fri, 8 Aug 2025 15:26:57 +1200 Subject: [PATCH 45/79] More progress. --- .sbomber-manifest-sdist.yaml | 10 ++++ .sbomber-manifest-wheel.yaml | 8 ++++ HACKING.md | 19 ++++---- docs/reference/index.md | 2 +- docs/reference/ops-tools.rst | 7 +++ pyproject.toml | 2 +- testing/tests/test_e2e/test_actions.py | 27 +++++++++++ testing/tests/test_e2e/test_config.py | 2 +- tools/README.md | 27 ++++------- tools/src/ops_tools/__init__.py | 3 +- tools/src/ops_tools/_attrdocs.py | 10 ++-- tools/src/ops_tools/_generate_yaml.py | 19 ++++++-- tools/{tests-ugh => tests_tools}/__init__.py | 4 ++ .../test_generate_yaml_action.py | 48 ++++++++++--------- .../test_generate_yaml_config.py | 3 +- 15 files changed, 125 insertions(+), 66 deletions(-) create mode 100644 docs/reference/ops-tools.rst rename tools/{tests-ugh => tests_tools}/__init__.py (72%) rename tools/{tests-ugh => tests_tools}/test_generate_yaml_action.py (84%) rename tools/{tests-ugh => tests_tools}/test_generate_yaml_config.py (99%) diff --git a/.sbomber-manifest-sdist.yaml b/.sbomber-manifest-sdist.yaml index 0108338b1..b1d5faf11 100644 --- a/.sbomber-manifest-sdist.yaml +++ b/.sbomber-manifest-sdist.yaml @@ -35,3 +35,13 @@ artifacts: version: '' channel: 'stable' cycle: '25.10' + + - name: 'ops-tools' + type: 'sdist' + version: '' + compression: 'gz' + ssdlc_params: + name: 'ops-tools' + version: '' + channel: 'stable' + cycle: '25.10' diff --git a/.sbomber-manifest-wheel.yaml b/.sbomber-manifest-wheel.yaml index e38f574ab..33b7a9cca 100644 --- a/.sbomber-manifest-wheel.yaml +++ b/.sbomber-manifest-wheel.yaml @@ -31,3 +31,11 @@ artifacts: version: '' channel: 'stable' cycle: '25.10' + + - name: 'ops-tools' + type: 'wheel' + ssdlc_params: + name: 'ops-tools' + version: '' + channel: 'stable' + cycle: '25.10' diff --git a/HACKING.md b/HACKING.md index c01bcbadb..7f0377a8f 100644 --- a/HACKING.md +++ b/HACKING.md @@ -242,13 +242,13 @@ Then, check out the main branch of your forked operator repo and pull upstream t 1. Draft a release: Run: `tox -e draft-release` at the root directory of the forked repo. > This assumes a draft release on the main branch, and your forked remote name is `origin`, and the `canonical/operator` remote name is `upstream`. - > + > > If you have different settings, add parameters accordingly. For example, the following command assumes your forked remote name is `mine`, and `canonical/operator` remote name is `origin`: - > + > > `tox -e draft-release -- --canonical-remote origin --fork-remote mine` - > + > > By default, the script makes a release on the main branch. If you want to make a release on another branch, for example, on "2.23-maintenance" (you do not need to switch to this branch in your forked repo), run it with the "--branch" parameter: - > + > > `tox -e draft-release -- --branch 2.23-maintenance` 2. Follow the steps of the `tox -e draft-release` output. You need to input the release title and an introduction section, which can be multiple paragraphs with empty lines in between. End the introduction section by typing a period sign (.) in a new line, then press enter. @@ -258,11 +258,12 @@ Then, check out the main branch of your forked operator repo and pull upstream t > You can troubleshoot errors on the [Actions Tab](https://github.com/canonical/operator/actions). > Pushing the tags will trigger automatic builds for the Python packages and - > publish them to PyPI ([ops](https://pypi.org/project/ops/) - > ,[ops-scenario](https://pypi.org/project/ops-scenario), and - > [ops-tracing](https://pypi.org/project/ops-tracing/)). + > publish them to PyPI ([ops](https://pypi.org/project/ops/) + > ,[ops-scenario](https://pypi.org/project/ops-scenario), + > [ops-tracing](https://pypi.org/project/ops-tracing/)), and + > [ops-tools](https://pypi.org/project/ops-tools/)). > Note that it sometimes take a bit of time for the new releases to show up. - > + > > See [.github/workflows/publish.yaml](.github/workflows/publish.yaml) for details. > > You can troubleshoot errors on the [Actions Tab](https://github.com/canonical/operator/actions). @@ -273,7 +274,7 @@ Then, check out the main branch of your forked operator repo and pull upstream t 7. Post release: At the root directory of your forked `canonical/operator` repo, check out to the main branch to ensure the release automation script is up-to-date, then run: `tox -e post-release`. > This assumes the same defaults as mentioned in step 1. - > + > > Add parameters accordingly if your setup differs, for example, if you are releasing from a maintenance branch. 8. Follow the steps of the `tox -e post-release` output. If it succeeds, a PR named "chore: adjust versions after release" will be created. Get it reviewed and merged. diff --git a/docs/reference/index.md b/docs/reference/index.md index 4fb51716b..1dae29a36 100644 --- a/docs/reference/index.md +++ b/docs/reference/index.md @@ -10,5 +10,5 @@ pebble ops-testing ops-testing-harness ops-tracing +ops-tools ``` - diff --git a/docs/reference/ops-tools.rst b/docs/reference/ops-tools.rst new file mode 100644 index 000000000..4cf77b12e --- /dev/null +++ b/docs/reference/ops-tools.rst @@ -0,0 +1,7 @@ +.. _ops-tools: + +`ops-tools` +=========== + +.. automodule:: ops-tools + :exclude-members: main diff --git a/pyproject.toml b/pyproject.toml index 176fcddf7..f0b2198e6 100644 --- a/pyproject.toml +++ b/pyproject.toml @@ -287,7 +287,7 @@ exclude = [ "RUF015", # Prefer `next` over single element slice "SIM115", # Use a context manager for opening files ] -"tools/tests/*" = [ +"tools/tests_tools/*" = [ # All documentation linting. "D", ] diff --git a/testing/tests/test_e2e/test_actions.py b/testing/tests/test_e2e/test_actions.py index bd45cb44a..e4dc745e5 100644 --- a/testing/tests/test_e2e/test_actions.py +++ b/testing/tests/test_e2e/test_actions.py @@ -1,5 +1,8 @@ from __future__ import annotations +import dataclasses + +import ops_tools import pytest from ops import __version__ as ops_version from ops.charm import ActionEvent, CharmBase @@ -203,3 +206,27 @@ def test_default_arguments(): assert action.name == name assert action.params == {} assert action.id == expected_id + + +def test_action_using_generated_action(): + @dataclasses.dataclass + class Act: + a: int + b: float + c: str + + class Charm(CharmBase): + def __init__(self, framework: Framework): + super().__init__(framework) + framework.observe(self.on['act'].action, self._on_action) + + def _on_action(self, event: ActionEvent): + self.typed_params = event.load_params(Act, 10, c='foo') + + schema = ops_tools.action_to_juju_schema(Act) + ctx = Context(Charm, meta={'name': 'foo'}, actions=schema) + with ctx(ctx.on.action('act', params={'b': 3.14}), State()) as mgr: + mgr.run() + assert mgr.charm.typed_params.a == 10 + assert mgr.charm.typed_params.b == 3.14 + assert mgr.charm.typed_params.c == 'foo' diff --git a/testing/tests/test_e2e/test_config.py b/testing/tests/test_e2e/test_config.py index 5fd4e2e35..a67366ed6 100644 --- a/testing/tests/test_e2e/test_config.py +++ b/testing/tests/test_e2e/test_config.py @@ -107,7 +107,7 @@ def _on_event(self, event): assert state_out.config == cfg_in -def test_config_using_configbase_class(): +def test_config_using_generated_config(): @dataclasses.dataclass class Config: a: int diff --git a/tools/README.md b/tools/README.md index aeac7cabf..76cc3e045 100644 --- a/tools/README.md +++ b/tools/README.md @@ -1,15 +1,12 @@ -# Ops charmcraft.yaml generation tooling +# Ops Tools -The definition of charm configuration options and actions should have a single -source of truth. Our preference is that truth is in the charm code: this is in -an expressive language (Python), that allows more complex type definitions and -validation than possible in the Juju config schema language or action parameter -JSONSchema. However, Juju and Charmcraft need to find these schema in the -`charmcraft.yaml` file. +A collection of tools to use when developing and maintaining Ops charms. -This package provides tooling to generate the appropriate `charmcraft.yaml` -sections for `config` and `actions` from config and action classes in the charm -Python code. +## charmcraft.yaml generation + +The definition of charm configuration options and actions should have a single source of truth. Our preference is that truth is in the charm code: this is in an expressive language (Python), that allows more complex type definitions and validation than possible in the Juju config schema language or action parameter JSONSchema. However, Juju and Charmcraft need to find these schema in the `charmcraft.yaml` file. + +The package provides tooling to generate the appropriate `charmcraft.yaml` sections for `config` and `actions` from config and action classes in the charm Python code. For example, the config class: @@ -101,12 +98,4 @@ add-admin-user: additionalProperties: false ``` -The Python classes may be: - -* Standard library `dataclasses.dataclass` classes. -* Pydantic dataclasses. -* Pydantic `BaseModel` subclasses. -* Other Python classes, as long as TODO - -Type annotations for all classes should use the modern `a | b` and `a | None` -form, rather than `Union[a, b]` or `Optional[a]`. +Type annotations for all classes should use the modern `a | b` and `a | None` form, rather than `Union[a, b]` or `Optional[a]`. diff --git a/tools/src/ops_tools/__init__.py b/tools/src/ops_tools/__init__.py index 14a440318..5b5a29d03 100644 --- a/tools/src/ops_tools/__init__.py +++ b/tools/src/ops_tools/__init__.py @@ -18,9 +18,10 @@ * Generate charmcraft.yaml from Python config and action classes. """ -from ._generate_yaml import OptionDict, action_to_juju_schema, config_to_juju_schema +from ._generate_yaml import ActionDict, OptionDict, action_to_juju_schema, config_to_juju_schema __all__ = [ + 'ActionDict', 'OptionDict', 'action_to_juju_schema', 'config_to_juju_schema', diff --git a/tools/src/ops_tools/_attrdocs.py b/tools/src/ops_tools/_attrdocs.py index ceb3681f2..1eae6479c 100644 --- a/tools/src/ops_tools/_attrdocs.py +++ b/tools/src/ops_tools/_attrdocs.py @@ -82,18 +82,18 @@ def get_attr_docstrings(cls: type[object]) -> dict[str, str]: ): docs[field.name] = field.default.description # type: ignore - for cls in cls.mro(): - if cls is object: + for schema_class in cls.mro(): + if schema_class is object: continue try: - source_code = inspect.getsource(cls) + source_code = inspect.getsource(schema_class) except OSError: - logger.debug('No source code found for %s', cls.__name__) + logger.debug('No source code found for %s', schema_class.__name__) continue try: tree = ast.parse(source_code) except (SyntaxError, IndentationError): - logger.debug('Failed to parse source code for %s', cls.__name__) + logger.debug('Failed to parse source code for %s', schema_class.__name__) continue extractor = AttributeDocstringExtractor() extractor.visit(tree) diff --git a/tools/src/ops_tools/_generate_yaml.py b/tools/src/ops_tools/_generate_yaml.py index 5275f309b..ebf61af96 100644 --- a/tools/src/ops_tools/_generate_yaml.py +++ b/tools/src/ops_tools/_generate_yaml.py @@ -30,6 +30,7 @@ get_origin, get_type_hints, ) + from typing_extensions import NotRequired import ops @@ -46,6 +47,16 @@ class OptionDict(TypedDict): default: NotRequired[bool | int | float | str] +class ActionDict(TypedDict, total=False): + description: str + params: dict[str, Any] + """A dictionary of parameters for the action.""" + required: list[str] + """A list of required parameters for the action.""" + additionalProperties: bool + """Whether additional properties are allowed in the action parameters.""" + + JUJU_TYPES: Final[Mapping[type, str]] = { bool: 'boolean', int: 'int', @@ -375,9 +386,8 @@ class RunBackup: To adjust the YAML, provide a ``to_juju_schema`` method in the class. For example, to allow additional properties:: - TODO: the type isn't right here, because we allow changing the name too. - def to_juju_schema(cls, schema: dict[str, Any]) -> dict[str, Any]: - schema['additionalProperties'] = True + def to_juju_schema(cls, schema: dict[str, ActionDict]) -> dict[str, ActionDict]: + schema['run-backup']['additionalProperties'] = True return schema """ # As of March 2025, there are no known charms that are using @@ -388,8 +398,7 @@ def to_juju_schema(cls, schema: dict[str, Any]) -> dict[str, Any]: if cls.__doc__: action['description'] = cls.__doc__ # Pydantic classes provide this, so we can just get it directly. - # The type: ignores are required because we don't want to import pydantic - # in this code. + # The type: ignores are to avoid importing pydantic. if hasattr(cls, 'schema'): schema = cls.schema() # type: ignore params = schema['properties'] # type: ignore diff --git a/tools/tests-ugh/__init__.py b/tools/tests_tools/__init__.py similarity index 72% rename from tools/tests-ugh/__init__.py rename to tools/tests_tools/__init__.py index d93a47edd..cc35be226 100644 --- a/tools/tests-ugh/__init__.py +++ b/tools/tests_tools/__init__.py @@ -11,3 +11,7 @@ # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. + +# Note that this package is called "test_tools" because we need to fix the +# structure of the operator repository to properly handle having multiple +# packages. When that's done, this can be called "tests" as expected. diff --git a/tools/tests-ugh/test_generate_yaml_action.py b/tools/tests_tools/test_generate_yaml_action.py similarity index 84% rename from tools/tests-ugh/test_generate_yaml_action.py rename to tools/tests_tools/test_generate_yaml_action.py index 4a06c11f8..81b93919e 100644 --- a/tools/tests-ugh/test_generate_yaml_action.py +++ b/tools/tests_tools/test_generate_yaml_action.py @@ -27,10 +27,8 @@ except ImportError: pydantic = None -import ops import ops_tools - logger = logging.getLogger(__name__) @@ -121,18 +119,18 @@ class Config: @pytest.mark.parametrize('action_class,action_name', _test_action_classes) -def test_action_yaml_schema(action_class: type[ops.ActionBase], action_name: str): - generated_yaml = ops_tools.action_to_juju_schema(action_class) +def test_action_yaml_schema(action_class: type[object], action_name: str): + generated_schema = ops_tools.action_to_juju_schema(action_class) if hasattr(action_class, 'schema'): # Remove the 'title' property that Pydantic adds to make the schema more # consistent with the others for simpler testing. - for prop in generated_yaml[action_name]['params'].values(): + for prop in generated_schema[action_name]['params'].values(): prop.pop('title', None) # Also adjust how `my-list` is specified. - assert generated_yaml[action_name]['params']['my-list']['items'] == {'type': 'string'} - del generated_yaml[action_name]['params']['my-list']['items'] - generated_yaml[action_name]['params']['my-list']['default'] = [] - expected_yaml: dict[str, Any] = { + assert generated_schema[action_name]['params']['my-list']['items'] == {'type': 'string'} + del generated_schema[action_name]['params']['my-list']['items'] + generated_schema[action_name]['params']['my-list']['default'] = [] + expected_schema: dict[str, Any] = { action_name: { 'description': 'An action description.', 'params': { @@ -165,7 +163,7 @@ def test_action_yaml_schema(action_class: type[ops.ActionBase], action_name: str 'additionalProperties': False, }, } - assert generated_yaml == expected_yaml + assert generated_schema == expected_schema def test_action_yaml_additional_properties(): @@ -175,19 +173,21 @@ class ActionTrue: x: int = 42 @classmethod - def to_juju_schema(cls: type[object], schema: dict[str, Any]) -> dict[str, Any]: + def to_juju_schema( + cls: type[object], schema: dict[str, ops_tools.ActionDict] + ) -> dict[str, ops_tools.ActionDict]: schema['action-true']['additionalProperties'] = True return schema - generated_yaml = ops_tools.action_to_juju_schema(ActionTrue) - expected_yaml = { + generated_schema = ops_tools.action_to_juju_schema(ActionTrue) + expected_schema = { 'action-true': { 'description': 'An action.', 'params': {'x': {'type': 'integer', 'default': 42}}, 'additionalProperties': True, }, } - assert generated_yaml == expected_yaml + assert generated_schema == expected_schema class ActionDefault: """An action.""" @@ -195,18 +195,20 @@ class ActionDefault: x: int = 42 @classmethod - def to_juju_schema(cls: type[object], schema: dict[str, Any]) -> dict[str, Any]: + def to_juju_schema( + cls: type[object], schema: dict[str, ops_tools.ActionDict] + ) -> dict[str, ops_tools.ActionDict]: del schema['action-default']['additionalProperties'] return schema - generated_yaml = ops_tools.action_to_juju_schema(ActionDefault) - expected_yaml = { + generated_schema = ops_tools.action_to_juju_schema(ActionDefault) + expected_schema = { 'action-default': { 'description': 'An action.', 'params': {'x': {'type': 'integer', 'default': 42}}, }, } - assert generated_yaml == expected_yaml + assert generated_schema == expected_schema def test_action_class_modification(): @@ -216,19 +218,21 @@ class ActionMinimum: x: int = 42 @classmethod - def to_juju_schema(cls, schema: dict[str, Any]) -> dict[str, Any]: + def to_juju_schema( + cls, schema: dict[str, ops_tools.ActionDict] + ) -> dict[str, ops_tools.ActionDict]: schema['action-minimum']['params']['x']['minimum'] = 0 return schema - generated_yaml = ops_tools.action_to_juju_schema(ActionMinimum) - expected_yaml = { + generated_schema = ops_tools.action_to_juju_schema(ActionMinimum) + expected_schema = { 'action-minimum': { 'description': 'An action.', 'additionalProperties': False, 'params': {'x': {'type': 'integer', 'default': 42, 'minimum': 0}}, }, } - assert generated_yaml == expected_yaml + assert generated_schema == expected_schema class Mode(enum.Enum): diff --git a/tools/tests-ugh/test_generate_yaml_config.py b/tools/tests_tools/test_generate_yaml_config.py similarity index 99% rename from tools/tests-ugh/test_generate_yaml_config.py rename to tools/tests_tools/test_generate_yaml_config.py index 1d18f7447..008ee992b 100644 --- a/tools/tests-ugh/test_generate_yaml_config.py +++ b/tools/tests_tools/test_generate_yaml_config.py @@ -26,10 +26,9 @@ except ImportError: pydantic = None -import ops - import ops_tools +import ops logger = logging.getLogger(__name__) From 8659adb4177a0c5d285053671bd741cbd046db3b Mon Sep 17 00:00:00 2001 From: Tony Meyer Date: Mon, 11 Aug 2025 12:04:14 +1200 Subject: [PATCH 46/79] Remaining cleanup. --- pyproject.toml | 2 +- tools/src/ops_tools/_generate_yaml.py | 45 ++++++++++--------- .../tests_tools/test_generate_yaml_action.py | 42 ++++++++++++----- tox.ini | 2 +- 4 files changed, 59 insertions(+), 32 deletions(-) diff --git a/pyproject.toml b/pyproject.toml index f0b2198e6..5439113d6 100644 --- a/pyproject.toml +++ b/pyproject.toml @@ -322,7 +322,7 @@ convention = "google" builtins-ignorelist = ["id", "min", "map", "range", "type", "TimeoutError", "ConnectionError", "Warning", "input", "format"] [tool.pyright] -include = ["ops/*.py", "ops/_private/*.py", "test/*.py", "test/charms/*/src/*.py", "testing/src/*.py", "tools/src/*.py", "tools/tests/*.py"] +include = ["ops/*.py", "ops/_private/*.py", "test/*.py", "test/charms/*/src/*.py", "testing/src/*.py", "tools/src/*.py", "tools/tests_tools/*.py"] exclude = ["tracing/*"] extraPaths = ["testing", "tracing", "tools"] pythonVersion = "3.10" # check no python > 3.10 features are used diff --git a/tools/src/ops_tools/_generate_yaml.py b/tools/src/ops_tools/_generate_yaml.py index ebf61af96..a20d0c716 100644 --- a/tools/src/ops_tools/_generate_yaml.py +++ b/tools/src/ops_tools/_generate_yaml.py @@ -66,19 +66,12 @@ class ActionDict(TypedDict, total=False): } # We currently only handle the basic types that we expect to see in real charms. +# lists and tuples (arrays) are handled without using this mapping. JSON_TYPES: Final[Mapping[type, str]] = { bool: 'boolean', int: 'integer', float: 'number', str: 'string', - list[bool]: 'array', - list[int]: 'array', - list[float]: 'array', - list[str]: 'array', - tuple[bool]: 'array', - tuple[int]: 'array', - tuple[float]: 'array', - tuple[str]: 'array', } @@ -100,10 +93,19 @@ def attr_to_default(cls: type[object], name: str) -> Any: if hasattr(field.default, 'default') else field.default ) - if field_default is not dataclasses.MISSING: + field_default_factory = ( # type: ignore + field.default.default_factory # type: ignore + if hasattr(field.default, 'default_factory') + else field.default_factory + ) + # A hack to avoid importing Pydantic here. + if ( + 'PydanticUndefinedType' not in str(type(field_default)) # type: ignore + and field_default is not dataclasses.MISSING + ): return field_default # type: ignore - if field.default_factory is not dataclasses.MISSING: - return field.default_factory() + if field_default_factory is not dataclasses.MISSING: + return field_default_factory() # type: ignore return default @@ -236,12 +238,15 @@ def to_json_schema(cls: type[object]) -> tuple[dict[str, Any], list[str]]: param = {} hint_obj = get_type_hints(cls)[attr] + origin = get_origin(hint_obj) + args = get_args(hint_obj) if isinstance(hint_obj, type) and issubclass(hint_obj, enum.Enum): param['type'] = 'string' param['enum'] = [m.value for m in hint_obj.__members__.values()] - elif isinstance(hint_obj, type) and issubclass(hint_obj, (list, tuple)): + elif isinstance(origin, type) and issubclass(origin, (list, tuple)): param['type'] = 'array' - param['items'] = {'type': attr_to_json_type(cls, attr)} + if issubclass(origin, list) and len(args) == 1: + param['items'] = {'type': JSON_TYPES.get(args[0], 'string')} else: param['type'] = attr_to_json_type(cls, attr) @@ -250,11 +255,9 @@ def to_json_schema(cls: type[object]) -> tuple[dict[str, Any], list[str]]: required = True else: required = False - if type(default) in (tuple, list): - param['items'] = {'type': attr_to_json_type(cls, attr)} - else: - if type(default) not in (bool, int, float, str): - default = str(default) + if type(default) not in (bool, int, float, str, list, tuple): + default = str(default) + if not issubclass(type(default), (list, tuple)) or len(default) > 0: param['default'] = default doc = attr_docs.get(attr) @@ -265,6 +268,7 @@ def to_json_schema(cls: type[object]) -> tuple[dict[str, Any], list[str]]: if required: required_params.append(json_name) + required_params.sort() return params, required_params @@ -401,8 +405,9 @@ def to_juju_schema(cls, schema: dict[str, ActionDict]) -> dict[str, ActionDict]: # The type: ignores are to avoid importing pydantic. if hasattr(cls, 'schema'): schema = cls.schema() # type: ignore - params = schema['properties'] # type: ignore - required_params = schema['required'] # type: ignore + params = {key.replace('_', '-'): value for key, value in schema['properties'].items()} # type: ignore + required_params = [key.replace('_', '-') for key in schema['required']] # type: ignore + required_params.sort() # type: ignore else: params, required_params = to_json_schema(cls) if params: diff --git a/tools/tests_tools/test_generate_yaml_action.py b/tools/tests_tools/test_generate_yaml_action.py index 81b93919e..04bfd3633 100644 --- a/tools/tests_tools/test_generate_yaml_action.py +++ b/tools/tests_tools/test_generate_yaml_action.py @@ -35,7 +35,12 @@ class MyAction: """An action description.""" - my_str: str + basic_bool: bool + basic_int: int + basic_float: float + basic_str: str + + my_str: str = 'foo' """A string value.""" my_bool: bool = False @@ -55,7 +60,12 @@ class MyAction: class MyDataclassAction: """An action description.""" - my_str: str + basic_bool: bool + basic_int: int + basic_float: float + basic_str: str + + my_str: str = 'foo' """A string value.""" my_bool: bool = False @@ -82,7 +92,12 @@ class MyDataclassAction: class MyPydanticDataclassAction: """An action description.""" - my_str: str = pydantic.Field(description='A string value.') + basic_bool: bool + basic_int: int + basic_float: float + basic_str: str + + my_str: str = pydantic.Field('foo', description='A string value.') my_bool: bool = pydantic.Field(False, description='A Boolean value.') my_int: int = pydantic.Field(42, description='A positive integer value.') my_float: float = pydantic.Field(3.14, description='A floating point value.') @@ -91,7 +106,12 @@ class MyPydanticDataclassAction: class MyPydanticBaseModelAction(pydantic.BaseModel): """An action description.""" - my_str: str = pydantic.Field(alias='my-str', description='A string value.') # type: ignore + basic_bool: bool + basic_int: int + basic_float: float + basic_str: str + + my_str: str = pydantic.Field('foo', alias='my-str', description='A string value.') # type: ignore my_bool: bool = pydantic.Field( False, alias='my-bool', # type: ignore @@ -126,14 +146,14 @@ def test_action_yaml_schema(action_class: type[object], action_name: str): # consistent with the others for simpler testing. for prop in generated_schema[action_name]['params'].values(): prop.pop('title', None) - # Also adjust how `my-list` is specified. - assert generated_schema[action_name]['params']['my-list']['items'] == {'type': 'string'} - del generated_schema[action_name]['params']['my-list']['items'] - generated_schema[action_name]['params']['my-list']['default'] = [] expected_schema: dict[str, Any] = { action_name: { 'description': 'An action description.', 'params': { + 'basic-bool': {'type': 'boolean'}, + 'basic-float': {'type': 'number'}, + 'basic-int': {'type': 'integer'}, + 'basic-str': {'type': 'string'}, 'my-bool': { 'type': 'boolean', 'default': False, @@ -151,15 +171,16 @@ def test_action_yaml_schema(action_class: type[object], action_name: str): }, 'my-str': { 'type': 'string', + 'default': 'foo', 'description': 'A string value.', }, 'my-list': { 'type': 'array', - 'default': [], + 'items': {'type': 'string'}, 'description': 'A list value.', }, }, - 'required': ['my-str'], + 'required': ['basic-bool', 'basic-float', 'basic-int', 'basic-str'], 'additionalProperties': False, }, } @@ -221,6 +242,7 @@ class ActionMinimum: def to_juju_schema( cls, schema: dict[str, ops_tools.ActionDict] ) -> dict[str, ops_tools.ActionDict]: + assert 'params' in schema['action-minimum'] schema['action-minimum']['params']['x']['minimum'] = 0 return schema diff --git a/tox.ini b/tox.ini index bb1219c48..9e9e922cd 100644 --- a/tox.ini +++ b/tox.ini @@ -27,7 +27,7 @@ testing_src_path = testing/src/scenario/ testing_tst_path = testing/tests/ tracing_tst_path = tracing/test/ tools_src_path = tools/src/ops_tools/ -tools_tst_path = tools/tests-ugh/ +tools_tst_path = tools/tests_tools/ examples_path = examples/ [testenv] From 82635955ac751ba6a0ae99a0075acaca6e47d725 Mon Sep 17 00:00:00 2001 From: Tony Meyer Date: Mon, 11 Aug 2025 12:26:24 +1200 Subject: [PATCH 47/79] Add a script that updates charmcraft.yaml. --- tools/pyproject.toml | 3 + tools/src/ops_tools/_attrdocs.py | 1 + tools/src/ops_tools/_generate_yaml.py | 4 +- .../src/ops_tools/_update_charmcraft_yaml.py | 92 +++++++++++++++++++ .../tests_tools/test_generate_yaml_action.py | 24 ++--- 5 files changed, 111 insertions(+), 13 deletions(-) create mode 100755 tools/src/ops_tools/_update_charmcraft_yaml.py diff --git a/tools/pyproject.toml b/tools/pyproject.toml index a2635de6c..30b9d4561 100644 --- a/tools/pyproject.toml +++ b/tools/pyproject.toml @@ -46,6 +46,9 @@ classifiers = [ "Topic :: Software Development :: Libraries", ] +[project.scripts] +update-charmcraft = "ops_tools._update_charmcraft_yaml:main" + [project.urls] "Homepage" = "https://github.com/canonical/operator" "Bug Tracker" = "https://github.com/canonical/operator/issues" diff --git a/tools/src/ops_tools/_attrdocs.py b/tools/src/ops_tools/_attrdocs.py index 1eae6479c..e61d01d58 100644 --- a/tools/src/ops_tools/_attrdocs.py +++ b/tools/src/ops_tools/_attrdocs.py @@ -40,6 +40,7 @@ def __init__(self): self._last_attr = None def visit_ClassDef(self, node: ast.ClassDef): # noqa: N802 + """Visit a class definition and extract attribute docstrings.""" # We iterate over the class definition, looking for attribute assignments. # We also track any standalone strings, and when we find one we use it # for the docstring of the most recent attribute assignments. diff --git a/tools/src/ops_tools/_generate_yaml.py b/tools/src/ops_tools/_generate_yaml.py index a20d0c716..811255f37 100644 --- a/tools/src/ops_tools/_generate_yaml.py +++ b/tools/src/ops_tools/_generate_yaml.py @@ -416,8 +416,10 @@ def to_juju_schema(cls, schema: dict[str, ActionDict]) -> dict[str, ActionDict]: action['required'] = required_params action['additionalProperties'] = False # Add a ``-`` after each A-Z character of the class name, and then - # lower-case the resulting string. + # lower-case the resulting string. Drop any 'action' suffix. action_name = re.sub(r'(? type: + """Import the specified module and get the class from the top-level namespace.""" + module_name, class_name = class_specifier.rsplit(':', 1) + module = importlib.import_module(module_name) + cls = getattr(module, class_name, None) + if cls is None: + raise ImportError(f"Class '{class_name}' not found in module '{module_name}'") + return cls + + +def main(): + """Merge generated config and action sections into charmcraft.yaml.""" + parser = argparse.ArgumentParser( + description=__doc__, + formatter_class=argparse.RawDescriptionHelpFormatter, + ) + parser.add_argument( + 'charmcraft_yaml', + help='Path to the charmcraft.yaml file to update.', + ) + parser.add_argument( + '--config-class', + action='append', + help='Python class with config classes (can be specified multiple times). ' + 'For example, "src.charm:Config"', + default=[], + ) + parser.add_argument( + '--action-class', + action='append', + help='Python class with action classes (can be specified multiple times). ' + 'For example, "src.charm:BackupAction"', + default=[], + ) + args = parser.parse_args() + + with open(args.charmcraft_yaml) as raw: + charmcraft_yaml = yaml.safe_load(raw) + + config: dict[str, dict[str, OptionDict]] = {} + for class_specifier in args.config_class: + cls = get_class_from_module(class_specifier) + config.update(config_to_juju_schema(cls)) + actions: list[dict[str, ActionDict]] = [] + for class_specifier in args.action_class: + cls = get_class_from_module(class_specifier) + actions.append(action_to_juju_schema(cls)) + actions.sort(key=lambda x: next(iter(x.keys()))) # Sort actions by name. + + if config: + charmcraft_yaml['config'] = config + if actions: + charmcraft_yaml['actions'] = actions + + with open(args.charmcraft_yaml, 'w') as raw: + yaml.safe_dump(charmcraft_yaml, raw) + + +if __name__ == '__main__': + main() diff --git a/tools/tests_tools/test_generate_yaml_action.py b/tools/tests_tools/test_generate_yaml_action.py index 04bfd3633..17aebb4f1 100644 --- a/tools/tests_tools/test_generate_yaml_action.py +++ b/tools/tests_tools/test_generate_yaml_action.py @@ -289,25 +289,25 @@ def test_action_enum(): assert generated_yaml == expected_yaml -class action: ... # noqa: N801 +class oneaction: ... # noqa: N801 -class Action: ... +class OneAction: ... -class AcTioN: ... +class oNeAcTioN: ... # noqa: N801 -class TheAction: ... +class TheOneAction: ... -class MYAction: ... +class MYOneAction: ... class ABC: ... -class myAction: ... # noqa: N801 +class myOneAction: ... # noqa: N801 class DoThisThing: ... @@ -316,13 +316,13 @@ class DoThisThing: ... @pytest.mark.parametrize( 'cls,action_name', [ - (action, 'action'), - (Action, 'action'), - (AcTioN, 'ac-tio-n'), - (TheAction, 'the-action'), - (MYAction, 'm-y-action'), + (oneaction, 'one'), + (OneAction, 'one'), + (oNeAcTioN, 'o-n-e'), + (TheOneAction, 'the-one'), + (MYOneAction, 'm-y-one'), (ABC, 'a-b-c'), - (myAction, 'my-action'), + (myOneAction, 'my-one'), (DoThisThing, 'do-this-thing'), ], ) From 76dd056ae09ed02a37b7fc5219e43e7397a79e2b Mon Sep 17 00:00:00 2001 From: Tony Meyer Date: Tue, 12 Aug 2025 10:05:40 +1200 Subject: [PATCH 48/79] Add support for releasing ops-tools. --- .gitignore | 3 +++ release.py | 10 ++++++++++ 2 files changed, 13 insertions(+) diff --git a/.gitignore b/.gitignore index 5a0206b22..ac8f3c157 100644 --- a/.gitignore +++ b/.gitignore @@ -28,6 +28,9 @@ coverage.xml ops_scenario.egg-info /testing/build/ /testing/dist/ +ops_tools.egg-info +/tools/build/ +/tools/dist/ # Smoke test artifacts *.tar.gz diff --git a/release.py b/release.py index 4bac4638f..8720497a2 100644 --- a/release.py +++ b/release.py @@ -49,6 +49,7 @@ 'ops/src': pathlib.Path('ops/version.py'), 'ops/pyproject': pathlib.Path('pyproject.toml'), 'testing': pathlib.Path('testing/pyproject.toml'), + 'tools': pathlib.Path('tools/pyproject.toml'), 'tracing': pathlib.Path('tracing/pyproject.toml'), 'uvlock': pathlib.Path('uv.lock'), } @@ -380,6 +381,13 @@ def update_tracing_version(ops_version: str): update_pyproject_versions(VERSION_FILES['tracing'], ops_version, deps={'ops': ops_version}) +def update_tools_version(ops_version: str): + """Update the tools pyproject version.""" + major, rest = ops_version.split('.', 1) + tools_version = f'{int(major) - 2}.{rest}' + update_pyproject_versions(VERSION_FILES['tools'], tools_version, deps={}) + + def update_uv_lock(): """Update the uv.lock file with the new versions.""" subprocess.run(['uv', 'lock'], check=True) # noqa: S607 @@ -415,6 +423,7 @@ def update_versions_for_release(tag: str): update_ops_version(tag, scenario_version) update_testing_version(tag, scenario_version) update_tracing_version(tag) + update_tools_version(tag) update_uv_lock() @@ -458,6 +467,7 @@ def update_versions_for_post_release(repo: github.Repository.Repository, branch_ update_ops_version(ops_version, scenario_version) update_testing_version(ops_version, scenario_version) update_tracing_version(ops_version) + update_tools_version(ops_version) update_uv_lock() From 9c72564f030728094661266718126a670abfb3ba Mon Sep 17 00:00:00 2001 From: Tony Meyer Date: Tue, 12 Aug 2025 10:05:55 +1200 Subject: [PATCH 49/79] Remove ignored files. --- tools/src/ops_tools.egg-info/PKG-INFO | 145 ------------------ tools/src/ops_tools.egg-info/SOURCES.txt | 12 -- .../ops_tools.egg-info/dependency_links.txt | 0 tools/src/ops_tools.egg-info/requires.txt | 3 - tools/src/ops_tools.egg-info/top_level.txt | 1 - 5 files changed, 161 deletions(-) delete mode 100644 tools/src/ops_tools.egg-info/PKG-INFO delete mode 100644 tools/src/ops_tools.egg-info/SOURCES.txt delete mode 100644 tools/src/ops_tools.egg-info/dependency_links.txt delete mode 100644 tools/src/ops_tools.egg-info/requires.txt delete mode 100644 tools/src/ops_tools.egg-info/top_level.txt diff --git a/tools/src/ops_tools.egg-info/PKG-INFO b/tools/src/ops_tools.egg-info/PKG-INFO deleted file mode 100644 index 2da387cc9..000000000 --- a/tools/src/ops_tools.egg-info/PKG-INFO +++ /dev/null @@ -1,145 +0,0 @@ -Metadata-Version: 2.4 -Name: ops-tools -Version: 1.2.0.dev0 -Summary: Tools to extend Ops charm code -Author: The Charm Tech team at Canonical Ltd. -License: Apache-2.0 -Project-URL: Homepage, https://github.com/canonical/operator -Project-URL: Bug Tracker, https://github.com/canonical/operator/issues -Keywords: juju,ops,charms -Classifier: Development Status :: 5 - Production/Stable -Classifier: License :: OSI Approved :: Apache Software License -Classifier: Intended Audience :: Developers -Classifier: Intended Audience :: System Administrators -Classifier: Topic :: Utilities -Classifier: Natural Language :: English -Classifier: Operating System :: MacOS :: MacOS X -Classifier: Operating System :: POSIX :: Linux -Classifier: Programming Language :: Python -Classifier: Programming Language :: Python :: 3 -Classifier: Programming Language :: Python :: 3.10 -Classifier: Programming Language :: Python :: 3.11 -Classifier: Programming Language :: Python :: 3.12 -Classifier: Programming Language :: Python :: 3.13 -Classifier: Programming Language :: Python :: 3.14 -Classifier: Programming Language :: Python :: 3 :: Only -Classifier: Programming Language :: Python :: Implementation :: CPython -Classifier: Topic :: Software Development :: Libraries -Requires-Python: >=3.10 -Description-Content-Type: text/markdown -Requires-Dist: ops==3.1.0.dev0 -Requires-Dist: PyYAML>=6.0.1 -Requires-Dist: typing_extensions~=4.2 - -# Ops charmcraft.yaml generation tooling - -The definition of charm configuration options and actions should have a single -source of truth. Our preference is that truth is in the charm code: this is in -an expressive language (Python), that allows more complex type definitions and -validation than possible in the Juju config schema language or action parameter -JSONSchema. However, Juju and Charmcraft need to find these schema in the -`charmcraft.yaml` file. - -This package provides tooling to generate the appropriate `charmcraft.yaml` -sections for `config` and `actions` from config and action classes in the charm -Python code. - -For example, the config class: - -```python -@dataclasses.dataclass(frozen=True, kw_only=True) -class MyConfig: - my_bool: bool | None = None - '''A boolean value.''' - my_float: float = 3.14 - '''A floating point value.''' - my_int: int = 42 - '''An integer value.''' - my_str: str = "foo" - '''A string value.''' - my_secret: ops.Secret | None = None - '''A user secret.''' -``` - -would generate this YAML: - -```yaml -options: - my-bool: - type: boolean - description: A boolean value. - my-float: - type: float - default: 3.14 - description: A floating point value. - my-int: - type: int - default: 42 - description: An integer value. - my-str: - type: string - default: foo - description: A string value. - my-secret: - type: secret - description: A user secret. -``` - -And the action classes: - -```python -class Compression(enum.Enum): - GZ = 'gzip' - BZ = 'bzip2' - -@dataclasses.dataclass(frozen=True, kw_only=True) -class RunBackup: - '''Backup the database.''' - - filename: str - '''The name of the backup file.''' - compression: Compression = Compression.GZ - '''The type of compression to use.''' - -@dataclasses.dataclass(frozen=True, kw_only=True) -class AddAdminUser: - '''Add a new admin user and return their credentials.''' - - username: str -``` - -would generate this YAML: - -```yaml -run-backup: - description: Backup the database. - params: - filename: - type: string - description: The name of the backup file. - compression: - type: string - description: The type of compression to use. - default: gzip - enum: [gzip, bzip2] - required: [filename] - additionalProperties: false - -add-admin-user: - description: Add a new admin user and return their credentials. - params: - username: - type: string - required: [username] - additionalProperties: false -``` - -The Python classes may be: - -* Standard library `dataclasses.dataclass` classes. -* Pydantic dataclasses. -* Pydantic `BaseModel` subclasses. -* Other Python classes, as long as TODO - -Type annotations for all classes should use the modern `a | b` and `a | None` -form, rather than `Union[a, b]` or `Optional[a]`. diff --git a/tools/src/ops_tools.egg-info/SOURCES.txt b/tools/src/ops_tools.egg-info/SOURCES.txt deleted file mode 100644 index 145eb49eb..000000000 --- a/tools/src/ops_tools.egg-info/SOURCES.txt +++ /dev/null @@ -1,12 +0,0 @@ -README.md -pyproject.toml -src/ops_tools/__init__.py -src/ops_tools/_attrdocs.py -src/ops_tools/_generate_yaml.py -src/ops_tools.egg-info/PKG-INFO -src/ops_tools.egg-info/SOURCES.txt -src/ops_tools.egg-info/dependency_links.txt -src/ops_tools.egg-info/requires.txt -src/ops_tools.egg-info/top_level.txt -tests/test_generate_yaml_action.py -tests/test_generate_yaml_config.py diff --git a/tools/src/ops_tools.egg-info/dependency_links.txt b/tools/src/ops_tools.egg-info/dependency_links.txt deleted file mode 100644 index e69de29bb..000000000 diff --git a/tools/src/ops_tools.egg-info/requires.txt b/tools/src/ops_tools.egg-info/requires.txt deleted file mode 100644 index 8427549be..000000000 --- a/tools/src/ops_tools.egg-info/requires.txt +++ /dev/null @@ -1,3 +0,0 @@ -ops==3.1.0.dev0 -PyYAML>=6.0.1 -typing_extensions~=4.2 diff --git a/tools/src/ops_tools.egg-info/top_level.txt b/tools/src/ops_tools.egg-info/top_level.txt deleted file mode 100644 index 29a82c813..000000000 --- a/tools/src/ops_tools.egg-info/top_level.txt +++ /dev/null @@ -1 +0,0 @@ -ops_tools From 36c3b649e834a8ee3cd452c32e243f34dee3db54 Mon Sep 17 00:00:00 2001 From: Tony Meyer Date: Tue, 12 Aug 2025 10:13:21 +1200 Subject: [PATCH 50/79] Use pydantic for examples. --- tools/src/ops_tools/_generate_yaml.py | 35 +++++++++++++-------------- 1 file changed, 17 insertions(+), 18 deletions(-) diff --git a/tools/src/ops_tools/_generate_yaml.py b/tools/src/ops_tools/_generate_yaml.py index 811255f37..6945fdffa 100644 --- a/tools/src/ops_tools/_generate_yaml.py +++ b/tools/src/ops_tools/_generate_yaml.py @@ -277,24 +277,23 @@ def config_to_juju_schema(cls: type[object]) -> dict[str, dict[str, OptionDict]] For example, with the class:: - @dataclasses.dataclass(frozen=True, kw_only=True) - class MyConfig: - my_bool: bool | None = None - '''A boolean value.''' - my_float: float = 3.14 - '''A floating point value.''' - my_int: int = 42 - '''An integer value.''' - my_str: str = "foo" - '''A string value.''' - my_secret: ops.Secret | None = None - '''A user secret.''' + class MyConfig(pydantic.BaseModel): + my_bool: bool = pydantic.Field(default=False, description='A boolean value.') + my_float: float = pydantic.Field( + default=3.14, description='A floating point value.' + ) + my_int: int = pydantic.Field(default=42, description='An integer value.') + my_str: str = pydantic.Field(default="foo", description='A string value.') + my_secret: ops.Secret | None = pydantic.Field( + default=None, description='A user secret.' + ) ``print(yaml.safe_dump(to_juju_schema(MyConfig)))`` will output:: options: my-bool: type: boolean + default: false description: A boolean value. my-float: type: float @@ -362,14 +361,14 @@ class Compression(enum.Enum): GZ = 'gzip' BZ = 'bzip2' - @dataclasses.dataclass(frozen=True, kw_only=True) - class RunBackup: + class RunBackup(pydantic.BaseModel): '''Backup the database.''' - filename: str - '''The name of the backup file.''' - compression: Compression = Compression.GZ - '''The type of compression to use.''' + filename: str = pydantic.Field(description='The name of the backup file.') + compression: Compression = pydantic.Field( + Compression.GZ, + description='The type of compression to use.', + ) The output will be a dictionary that can be dumped to produce YAML like this:: From 28b7a473e4453d74416b5d418c78f016f8979254 Mon Sep 17 00:00:00 2001 From: Tony Meyer Date: Tue, 12 Aug 2025 10:31:27 +1200 Subject: [PATCH 51/79] Fix stripping 'action' from the class name. --- tools/src/ops_tools/_generate_yaml.py | 5 +++-- tools/tests_tools/test_generate_yaml_action.py | 10 +++++----- 2 files changed, 8 insertions(+), 7 deletions(-) diff --git a/tools/src/ops_tools/_generate_yaml.py b/tools/src/ops_tools/_generate_yaml.py index 6945fdffa..1563fa257 100644 --- a/tools/src/ops_tools/_generate_yaml.py +++ b/tools/src/ops_tools/_generate_yaml.py @@ -416,9 +416,10 @@ def to_juju_schema(cls, schema: dict[str, ActionDict]) -> dict[str, ActionDict]: action['additionalProperties'] = False # Add a ``-`` after each A-Z character of the class name, and then # lower-case the resulting string. Drop any 'action' suffix. - action_name = re.sub(r'(? Date: Tue, 12 Aug 2025 10:31:44 +1200 Subject: [PATCH 52/79] No need to have tools installed for the integration tests at this point. --- pyproject.toml | 1 - uv.lock | 4 +--- 2 files changed, 1 insertion(+), 4 deletions(-) diff --git a/pyproject.toml b/pyproject.toml index cac7e7263..5b0a41087 100644 --- a/pyproject.toml +++ b/pyproject.toml @@ -74,7 +74,6 @@ benchmark = [ ] integration = [ "ops[testing,tracing]", - "ops-tools", "pytest~=8.4", "jubilant~=1.2", "jubilant-backports", diff --git a/uv.lock b/uv.lock index 033078b80..fa711074d 100644 --- a/uv.lock +++ b/uv.lock @@ -577,7 +577,7 @@ name = "exceptiongroup" version = "1.3.0" source = { registry = "https://pypi.org/simple" } dependencies = [ - { name = "typing-extensions", marker = "python_full_version < '3.13'" }, + { name = "typing-extensions", marker = "python_full_version < '3.11'" }, ] sdist = { url = "https://files.pythonhosted.org/packages/0b/9f/a65090624ecf468cdca03533906e7c69ed7588582240cfe7cc9e770b50eb/exceptiongroup-1.3.0.tar.gz", hash = "sha256:b241f5885f560bc56a59ee63ca4c6a8bfa46ae4ad651af316d4e81817bb9fd88", size = 29749, upload-time = "2025-05-10T17:42:51.123Z" } wheels = [ @@ -1089,7 +1089,6 @@ integration = [ { name = "jubilant-backports" }, { name = "minio" }, { name = "ops", extra = ["testing", "tracing"] }, - { name = "ops-tools" }, { name = "pytest" }, ] lint = [ @@ -1145,7 +1144,6 @@ integration = [ { name = "jubilant-backports" }, { name = "minio", specifier = "~=7.2" }, { name = "ops", extras = ["testing", "tracing"], editable = "." }, - { name = "ops-tools", editable = "tools" }, { name = "pytest", specifier = "~=8.4" }, ] lint = [ From 951d91ce451a8546510c6ec05f66bf098a8cff03 Mon Sep 17 00:00:00 2001 From: Tony Meyer Date: Tue, 12 Aug 2025 10:55:12 +1200 Subject: [PATCH 53/79] Make it more convenient to pass in the modules and classes. --- tools/pyproject.toml | 2 +- .../src/ops_tools/_update_charmcraft_yaml.py | 42 ++++++++++++------- 2 files changed, 27 insertions(+), 17 deletions(-) diff --git a/tools/pyproject.toml b/tools/pyproject.toml index 30b9d4561..b0e7d7491 100644 --- a/tools/pyproject.toml +++ b/tools/pyproject.toml @@ -18,7 +18,7 @@ license.text = "Apache-2.0" keywords = ["juju", "ops", "charms"] dependencies = [ - "ops==3.1.0.dev0", + "ops==3.2.0.dev0", "PyYAML>=6.0.1", "typing_extensions~=4.2", ] diff --git a/tools/src/ops_tools/_update_charmcraft_yaml.py b/tools/src/ops_tools/_update_charmcraft_yaml.py index 1ee8e97d4..7c7303ecc 100755 --- a/tools/src/ops_tools/_update_charmcraft_yaml.py +++ b/tools/src/ops_tools/_update_charmcraft_yaml.py @@ -24,20 +24,27 @@ import argparse import importlib +import re +from typing import Generator import yaml from . import ActionDict, OptionDict, action_to_juju_schema, config_to_juju_schema -def get_class_from_module(class_specifier: str) -> type: +def get_class_from_module(class_specifier: str) -> Generator[type]: """Import the specified module and get the class from the top-level namespace.""" - module_name, class_name = class_specifier.rsplit(':', 1) + if ':' in class_specifier: + module_name, class_name = class_specifier.rsplit(':', 1) + else: + module_name = 'src.charm' + class_name = class_specifier module = importlib.import_module(module_name) - cls = getattr(module, class_name, None) - if cls is None: - raise ImportError(f"Class '{class_name}' not found in module '{module_name}'") - return cls + for attr in dir(module): + if not isinstance(getattr(module, attr), type): + continue + if re.fullmatch(class_name, attr): + yield getattr(module, attr) def main(): @@ -47,21 +54,24 @@ def main(): formatter_class=argparse.RawDescriptionHelpFormatter, ) parser.add_argument( - 'charmcraft_yaml', + '--charmcraft-yaml', help='Path to the charmcraft.yaml file to update.', + default='charmcraft.yaml', ) parser.add_argument( '--config-class', action='append', help='Python class with config classes (can be specified multiple times). ' - 'For example, "src.charm:Config"', + 'For example, "src.config:Config". The module defaults to "src.charm".' + 'The class may be a regular expression.', default=[], ) parser.add_argument( '--action-class', action='append', help='Python class with action classes (can be specified multiple times). ' - 'For example, "src.charm:BackupAction"', + 'For example, "src.backup:BackupAction". The module defaults to "src.charm".' + 'The class may be a regular expression.', default=[], ) args = parser.parse_args() @@ -69,15 +79,15 @@ def main(): with open(args.charmcraft_yaml) as raw: charmcraft_yaml = yaml.safe_load(raw) - config: dict[str, dict[str, OptionDict]] = {} + config: dict[str, dict[str, OptionDict]] = {'options': {}} for class_specifier in args.config_class: - cls = get_class_from_module(class_specifier) - config.update(config_to_juju_schema(cls)) - actions: list[dict[str, ActionDict]] = [] + for cls in get_class_from_module(class_specifier): + config['options'].update(config_to_juju_schema(cls)['options']) + actions: dict[str, ActionDict] = {} for class_specifier in args.action_class: - cls = get_class_from_module(class_specifier) - actions.append(action_to_juju_schema(cls)) - actions.sort(key=lambda x: next(iter(x.keys()))) # Sort actions by name. + for cls in get_class_from_module(class_specifier): + actions.update(action_to_juju_schema(cls)) + actions = dict(sorted(actions.items())) # Sort actions by name. if config: charmcraft_yaml['config'] = config From bb9e760465ad87175907cf4d2978b31ad4e77f2f Mon Sep 17 00:00:00 2001 From: Tony Meyer Date: Tue, 12 Aug 2025 11:01:06 +1200 Subject: [PATCH 54/79] Improve the readme with an example to run. --- tools/README.md | 99 ++++++++++++++++++++++--------------------------- 1 file changed, 44 insertions(+), 55 deletions(-) diff --git a/tools/README.md b/tools/README.md index 76cc3e045..1d4ea5739 100644 --- a/tools/README.md +++ b/tools/README.md @@ -8,17 +8,29 @@ The definition of charm configuration options and actions should have a single s The package provides tooling to generate the appropriate `charmcraft.yaml` sections for `config` and `actions` from config and action classes in the charm Python code. -For example, the config class: +### Usage + +For example, if your charm contains a single config class in `src/charm.py` called `Config` and three actions, which all end with 'Action' (and no other classes have that name): + +```bash +update-charmcraft --config-class Config --action-class '.+Action' +``` + +If you have a config class in `src/workload.py` called `WorkloadConfig` and one in `src/charm.py` called `AdditionalConfig`: + +```bash +update-charmcraft --config-class src.workload:WorkloadConfig --config-class src.charm:AdditionalConfig +``` + +This command can be included in a pre-commit configuration, or CI workflow, to ensure that the `charmcraft.yaml` file is always in sync with the Python classes. + +### Example output + +The config class: ```python @dataclasses.dataclass(frozen=True, kw_only=True) class MyConfig: - my_bool: bool | None = None - '''A boolean value.''' - my_float: float = 3.14 - '''A floating point value.''' - my_int: int = 42 - '''An integer value.''' my_str: str = "foo" '''A string value.''' my_secret: ops.Secret | None = None @@ -28,28 +40,18 @@ class MyConfig: would generate this YAML: ```yaml -options: - my-bool: - type: boolean - description: A boolean value. - my-float: - type: float - default: 3.14 - description: A floating point value. - my-int: - type: int - default: 42 - description: An integer value. - my-str: - type: string - default: foo - description: A string value. - my-secret: - type: secret - description: A user secret. +config: + options: + my-str: + type: string + default: foo + description: A string value. + my-secret: + type: secret + description: A user secret. ``` -And the action classes: +And the action class: ```python class Compression(enum.Enum): @@ -57,45 +59,32 @@ class Compression(enum.Enum): BZ = 'bzip2' @dataclasses.dataclass(frozen=True, kw_only=True) -class RunBackup: +class RunBackupAction: '''Backup the database.''' filename: str '''The name of the backup file.''' compression: Compression = Compression.GZ '''The type of compression to use.''' - -@dataclasses.dataclass(frozen=True, kw_only=True) -class AddAdminUser: - '''Add a new admin user and return their credentials.''' - - username: str ``` would generate this YAML: ```yaml -run-backup: - description: Backup the database. - params: - filename: - type: string - description: The name of the backup file. - compression: - type: string - description: The type of compression to use. - default: gzip - enum: [gzip, bzip2] - required: [filename] - additionalProperties: false - -add-admin-user: - description: Add a new admin user and return their credentials. - params: - username: - type: string - required: [username] - additionalProperties: false +actions: + run-backup: + description: Backup the database. + params: + filename: + type: string + description: The name of the backup file. + compression: + type: string + description: The type of compression to use. + default: gzip + enum: [gzip, bzip2] + required: [filename] + additionalProperties: false ``` Type annotations for all classes should use the modern `a | b` and `a | None` form, rather than `Union[a, b]` or `Optional[a]`. From 3a94b7d015d7e6aec63a7d8f8388e7cccc97d348 Mon Sep 17 00:00:00 2001 From: Tony Meyer Date: Tue, 12 Aug 2025 11:12:33 +1200 Subject: [PATCH 55/79] Tweaks from the old review. --- tools/src/ops_tools/_attrdocs.py | 11 ++++++----- 1 file changed, 6 insertions(+), 5 deletions(-) diff --git a/tools/src/ops_tools/_attrdocs.py b/tools/src/ops_tools/_attrdocs.py index e61d01d58..1d8a82e19 100644 --- a/tools/src/ops_tools/_attrdocs.py +++ b/tools/src/ops_tools/_attrdocs.py @@ -37,7 +37,6 @@ class Foo: class AttributeDocstringExtractor(ast.NodeVisitor): def __init__(self): self.attribute_docs: dict[str, str] = {} - self._last_attr = None def visit_ClassDef(self, node: ast.ClassDef): # noqa: N802 """Visit a class definition and extract attribute docstrings.""" @@ -45,6 +44,7 @@ def visit_ClassDef(self, node: ast.ClassDef): # noqa: N802 # We also track any standalone strings, and when we find one we use it # for the docstring of the most recent attribute assignments. # This isn't perfect - but it should cover the majority of cases. + last_attr = None for child in node.body: if isinstance(child, (ast.Assign, ast.AnnAssign)): target = None # Make the type checker happy. @@ -53,14 +53,15 @@ def visit_ClassDef(self, node: ast.ClassDef): # noqa: N802 elif isinstance(child, ast.AnnAssign): target = child.target assert isinstance(target, ast.Name) - self._last_attr = target.id + last_attr = target.id elif ( isinstance(child, ast.Expr) and isinstance(child.value, ast.Constant) - and self._last_attr + and last_attr + and isinstance(child.value.value, str) ): - self.attribute_docs[self._last_attr] = child.value.value - self._last_attr = None + self.attribute_docs[last_attr] = child.value.value + last_attr = None self.generic_visit(node) From db5e7c8c1fd4ba0771269db195c563fd4eb268c8 Mon Sep 17 00:00:00 2001 From: Tony Meyer Date: Tue, 12 Aug 2025 11:15:02 +1200 Subject: [PATCH 56/79] Fix docs. --- docs/reference/ops-tools.rst | 6 +++--- 1 file changed, 3 insertions(+), 3 deletions(-) diff --git a/docs/reference/ops-tools.rst b/docs/reference/ops-tools.rst index 4cf77b12e..6bbbc3b60 100644 --- a/docs/reference/ops-tools.rst +++ b/docs/reference/ops-tools.rst @@ -1,7 +1,7 @@ -.. _ops-tools: +.. _ops_tools: -`ops-tools` +`ops_tools` =========== -.. automodule:: ops-tools +.. automodule:: ops_tools :exclude-members: main From 8db8ee80f773fd8307f93c15f50e330f16f91384 Mon Sep 17 00:00:00 2001 From: Tony Meyer Date: Fri, 15 Aug 2025 11:11:14 +1200 Subject: [PATCH 57/79] Fix the order of moving through the classes, add an explicit test for this. --- tools/src/ops_tools/_attrdocs.py | 11 ++++-- .../src/ops_tools/_update_charmcraft_yaml.py | 7 ++++ .../tests_tools/test_generate_yaml_action.py | 39 +++++++++++++++++++ 3 files changed, 54 insertions(+), 3 deletions(-) diff --git a/tools/src/ops_tools/_attrdocs.py b/tools/src/ops_tools/_attrdocs.py index 1d8a82e19..94d4ace9b 100644 --- a/tools/src/ops_tools/_attrdocs.py +++ b/tools/src/ops_tools/_attrdocs.py @@ -72,19 +72,24 @@ def get_attr_docstrings(cls: type[object]) -> dict[str, str]: for attr, field in cls.model_fields.items(): # type: ignore if hasattr(field, 'description') and field.description: # type: ignore docs[attr] = field.description # type: ignore + # If we have `model_fields` then we'll assume that this is all of the documentation. + return docs # For Pydantic dataclasses, we expect to have the docstrings in field # objects, but there's no "model_fields" attribute. - elif hasattr(cls, '__dataclass_fields__'): - for field in dataclasses.fields(cls): # type: ignore + elif dataclasses.is_dataclass(cls): + for field in dataclasses.fields(cls): if ( hasattr(field, 'default') and hasattr(field.default, 'description') and field.default.description # type: ignore ): docs[field.name] = field.default.description # type: ignore + # This might be a standard library dataclass, where there aren't + # description fields, so we fall through to collect any docstrings from + # the code as well. - for schema_class in cls.mro(): + for schema_class in reversed(cls.mro()): if schema_class is object: continue try: diff --git a/tools/src/ops_tools/_update_charmcraft_yaml.py b/tools/src/ops_tools/_update_charmcraft_yaml.py index 7c7303ecc..dd5a3170c 100755 --- a/tools/src/ops_tools/_update_charmcraft_yaml.py +++ b/tools/src/ops_tools/_update_charmcraft_yaml.py @@ -74,6 +74,13 @@ def main(): 'The class may be a regular expression.', default=[], ) + parser.add_argument( + '--merge', + action='store_true', + help='Merge the generated config and action sections into the existing charmcraft.yaml ' + 'file instead of overwriting those sections completely.', + default=False, + ) args = parser.parse_args() with open(args.charmcraft_yaml) as raw: diff --git a/tools/tests_tools/test_generate_yaml_action.py b/tools/tests_tools/test_generate_yaml_action.py index 238abbbdb..0f1cbe7c1 100644 --- a/tools/tests_tools/test_generate_yaml_action.py +++ b/tools/tests_tools/test_generate_yaml_action.py @@ -328,3 +328,42 @@ class DoThisThing: ... ) def test_action_class_name_to_action_name(cls: type[object], action_name: str): assert list(ops_tools.action_to_juju_schema(cls).keys()) == [action_name] + + +class BaseAction: + """Base action.""" + + x: int = 42 + """X-ray.""" + + +class ChildAction(BaseAction): + """Derived action.""" + + y: str = 'foo' + """Yellow.""" + + +class GrandchildAction(ChildAction): + """Grandchild action.""" + + x: int = 24 + """Xylophone.""" + z: float = 3.14 + """Zebra.""" + + +def test_action_inherited_classes(): + generated_schema = ops_tools.action_to_juju_schema(GrandchildAction) + expected_schema = { + 'grandchild': { + 'description': 'Grandchild action.', + 'params': { + 'x': {'type': 'integer', 'default': 24, 'description': 'Xylophone.'}, + 'y': {'type': 'string', 'default': 'foo', 'description': 'Yellow.'}, + 'z': {'type': 'number', 'default': 3.14, 'description': 'Zebra.'}, + }, + 'additionalProperties': False, + }, + } + assert generated_schema == expected_schema From b901a0abd31eee1e616170dd094b8324a3fbb0f7 Mon Sep 17 00:00:00 2001 From: Tony Meyer Date: Fri, 15 Aug 2025 11:14:05 +1200 Subject: [PATCH 58/79] Make the entry point name clearer. --- tools/README.md | 4 ++-- tools/pyproject.toml | 2 +- 2 files changed, 3 insertions(+), 3 deletions(-) diff --git a/tools/README.md b/tools/README.md index 1d4ea5739..7343abb6d 100644 --- a/tools/README.md +++ b/tools/README.md @@ -13,13 +13,13 @@ The package provides tooling to generate the appropriate `charmcraft.yaml` secti For example, if your charm contains a single config class in `src/charm.py` called `Config` and three actions, which all end with 'Action' (and no other classes have that name): ```bash -update-charmcraft --config-class Config --action-class '.+Action' +update-charmcraft-schema --config-class Config --action-class '.+Action' ``` If you have a config class in `src/workload.py` called `WorkloadConfig` and one in `src/charm.py` called `AdditionalConfig`: ```bash -update-charmcraft --config-class src.workload:WorkloadConfig --config-class src.charm:AdditionalConfig +update-charmcraft-schema --config-class src.workload:WorkloadConfig --config-class src.charm:AdditionalConfig ``` This command can be included in a pre-commit configuration, or CI workflow, to ensure that the `charmcraft.yaml` file is always in sync with the Python classes. diff --git a/tools/pyproject.toml b/tools/pyproject.toml index b0e7d7491..8a9b6480f 100644 --- a/tools/pyproject.toml +++ b/tools/pyproject.toml @@ -47,7 +47,7 @@ classifiers = [ ] [project.scripts] -update-charmcraft = "ops_tools._update_charmcraft_yaml:main" +update-charmcraft-schema = "ops_tools._update_charmcraft_yaml:main" [project.urls] "Homepage" = "https://github.com/canonical/operator" From 335c01cc9df5334fdd9a56d36fba23745f08cb32 Mon Sep 17 00:00:00 2001 From: Tony Meyer Date: Fri, 15 Aug 2025 11:26:48 +1200 Subject: [PATCH 59/79] Allow merging rather than replacing. --- tools/src/ops_tools/_update_charmcraft_yaml.py | 10 ++++++++-- 1 file changed, 8 insertions(+), 2 deletions(-) diff --git a/tools/src/ops_tools/_update_charmcraft_yaml.py b/tools/src/ops_tools/_update_charmcraft_yaml.py index dd5a3170c..b0041a7ff 100755 --- a/tools/src/ops_tools/_update_charmcraft_yaml.py +++ b/tools/src/ops_tools/_update_charmcraft_yaml.py @@ -97,9 +97,15 @@ def main(): actions = dict(sorted(actions.items())) # Sort actions by name. if config: - charmcraft_yaml['config'] = config + if args.merge and 'config' in charmcraft_yaml: + charmcraft_yaml['config']['options'].update(config['options']) + else: + charmcraft_yaml['config'] = config if actions: - charmcraft_yaml['actions'] = actions + if args.merge and 'actions' in charmcraft_yaml: + charmcraft_yaml['actions'].update(actions) + else: + charmcraft_yaml['actions'] = actions with open(args.charmcraft_yaml, 'w') as raw: yaml.safe_dump(charmcraft_yaml, raw) From 71d14d6259a06402e12a3ea2209e2e770c092d75 Mon Sep 17 00:00:00 2001 From: Tony Meyer Date: Fri, 15 Aug 2025 11:38:41 +1200 Subject: [PATCH 60/79] Add a diff method. --- .../src/ops_tools/_update_charmcraft_yaml.py | 37 +++++++++++++++++++ 1 file changed, 37 insertions(+) diff --git a/tools/src/ops_tools/_update_charmcraft_yaml.py b/tools/src/ops_tools/_update_charmcraft_yaml.py index b0041a7ff..92ea9226e 100755 --- a/tools/src/ops_tools/_update_charmcraft_yaml.py +++ b/tools/src/ops_tools/_update_charmcraft_yaml.py @@ -23,8 +23,10 @@ """Update a charmcraft.yaml file with generated config and action sections.""" import argparse +import difflib import importlib import re +import sys from typing import Generator import yaml @@ -81,6 +83,14 @@ def main(): 'file instead of overwriting those sections completely.', default=False, ) + parser.add_argument( + '--diff', + action='store_true', + help='Show the differences between the generated config and action sections and the ' + 'existing charmcraft.yaml file instead of writing to the file. Exit non-zero if there are ' + 'differences.', + default=False, + ) args = parser.parse_args() with open(args.charmcraft_yaml) as raw: @@ -96,6 +106,33 @@ def main(): actions.update(action_to_juju_schema(cls)) actions = dict(sorted(actions.items())) # Sort actions by name. + if args.diff: + exit_code = 0 + + if 'config' in charmcraft_yaml: + existing_config = charmcraft_yaml['config']['options'] + else: + existing_config = {} + if config != {'options': existing_config}: + print('Config section differs from existing charmcraft.yaml:\n') + existing = yaml.safe_dump({'config': {'options': existing_config}}) + generated = yaml.safe_dump({'config': config}) + differ = difflib.Differ() + result = differ.compare(existing.splitlines(), generated.splitlines()) + print('\n'.join(result)) + exit_code += 1 + + existing_actions = charmcraft_yaml.get('actions', {}) + if actions != existing_actions: + print('Action section differs from existing charmcraft.yaml:\n') + existing = yaml.safe_dump({'actions': existing_actions}) + generated = yaml.safe_dump({'actions': actions}) + differ = difflib.Differ() + result = differ.compare(existing.splitlines(), generated.splitlines()) + print('\n'.join(result)) + exit_code += 2 + sys.exit(exit_code) + if config: if args.merge and 'config' in charmcraft_yaml: charmcraft_yaml['config']['options'].update(config['options']) From a5b5dc587093d905d976a87f095a500046020560 Mon Sep 17 00:00:00 2001 From: Tony Meyer Date: Fri, 15 Aug 2025 13:47:02 +1200 Subject: [PATCH 61/79] WiP doctests. --- tools/src/ops_tools/_generate_yaml.py | 133 ++++++++++++++------------ tox.ini | 5 +- 2 files changed, 73 insertions(+), 65 deletions(-) diff --git a/tools/src/ops_tools/_generate_yaml.py b/tools/src/ops_tools/_generate_yaml.py index 1563fa257..64b7c8da8 100644 --- a/tools/src/ops_tools/_generate_yaml.py +++ b/tools/src/ops_tools/_generate_yaml.py @@ -275,41 +275,44 @@ def to_json_schema(cls: type[object]) -> tuple[dict[str, Any], list[str]]: def config_to_juju_schema(cls: type[object]) -> dict[str, dict[str, OptionDict]]: """Translate the class to YAML suitable for charmcraft.yaml. - For example, with the class:: - - class MyConfig(pydantic.BaseModel): - my_bool: bool = pydantic.Field(default=False, description='A boolean value.') - my_float: float = pydantic.Field( - default=3.14, description='A floating point value.' - ) - my_int: int = pydantic.Field(default=42, description='An integer value.') - my_str: str = pydantic.Field(default="foo", description='A string value.') - my_secret: ops.Secret | None = pydantic.Field( - default=None, description='A user secret.' - ) - - ``print(yaml.safe_dump(to_juju_schema(MyConfig)))`` will output:: - + For example:: + + >>> import pydantic + >>> import yaml + >>> class MyConfig(pydantic.BaseModel): + ... my_bool: bool = pydantic.Field(default=False, description='A boolean value.') + ... my_float: float = pydantic.Field( + ... default=3.14, description='A floating point value.' + ... ) + ... my_int: int = pydantic.Field(default=42, description='An integer value.') + ... my_str: str = pydantic.Field(default="foo", description='A string value.') + ... my_secret: ops.Secret | None = pydantic.Field( + ... default=None, description='A user secret.' + ... ) + ... class Config: + ... arbitrary_types_allowed = True + >>> print(yaml.safe_dump(config_to_juju_schema(MyConfig))) options: - my-bool: - type: boolean - default: false - description: A boolean value. - my-float: - type: float - default: 3.14 - description: A floating point value. - my-int: - type: int - default: 42 - description: An integer value. - my-str: - type: string - default: foo - description: A string value. - my-secret: - type: secret - description: A user secret. + my-bool: + type: boolean + default: false + description: A boolean value. + my-float: + type: float + default: 3.14 + description: A floating point value. + my-int: + type: int + default: 42 + description: An integer value. + my-str: + type: string + default: foo + description: A string value. + my-secret: + type: secret + description: A user secret. + Options with a default value of ``None`` will not have a ``default`` key in the output. If the type of the option cannot be determined, it will @@ -355,36 +358,40 @@ def to_juju_schema(cls, schema: dict[str, OptionDict]) -> dict[str, OptionDict]: def action_to_juju_schema(cls: type[object]) -> dict[str, Any]: """Translate the class to a dictionary suitable for ``charmcraft.yaml``. - For example, with the classes:: - - class Compression(enum.Enum): - GZ = 'gzip' - BZ = 'bzip2' - - class RunBackup(pydantic.BaseModel): - '''Backup the database.''' - - filename: str = pydantic.Field(description='The name of the backup file.') - compression: Compression = pydantic.Field( - Compression.GZ, - description='The type of compression to use.', - ) - - The output will be a dictionary that can be dumped to produce YAML like this:: - + For example:: + + >>> import enum + >>> import pydantic + >>> import yaml + >>> class RunBackup(pydantic.BaseModel): + ... '''Backup the database.''' + ... class Compression(enum.Enum): + ... GZ = 'gzip' + ... BZ = 'bzip2' + ... + ... filename: str = pydantic.Field(description='The name of the backup file.') + ... compression: Compression = pydantic.Field( + ... Compression.GZ, + ... description='The type of compression to use.', + ... ) + >>> print(yaml.safe_dump(action_to_juju_schema(RunBackup))) run-backup: - description: Backup the database. - params: - filename: - type: string - description: The name of the backup file. - compression: - type: string - description: The type of compression to use. - default: gzip - enum: [gzip, bzip2] - required: [filename] - additionalProperties: false + additionalProperties: false + description: Backup the database. + params: + compression: + type: string + default: gzip + description: The type of compression to use. + enum: [gzip, bzip2] + filename: + description: The name of the backup file. + title: Filename + type: string + required: + - filename + + >>> To adjust the YAML, provide a ``to_juju_schema`` method in the class. For example, to allow additional properties:: diff --git a/tox.ini b/tox.ini index fa7e1ecb9..d755035b0 100644 --- a/tox.ini +++ b/tox.ini @@ -93,7 +93,7 @@ passenv = PEBBLE dependency_groups = unit, xdist commands = - pytest -n auto \ + pytest --doctest-modules -n auto \ --ignore={[vars]tst_path}smoke \ --ignore={[vars]tst_path}integration \ --ignore={[vars]tst_path}benchmark \ @@ -112,7 +112,8 @@ passenv = dependency_groups = unit, coverage commands = coverage run --source={[vars]src_path},{[vars]testing_src_path} \ - --branch -m pytest --ignore={[vars]tst_path}smoke \ + --branch -m pytest \ + --ignore={[vars]tst_path}smoke \ --ignore={[vars]tst_path}integration \ --ignore={[vars]tst_path}benchmark \ --ignore={[vars]testing_tst_path}benchmark \ From b2efed58a18719b7864b2938f3eea7097411d86f Mon Sep 17 00:00:00 2001 From: Tony Meyer Date: Tue, 19 Aug 2025 10:27:57 +1200 Subject: [PATCH 62/79] Edit the charmcraft.yaml in a way that preserves comments and ordering. --- .../src/ops_tools/_update_charmcraft_yaml.py | 61 +++++++++++++++---- 1 file changed, 50 insertions(+), 11 deletions(-) diff --git a/tools/src/ops_tools/_update_charmcraft_yaml.py b/tools/src/ops_tools/_update_charmcraft_yaml.py index 92ea9226e..aaa12e7c5 100755 --- a/tools/src/ops_tools/_update_charmcraft_yaml.py +++ b/tools/src/ops_tools/_update_charmcraft_yaml.py @@ -22,12 +22,14 @@ """Update a charmcraft.yaml file with generated config and action sections.""" +from __future__ import annotations + import argparse import difflib import importlib import re import sys -from typing import Generator +from typing import Any, Generator import yaml @@ -49,6 +51,45 @@ def get_class_from_module(class_specifier: str) -> Generator[type]: yield getattr(module, attr) +def _insert_into_charmcraft_yaml( + raw_yaml: str, section_name: str, replacement: dict[str, Any] +) -> str: + """Surgically insert a section into charmcraft.yaml. + + The specified section of charmcraft.yaml is replaced with the provided data. + However, the rest of the file is left unchanged; in particular, comments and + ordering is preserved. + """ + # To simplify the regular expressions, look for four variants. Firstly, + # there is a section with YAML both before and after it. + mo = re.match( + rf'(?P.*)^{section_name}:(?P\s+).+?^(?P\w.*)', + raw_yaml, + re.DOTALL | re.MULTILINE, + ) + if mo: + replacement_section = yaml.safe_dump(replacement, indent=len(mo['tab_size'])) + return f'{mo["before"]}{replacement_section}{mo["after"]}' + # Secondly, there is a section with YAML before it, but no section after it. + mo = re.match( + rf'(?P.*)^{section_name}:(?P\s+).+', raw_yaml, re.DOTALL | re.MULTILINE + ) + if mo: + replacement_section = yaml.safe_dump(replacement, indent=len(mo['tab_size'])) + return f'{mo["before"]}{replacement_section}' + # Next, there is a section with no YAML before it, but YAML after it. + mo = re.match( + rf'^{section_name}:(?P\s+).+?^(?P\w.*)', + raw_yaml, + re.DOTALL | re.MULTILINE, + ) + if mo: + replacement_section = yaml.safe_dump(replacement, indent=len(mo['tab_size'])) + return f'{replacement_section}{mo["after"]}' + # Finally, there is no existing config section. + return f'{raw_yaml}\n{yaml.safe_dump(replacement, indent=2)}' + + def main(): """Merge generated config and action sections into charmcraft.yaml.""" parser = argparse.ArgumentParser( @@ -94,7 +135,8 @@ def main(): args = parser.parse_args() with open(args.charmcraft_yaml) as raw: - charmcraft_yaml = yaml.safe_load(raw) + raw_yaml = raw.read() + charmcraft_yaml = yaml.safe_load(raw_yaml) config: dict[str, dict[str, OptionDict]] = {'options': {}} for class_specifier in args.config_class: @@ -133,19 +175,16 @@ def main(): exit_code += 2 sys.exit(exit_code) - if config: - if args.merge and 'config' in charmcraft_yaml: - charmcraft_yaml['config']['options'].update(config['options']) - else: - charmcraft_yaml['config'] = config + if args.merge and 'config' in charmcraft_yaml: + config = charmcraft_yaml['config']['options'].update(config['options']) + raw_yaml = _insert_into_charmcraft_yaml(raw_yaml, 'config', {'config': config}) if actions: if args.merge and 'actions' in charmcraft_yaml: - charmcraft_yaml['actions'].update(actions) - else: - charmcraft_yaml['actions'] = actions + actions = charmcraft_yaml['actions'].update(actions) + raw_yaml = _insert_into_charmcraft_yaml(raw_yaml, 'actions', {'actions': actions}) with open(args.charmcraft_yaml, 'w') as raw: - yaml.safe_dump(charmcraft_yaml, raw) + raw.write(raw_yaml) if __name__ == '__main__': From b485a506a4723c6d70d7eb087c11a0ebe55003f5 Mon Sep 17 00:00:00 2001 From: Tony Meyer Date: Tue, 19 Aug 2025 11:06:12 +1200 Subject: [PATCH 63/79] Update for newer pyright. --- tools/tests_tools/test_generate_yaml_action.py | 12 ++++++------ 1 file changed, 6 insertions(+), 6 deletions(-) diff --git a/tools/tests_tools/test_generate_yaml_action.py b/tools/tests_tools/test_generate_yaml_action.py index 0f1cbe7c1..8f5b2b8a0 100644 --- a/tools/tests_tools/test_generate_yaml_action.py +++ b/tools/tests_tools/test_generate_yaml_action.py @@ -77,7 +77,7 @@ class MyDataclassAction: my_float: float = 3.14 """A floating point value.""" - my_list: list[str] = dataclasses.field(default_factory=list) + my_list: list[str] = dataclasses.field(default_factory=list) # type: ignore """A list value.""" @@ -111,20 +111,20 @@ class MyPydanticBaseModelAction(pydantic.BaseModel): basic_float: float basic_str: str - my_str: str = pydantic.Field('foo', alias='my-str', description='A string value.') # type: ignore + my_str: str = pydantic.Field('foo', alias='my-str', description='A string value.') my_bool: bool = pydantic.Field( False, - alias='my-bool', # type: ignore + alias='my-bool', description='A Boolean value.', ) - my_int: int = pydantic.Field(42, alias='my-int', description='A positive integer value.') # type: ignore + my_int: int = pydantic.Field(42, alias='my-int', description='A positive integer value.') my_float: float = pydantic.Field( 3.14, - alias='my-float', # type: ignore + alias='my-float', description='A floating point value.', ) my_list: list[str] = pydantic.Field( - alias='my-list', # type: ignore + alias='my-list', default_factory=list, description='A list value.', ) From f88806306e25a71eda0cbafff51d152bb48fc58c Mon Sep 17 00:00:00 2001 From: Tony Meyer Date: Tue, 19 Aug 2025 12:03:31 +1200 Subject: [PATCH 64/79] Fix order of output. --- tools/src/ops_tools/_generate_yaml.py | 14 +++++++------- 1 file changed, 7 insertions(+), 7 deletions(-) diff --git a/tools/src/ops_tools/_generate_yaml.py b/tools/src/ops_tools/_generate_yaml.py index 64b7c8da8..510ab81ee 100644 --- a/tools/src/ops_tools/_generate_yaml.py +++ b/tools/src/ops_tools/_generate_yaml.py @@ -294,24 +294,24 @@ def config_to_juju_schema(cls: type[object]) -> dict[str, dict[str, OptionDict]] >>> print(yaml.safe_dump(config_to_juju_schema(MyConfig))) options: my-bool: - type: boolean default: false description: A boolean value. + type: boolean my-float: - type: float default: 3.14 description: A floating point value. + type: float my-int: - type: int default: 42 description: An integer value. + type: int + my-secret: + description: A user secret. + type: secret my-str: - type: string default: foo description: A string value. - my-secret: - type: secret - description: A user secret. + type: string Options with a default value of ``None`` will not have a ``default`` key From 36aa0e050dc4e493f0c6aa98d4a0d1f3e1f56bfc Mon Sep 17 00:00:00 2001 From: Tony Meyer Date: Wed, 27 Aug 2025 13:25:05 +1200 Subject: [PATCH 65/79] Update tools/README.md Co-authored-by: James Garner --- tools/README.md | 2 +- 1 file changed, 1 insertion(+), 1 deletion(-) diff --git a/tools/README.md b/tools/README.md index 7343abb6d..f83f9ad82 100644 --- a/tools/README.md +++ b/tools/README.md @@ -87,4 +87,4 @@ actions: additionalProperties: false ``` -Type annotations for all classes should use the modern `a | b` and `a | None` form, rather than `Union[a, b]` or `Optional[a]`. +Type annotations for all classes must use the modern `a | b` and `a | None` form, rather than `Union[a, b]` or `Optional[a]`. From 9044d61b882eef1e21202d82d338ebba3d50ec4c Mon Sep 17 00:00:00 2001 From: Tony Meyer Date: Wed, 27 Aug 2025 13:26:21 +1200 Subject: [PATCH 66/79] Apply suggestions from code review Co-authored-by: James Garner --- tools/src/ops_tools/_attrdocs.py | 4 +++- 1 file changed, 3 insertions(+), 1 deletion(-) diff --git a/tools/src/ops_tools/_attrdocs.py b/tools/src/ops_tools/_attrdocs.py index 94d4ace9b..012de7999 100644 --- a/tools/src/ops_tools/_attrdocs.py +++ b/tools/src/ops_tools/_attrdocs.py @@ -77,7 +77,7 @@ def get_attr_docstrings(cls: type[object]) -> dict[str, str]: # For Pydantic dataclasses, we expect to have the docstrings in field # objects, but there's no "model_fields" attribute. - elif dataclasses.is_dataclass(cls): + if dataclasses.is_dataclass(cls): for field in dataclasses.fields(cls): if ( hasattr(field, 'default') @@ -85,6 +85,8 @@ def get_attr_docstrings(cls: type[object]) -> dict[str, str]: and field.default.description # type: ignore ): docs[field.name] = field.default.description # type: ignore + if docs: + return docs # This might be a standard library dataclass, where there aren't # description fields, so we fall through to collect any docstrings from # the code as well. From 89cac5845566053490b47c349e8f4b6bb78aab70 Mon Sep 17 00:00:00 2001 From: Tony Meyer Date: Wed, 27 Aug 2025 13:31:59 +1200 Subject: [PATCH 67/79] Tweak args, per review. --- tools/src/ops_tools/_update_charmcraft_yaml.py | 14 +++++++------- 1 file changed, 7 insertions(+), 7 deletions(-) diff --git a/tools/src/ops_tools/_update_charmcraft_yaml.py b/tools/src/ops_tools/_update_charmcraft_yaml.py index aaa12e7c5..1f857d658 100755 --- a/tools/src/ops_tools/_update_charmcraft_yaml.py +++ b/tools/src/ops_tools/_update_charmcraft_yaml.py @@ -97,12 +97,12 @@ def main(): formatter_class=argparse.RawDescriptionHelpFormatter, ) parser.add_argument( - '--charmcraft-yaml', + '--path', help='Path to the charmcraft.yaml file to update.', default='charmcraft.yaml', ) parser.add_argument( - '--config-class', + '--config', action='append', help='Python class with config classes (can be specified multiple times). ' 'For example, "src.config:Config". The module defaults to "src.charm".' @@ -110,7 +110,7 @@ def main(): default=[], ) parser.add_argument( - '--action-class', + '--action', action='append', help='Python class with action classes (can be specified multiple times). ' 'For example, "src.backup:BackupAction". The module defaults to "src.charm".' @@ -134,16 +134,16 @@ def main(): ) args = parser.parse_args() - with open(args.charmcraft_yaml) as raw: + with open(args.path) as raw: raw_yaml = raw.read() charmcraft_yaml = yaml.safe_load(raw_yaml) config: dict[str, dict[str, OptionDict]] = {'options': {}} - for class_specifier in args.config_class: + for class_specifier in args.config: for cls in get_class_from_module(class_specifier): config['options'].update(config_to_juju_schema(cls)['options']) actions: dict[str, ActionDict] = {} - for class_specifier in args.action_class: + for class_specifier in args.action: for cls in get_class_from_module(class_specifier): actions.update(action_to_juju_schema(cls)) actions = dict(sorted(actions.items())) # Sort actions by name. @@ -183,7 +183,7 @@ def main(): actions = charmcraft_yaml['actions'].update(actions) raw_yaml = _insert_into_charmcraft_yaml(raw_yaml, 'actions', {'actions': actions}) - with open(args.charmcraft_yaml, 'w') as raw: + with open(args.path, 'w') as raw: raw.write(raw_yaml) From 181ce73d9004ea705bbf4b7048f75f3d095a703e Mon Sep 17 00:00:00 2001 From: Tony Meyer Date: Wed, 27 Aug 2025 13:57:44 +1200 Subject: [PATCH 68/79] Apply suggestions from code review Co-authored-by: James Garner --- tools/src/ops_tools/_generate_yaml.py | 5 ++++- 1 file changed, 4 insertions(+), 1 deletion(-) diff --git a/tools/src/ops_tools/_generate_yaml.py b/tools/src/ops_tools/_generate_yaml.py index 510ab81ee..201106da1 100644 --- a/tools/src/ops_tools/_generate_yaml.py +++ b/tools/src/ops_tools/_generate_yaml.py @@ -43,6 +43,7 @@ class OptionDict(TypedDict): type: str """The Juju option type.""" + description: NotRequired[str] default: NotRequired[bool | int | float | str] @@ -51,8 +52,10 @@ class ActionDict(TypedDict, total=False): description: str params: dict[str, Any] """A dictionary of parameters for the action.""" + required: list[str] """A list of required parameters for the action.""" + additionalProperties: bool """Whether additional properties are allowed in the action parameters.""" @@ -75,7 +78,7 @@ class ActionDict(TypedDict, total=False): } -def attr_to_default(cls: type[object], name: str) -> Any: +def attr_to_default(cls: type[object], name: str) -> object: """Get the default value for the attribute.""" if not dataclasses.is_dataclass(cls): return getattr(cls, name, None) From 3d26c4b4f58d131dfae7c8ef2888f311cdd3484f Mon Sep 17 00:00:00 2001 From: Tony Meyer Date: Wed, 3 Sep 2025 14:42:00 +1200 Subject: [PATCH 69/79] Apply suggestions from code review Co-authored-by: James Garner --- tools/src/ops_tools/_update_charmcraft_yaml.py | 4 ++-- 1 file changed, 2 insertions(+), 2 deletions(-) diff --git a/tools/src/ops_tools/_update_charmcraft_yaml.py b/tools/src/ops_tools/_update_charmcraft_yaml.py index 1f857d658..c625000cb 100755 --- a/tools/src/ops_tools/_update_charmcraft_yaml.py +++ b/tools/src/ops_tools/_update_charmcraft_yaml.py @@ -104,7 +104,7 @@ def main(): parser.add_argument( '--config', action='append', - help='Python class with config classes (can be specified multiple times). ' + help='Python class with optional module path (can be specified multiple times). ' 'For example, "src.config:Config". The module defaults to "src.charm".' 'The class may be a regular expression.', default=[], @@ -112,7 +112,7 @@ def main(): parser.add_argument( '--action', action='append', - help='Python class with action classes (can be specified multiple times). ' + help='Python class with optional module path (can be specified multiple times). ' 'For example, "src.backup:BackupAction". The module defaults to "src.charm".' 'The class may be a regular expression.', default=[], From 223ed26a0ae0a0f138135489f1074989cb1efdba Mon Sep 17 00:00:00 2001 From: Tony Meyer Date: Fri, 5 Sep 2025 11:45:22 +1200 Subject: [PATCH 70/79] Remove the --merge and --diff options. --- .../src/ops_tools/_update_charmcraft_yaml.py | 49 ------------------- 1 file changed, 49 deletions(-) diff --git a/tools/src/ops_tools/_update_charmcraft_yaml.py b/tools/src/ops_tools/_update_charmcraft_yaml.py index c625000cb..a000130ea 100755 --- a/tools/src/ops_tools/_update_charmcraft_yaml.py +++ b/tools/src/ops_tools/_update_charmcraft_yaml.py @@ -25,10 +25,8 @@ from __future__ import annotations import argparse -import difflib import importlib import re -import sys from typing import Any, Generator import yaml @@ -117,26 +115,10 @@ def main(): 'The class may be a regular expression.', default=[], ) - parser.add_argument( - '--merge', - action='store_true', - help='Merge the generated config and action sections into the existing charmcraft.yaml ' - 'file instead of overwriting those sections completely.', - default=False, - ) - parser.add_argument( - '--diff', - action='store_true', - help='Show the differences between the generated config and action sections and the ' - 'existing charmcraft.yaml file instead of writing to the file. Exit non-zero if there are ' - 'differences.', - default=False, - ) args = parser.parse_args() with open(args.path) as raw: raw_yaml = raw.read() - charmcraft_yaml = yaml.safe_load(raw_yaml) config: dict[str, dict[str, OptionDict]] = {'options': {}} for class_specifier in args.config: @@ -148,39 +130,8 @@ def main(): actions.update(action_to_juju_schema(cls)) actions = dict(sorted(actions.items())) # Sort actions by name. - if args.diff: - exit_code = 0 - - if 'config' in charmcraft_yaml: - existing_config = charmcraft_yaml['config']['options'] - else: - existing_config = {} - if config != {'options': existing_config}: - print('Config section differs from existing charmcraft.yaml:\n') - existing = yaml.safe_dump({'config': {'options': existing_config}}) - generated = yaml.safe_dump({'config': config}) - differ = difflib.Differ() - result = differ.compare(existing.splitlines(), generated.splitlines()) - print('\n'.join(result)) - exit_code += 1 - - existing_actions = charmcraft_yaml.get('actions', {}) - if actions != existing_actions: - print('Action section differs from existing charmcraft.yaml:\n') - existing = yaml.safe_dump({'actions': existing_actions}) - generated = yaml.safe_dump({'actions': actions}) - differ = difflib.Differ() - result = differ.compare(existing.splitlines(), generated.splitlines()) - print('\n'.join(result)) - exit_code += 2 - sys.exit(exit_code) - - if args.merge and 'config' in charmcraft_yaml: - config = charmcraft_yaml['config']['options'].update(config['options']) raw_yaml = _insert_into_charmcraft_yaml(raw_yaml, 'config', {'config': config}) if actions: - if args.merge and 'actions' in charmcraft_yaml: - actions = charmcraft_yaml['actions'].update(actions) raw_yaml = _insert_into_charmcraft_yaml(raw_yaml, 'actions', {'actions': actions}) with open(args.path, 'w') as raw: From 7f99709947e231fe34442b60f722fbbe6e3ea13e Mon Sep 17 00:00:00 2001 From: Tony Meyer Date: Fri, 5 Sep 2025 11:52:02 +1200 Subject: [PATCH 71/79] Remove unnecessary comment. --- testing/src/scenario/state.py | 4 ---- 1 file changed, 4 deletions(-) diff --git a/testing/src/scenario/state.py b/testing/src/scenario/state.py index 1cd2a1ed5..d4f1413c6 100644 --- a/testing/src/scenario/state.py +++ b/testing/src/scenario/state.py @@ -1975,10 +1975,6 @@ def autoload(charm_type: type[CharmBase]) -> _CharmSpec[CharmType]: # try to load using legacy metadata.yaml/actions.yaml/config.yaml files meta, config, actions = _CharmSpec._load_metadata_legacy(charm_root) - # TODO: ideally, we would look for ConfigBase classes in the charm - # module and autoload from there at this point. Leaving this until the - # conversation about if & how the generation is done is resolved. - if not meta: # still no metadata? bug out raise MetadataNotFoundError( From 04631c292882fad96216ae46cf97cbfa210efd20 Mon Sep 17 00:00:00 2001 From: Tony Meyer Date: Fri, 5 Sep 2025 11:52:20 +1200 Subject: [PATCH 72/79] Include tools in coverage. --- tox.ini | 2 +- 1 file changed, 1 insertion(+), 1 deletion(-) diff --git a/tox.ini b/tox.ini index f60c7864d..0fba79aef 100644 --- a/tox.ini +++ b/tox.ini @@ -109,7 +109,7 @@ passenv = PEBBLE dependency_groups = unit, coverage commands = - coverage run --source={[vars]src_path},{[vars]testing_src_path} \ + coverage run --source={[vars]src_path},{[vars]testing_src_path},{[vars]tools_src_path} \ --branch -m pytest \ --ignore={[vars]tst_path}smoke \ --ignore={[vars]tst_path}integration \ From d670d04403bb4f24bf0e6e02b1bb6ad0bfb97140 Mon Sep 17 00:00:00 2001 From: Tony Meyer Date: Fri, 5 Sep 2025 11:52:31 +1200 Subject: [PATCH 73/79] Tweak comment, per review. --- tools/src/ops_tools/_generate_yaml.py | 3 ++- 1 file changed, 2 insertions(+), 1 deletion(-) diff --git a/tools/src/ops_tools/_generate_yaml.py b/tools/src/ops_tools/_generate_yaml.py index 201106da1..fbb5175fa 100644 --- a/tools/src/ops_tools/_generate_yaml.py +++ b/tools/src/ops_tools/_generate_yaml.py @@ -69,7 +69,8 @@ class ActionDict(TypedDict, total=False): } # We currently only handle the basic types that we expect to see in real charms. -# lists and tuples (arrays) are handled without using this mapping. +# Arrays and objects (lists, tuples, and dicts) are handled without using this +# mapping. JSON_TYPES: Final[Mapping[type, str]] = { bool: 'boolean', int: 'integer', From b6a8e5884d0c0dec0e7e5c4b656f22f1443ff07a Mon Sep 17 00:00:00 2001 From: Tony Meyer Date: Fri, 5 Sep 2025 11:56:52 +1200 Subject: [PATCH 74/79] Minor readability improvement, per review. --- tools/src/ops_tools/_generate_yaml.py | 5 ++--- 1 file changed, 2 insertions(+), 3 deletions(-) diff --git a/tools/src/ops_tools/_generate_yaml.py b/tools/src/ops_tools/_generate_yaml.py index fbb5175fa..5ade935bf 100644 --- a/tools/src/ops_tools/_generate_yaml.py +++ b/tools/src/ops_tools/_generate_yaml.py @@ -85,9 +85,8 @@ def attr_to_default(cls: type[object], name: str) -> object: return getattr(cls, name, None) default = None for field in dataclasses.fields(cls): - if field.name != name: - continue - break + if field.name == name: + break else: return default From 0dfbfa2ae85b1ee6cad466404ac296cfdcb6a033 Mon Sep 17 00:00:00 2001 From: Tony Meyer Date: Fri, 5 Sep 2025 11:58:13 +1200 Subject: [PATCH 75/79] Minor readability improvement, per review. --- tools/src/ops_tools/_generate_yaml.py | 5 ++--- 1 file changed, 2 insertions(+), 3 deletions(-) diff --git a/tools/src/ops_tools/_generate_yaml.py b/tools/src/ops_tools/_generate_yaml.py index 5ade935bf..c7fa662b4 100644 --- a/tools/src/ops_tools/_generate_yaml.py +++ b/tools/src/ops_tools/_generate_yaml.py @@ -83,12 +83,11 @@ def attr_to_default(cls: type[object], name: str) -> object: """Get the default value for the attribute.""" if not dataclasses.is_dataclass(cls): return getattr(cls, name, None) - default = None for field in dataclasses.fields(cls): if field.name == name: break else: - return default + return None # This might be a Pydantic dataclass using a Pydantic.Field object. field_default = ( # type: ignore @@ -109,7 +108,7 @@ def attr_to_default(cls: type[object], name: str) -> object: return field_default # type: ignore if field_default_factory is not dataclasses.MISSING: return field_default_factory() # type: ignore - return default + return None def _attr_to_yaml_type(cls: type[object], name: str, yaml_types: dict[type, str]) -> str: From 10d06ef7a0128521aa31a918f34dd42142998bd3 Mon Sep 17 00:00:00 2001 From: Tony Meyer Date: Fri, 5 Sep 2025 12:02:09 +1200 Subject: [PATCH 76/79] Minor refactor, per review. --- tools/src/ops_tools/_generate_yaml.py | 49 ++++++++++++++------------- 1 file changed, 25 insertions(+), 24 deletions(-) diff --git a/tools/src/ops_tools/_generate_yaml.py b/tools/src/ops_tools/_generate_yaml.py index c7fa662b4..4c482bb86 100644 --- a/tools/src/ops_tools/_generate_yaml.py +++ b/tools/src/ops_tools/_generate_yaml.py @@ -112,34 +112,35 @@ def attr_to_default(cls: type[object], name: str) -> object: def _attr_to_yaml_type(cls: type[object], name: str, yaml_types: dict[type, str]) -> str: + # If we can't figure it out, then use "string", which should be the most + # compatible, and most likely to be used for arbitrary types. Charms can + # provide `to_juju_schema` to adjust this if required. + fallback: Final[str] = yaml_types[str] + try: raw_hint = get_type_hints(cls)[name] except KeyError: - pass + return fallback + # Collapse Optional[] and Union[] and so on to the simpler form. + origin = get_origin(raw_hint) + if origin in (list, tuple): + return yaml_types[origin] + elif origin: + hints = {arg for arg in get_args(raw_hint) if arg in yaml_types} else: - # Collapse Optional[] and Union[] and so on to the simpler form. - origin = get_origin(raw_hint) - if origin in (list, tuple): - return yaml_types[origin] - elif origin: - hints = {arg for arg in get_args(raw_hint) if arg in yaml_types} - else: - hints = {raw_hint} - # If there are multiple types -- for example, the type annotation is - # `int | str` -- then we can't determine the type, and we fall back to - # "string", even if `str` is not in the type hint, because our - # "we can't determine the type" choice is always "string". - if len(hints) > 1: - return 'string' - elif hints: - try: - return yaml_types[hints.pop()] - except KeyError: - pass - # If we can't figure it out, then use "string", which should be the most - # compatible, and most likely to be used for arbitrary types. Charms can - # override `to_juju_schema` to adjust this if required. - return 'string' + hints = {raw_hint} + # If there are multiple types -- for example, the type annotation is + # `int | str` -- then we can't determine the type, and we fall back to + # "string", even if `str` is not in the type hint, because our + # "we can't determine the type" choice is always "string". + if len(hints) > 1: + return 'string' + elif hints: + try: + return yaml_types[hints.pop()] + except KeyError: + pass + return fallback def attr_to_juju_type(cls: type[object], name: str) -> str: From f3ef1600a020d6e0ee9bc82bb866fc900f9b57bd Mon Sep 17 00:00:00 2001 From: Tony Meyer Date: Fri, 5 Sep 2025 12:05:53 +1200 Subject: [PATCH 77/79] Minor refactor, per review. --- tools/src/ops_tools/_generate_yaml.py | 21 ++++++--------------- 1 file changed, 6 insertions(+), 15 deletions(-) diff --git a/tools/src/ops_tools/_generate_yaml.py b/tools/src/ops_tools/_generate_yaml.py index 4c482bb86..dcf3a8ffa 100644 --- a/tools/src/ops_tools/_generate_yaml.py +++ b/tools/src/ops_tools/_generate_yaml.py @@ -121,26 +121,17 @@ def _attr_to_yaml_type(cls: type[object], name: str, yaml_types: dict[type, str] raw_hint = get_type_hints(cls)[name] except KeyError: return fallback + # Collapse Optional[] and Union[] and so on to the simpler form. origin = get_origin(raw_hint) if origin in (list, tuple): return yaml_types[origin] - elif origin: - hints = {arg for arg in get_args(raw_hint) if arg in yaml_types} - else: - hints = {raw_hint} + + hints = set(get_args(raw_hint)) if origin else {raw_hint} # If there are multiple types -- for example, the type annotation is - # `int | str` -- then we can't determine the type, and we fall back to - # "string", even if `str` is not in the type hint, because our - # "we can't determine the type" choice is always "string". - if len(hints) > 1: - return 'string' - elif hints: - try: - return yaml_types[hints.pop()] - except KeyError: - pass - return fallback + # `int | str` -- then we can't determine the type. + # Likewise if there are no hints somehow (generic used without args?). + return yaml_types.get(hints.pop(), fallback) if len(hints) == 1 else fallback def attr_to_juju_type(cls: type[object], name: str) -> str: From d462027c1016d9d5ff8734877ddf50dc4043d0e9 Mon Sep 17 00:00:00 2001 From: Tony Meyer Date: Fri, 5 Sep 2025 12:11:23 +1200 Subject: [PATCH 78/79] Handle lists and tuples in config. --- tools/src/ops_tools/_generate_yaml.py | 2 +- 1 file changed, 1 insertion(+), 1 deletion(-) diff --git a/tools/src/ops_tools/_generate_yaml.py b/tools/src/ops_tools/_generate_yaml.py index dcf3a8ffa..6a335df9b 100644 --- a/tools/src/ops_tools/_generate_yaml.py +++ b/tools/src/ops_tools/_generate_yaml.py @@ -125,7 +125,7 @@ def _attr_to_yaml_type(cls: type[object], name: str, yaml_types: dict[type, str] # Collapse Optional[] and Union[] and so on to the simpler form. origin = get_origin(raw_hint) if origin in (list, tuple): - return yaml_types[origin] + return fallback hints = set(get_args(raw_hint)) if origin else {raw_hint} # If there are multiple types -- for example, the type annotation is From b89c2b5ad6f0b1cdc37d20f556d8d91eec40950e Mon Sep 17 00:00:00 2001 From: Tony Meyer Date: Mon, 8 Sep 2025 11:39:15 +1200 Subject: [PATCH 79/79] Align the behaviour of juju_names exactly with Relation.save(). --- tools/src/ops_tools/_generate_yaml.py | 13 ++++++++----- 1 file changed, 8 insertions(+), 5 deletions(-) diff --git a/tools/src/ops_tools/_generate_yaml.py b/tools/src/ops_tools/_generate_yaml.py index 6a335df9b..19f09cdba 100644 --- a/tools/src/ops_tools/_generate_yaml.py +++ b/tools/src/ops_tools/_generate_yaml.py @@ -188,16 +188,19 @@ def juju_schema_from_model_fields(cls: type[object]) -> dict[str, OptionDict]: def juju_names(cls: type[object]) -> Generator[str]: """Iterates over all the names to include in the config or action YAML.""" + # Note that this should match the behaviour of ops.Relation.save(). if dataclasses.is_dataclass(cls): for field in dataclasses.fields(cls): - yield field.name + yield field.metadata.get('alias', field.name) return if hasattr(cls, 'model_fields'): - for field in cls.model_fields.values(): # type: ignore - yield field.name # type: ignore + # Pydantic models: + for name, field in cls.model_fields.items(): # type: ignore + yield field.alias or name # type: ignore return - # If this isn't a dataclass or a Pydantic model, then fall back to using - # any class attribute with a type annotation. + # If we could not otherwise determine the fields for the class, store all + # the fields that have type annotations. If a charm needs a more specific + # set of fields, then it should use a dataclass or Pydantic model instead. yield from get_type_hints(cls)